diff --git a/index.data b/index.data
new file mode 100644
index 0000000..c3edc28
Binary files /dev/null and b/index.data differ
diff --git a/index.html b/index.html
index d8728f0..9c9ba39 100644
--- a/index.html
+++ b/index.html
@@ -1,27 +1,225 @@
-
-
-
-
-
- 나의 첫 정적 웹사이트
+
+
+
+
+
+ Emscripten-Generated Code
-
-
- hello!
-
-
\ No newline at end of file
+
+
+
+
+ Resize canvas
+ Lock/hide mouse pointer
+
+
+ |
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/index.js b/index.js
new file mode 100644
index 0000000..dfc1524
--- /dev/null
+++ b/index.js
@@ -0,0 +1,14888 @@
+// Support for growable heap + pthreads, where the buffer may change, so JS views
+// must be updated.
+function GROWABLE_HEAP_I8() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAP8;
+}
+function GROWABLE_HEAP_U8() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPU8;
+}
+function GROWABLE_HEAP_I16() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAP16;
+}
+function GROWABLE_HEAP_U16() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPU16;
+}
+function GROWABLE_HEAP_I32() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAP32;
+}
+function GROWABLE_HEAP_U32() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPU32;
+}
+function GROWABLE_HEAP_F32() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPF32;
+}
+function GROWABLE_HEAP_F64() {
+ if (wasmMemory.buffer != HEAP8.buffer) {
+ updateMemoryViews();
+ }
+ return HEAPF64;
+}
+
+// include: shell.js
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(moduleArg) => Promise
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = typeof Module != "undefined" ? Module : {};
+
+// Determine the runtime environment we are in. You can customize this by
+// setting the ENVIRONMENT setting at compile time (see settings.js).
+// Attempt to auto-detect the environment
+var ENVIRONMENT_IS_WEB = typeof window == "object";
+
+var ENVIRONMENT_IS_WORKER = typeof WorkerGlobalScope != "undefined";
+
+// N.b. Electron.js environment is simultaneously a NODE-environment, but
+// also a web environment.
+var ENVIRONMENT_IS_NODE = typeof process == "object" && typeof process.versions == "object" && typeof process.versions.node == "string" && process.type != "renderer";
+
+var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+// Three configurations we can be running in:
+// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
+// 2) We could be the application main() thread proxied to worker. (with Emscripten -sPROXY_TO_WORKER) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
+// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
+// The way we signal to a worker that it is hosting a pthread is to construct
+// it with a specific name.
+var ENVIRONMENT_IS_PTHREAD = ENVIRONMENT_IS_WORKER && self.name?.startsWith("em-pthread");
+
+if (ENVIRONMENT_IS_NODE) {
+ // `require()` is no-op in an ESM module, use `createRequire()` to construct
+ // the require()` function. This is only necessary for multi-environment
+ // builds, `-sENVIRONMENT=node` emits a static import declaration instead.
+ // TODO: Swap all `require()`'s with `import()`'s?
+ var worker_threads = require("worker_threads");
+ global.Worker = worker_threads.Worker;
+ ENVIRONMENT_IS_WORKER = !worker_threads.isMainThread;
+ // Under node we set `workerData` to `em-pthread` to signal that the worker
+ // is hosting a pthread.
+ ENVIRONMENT_IS_PTHREAD = ENVIRONMENT_IS_WORKER && worker_threads["workerData"] == "em-pthread";
+}
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+// include: C:\Users\tymmkang\AppData\Local\Temp\tmpyjlnr784.js
+Module["expectedDataFileDownloads"] ??= 0;
+
+Module["expectedDataFileDownloads"]++;
+
+(() => {
+ // Do not attempt to redownload the virtual filesystem data when in a pthread or a Wasm Worker context.
+ var isPthread = typeof ENVIRONMENT_IS_PTHREAD != "undefined" && ENVIRONMENT_IS_PTHREAD;
+ var isWasmWorker = typeof ENVIRONMENT_IS_WASM_WORKER != "undefined" && ENVIRONMENT_IS_WASM_WORKER;
+ if (isPthread || isWasmWorker) return;
+ var isNode = typeof process === "object" && typeof process.versions === "object" && typeof process.versions.node === "string";
+ function loadPackage(metadata) {
+ var PACKAGE_PATH = "";
+ if (typeof window === "object") {
+ PACKAGE_PATH = window["encodeURIComponent"](window.location.pathname.substring(0, window.location.pathname.lastIndexOf("/")) + "/");
+ } else if (typeof process === "undefined" && typeof location !== "undefined") {
+ // web worker
+ PACKAGE_PATH = encodeURIComponent(location.pathname.substring(0, location.pathname.lastIndexOf("/")) + "/");
+ }
+ var PACKAGE_NAME = "bin/AxmolTestbed/index.data";
+ var REMOTE_PACKAGE_BASE = "index.data";
+ var REMOTE_PACKAGE_NAME = Module["locateFile"] ? Module["locateFile"](REMOTE_PACKAGE_BASE, "") : REMOTE_PACKAGE_BASE;
+ var REMOTE_PACKAGE_SIZE = metadata["remote_package_size"];
+ function fetchRemotePackage(packageName, packageSize, callback, errback) {
+ if (isNode) {
+ require("fs").readFile(packageName, (err, contents) => {
+ if (err) {
+ errback(err);
+ } else {
+ callback(contents.buffer);
+ }
+ });
+ return;
+ }
+ Module["dataFileDownloads"] ??= {};
+ fetch(packageName).catch(cause => Promise.reject(new Error(`Network Error: ${packageName}`, {
+ cause
+ }))).then(// If fetch fails, rewrite the error to include the failing URL & the cause.
+ response => {
+ if (!response.ok) {
+ return Promise.reject(new Error(`${response.status}: ${response.url}`));
+ }
+ if (!response.body && response.arrayBuffer) {
+ // If we're using the polyfill, readers won't be available...
+ return response.arrayBuffer().then(callback);
+ }
+ const reader = response.body.getReader();
+ const iterate = () => reader.read().then(handleChunk).catch(cause => Promise.reject(new Error(`Unexpected error while handling : ${response.url} ${cause}`, {
+ cause
+ })));
+ const chunks = [];
+ const headers = response.headers;
+ const total = Number(headers.get("Content-Length") ?? packageSize);
+ let loaded = 0;
+ const handleChunk = ({done, value}) => {
+ if (!done) {
+ chunks.push(value);
+ loaded += value.length;
+ Module["dataFileDownloads"][packageName] = {
+ loaded,
+ total
+ };
+ let totalLoaded = 0;
+ let totalSize = 0;
+ for (const download of Object.values(Module["dataFileDownloads"])) {
+ totalLoaded += download.loaded;
+ totalSize += download.total;
+ }
+ Module["setStatus"]?.(`Downloading data... (${totalLoaded}/${totalSize})`);
+ return iterate();
+ } else {
+ const packageData = new Uint8Array(chunks.map(c => c.length).reduce((a, b) => a + b, 0));
+ let offset = 0;
+ for (const chunk of chunks) {
+ packageData.set(chunk, offset);
+ offset += chunk.length;
+ }
+ callback(packageData.buffer);
+ }
+ };
+ Module["setStatus"]?.("Downloading data...");
+ return iterate();
+ });
+ }
+ function handleError(error) {
+ console.error("package error:", error);
+ }
+ function runWithFS(Module) {
+ function assert(check, msg) {
+ if (!check) throw msg + (new Error).stack;
+ }
+ Module["FS_createPath"]("/", "axslc", true, true);
+ Module["FS_createPath"]("/axslc", "custom", true, true);
+ Module["FS_createPath"]("/", "fonts", true, true);
+ Module["FS_createPath"]("/", "res", true, true);
+ /** @constructor */ function DataRequest(start, end, audio) {
+ this.start = start;
+ this.end = end;
+ this.audio = audio;
+ }
+ DataRequest.prototype = {
+ requests: {},
+ open: function(mode, name) {
+ this.name = name;
+ this.requests[name] = this;
+ Module["addRunDependency"](`fp ${this.name}`);
+ },
+ send: function() {},
+ onload: function() {
+ var byteArray = this.byteArray.subarray(this.start, this.end);
+ this.finish(byteArray);
+ },
+ finish: function(byteArray) {
+ var that = this;
+ // canOwn this data in the filesystem, it is a slide into the heap that will never change
+ Module["FS_createDataFile"](this.name, null, byteArray, true, true, true);
+ Module["removeRunDependency"](`fp ${that.name}`);
+ this.requests[this.name] = null;
+ }
+ };
+ var files = metadata["files"];
+ for (var i = 0; i < files.length; ++i) {
+ new DataRequest(files[i]["start"], files[i]["end"], files[i]["audio"] || 0).open("GET", files[i]["filename"]);
+ }
+ var PACKAGE_UUID = metadata["package_uuid"];
+ var IDB_RO = "readonly";
+ var IDB_RW = "readwrite";
+ var DB_NAME = "EM_PRELOAD_CACHE";
+ var DB_VERSION = 1;
+ var METADATA_STORE_NAME = "METADATA";
+ var PACKAGE_STORE_NAME = "PACKAGES";
+ function openDatabase(callback, errback) {
+ if (isNode) {
+ return errback();
+ }
+ var indexedDB;
+ if (typeof window === "object") {
+ indexedDB = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ } else if (typeof location !== "undefined") {
+ // worker
+ indexedDB = self.indexedDB;
+ } else {
+ throw "using IndexedDB to cache data can only be done on a web page or in a web worker";
+ }
+ try {
+ var openRequest = indexedDB.open(DB_NAME, DB_VERSION);
+ } catch (e) {
+ return errback(e);
+ }
+ openRequest.onupgradeneeded = event => {
+ var db = /** @type {IDBDatabase} */ (event.target.result);
+ if (db.objectStoreNames.contains(PACKAGE_STORE_NAME)) {
+ db.deleteObjectStore(PACKAGE_STORE_NAME);
+ }
+ var packages = db.createObjectStore(PACKAGE_STORE_NAME);
+ if (db.objectStoreNames.contains(METADATA_STORE_NAME)) {
+ db.deleteObjectStore(METADATA_STORE_NAME);
+ }
+ var metadata = db.createObjectStore(METADATA_STORE_NAME);
+ };
+ openRequest.onsuccess = event => {
+ var db = /** @type {IDBDatabase} */ (event.target.result);
+ callback(db);
+ };
+ openRequest.onerror = error => errback(error);
+ }
+ // This is needed as chromium has a limit on per-entry files in IndexedDB
+ // https://cs.chromium.org/chromium/src/content/renderer/indexed_db/webidbdatabase_impl.cc?type=cs&sq=package:chromium&g=0&l=177
+ // https://cs.chromium.org/chromium/src/out/Debug/gen/third_party/blink/public/mojom/indexeddb/indexeddb.mojom.h?type=cs&sq=package:chromium&g=0&l=60
+ // We set the chunk size to 64MB to stay well-below the limit
+ var CHUNK_SIZE = 64 * 1024 * 1024;
+ function cacheRemotePackage(db, packageName, packageData, packageMeta, callback, errback) {
+ var transactionPackages = db.transaction([ PACKAGE_STORE_NAME ], IDB_RW);
+ var packages = transactionPackages.objectStore(PACKAGE_STORE_NAME);
+ var chunkSliceStart = 0;
+ var nextChunkSliceStart = 0;
+ var chunkCount = Math.ceil(packageData.byteLength / CHUNK_SIZE);
+ var finishedChunks = 0;
+ for (var chunkId = 0; chunkId < chunkCount; chunkId++) {
+ nextChunkSliceStart += CHUNK_SIZE;
+ var putPackageRequest = packages.put(packageData.slice(chunkSliceStart, nextChunkSliceStart), `package/${packageName}/${chunkId}`);
+ chunkSliceStart = nextChunkSliceStart;
+ putPackageRequest.onsuccess = event => {
+ finishedChunks++;
+ if (finishedChunks == chunkCount) {
+ var transaction_metadata = db.transaction([ METADATA_STORE_NAME ], IDB_RW);
+ var metadata = transaction_metadata.objectStore(METADATA_STORE_NAME);
+ var putMetadataRequest = metadata.put({
+ "uuid": packageMeta.uuid,
+ "chunkCount": chunkCount
+ }, `metadata/${packageName}`);
+ putMetadataRequest.onsuccess = event => callback(packageData);
+ putMetadataRequest.onerror = error => errback(error);
+ }
+ };
+ putPackageRequest.onerror = error => errback(error);
+ }
+ }
+ /* Check if there's a cached package, and if so whether it's the latest available */ function checkCachedPackage(db, packageName, callback, errback) {
+ var transaction = db.transaction([ METADATA_STORE_NAME ], IDB_RO);
+ var metadata = transaction.objectStore(METADATA_STORE_NAME);
+ var getRequest = metadata.get(`metadata/${packageName}`);
+ getRequest.onsuccess = event => {
+ var result = event.target.result;
+ if (!result) {
+ return callback(false, null);
+ } else {
+ return callback(PACKAGE_UUID === result["uuid"], result);
+ }
+ };
+ getRequest.onerror = error => errback(error);
+ }
+ function fetchCachedPackage(db, packageName, metadata, callback, errback) {
+ var transaction = db.transaction([ PACKAGE_STORE_NAME ], IDB_RO);
+ var packages = transaction.objectStore(PACKAGE_STORE_NAME);
+ var chunksDone = 0;
+ var totalSize = 0;
+ var chunkCount = metadata["chunkCount"];
+ var chunks = new Array(chunkCount);
+ for (var chunkId = 0; chunkId < chunkCount; chunkId++) {
+ var getRequest = packages.get(`package/${packageName}/${chunkId}`);
+ getRequest.onsuccess = event => {
+ if (!event.target.result) {
+ errback(new Error(`CachedPackageNotFound for: ${packageName}`));
+ return;
+ }
+ // If there's only 1 chunk, there's nothing to concatenate it with so we can just return it now
+ if (chunkCount == 1) {
+ callback(event.target.result);
+ } else {
+ chunksDone++;
+ totalSize += event.target.result.byteLength;
+ chunks.push(event.target.result);
+ if (chunksDone == chunkCount) {
+ if (chunksDone == 1) {
+ callback(event.target.result);
+ } else {
+ var tempTyped = new Uint8Array(totalSize);
+ var byteOffset = 0;
+ for (var chunkId in chunks) {
+ var buffer = chunks[chunkId];
+ tempTyped.set(new Uint8Array(buffer), byteOffset);
+ byteOffset += buffer.byteLength;
+ buffer = undefined;
+ }
+ chunks = undefined;
+ callback(tempTyped.buffer);
+ tempTyped = undefined;
+ }
+ }
+ }
+ };
+ getRequest.onerror = error => errback(error);
+ }
+ }
+ function processPackageData(arrayBuffer) {
+ assert(arrayBuffer, "Loading data file failed.");
+ assert(arrayBuffer.constructor.name === ArrayBuffer.name, "bad input to processPackageData");
+ var byteArray = new Uint8Array(arrayBuffer);
+ var curr;
+ // Reuse the bytearray from the XHR as the source for file reads.
+ DataRequest.prototype.byteArray = byteArray;
+ var files = metadata["files"];
+ for (var i = 0; i < files.length; ++i) {
+ DataRequest.prototype.requests[files[i].filename].onload();
+ }
+ Module["removeRunDependency"]("datafile_bin/AxmolTestbed/index.data");
+ }
+ Module["addRunDependency"]("datafile_bin/AxmolTestbed/index.data");
+ Module["preloadResults"] ??= {};
+ function preloadFallback(error) {
+ console.error(error);
+ console.error("falling back to default preload behavior");
+ fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, processPackageData, handleError);
+ }
+ openDatabase(db => checkCachedPackage(db, PACKAGE_PATH + PACKAGE_NAME, (useCached, metadata) => {
+ Module["preloadResults"][PACKAGE_NAME] = {
+ fromCache: useCached
+ };
+ if (useCached) {
+ fetchCachedPackage(db, PACKAGE_PATH + PACKAGE_NAME, metadata, processPackageData, preloadFallback);
+ } else {
+ fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, packageData => {
+ cacheRemotePackage(db, PACKAGE_PATH + PACKAGE_NAME, packageData, {
+ uuid: PACKAGE_UUID
+ }, processPackageData, error => {
+ console.error(error);
+ processPackageData(packageData);
+ });
+ }, preloadFallback);
+ }
+ }, preloadFallback), preloadFallback);
+ Module["setStatus"]?.("Downloading...");
+ }
+ if (Module["calledRun"]) {
+ runWithFS(Module);
+ } else {
+ (Module["preRun"] ??= []).push(runWithFS);
+ }
+ }
+ // FS is not initialized yet, wait for it
+ loadPackage({
+ "files": [ {
+ "filename": "/CloseNormal.png",
+ "start": 0,
+ "end": 3596
+ }, {
+ "filename": "/CloseSelected.png",
+ "start": 3596,
+ "end": 6406
+ }, {
+ "filename": "/HelloWorld.png",
+ "start": 6406,
+ "end": 17832
+ }, {
+ "filename": "/axslc/cameraClear_fs",
+ "start": 17832,
+ "end": 18034
+ }, {
+ "filename": "/axslc/cameraClear_vs",
+ "start": 18034,
+ "end": 18423
+ }, {
+ "filename": "/axslc/colorNormalTexture_fs",
+ "start": 18423,
+ "end": 23073
+ }, {
+ "filename": "/axslc/colorNormalTexture_fs_1",
+ "start": 23073,
+ "end": 27473
+ }, {
+ "filename": "/axslc/colorNormal_fs",
+ "start": 27473,
+ "end": 32056
+ }, {
+ "filename": "/axslc/colorTexture_fs",
+ "start": 32056,
+ "end": 32367
+ }, {
+ "filename": "/axslc/color_fs",
+ "start": 32367,
+ "end": 32587
+ }, {
+ "filename": "/axslc/custom/imgui_sprite_vs",
+ "start": 32587,
+ "end": 32959
+ }, {
+ "filename": "/axslc/dualSampler_fs",
+ "start": 32959,
+ "end": 33510
+ }, {
+ "filename": "/axslc/dualSampler_gray_fs",
+ "start": 33510,
+ "end": 34330
+ }, {
+ "filename": "/axslc/dualSampler_hsv_fs",
+ "start": 34330,
+ "end": 36649
+ }, {
+ "filename": "/axslc/grayScale_fs",
+ "start": 36649,
+ "end": 37165
+ }, {
+ "filename": "/axslc/hsv_fs",
+ "start": 37165,
+ "end": 39230
+ }, {
+ "filename": "/axslc/label_distanceGlow_fs",
+ "start": 39230,
+ "end": 40411
+ }, {
+ "filename": "/axslc/label_distanceNormal_fs",
+ "start": 40411,
+ "end": 40942
+ }, {
+ "filename": "/axslc/label_distanceOutline_fs",
+ "start": 40942,
+ "end": 42179
+ }, {
+ "filename": "/axslc/label_normal_fs",
+ "start": 42179,
+ "end": 42562
+ }, {
+ "filename": "/axslc/label_outline_fs",
+ "start": 42562,
+ "end": 43488
+ }, {
+ "filename": "/axslc/layer_radialGradient_fs",
+ "start": 43488,
+ "end": 44208
+ }, {
+ "filename": "/axslc/lineColor_fs",
+ "start": 44208,
+ "end": 44384
+ }, {
+ "filename": "/axslc/lineColor_vs",
+ "start": 44384,
+ "end": 44660
+ }, {
+ "filename": "/axslc/particleColor_fs",
+ "start": 44660,
+ "end": 44913
+ }, {
+ "filename": "/axslc/particleTexture_fs",
+ "start": 44913,
+ "end": 45259
+ }, {
+ "filename": "/axslc/particle_vs",
+ "start": 45259,
+ "end": 45650
+ }, {
+ "filename": "/axslc/positionColorLengthTexture_fs",
+ "start": 45650,
+ "end": 45890
+ }, {
+ "filename": "/axslc/positionColorLengthTexture_vs",
+ "start": 45890,
+ "end": 46328
+ }, {
+ "filename": "/axslc/positionColorTextureAsPointsize_vs",
+ "start": 46328,
+ "end": 46749
+ }, {
+ "filename": "/axslc/positionColor_fs",
+ "start": 46749,
+ "end": 46925
+ }, {
+ "filename": "/axslc/positionColor_vs",
+ "start": 46925,
+ "end": 47190
+ }, {
+ "filename": "/axslc/positionNormalTexture_vs",
+ "start": 47190,
+ "end": 48540
+ }, {
+ "filename": "/axslc/positionNormalTexture_vs_1",
+ "start": 48540,
+ "end": 52361
+ }, {
+ "filename": "/axslc/positionTexture3D_vs",
+ "start": 52361,
+ "end": 52676
+ }, {
+ "filename": "/axslc/positionTextureColorAlphaTest_fs",
+ "start": 52676,
+ "end": 53119
+ }, {
+ "filename": "/axslc/positionTextureColor_fs",
+ "start": 53119,
+ "end": 53386
+ }, {
+ "filename": "/axslc/positionTextureColor_vs",
+ "start": 53386,
+ "end": 53742
+ }, {
+ "filename": "/axslc/positionTextureInstance_vs",
+ "start": 53742,
+ "end": 54113
+ }, {
+ "filename": "/axslc/positionTexture_fs",
+ "start": 54113,
+ "end": 54347
+ }, {
+ "filename": "/axslc/positionTexture_vs",
+ "start": 54347,
+ "end": 54623
+ }, {
+ "filename": "/axslc/positionUColor_vs",
+ "start": 54623,
+ "end": 54871
+ }, {
+ "filename": "/axslc/position_vs",
+ "start": 54871,
+ "end": 55106
+ }, {
+ "filename": "/axslc/quadColor_fs",
+ "start": 55106,
+ "end": 55359
+ }, {
+ "filename": "/axslc/quadColor_vs",
+ "start": 55359,
+ "end": 55624
+ }, {
+ "filename": "/axslc/quadTexture_fs",
+ "start": 55624,
+ "end": 55970
+ }, {
+ "filename": "/axslc/quadTexture_vs",
+ "start": 55970,
+ "end": 56365
+ }, {
+ "filename": "/axslc/skinPositionNormalTexture_vs",
+ "start": 56365,
+ "end": 59967
+ }, {
+ "filename": "/axslc/skinPositionNormalTexture_vs_1",
+ "start": 59967,
+ "end": 65572
+ }, {
+ "filename": "/axslc/skinPositionTexture_vs",
+ "start": 65572,
+ "end": 67853
+ }, {
+ "filename": "/axslc/skybox_fs",
+ "start": 67853,
+ "end": 68162
+ }, {
+ "filename": "/axslc/skybox_vs",
+ "start": 68162,
+ "end": 68459
+ }, {
+ "filename": "/axslc/terrain_fs",
+ "start": 68459,
+ "end": 69871
+ }, {
+ "filename": "/axslc/terrain_vs",
+ "start": 69871,
+ "end": 70230
+ }, {
+ "filename": "/axslc/videoTextureBGRA_fs",
+ "start": 70230,
+ "end": 70502
+ }, {
+ "filename": "/axslc/videoTextureI420_fs",
+ "start": 70502,
+ "end": 71552
+ }, {
+ "filename": "/axslc/videoTextureNV12_fs",
+ "start": 71552,
+ "end": 72563
+ }, {
+ "filename": "/axslc/videoTextureYUY2_fs",
+ "start": 72563,
+ "end": 73574
+ }, {
+ "filename": "/fonts/Marker Felt.ttf",
+ "start": 73574,
+ "end": 99350
+ }, {
+ "filename": "/fonts/arial.ttf",
+ "start": 99350,
+ "end": 877902
+ }, {
+ "filename": "/res/.gitkeep",
+ "start": 877902,
+ "end": 877902
+ } ],
+ "remote_package_size": 877902,
+ "package_uuid": "sha256-ee183916b333fcf7d371811b747a8b2cf3bcb1cea09ef4001d4c23413ccaeb20"
+ });
+})();
+
+// end include: C:\Users\tymmkang\AppData\Local\Temp\tmpyjlnr784.js
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = Object.assign({}, Module);
+
+var arguments_ = [];
+
+var thisProgram = "./this.program";
+
+var quit_ = (status, toThrow) => {
+ throw toThrow;
+};
+
+// In MODULARIZE mode _scriptName needs to be captured already at the very top of the page immediately when the page is parsed, so it is generated there
+// before the page load. In non-MODULARIZE modes generate it here.
+var _scriptName = (typeof document != "undefined") ? document.currentScript?.src : undefined;
+
+if (ENVIRONMENT_IS_NODE) {
+ _scriptName = __filename;
+} else if (ENVIRONMENT_IS_WORKER) {
+ _scriptName = self.location.href;
+}
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = "";
+
+function locateFile(path) {
+ if (Module["locateFile"]) {
+ return Module["locateFile"](path, scriptDirectory);
+ }
+ return scriptDirectory + path;
+}
+
+// Hooks that are implemented differently in different runtime environments.
+var readAsync, readBinary;
+
+if (ENVIRONMENT_IS_NODE) {
+ // These modules will usually be used on Node.js. Load them eagerly to avoid
+ // the complexity of lazy-loading.
+ var fs = require("fs");
+ var nodePath = require("path");
+ scriptDirectory = __dirname + "/";
+ // include: node_shell_read.js
+ readBinary = filename => {
+ // We need to re-wrap `file://` strings to URLs. Normalizing isn't
+ // necessary in that case, the path should already be absolute.
+ filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
+ var ret = fs.readFileSync(filename);
+ return ret;
+ };
+ readAsync = (filename, binary = true) => {
+ // See the comment in the `readBinary` function.
+ filename = isFileURI(filename) ? new URL(filename) : nodePath.normalize(filename);
+ return new Promise((resolve, reject) => {
+ fs.readFile(filename, binary ? undefined : "utf8", (err, data) => {
+ if (err) reject(err); else resolve(binary ? data.buffer : data);
+ });
+ });
+ };
+ // end include: node_shell_read.js
+ if (!Module["thisProgram"] && process.argv.length > 1) {
+ thisProgram = process.argv[1].replace(/\\/g, "/");
+ }
+ arguments_ = process.argv.slice(2);
+ if (typeof module != "undefined") {
+ module["exports"] = Module;
+ }
+ quit_ = (status, toThrow) => {
+ process.exitCode = status;
+ throw toThrow;
+ };
+} else // Note that this includes Node.js workers when relevant (pthreads is enabled).
+// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and
+// ENVIRONMENT_IS_NODE.
+if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ if (ENVIRONMENT_IS_WORKER) {
+ // Check worker, not web, since window could be polyfilled
+ scriptDirectory = self.location.href;
+ } else if (typeof document != "undefined" && document.currentScript) {
+ // web
+ scriptDirectory = document.currentScript.src;
+ }
+ // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
+ // otherwise, slice off the final part of the url to find the script directory.
+ // if scriptDirectory does not contain a slash, lastIndexOf will return -1,
+ // and scriptDirectory will correctly be replaced with an empty string.
+ // If scriptDirectory contains a query (starting with ?) or a fragment (starting with #),
+ // they are removed because they could contain a slash.
+ if (scriptDirectory.startsWith("blob:")) {
+ scriptDirectory = "";
+ } else {
+ scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf("/") + 1);
+ }
+ // Differentiate the Web Worker from the Node Worker case, as reading must
+ // be done differently.
+ if (!ENVIRONMENT_IS_NODE) {
+ // include: web_or_worker_shell_read.js
+ if (ENVIRONMENT_IS_WORKER) {
+ readBinary = url => {
+ var xhr = new XMLHttpRequest;
+ xhr.open("GET", url, false);
+ xhr.responseType = "arraybuffer";
+ xhr.send(null);
+ return new Uint8Array(/** @type{!ArrayBuffer} */ (xhr.response));
+ };
+ }
+ readAsync = url => {
+ // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url.
+ // See https://github.com/github/fetch/pull/92#issuecomment-140665932
+ // Cordova or Electron apps are typically loaded from a file:// url.
+ // So use XHR on webview if URL is a file URL.
+ if (isFileURI(url)) {
+ return new Promise((resolve, reject) => {
+ var xhr = new XMLHttpRequest;
+ xhr.open("GET", url, true);
+ xhr.responseType = "arraybuffer";
+ xhr.onload = () => {
+ if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) {
+ // file URLs can return 0
+ resolve(xhr.response);
+ return;
+ }
+ reject(xhr.status);
+ };
+ xhr.onerror = reject;
+ xhr.send(null);
+ });
+ }
+ return fetch(url, {
+ credentials: "same-origin"
+ }).then(response => {
+ if (response.ok) {
+ return response.arrayBuffer();
+ }
+ return Promise.reject(new Error(response.status + " : " + response.url));
+ });
+ };
+ }
+} else // end include: web_or_worker_shell_read.js
+{}
+
+// Set up the out() and err() hooks, which are how we can print to stdout or
+// stderr, respectively.
+// Normally just binding console.log/console.error here works fine, but
+// under node (with workers) we see missing/out-of-order messages so route
+// directly to stdout and stderr.
+// See https://github.com/emscripten-core/emscripten/issues/14804
+var defaultPrint = console.log.bind(console);
+
+var defaultPrintErr = console.error.bind(console);
+
+if (ENVIRONMENT_IS_NODE) {
+ defaultPrint = (...args) => fs.writeSync(1, args.join(" ") + "\n");
+ defaultPrintErr = (...args) => fs.writeSync(2, args.join(" ") + "\n");
+}
+
+var out = Module["print"] || defaultPrint;
+
+var err = Module["printErr"] || defaultPrintErr;
+
+// Merge back in the overrides
+Object.assign(Module, moduleOverrides);
+
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used.
+moduleOverrides = null;
+
+// Emit code to handle expected values on the Module object. This applies Module.x
+// to the proper local x. This has two benefits: first, we only emit it if it is
+// expected to arrive, and second, by using a local everywhere else that can be
+// minified.
+if (Module["arguments"]) arguments_ = Module["arguments"];
+
+if (Module["thisProgram"]) thisProgram = Module["thisProgram"];
+
+// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+// end include: shell.js
+// include: preamble.js
+// === Preamble library stuff ===
+// Documentation for the public APIs defined in this file must be updated in:
+// site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+// site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+var wasmBinary = Module["wasmBinary"];
+
+// include: base64Utils.js
+// Converts a string of base64 into a byte array (Uint8Array).
+function intArrayFromBase64(s) {
+ if (typeof ENVIRONMENT_IS_NODE != "undefined" && ENVIRONMENT_IS_NODE) {
+ var buf = Buffer.from(s, "base64");
+ return new Uint8Array(buf.buffer, buf.byteOffset, buf.length);
+ }
+ var decoded = atob(s);
+ var bytes = new Uint8Array(decoded.length);
+ for (var i = 0; i < decoded.length; ++i) {
+ bytes[i] = decoded.charCodeAt(i);
+ }
+ return bytes;
+}
+
+// If filename is a base64 data URI, parses and returns data (Buffer on node,
+// Uint8Array otherwise). If filename is not a base64 data URI, returns undefined.
+function tryParseAsDataURI(filename) {
+ if (!isDataURI(filename)) {
+ return;
+ }
+ return intArrayFromBase64(filename.slice(dataURIPrefix.length));
+}
+
+// end include: base64Utils.js
+// Wasm globals
+var wasmMemory;
+
+// For sending to workers.
+var wasmModule;
+
+//========================================
+// Runtime essentials
+//========================================
+// whether we are quitting the application. no code should run after this.
+// set in exit() and abort()
+var ABORT = false;
+
+// set by exit() and abort(). Passed to 'onExit' handler.
+// NOTE: This is also used as the process return code code in shell environments
+// but only when noExitRuntime is false.
+var EXITSTATUS;
+
+// In STRICT mode, we only define assert() when ASSERTIONS is set. i.e. we
+// don't define it at all in release modes. This matches the behaviour of
+// MINIMAL_RUNTIME.
+// TODO(sbc): Make this the default even without STRICT enabled.
+/** @type {function(*, string=)} */ function assert(condition, text) {
+ if (!condition) {
+ // This build was created without ASSERTIONS defined. `assert()` should not
+ // ever be called in this configuration but in case there are callers in
+ // the wild leave this simple abort() implementation here for now.
+ abort(text);
+ }
+}
+
+// Memory management
+var HEAP, /** @type {!Int8Array} */ HEAP8, /** @type {!Uint8Array} */ HEAPU8, /** @type {!Int16Array} */ HEAP16, /** @type {!Uint16Array} */ HEAPU16, /** @type {!Int32Array} */ HEAP32, /** @type {!Uint32Array} */ HEAPU32, /** @type {!Float32Array} */ HEAPF32, /** @type {!Float64Array} */ HEAPF64;
+
+// include: runtime_shared.js
+function updateMemoryViews() {
+ var b = wasmMemory.buffer;
+ Module["HEAP8"] = HEAP8 = new Int8Array(b);
+ Module["HEAP16"] = HEAP16 = new Int16Array(b);
+ Module["HEAPU8"] = HEAPU8 = new Uint8Array(b);
+ Module["HEAPU16"] = HEAPU16 = new Uint16Array(b);
+ Module["HEAP32"] = HEAP32 = new Int32Array(b);
+ Module["HEAPU32"] = HEAPU32 = new Uint32Array(b);
+ Module["HEAPF32"] = HEAPF32 = new Float32Array(b);
+ Module["HEAPF64"] = HEAPF64 = new Float64Array(b);
+}
+
+// end include: runtime_shared.js
+// include: runtime_pthread.js
+// Pthread Web Worker handling code.
+// This code runs only on pthread web workers and handles pthread setup
+// and communication with the main thread via postMessage.
+if (ENVIRONMENT_IS_PTHREAD) {
+ var wasmModuleReceived;
+ // Node.js support
+ if (ENVIRONMENT_IS_NODE) {
+ // Create as web-worker-like an environment as we can.
+ var parentPort = worker_threads["parentPort"];
+ parentPort.on("message", msg => onmessage({
+ data: msg
+ }));
+ Object.assign(globalThis, {
+ self: global,
+ postMessage: msg => parentPort.postMessage(msg)
+ });
+ }
+ // Thread-local guard variable for one-time init of the JS state
+ var initializedJS = false;
+ function threadPrintErr(...args) {
+ var text = args.join(" ");
+ // See https://github.com/emscripten-core/emscripten/issues/14804
+ if (ENVIRONMENT_IS_NODE) {
+ fs.writeSync(2, text + "\n");
+ return;
+ }
+ console.error(text);
+ }
+ if (!Module["printErr"]) err = threadPrintErr;
+ function threadAlert(...args) {
+ var text = args.join(" ");
+ postMessage({
+ cmd: "alert",
+ text,
+ threadId: _pthread_self()
+ });
+ }
+ self.alert = threadAlert;
+ // Turn unhandled rejected promises into errors so that the main thread will be
+ // notified about them.
+ self.onunhandledrejection = e => {
+ throw e.reason || e;
+ };
+ function handleMessage(e) {
+ try {
+ var msgData = e["data"];
+ //dbg('msgData: ' + Object.keys(msgData));
+ var cmd = msgData.cmd;
+ if (cmd === "load") {
+ // Preload command that is called once per worker to parse and load the Emscripten code.
+ // Until we initialize the runtime, queue up any further incoming messages.
+ let messageQueue = [];
+ self.onmessage = e => messageQueue.push(e);
+ // And add a callback for when the runtime is initialized.
+ self.startWorker = instance => {
+ // Notify the main thread that this thread has loaded.
+ postMessage({
+ cmd: "loaded"
+ });
+ // Process any messages that were queued before the thread was ready.
+ for (let msg of messageQueue) {
+ handleMessage(msg);
+ }
+ // Restore the real message handler.
+ self.onmessage = handleMessage;
+ };
+ // Use `const` here to ensure that the variable is scoped only to
+ // that iteration, allowing safe reference from a closure.
+ for (const handler of msgData.handlers) {
+ // The the main module has a handler for a certain even, but no
+ // handler exists on the pthread worker, then proxy that handler
+ // back to the main thread.
+ if (!Module[handler] || Module[handler].proxy) {
+ Module[handler] = (...args) => {
+ postMessage({
+ cmd: "callHandler",
+ handler,
+ args
+ });
+ };
+ // Rebind the out / err handlers if needed
+ if (handler == "print") out = Module[handler];
+ if (handler == "printErr") err = Module[handler];
+ }
+ }
+ wasmMemory = msgData.wasmMemory;
+ updateMemoryViews();
+ wasmModuleReceived(msgData.wasmModule);
+ } else if (cmd === "run") {
+ // Call inside JS module to set up the stack frame for this pthread in JS module scope.
+ // This needs to be the first thing that we do, as we cannot call to any C/C++ functions
+ // until the thread stack is initialized.
+ establishStackSpace(msgData.pthread_ptr);
+ // Pass the thread address to wasm to store it for fast access.
+ __emscripten_thread_init(msgData.pthread_ptr, /*is_main=*/ 0, /*is_runtime=*/ 0, /*can_block=*/ 1, 0, 0);
+ PThread.receiveObjectTransfer(msgData);
+ PThread.threadInitTLS();
+ // Await mailbox notifications with `Atomics.waitAsync` so we can start
+ // using the fast `Atomics.notify` notification path.
+ __emscripten_thread_mailbox_await(msgData.pthread_ptr);
+ if (!initializedJS) {
+ initializedJS = true;
+ }
+ try {
+ invokeEntryPoint(msgData.start_routine, msgData.arg);
+ } catch (ex) {
+ if (ex != "unwind") {
+ // The pthread "crashed". Do not call `_emscripten_thread_exit` (which
+ // would make this thread joinable). Instead, re-throw the exception
+ // and let the top level handler propagate it back to the main thread.
+ throw ex;
+ }
+ }
+ } else if (msgData.target === "setimmediate") {} else // no-op
+ if (cmd === "checkMailbox") {
+ if (initializedJS) {
+ checkMailbox();
+ }
+ } else if (cmd) {
+ // The received message looks like something that should be handled by this message
+ // handler, (since there is a cmd field present), but is not one of the
+ // recognized commands:
+ err(`worker: received unknown command ${cmd}`);
+ err(msgData);
+ }
+ } catch (ex) {
+ __emscripten_thread_crashed();
+ throw ex;
+ }
+ }
+ self.onmessage = handleMessage;
+}
+
+// ENVIRONMENT_IS_PTHREAD
+// end include: runtime_pthread.js
+// In non-standalone/normal mode, we create the memory here.
+// include: runtime_init_memory.js
+// Create the wasm memory. (Note: this only applies if IMPORTED_MEMORY is defined)
+// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
+if (!ENVIRONMENT_IS_PTHREAD) {
+ if (Module["wasmMemory"]) {
+ wasmMemory = Module["wasmMemory"];
+ } else {
+ var INITIAL_MEMORY = Module["INITIAL_MEMORY"] || 134217728;
+ /** @suppress {checkTypes} */ wasmMemory = new WebAssembly.Memory({
+ "initial": INITIAL_MEMORY / 65536,
+ // In theory we should not need to emit the maximum if we want "unlimited"
+ // or 4GB of memory, but VMs error on that atm, see
+ // https://github.com/emscripten-core/emscripten/issues/14130
+ // And in the pthreads case we definitely need to emit a maximum. So
+ // always emit one.
+ "maximum": 32768,
+ "shared": true
+ });
+ }
+ updateMemoryViews();
+}
+
+// end include: runtime_init_memory.js
+// include: runtime_stack_check.js
+// end include: runtime_stack_check.js
+var __ATPRERUN__ = [];
+
+// functions called before the runtime is initialized
+var __ATINIT__ = [];
+
+// functions called during startup
+var __ATMAIN__ = [];
+
+// functions called when main() is to be run
+var __ATEXIT__ = [];
+
+// functions called during shutdown
+var __ATPOSTRUN__ = [];
+
+// functions called after the main() is called
+var runtimeInitialized = false;
+
+function preRun() {
+ if (Module["preRun"]) {
+ if (typeof Module["preRun"] == "function") Module["preRun"] = [ Module["preRun"] ];
+ while (Module["preRun"].length) {
+ addOnPreRun(Module["preRun"].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function initRuntime() {
+ runtimeInitialized = true;
+ if (ENVIRONMENT_IS_PTHREAD) return;
+ if (!Module["noFSInit"] && !FS.initialized) FS.init();
+ FS.ignorePermissions = false;
+ TTY.init();
+ PIPEFS.root = FS.mount(PIPEFS, {}, null);
+ SOCKFS.root = FS.mount(SOCKFS, {}, null);
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+ if (ENVIRONMENT_IS_PTHREAD) return;
+ // PThreads reuse the runtime from the main thread.
+ callRuntimeCallbacks(__ATMAIN__);
+}
+
+function postRun() {
+ if (ENVIRONMENT_IS_PTHREAD) return;
+ // PThreads reuse the runtime from the main thread.
+ if (Module["postRun"]) {
+ if (typeof Module["postRun"] == "function") Module["postRun"] = [ Module["postRun"] ];
+ while (Module["postRun"].length) {
+ addOnPostRun(Module["postRun"].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+
+function addOnPreMain(cb) {
+ __ATMAIN__.unshift(cb);
+}
+
+function addOnExit(cb) {}
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+
+// include: runtime_math.js
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc
+// end include: runtime_math.js
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// Module.preRun (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+
+var runDependencyWatcher = null;
+
+var dependenciesFulfilled = null;
+
+// overridden to take different actions when all run dependencies are fulfilled
+function getUniqueRunDependency(id) {
+ return id;
+}
+
+function addRunDependency(id) {
+ runDependencies++;
+ Module["monitorRunDependencies"]?.(runDependencies);
+}
+
+function removeRunDependency(id) {
+ runDependencies--;
+ Module["monitorRunDependencies"]?.(runDependencies);
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback();
+ }
+ }
+}
+
+/** @param {string|number=} what */ function abort(what) {
+ Module["onAbort"]?.(what);
+ what = "Aborted(" + what + ")";
+ // TODO(sbc): Should we remove printing and leave it up to whoever
+ // catches the exception?
+ err(what);
+ ABORT = true;
+ what += ". Build with -sASSERTIONS for more info.";
+ // Use a wasm runtime error, because a JS error might be seen as a foreign
+ // exception, which means we'd run destructors on it. We need the error to
+ // simply make the program stop.
+ // FIXME This approach does not work in Wasm EH because it currently does not assume
+ // all RuntimeErrors are from traps; it decides whether a RuntimeError is from
+ // a trap or not based on a hidden field within the object. So at the moment
+ // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that
+ // allows this in the wasm spec.
+ // Suppress closure compiler warning here. Closure compiler's builtin extern
+ // definition for WebAssembly.RuntimeError claims it takes no arguments even
+ // though it can.
+ // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed.
+ /** @suppress {checkTypes} */ var e = new WebAssembly.RuntimeError(what);
+ // Throw the error whether or not MODULARIZE is set because abort is used
+ // in code paths apart from instantiation where an exception is expected
+ // to be thrown when abort is called.
+ throw e;
+}
+
+// include: memoryprofiler.js
+// end include: memoryprofiler.js
+// include: URIUtils.js
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = "data:application/octet-stream;base64,";
+
+/**
+ * Indicates whether filename is a base64 data URI.
+ * @noinline
+ */ var isDataURI = filename => filename.startsWith(dataURIPrefix);
+
+/**
+ * Indicates whether filename is delivered via file protocol (as opposed to http/https)
+ * @noinline
+ */ var isFileURI = filename => filename.startsWith("file://");
+
+// end include: URIUtils.js
+// include: runtime_exceptions.js
+// end include: runtime_exceptions.js
+function findWasmBinary() {
+ var f = "index.wasm";
+ if (!isDataURI(f)) {
+ return locateFile(f);
+ }
+ return f;
+}
+
+var wasmBinaryFile;
+
+function getBinarySync(file) {
+ if (file == wasmBinaryFile && wasmBinary) {
+ return new Uint8Array(wasmBinary);
+ }
+ if (readBinary) {
+ return readBinary(file);
+ }
+ throw "both async and sync fetching of the wasm failed";
+}
+
+function getBinaryPromise(binaryFile) {
+ // If we don't have the binary yet, load it asynchronously using readAsync.
+ if (!wasmBinary) {
+ // Fetch the binary using readAsync
+ return readAsync(binaryFile).then(response => new Uint8Array(/** @type{!ArrayBuffer} */ (response)), // Fall back to getBinarySync if readAsync fails
+ () => getBinarySync(binaryFile));
+ }
+ // Otherwise, getBinarySync should be able to get it synchronously
+ return Promise.resolve().then(() => getBinarySync(binaryFile));
+}
+
+function instantiateArrayBuffer(binaryFile, imports, receiver) {
+ return getBinaryPromise(binaryFile).then(binary => WebAssembly.instantiate(binary, imports)).then(receiver, reason => {
+ err(`failed to asynchronously prepare wasm: ${reason}`);
+ abort(reason);
+ });
+}
+
+function instantiateAsync(binary, binaryFile, imports, callback) {
+ if (!binary && typeof WebAssembly.instantiateStreaming == "function" && !isDataURI(binaryFile) && // Don't use streaming for file:// delivered objects in a webview, fetch them synchronously.
+ !isFileURI(binaryFile) && // Avoid instantiateStreaming() on Node.js environment for now, as while
+ // Node.js v18.1.0 implements it, it does not have a full fetch()
+ // implementation yet.
+ // Reference:
+ // https://github.com/emscripten-core/emscripten/pull/16917
+ !ENVIRONMENT_IS_NODE && typeof fetch == "function") {
+ return fetch(binaryFile, {
+ credentials: "same-origin"
+ }).then(response => {
+ // Suppress closure warning here since the upstream definition for
+ // instantiateStreaming only allows Promise rather than
+ // an actual Response.
+ // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed.
+ /** @suppress {checkTypes} */ var result = WebAssembly.instantiateStreaming(response, imports);
+ return result.then(callback, function(reason) {
+ // We expect the most common failure cause to be a bad MIME type for the binary,
+ // in which case falling back to ArrayBuffer instantiation should work.
+ err(`wasm streaming compile failed: ${reason}`);
+ err("falling back to ArrayBuffer instantiation");
+ return instantiateArrayBuffer(binaryFile, imports, callback);
+ });
+ });
+ }
+ return instantiateArrayBuffer(binaryFile, imports, callback);
+}
+
+function getWasmImports() {
+ assignWasmImports();
+ // prepare imports
+ return {
+ "env": wasmImports,
+ "wasi_snapshot_preview1": wasmImports
+ };
+}
+
+// Create the wasm instance.
+// Receives the wasm imports, returns the exports.
+function createWasm() {
+ // Load the wasm module and create an instance of using native support in the JS engine.
+ // handle a generated wasm instance, receiving its exports and
+ // performing other necessary setup
+ /** @param {WebAssembly.Module=} module*/ function receiveInstance(instance, module) {
+ wasmExports = instance.exports;
+ registerTLSInit(wasmExports["_emscripten_tls_init"]);
+ wasmTable = wasmExports["__indirect_function_table"];
+ addOnInit(wasmExports["__wasm_call_ctors"]);
+ // We now have the Wasm module loaded up, keep a reference to the compiled module so we can post it to the workers.
+ wasmModule = module;
+ removeRunDependency("wasm-instantiate");
+ return wasmExports;
+ }
+ // wait for the pthread pool (if any)
+ addRunDependency("wasm-instantiate");
+ // Prefer streaming instantiation if available.
+ function receiveInstantiationResult(result) {
+ // 'result' is a ResultObject object which has both the module and instance.
+ // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+ receiveInstance(result["instance"], result["module"]);
+ }
+ var info = getWasmImports();
+ // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+ // to manually instantiate the Wasm module themselves. This allows pages to
+ // run the instantiation parallel to any other async startup actions they are
+ // performing.
+ // Also pthreads and wasm workers initialize the wasm instance through this
+ // path.
+ if (Module["instantiateWasm"]) {
+ try {
+ return Module["instantiateWasm"](info, receiveInstance);
+ } catch (e) {
+ err(`Module.instantiateWasm callback failed with error: ${e}`);
+ return false;
+ }
+ }
+ if (ENVIRONMENT_IS_PTHREAD) {
+ return new Promise(resolve => {
+ wasmModuleReceived = module => {
+ // Instantiate from the module posted from the main thread.
+ // We can just use sync instantiation in the worker.
+ var instance = new WebAssembly.Instance(module, getWasmImports());
+ receiveInstance(instance, module);
+ resolve();
+ };
+ });
+ }
+ wasmBinaryFile ??= findWasmBinary();
+ instantiateAsync(wasmBinary, wasmBinaryFile, info, receiveInstantiationResult);
+ return {};
+}
+
+// Globals used by JS i64 conversions (see makeSetValue)
+var tempDouble;
+
+var tempI64;
+
+// include: runtime_debug.js
+// end include: runtime_debug.js
+// === Body ===
+var ASM_CONSTS = {
+ 363188: $0 => {
+ window.open(UTF8ToString($0));
+ },
+ 363223: $0 => {
+ var lang = localStorage.getItem("localization_language");
+ if (lang == null) {
+ stringToUTF8(window.navigator.language.replace(/-.*/, ""), $0, 16);
+ } else {
+ stringToUTF8(lang, $0, 16);
+ }
+ },
+ 363412: ($0, $1) => {
+ window.alert(UTF8ToString($0) + ": " + UTF8ToString($1));
+ },
+ 363474: () => (("ontouchstart" in window) || (navigator.maxTouchPoints > 0) || (navigator.msMaxTouchPoints > 0)) ? 1 : 0,
+ 363589: () => {
+ document.addEventListener("click", function(event) {
+ Module.ccall("axmol_onwebclickcallback");
+ });
+ },
+ 363691: () => canvas.getBoundingClientRect().left,
+ 363734: () => canvas.getBoundingClientRect().top,
+ 363776: () => window.devicePixelRatio,
+ 363807: ($0, $1, $2, $3, $4, $5, $6) => {
+ var lines = UTF8ToString($0).split("\n");
+ var fontName = UTF8ToString($1);
+ var fontSize = $2;
+ var color = UTF8ToString($3);
+ var dimWidth = $4;
+ var dimHeight = $5;
+ var align = $6;
+ var canvas = Module.axmolSharedCanvas = Module.axmolSharedCanvas || document.createElement("canvas");
+ var context = canvas.getContext("2d", {
+ willReadFrequently: true
+ });
+ context.font = fontSize + "px " + fontName;
+ context.textBaseline = "alphabetic";
+ var linesWidth = [];
+ var linesAscent = [];
+ var linesDescent = [];
+ var totalHeight = 0;
+ var maxWidth = dimWidth > 0 ? dimWidth : 0;
+ var defaultAscent = 0;
+ var defaultDescent = 0;
+ var measureDefault = () => {
+ if (defaultAscent == 0 && defaultDescent == 0) {
+ var metrics = context.measureText("M");
+ defaultAscent = (typeof metrics.actualBoundingBoxAscent === "number") ? metrics.actualBoundingBoxAscent : fontSize * .8;
+ defaultDescent = (typeof metrics.actualBoundingBoxDescent === "number") ? metrics.actualBoundingBoxDescent : fontSize * .2;
+ }
+ };
+ for (var i = 0; i < lines.length; i++) {
+ var metrics = context.measureText(lines[i]);
+ var lineWidth = metrics.width;
+ var ascent = (typeof metrics.actualBoundingBoxAscent === "number") ? metrics.actualBoundingBoxAscent : fontSize * .8;
+ var descent = (typeof metrics.actualBoundingBoxDescent === "number") ? metrics.actualBoundingBoxDescent : fontSize * .2;
+ var lineHeight = ascent + descent;
+ if (lineHeight == 0) {
+ measureDefault();
+ ascent = defaultAscent;
+ descent = defaultDescent;
+ lineHeight = ascent + descent;
+ }
+ linesWidth.push(lineWidth);
+ linesAscent.push(ascent);
+ linesDescent.push(descent);
+ if (dimWidth <= 0 && lineWidth > maxWidth) {
+ maxWidth = lineWidth;
+ }
+ totalHeight += lineHeight;
+ }
+ if (dimHeight > 0) {
+ totalHeight = dimHeight;
+ }
+ var canvasWidth = Math.ceil(maxWidth);
+ var canvasHeight = Math.ceil(totalHeight);
+ canvas.width = canvasWidth;
+ canvas.height = canvasHeight;
+ context.clearRect(0, 0, canvasWidth, canvasHeight);
+ context.font = fontSize + "px " + fontName;
+ context.fillStyle = color;
+ context.textBaseline = "alphabetic";
+ var offsetY = 0;
+ if ((align & 240) === 48) {
+ offsetY = (canvasHeight - totalHeight) / 2;
+ } else if ((align & 240) === 32) {
+ offsetY = canvasHeight - totalHeight;
+ }
+ for (var i = 0; i < lines.length; i++) {
+ var lineH = linesAscent[i] + linesDescent[i];
+ var offsetX = 0;
+ if ((align & 15) === 3) {
+ offsetX = (canvasWidth - linesWidth[i]) / 2;
+ } else if ((align & 15) === 2) {
+ offsetX = canvasWidth - linesWidth[i];
+ }
+ var baselineY = offsetY + linesAscent[i];
+ context.fillText(lines[i], offsetX, baselineY);
+ offsetY += lineH;
+ }
+ var data = context.getImageData(0, 0, canvasWidth, canvasHeight).data;
+ var ptr = _malloc(data.byteLength);
+ var buffer = new Uint8Array(Module.HEAPU8.buffer, ptr, data.byteLength);
+ buffer.set(data);
+ return ptr;
+ },
+ 366583: () => Module.axmolSharedCanvas.width,
+ 366626: () => Module.axmolSharedCanvas.height,
+ 366670: () => PThread.unusedWorkers.length
+};
+
+function ImGui_ImplGlfw_EmscriptenOpenURL(url) {
+ url = url ? UTF8ToString(url) : null;
+ if (url) window.open(url, "_blank");
+}
+
+// end include: preamble.js
+class ExitStatus {
+ name="ExitStatus";
+ constructor(status) {
+ this.message = `Program terminated with exit(${status})`;
+ this.status = status;
+ }
+}
+
+var terminateWorker = worker => {
+ worker.terminate();
+ // terminate() can be asynchronous, so in theory the worker can continue
+ // to run for some amount of time after termination. However from our POV
+ // the worker now dead and we don't want to hear from it again, so we stub
+ // out its message handler here. This avoids having to check in each of
+ // the onmessage handlers if the message was coming from valid worker.
+ worker.onmessage = e => {};
+};
+
+var cleanupThread = pthread_ptr => {
+ var worker = PThread.pthreads[pthread_ptr];
+ PThread.returnWorkerToPool(worker);
+};
+
+var spawnThread = threadParams => {
+ var worker = PThread.getNewWorker();
+ if (!worker) {
+ // No available workers in the PThread pool.
+ return 6;
+ }
+ PThread.runningWorkers.push(worker);
+ // Add to pthreads map
+ PThread.pthreads[threadParams.pthread_ptr] = worker;
+ worker.pthread_ptr = threadParams.pthread_ptr;
+ var msg = {
+ cmd: "run",
+ start_routine: threadParams.startRoutine,
+ arg: threadParams.arg,
+ pthread_ptr: threadParams.pthread_ptr
+ };
+ if (ENVIRONMENT_IS_NODE) {
+ // Mark worker as weakly referenced once we start executing a pthread,
+ // so that its existence does not prevent Node.js from exiting. This
+ // has no effect if the worker is already weakly referenced (e.g. if
+ // this worker was previously idle/unused).
+ worker.unref();
+ }
+ // Ask the worker to start executing its pthread entry point function.
+ worker.postMessage(msg, threadParams.transferList);
+ return 0;
+};
+
+var runtimeKeepaliveCounter = 0;
+
+var keepRuntimeAlive = () => noExitRuntime || runtimeKeepaliveCounter > 0;
+
+var stackSave = () => _emscripten_stack_get_current();
+
+var stackRestore = val => __emscripten_stack_restore(val);
+
+var stackAlloc = sz => __emscripten_stack_alloc(sz);
+
+var convertI32PairToI53Checked = (lo, hi) => ((hi + 2097152) >>> 0 < 4194305 - !!lo) ? (lo >>> 0) + hi * 4294967296 : NaN;
+
+/** @type{function(number, (number|boolean), ...number)} */ var proxyToMainThread = (funcIndex, emAsmAddr, sync, ...callArgs) => {
+ // EM_ASM proxying is done by passing a pointer to the address of the EM_ASM
+ // content as `emAsmAddr`. JS library proxying is done by passing an index
+ // into `proxiedJSCallArgs` as `funcIndex`. If `emAsmAddr` is non-zero then
+ // `funcIndex` will be ignored.
+ // Additional arguments are passed after the first three are the actual
+ // function arguments.
+ // The serialization buffer contains the number of call params, and then
+ // all the args here.
+ // We also pass 'sync' to C separately, since C needs to look at it.
+ // Allocate a buffer, which will be copied by the C code.
+ // First passed parameter specifies the number of arguments to the function.
+ // When BigInt support is enabled, we must handle types in a more complex
+ // way, detecting at runtime if a value is a BigInt or not (as we have no
+ // type info here). To do that, add a "prefix" before each value that
+ // indicates if it is a BigInt, which effectively doubles the number of
+ // values we serialize for proxying. TODO: pack this?
+ var serializedNumCallArgs = callArgs.length;
+ var sp = stackSave();
+ var args = stackAlloc(serializedNumCallArgs * 8);
+ var b = ((args) >> 3);
+ for (var i = 0; i < callArgs.length; i++) {
+ var arg = callArgs[i];
+ GROWABLE_HEAP_F64()[b + i] = arg;
+ }
+ var rtn = __emscripten_run_on_main_thread_js(funcIndex, emAsmAddr, serializedNumCallArgs, args, sync);
+ stackRestore(sp);
+ return rtn;
+};
+
+function _proc_exit(code) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(0, 0, 1, code);
+ EXITSTATUS = code;
+ if (!keepRuntimeAlive()) {
+ PThread.terminateAllThreads();
+ Module["onExit"]?.(code);
+ ABORT = true;
+ }
+ quit_(code, new ExitStatus(code));
+}
+
+var handleException = e => {
+ // Certain exception types we do not treat as errors since they are used for
+ // internal control flow.
+ // 1. ExitStatus, which is thrown by exit()
+ // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others
+ // that wish to return to JS event loop.
+ if (e instanceof ExitStatus || e == "unwind") {
+ return EXITSTATUS;
+ }
+ quit_(1, e);
+};
+
+function exitOnMainThread(returnCode) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(1, 0, 0, returnCode);
+ _exit(returnCode);
+}
+
+/** @suppress {duplicate } */ /** @param {boolean|number=} implicit */ var exitJS = (status, implicit) => {
+ EXITSTATUS = status;
+ if (ENVIRONMENT_IS_PTHREAD) {
+ // implicit exit can never happen on a pthread
+ // When running in a pthread we propagate the exit back to the main thread
+ // where it can decide if the whole process should be shut down or not.
+ // The pthread may have decided not to exit its own runtime, for example
+ // because it runs a main loop, but that doesn't affect the main thread.
+ exitOnMainThread(status);
+ throw "unwind";
+ }
+ _proc_exit(status);
+};
+
+var _exit = exitJS;
+
+var PThread = {
+ unusedWorkers: [],
+ runningWorkers: [],
+ tlsInitFunctions: [],
+ pthreads: {},
+ init() {
+ if ((!(ENVIRONMENT_IS_PTHREAD))) {
+ PThread.initMainThread();
+ }
+ },
+ initMainThread() {
+ var pthreadPoolSize = 4;
+ // Start loading up the Worker pool, if requested.
+ while (pthreadPoolSize--) {
+ PThread.allocateUnusedWorker();
+ }
+ // MINIMAL_RUNTIME takes care of calling loadWasmModuleToAllWorkers
+ // in postamble_minimal.js
+ addOnPreRun(() => {
+ addRunDependency("loading-workers");
+ PThread.loadWasmModuleToAllWorkers(() => removeRunDependency("loading-workers"));
+ });
+ },
+ terminateAllThreads: () => {
+ // Attempt to kill all workers. Sadly (at least on the web) there is no
+ // way to terminate a worker synchronously, or to be notified when a
+ // worker in actually terminated. This means there is some risk that
+ // pthreads will continue to be executing after `worker.terminate` has
+ // returned. For this reason, we don't call `returnWorkerToPool` here or
+ // free the underlying pthread data structures.
+ for (var worker of PThread.runningWorkers) {
+ terminateWorker(worker);
+ }
+ for (var worker of PThread.unusedWorkers) {
+ terminateWorker(worker);
+ }
+ PThread.unusedWorkers = [];
+ PThread.runningWorkers = [];
+ PThread.pthreads = {};
+ },
+ returnWorkerToPool: worker => {
+ // We don't want to run main thread queued calls here, since we are doing
+ // some operations that leave the worker queue in an invalid state until
+ // we are completely done (it would be bad if free() ends up calling a
+ // queued pthread_create which looks at the global data structures we are
+ // modifying). To achieve that, defer the free() til the very end, when
+ // we are all done.
+ var pthread_ptr = worker.pthread_ptr;
+ delete PThread.pthreads[pthread_ptr];
+ // Note: worker is intentionally not terminated so the pool can
+ // dynamically grow.
+ PThread.unusedWorkers.push(worker);
+ PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker), 1);
+ // Not a running Worker anymore
+ // Detach the worker from the pthread object, and return it to the
+ // worker pool as an unused worker.
+ worker.pthread_ptr = 0;
+ // Finally, free the underlying (and now-unused) pthread structure in
+ // linear memory.
+ __emscripten_thread_free_data(pthread_ptr);
+ },
+ receiveObjectTransfer(data) {},
+ threadInitTLS() {
+ // Call thread init functions (these are the _emscripten_tls_init for each
+ // module loaded.
+ PThread.tlsInitFunctions.forEach(f => f());
+ },
+ loadWasmModuleToWorker: worker => new Promise(onFinishedLoading => {
+ worker.onmessage = e => {
+ var d = e["data"];
+ var cmd = d.cmd;
+ // If this message is intended to a recipient that is not the main
+ // thread, forward it to the target thread.
+ if (d.targetThread && d.targetThread != _pthread_self()) {
+ var targetWorker = PThread.pthreads[d.targetThread];
+ if (targetWorker) {
+ targetWorker.postMessage(d, d.transferList);
+ } else {
+ err(`Internal error! Worker sent a message "${cmd}" to target pthread ${d.targetThread}, but that thread no longer exists!`);
+ }
+ return;
+ }
+ if (cmd === "checkMailbox") {
+ checkMailbox();
+ } else if (cmd === "spawnThread") {
+ spawnThread(d);
+ } else if (cmd === "cleanupThread") {
+ cleanupThread(d.thread);
+ } else if (cmd === "loaded") {
+ worker.loaded = true;
+ // Check that this worker doesn't have an associated pthread.
+ if (ENVIRONMENT_IS_NODE && !worker.pthread_ptr) {
+ // Once worker is loaded & idle, mark it as weakly referenced,
+ // so that mere existence of a Worker in the pool does not prevent
+ // Node.js from exiting the app.
+ worker.unref();
+ }
+ onFinishedLoading(worker);
+ } else if (cmd === "alert") {
+ alert(`Thread ${d.threadId}: ${d.text}`);
+ } else if (d.target === "setimmediate") {
+ // Worker wants to postMessage() to itself to implement setImmediate()
+ // emulation.
+ worker.postMessage(d);
+ } else if (cmd === "callHandler") {
+ Module[d.handler](...d.args);
+ } else if (cmd) {
+ // The received message looks like something that should be handled by this message
+ // handler, (since there is a e.data.cmd field present), but is not one of the
+ // recognized commands:
+ err(`worker sent an unknown command ${cmd}`);
+ }
+ };
+ worker.onerror = e => {
+ var message = "worker sent an error!";
+ err(`${message} ${e.filename}:${e.lineno}: ${e.message}`);
+ throw e;
+ };
+ if (ENVIRONMENT_IS_NODE) {
+ worker.on("message", data => worker.onmessage({
+ data
+ }));
+ worker.on("error", e => worker.onerror(e));
+ }
+ // When running on a pthread, none of the incoming parameters on the module
+ // object are present. Proxy known handlers back to the main thread if specified.
+ var handlers = [];
+ var knownHandlers = [ "onExit", "onAbort", "print", "printErr" ];
+ for (var handler of knownHandlers) {
+ if (Module.propertyIsEnumerable(handler)) {
+ handlers.push(handler);
+ }
+ }
+ // Ask the new worker to load up the Emscripten-compiled page. This is a heavy operation.
+ worker.postMessage({
+ cmd: "load",
+ handlers,
+ wasmMemory,
+ wasmModule
+ });
+ }),
+ loadWasmModuleToAllWorkers(onMaybeReady) {
+ // Instantiation is synchronous in pthreads.
+ if (ENVIRONMENT_IS_PTHREAD) {
+ return onMaybeReady();
+ }
+ let pthreadPoolReady = Promise.all(PThread.unusedWorkers.map(PThread.loadWasmModuleToWorker));
+ pthreadPoolReady.then(onMaybeReady);
+ },
+ allocateUnusedWorker() {
+ var worker;
+ var workerOptions = {
+ // This is the way that we signal to the node worker that it is hosting
+ // a pthread.
+ "workerData": "em-pthread",
+ // This is the way that we signal to the Web Worker that it is hosting
+ // a pthread.
+ "name": "em-pthread"
+ };
+ var pthreadMainJs = _scriptName;
+ // We can't use makeModuleReceiveWithVar here since we want to also
+ // call URL.createObjectURL on the mainScriptUrlOrBlob.
+ if (Module["mainScriptUrlOrBlob"]) {
+ pthreadMainJs = Module["mainScriptUrlOrBlob"];
+ if (typeof pthreadMainJs != "string") {
+ pthreadMainJs = URL.createObjectURL(pthreadMainJs);
+ }
+ }
+ worker = new Worker(pthreadMainJs, workerOptions);
+ PThread.unusedWorkers.push(worker);
+ },
+ getNewWorker() {
+ if (PThread.unusedWorkers.length == 0) {
+ // PTHREAD_POOL_SIZE_STRICT should show a warning and, if set to level `2`, return from the function.
+ PThread.allocateUnusedWorker();
+ PThread.loadWasmModuleToWorker(PThread.unusedWorkers[0]);
+ }
+ return PThread.unusedWorkers.pop();
+ }
+};
+
+var callRuntimeCallbacks = callbacks => {
+ while (callbacks.length > 0) {
+ // Pass the module as the first argument.
+ callbacks.shift()(Module);
+ }
+};
+
+var establishStackSpace = pthread_ptr => {
+ // If memory growth is enabled, the memory views may have gotten out of date,
+ // so resync them before accessing the pthread ptr below.
+ updateMemoryViews();
+ var stackHigh = GROWABLE_HEAP_U32()[(((pthread_ptr) + (52)) >> 2)];
+ var stackSize = GROWABLE_HEAP_U32()[(((pthread_ptr) + (56)) >> 2)];
+ var stackLow = stackHigh - stackSize;
+ // Set stack limits used by `emscripten/stack.h` function. These limits are
+ // cached in wasm-side globals to make checks as fast as possible.
+ _emscripten_stack_set_limits(stackHigh, stackLow);
+ // Call inside wasm module to set up the stack frame for this pthread in wasm module scope
+ stackRestore(stackHigh);
+};
+
+/**
+ * @param {number} ptr
+ * @param {string} type
+ */ function getValue(ptr, type = "i8") {
+ if (type.endsWith("*")) type = "*";
+ switch (type) {
+ case "i1":
+ return GROWABLE_HEAP_I8()[ptr];
+
+ case "i8":
+ return GROWABLE_HEAP_I8()[ptr];
+
+ case "i16":
+ return GROWABLE_HEAP_I16()[((ptr) >> 1)];
+
+ case "i32":
+ return GROWABLE_HEAP_I32()[((ptr) >> 2)];
+
+ case "i64":
+ abort("to do getValue(i64) use WASM_BIGINT");
+
+ case "float":
+ return GROWABLE_HEAP_F32()[((ptr) >> 2)];
+
+ case "double":
+ return GROWABLE_HEAP_F64()[((ptr) >> 3)];
+
+ case "*":
+ return GROWABLE_HEAP_U32()[((ptr) >> 2)];
+
+ default:
+ abort(`invalid type for getValue: ${type}`);
+ }
+}
+
+var wasmTableMirror = [];
+
+/** @type {WebAssembly.Table} */ var wasmTable;
+
+var getWasmTableEntry = funcPtr => {
+ var func = wasmTableMirror[funcPtr];
+ if (!func) {
+ if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1;
+ /** @suppress {checkTypes} */ wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
+ }
+ return func;
+};
+
+var invokeEntryPoint = (ptr, arg) => {
+ // An old thread on this worker may have been canceled without returning the
+ // `runtimeKeepaliveCounter` to zero. Reset it now so the new thread won't
+ // be affected.
+ runtimeKeepaliveCounter = 0;
+ // Same for noExitRuntime. The default for pthreads should always be false
+ // otherwise pthreads would never complete and attempts to pthread_join to
+ // them would block forever.
+ // pthreads can still choose to set `noExitRuntime` explicitly, or
+ // call emscripten_unwind_to_js_event_loop to extend their lifetime beyond
+ // their main function. See comment in src/runtime_pthread.js for more.
+ noExitRuntime = 0;
+ // pthread entry points are always of signature 'void *ThreadMain(void *arg)'
+ // Native codebases sometimes spawn threads with other thread entry point
+ // signatures, such as void ThreadMain(void *arg), void *ThreadMain(), or
+ // void ThreadMain(). That is not acceptable per C/C++ specification, but
+ // x86 compiler ABI extensions enable that to work. If you find the
+ // following line to crash, either change the signature to "proper" void
+ // *ThreadMain(void *arg) form, or try linking with the Emscripten linker
+ // flag -sEMULATE_FUNCTION_POINTER_CASTS to add in emulation for this x86
+ // ABI extension.
+ var result = getWasmTableEntry(ptr)(arg);
+ function finish(result) {
+ if (keepRuntimeAlive()) {
+ EXITSTATUS = result;
+ } else {
+ __emscripten_thread_exit(result);
+ }
+ }
+ finish(result);
+};
+
+var noExitRuntime = Module["noExitRuntime"] || true;
+
+var registerTLSInit = tlsInitFunc => PThread.tlsInitFunctions.push(tlsInitFunc);
+
+/**
+ * @param {number} ptr
+ * @param {number} value
+ * @param {string} type
+ */ function setValue(ptr, value, type = "i8") {
+ if (type.endsWith("*")) type = "*";
+ switch (type) {
+ case "i1":
+ GROWABLE_HEAP_I8()[ptr] = value;
+ break;
+
+ case "i8":
+ GROWABLE_HEAP_I8()[ptr] = value;
+ break;
+
+ case "i16":
+ GROWABLE_HEAP_I16()[((ptr) >> 1)] = value;
+ break;
+
+ case "i32":
+ GROWABLE_HEAP_I32()[((ptr) >> 2)] = value;
+ break;
+
+ case "i64":
+ abort("to do setValue(i64) use WASM_BIGINT");
+
+ case "float":
+ GROWABLE_HEAP_F32()[((ptr) >> 2)] = value;
+ break;
+
+ case "double":
+ GROWABLE_HEAP_F64()[((ptr) >> 3)] = value;
+ break;
+
+ case "*":
+ GROWABLE_HEAP_U32()[((ptr) >> 2)] = value;
+ break;
+
+ default:
+ abort(`invalid type for setValue: ${type}`);
+ }
+}
+
+var UTF8Decoder = typeof TextDecoder != "undefined" ? new TextDecoder : undefined;
+
+/**
+ * Given a pointer 'idx' to a null-terminated UTF8-encoded string in the given
+ * array that contains uint8 values, returns a copy of that string as a
+ * Javascript String object.
+ * heapOrArray is either a regular array, or a JavaScript typed array view.
+ * @param {number=} idx
+ * @param {number=} maxBytesToRead
+ * @return {string}
+ */ var UTF8ArrayToString = (heapOrArray, idx = 0, maxBytesToRead = NaN) => {
+ var endIdx = idx + maxBytesToRead;
+ var endPtr = idx;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on
+ // null terminator by itself. Also, use the length info to avoid running tiny
+ // strings through TextDecoder, since .subarray() allocates garbage.
+ // (As a tiny code save trick, compare endPtr against endIdx using a negation,
+ // so that undefined/NaN means Infinity)
+ while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
+ if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
+ return UTF8Decoder.decode(heapOrArray.buffer instanceof ArrayBuffer ? heapOrArray.subarray(idx, endPtr) : heapOrArray.slice(idx, endPtr));
+ }
+ var str = "";
+ // If building with TextDecoder, we have already computed the string length
+ // above, so test loop end condition against that
+ while (idx < endPtr) {
+ // For UTF8 byte structure, see:
+ // http://en.wikipedia.org/wiki/UTF-8#Description
+ // https://www.ietf.org/rfc/rfc2279.txt
+ // https://tools.ietf.org/html/rfc3629
+ var u0 = heapOrArray[idx++];
+ if (!(u0 & 128)) {
+ str += String.fromCharCode(u0);
+ continue;
+ }
+ var u1 = heapOrArray[idx++] & 63;
+ if ((u0 & 224) == 192) {
+ str += String.fromCharCode(((u0 & 31) << 6) | u1);
+ continue;
+ }
+ var u2 = heapOrArray[idx++] & 63;
+ if ((u0 & 240) == 224) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63);
+ }
+ if (u0 < 65536) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 65536;
+ str += String.fromCharCode(55296 | (ch >> 10), 56320 | (ch & 1023));
+ }
+ }
+ return str;
+};
+
+/**
+ * Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the
+ * emscripten HEAP, returns a copy of that string as a Javascript String object.
+ *
+ * @param {number} ptr
+ * @param {number=} maxBytesToRead - An optional length that specifies the
+ * maximum number of bytes to read. You can omit this parameter to scan the
+ * string until the first 0 byte. If maxBytesToRead is passed, and the string
+ * at [ptr, ptr+maxBytesToReadr[ contains a null byte in the middle, then the
+ * string will cut short at that byte index (i.e. maxBytesToRead will not
+ * produce a string of exact length [ptr, ptr+maxBytesToRead[) N.B. mixing
+ * frequent uses of UTF8ToString() with and without maxBytesToRead may throw
+ * JS JIT optimizations off, so it is worth to consider consistently using one
+ * @return {string}
+ */ var UTF8ToString = (ptr, maxBytesToRead) => ptr ? UTF8ArrayToString(GROWABLE_HEAP_U8(), ptr, maxBytesToRead) : "";
+
+var ___assert_fail = (condition, filename, line, func) => abort(`Assertion failed: ${UTF8ToString(condition)}, at: ` + [ filename ? UTF8ToString(filename) : "unknown filename", line, func ? UTF8ToString(func) : "unknown function" ]);
+
+var ___call_sighandler = (fp, sig) => getWasmTableEntry(fp)(sig);
+
+class ExceptionInfo {
+ // excPtr - Thrown object pointer to wrap. Metadata pointer is calculated from it.
+ constructor(excPtr) {
+ this.excPtr = excPtr;
+ this.ptr = excPtr - 24;
+ }
+ set_type(type) {
+ GROWABLE_HEAP_U32()[(((this.ptr) + (4)) >> 2)] = type;
+ }
+ get_type() {
+ return GROWABLE_HEAP_U32()[(((this.ptr) + (4)) >> 2)];
+ }
+ set_destructor(destructor) {
+ GROWABLE_HEAP_U32()[(((this.ptr) + (8)) >> 2)] = destructor;
+ }
+ get_destructor() {
+ return GROWABLE_HEAP_U32()[(((this.ptr) + (8)) >> 2)];
+ }
+ set_caught(caught) {
+ caught = caught ? 1 : 0;
+ GROWABLE_HEAP_I8()[(this.ptr) + (12)] = caught;
+ }
+ get_caught() {
+ return GROWABLE_HEAP_I8()[(this.ptr) + (12)] != 0;
+ }
+ set_rethrown(rethrown) {
+ rethrown = rethrown ? 1 : 0;
+ GROWABLE_HEAP_I8()[(this.ptr) + (13)] = rethrown;
+ }
+ get_rethrown() {
+ return GROWABLE_HEAP_I8()[(this.ptr) + (13)] != 0;
+ }
+ // Initialize native structure fields. Should be called once after allocated.
+ init(type, destructor) {
+ this.set_adjusted_ptr(0);
+ this.set_type(type);
+ this.set_destructor(destructor);
+ }
+ set_adjusted_ptr(adjustedPtr) {
+ GROWABLE_HEAP_U32()[(((this.ptr) + (16)) >> 2)] = adjustedPtr;
+ }
+ get_adjusted_ptr() {
+ return GROWABLE_HEAP_U32()[(((this.ptr) + (16)) >> 2)];
+ }
+}
+
+var exceptionLast = 0;
+
+var uncaughtExceptionCount = 0;
+
+var ___cxa_throw = (ptr, type, destructor) => {
+ var info = new ExceptionInfo(ptr);
+ // Initialize ExceptionInfo content after it was allocated in __cxa_allocate_exception.
+ info.init(type, destructor);
+ exceptionLast = ptr;
+ uncaughtExceptionCount++;
+ throw exceptionLast;
+};
+
+function pthreadCreateProxied(pthread_ptr, attr, startRoutine, arg) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(2, 0, 1, pthread_ptr, attr, startRoutine, arg);
+ return ___pthread_create_js(pthread_ptr, attr, startRoutine, arg);
+}
+
+var _emscripten_has_threading_support = () => typeof SharedArrayBuffer != "undefined";
+
+var ___pthread_create_js = (pthread_ptr, attr, startRoutine, arg) => {
+ if (!_emscripten_has_threading_support()) {
+ return 6;
+ }
+ // List of JS objects that will transfer ownership to the Worker hosting the thread
+ var transferList = [];
+ var error = 0;
+ // Synchronously proxy the thread creation to main thread if possible. If we
+ // need to transfer ownership of objects, then proxy asynchronously via
+ // postMessage.
+ if (ENVIRONMENT_IS_PTHREAD && (transferList.length === 0 || error)) {
+ return pthreadCreateProxied(pthread_ptr, attr, startRoutine, arg);
+ }
+ // If on the main thread, and accessing Canvas/OffscreenCanvas failed, abort
+ // with the detected error.
+ if (error) return error;
+ var threadParams = {
+ startRoutine,
+ pthread_ptr,
+ arg,
+ transferList
+ };
+ if (ENVIRONMENT_IS_PTHREAD) {
+ // The prepopulated pool of web workers that can host pthreads is stored
+ // in the main JS thread. Therefore if a pthread is attempting to spawn a
+ // new thread, the thread creation must be deferred to the main JS thread.
+ threadParams.cmd = "spawnThread";
+ postMessage(threadParams, transferList);
+ // When we defer thread creation this way, we have no way to detect thread
+ // creation synchronously today, so we have to assume success and return 0.
+ return 0;
+ }
+ // We are the main thread, so we have the pthread warmup pool in this
+ // thread and can fire off JS thread creation directly ourselves.
+ return spawnThread(threadParams);
+};
+
+var PATH = {
+ isAbs: path => path.charAt(0) === "/",
+ splitPath: filename => {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },
+ normalizeArray: (parts, allowAboveRoot) => {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === ".") {
+ parts.splice(i, 1);
+ } else if (last === "..") {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (;up; up--) {
+ parts.unshift("..");
+ }
+ }
+ return parts;
+ },
+ normalize: path => {
+ var isAbsolute = PATH.isAbs(path), trailingSlash = path.substr(-1) === "/";
+ // Normalize the path
+ path = PATH.normalizeArray(path.split("/").filter(p => !!p), !isAbsolute).join("/");
+ if (!path && !isAbsolute) {
+ path = ".";
+ }
+ if (path && trailingSlash) {
+ path += "/";
+ }
+ return (isAbsolute ? "/" : "") + path;
+ },
+ dirname: path => {
+ var result = PATH.splitPath(path), root = result[0], dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return ".";
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },
+ basename: path => {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === "/") return "/";
+ path = PATH.normalize(path);
+ path = path.replace(/\/$/, "");
+ var lastSlash = path.lastIndexOf("/");
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash + 1);
+ },
+ join: (...paths) => PATH.normalize(paths.join("/")),
+ join2: (l, r) => PATH.normalize(l + "/" + r)
+};
+
+var initRandomFill = () => {
+ if (typeof crypto == "object" && typeof crypto["getRandomValues"] == "function") {
+ // for modern web browsers
+ // like with most Web APIs, we can't use Web Crypto API directly on shared memory,
+ // so we need to create an intermediate buffer and copy it to the destination
+ return view => (view.set(crypto.getRandomValues(new Uint8Array(view.byteLength))),
+ // Return the original view to match modern native implementations.
+ view);
+ } else if (ENVIRONMENT_IS_NODE) {
+ // for nodejs with or without crypto support included
+ try {
+ var crypto_module = require("crypto");
+ var randomFillSync = crypto_module["randomFillSync"];
+ if (randomFillSync) {
+ // nodejs with LTS crypto support
+ return view => crypto_module["randomFillSync"](view);
+ }
+ // very old nodejs with the original crypto API
+ var randomBytes = crypto_module["randomBytes"];
+ return view => (view.set(randomBytes(view.byteLength)), // Return the original view to match modern native implementations.
+ view);
+ } catch (e) {}
+ }
+ // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
+ abort("initRandomDevice");
+};
+
+var randomFill = view => (randomFill = initRandomFill())(view);
+
+var PATH_FS = {
+ resolve: (...args) => {
+ var resolvedPath = "", resolvedAbsolute = false;
+ for (var i = args.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = (i >= 0) ? args[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path != "string") {
+ throw new TypeError("Arguments to path.resolve must be strings");
+ } else if (!path) {
+ return "";
+ }
+ // an invalid portion invalidates the whole thing
+ resolvedPath = path + "/" + resolvedPath;
+ resolvedAbsolute = PATH.isAbs(path);
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter(p => !!p), !resolvedAbsolute).join("/");
+ return ((resolvedAbsolute ? "/" : "") + resolvedPath) || ".";
+ },
+ relative: (from, to) => {
+ from = PATH_FS.resolve(from).substr(1);
+ to = PATH_FS.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (;start < arr.length; start++) {
+ if (arr[start] !== "") break;
+ }
+ var end = arr.length - 1;
+ for (;end >= 0; end--) {
+ if (arr[end] !== "") break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split("/"));
+ var toParts = trim(to.split("/"));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push("..");
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join("/");
+ }
+};
+
+var FS_stdin_getChar_buffer = [];
+
+var lengthBytesUTF8 = str => {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+ // unit, not a Unicode code point of the character! So decode
+ // UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var c = str.charCodeAt(i);
+ // possibly a lead surrogate
+ if (c <= 127) {
+ len++;
+ } else if (c <= 2047) {
+ len += 2;
+ } else if (c >= 55296 && c <= 57343) {
+ len += 4;
+ ++i;
+ } else {
+ len += 3;
+ }
+ }
+ return len;
+};
+
+var stringToUTF8Array = (str, heap, outIdx, maxBytesToWrite) => {
+ // Parameter maxBytesToWrite is not optional. Negative values, 0, null,
+ // undefined and false each don't write out any bytes.
+ if (!(maxBytesToWrite > 0)) return 0;
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1;
+ // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code
+ // unit, not a Unicode code point of the character! So decode
+ // UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description
+ // and https://www.ietf.org/rfc/rfc2279.txt
+ // and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i);
+ // possibly a lead surrogate
+ if (u >= 55296 && u <= 57343) {
+ var u1 = str.charCodeAt(++i);
+ u = 65536 + ((u & 1023) << 10) | (u1 & 1023);
+ }
+ if (u <= 127) {
+ if (outIdx >= endIdx) break;
+ heap[outIdx++] = u;
+ } else if (u <= 2047) {
+ if (outIdx + 1 >= endIdx) break;
+ heap[outIdx++] = 192 | (u >> 6);
+ heap[outIdx++] = 128 | (u & 63);
+ } else if (u <= 65535) {
+ if (outIdx + 2 >= endIdx) break;
+ heap[outIdx++] = 224 | (u >> 12);
+ heap[outIdx++] = 128 | ((u >> 6) & 63);
+ heap[outIdx++] = 128 | (u & 63);
+ } else {
+ if (outIdx + 3 >= endIdx) break;
+ heap[outIdx++] = 240 | (u >> 18);
+ heap[outIdx++] = 128 | ((u >> 12) & 63);
+ heap[outIdx++] = 128 | ((u >> 6) & 63);
+ heap[outIdx++] = 128 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ heap[outIdx] = 0;
+ return outIdx - startIdx;
+};
+
+/** @type {function(string, boolean=, number=)} */ function intArrayFromString(stringy, dontAddNull, length) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+}
+
+var FS_stdin_getChar = () => {
+ if (!FS_stdin_getChar_buffer.length) {
+ var result = null;
+ if (ENVIRONMENT_IS_NODE) {
+ // we will read data by chunks of BUFSIZE
+ var BUFSIZE = 256;
+ var buf = Buffer.alloc(BUFSIZE);
+ var bytesRead = 0;
+ // For some reason we must suppress a closure warning here, even though
+ // fd definitely exists on process.stdin, and is even the proper way to
+ // get the fd of stdin,
+ // https://github.com/nodejs/help/issues/2136#issuecomment-523649904
+ // This started to happen after moving this logic out of library_tty.js,
+ // so it is related to the surrounding code in some unclear manner.
+ /** @suppress {missingProperties} */ var fd = process.stdin.fd;
+ try {
+ bytesRead = fs.readSync(fd, buf, 0, BUFSIZE);
+ } catch (e) {
+ // Cross-platform differences: on Windows, reading EOF throws an
+ // exception, but on other OSes, reading EOF returns 0. Uniformize
+ // behavior by treating the EOF exception to return 0.
+ if (e.toString().includes("EOF")) bytesRead = 0; else throw e;
+ }
+ if (bytesRead > 0) {
+ result = buf.slice(0, bytesRead).toString("utf-8");
+ }
+ } else if (typeof window != "undefined" && typeof window.prompt == "function") {
+ // Browser.
+ result = window.prompt("Input: ");
+ // returns null on cancel
+ if (result !== null) {
+ result += "\n";
+ }
+ } else {}
+ if (!result) {
+ return null;
+ }
+ FS_stdin_getChar_buffer = intArrayFromString(result, true);
+ }
+ return FS_stdin_getChar_buffer.shift();
+};
+
+var TTY = {
+ ttys: [],
+ init() {},
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process.stdin.setEncoding('utf8');
+ // }
+ shutdown() {},
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process.stdin.pause();
+ // }
+ register(dev, ops) {
+ TTY.ttys[dev] = {
+ input: [],
+ output: [],
+ ops
+ };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },
+ stream_ops: {
+ open(stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(43);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },
+ close(stream) {
+ // flush any pending line data
+ stream.tty.ops.fsync(stream.tty);
+ },
+ fsync(stream) {
+ stream.tty.ops.fsync(stream.tty);
+ },
+ read(stream, buffer, offset, length, pos) {
+ /* ignored */ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(60);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset + i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(60);
+ }
+ try {
+ for (var i = 0; i < length; i++) {
+ stream.tty.ops.put_char(stream.tty, buffer[offset + i]);
+ }
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ },
+ default_tty_ops: {
+ get_char(tty) {
+ return FS_stdin_getChar();
+ },
+ put_char(tty, val) {
+ if (val === null || val === 10) {
+ out(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },
+ // val == 0 would cut text output off in the middle.
+ fsync(tty) {
+ if (tty.output && tty.output.length > 0) {
+ out(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ }
+ },
+ ioctl_tcgets(tty) {
+ // typical setting
+ return {
+ c_iflag: 25856,
+ c_oflag: 5,
+ c_cflag: 191,
+ c_lflag: 35387,
+ c_cc: [ 3, 28, 127, 21, 4, 0, 1, 0, 17, 19, 26, 0, 18, 15, 23, 22, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]
+ };
+ },
+ ioctl_tcsets(tty, optional_actions, data) {
+ // currently just ignore
+ return 0;
+ },
+ ioctl_tiocgwinsz(tty) {
+ return [ 24, 80 ];
+ }
+ },
+ default_tty1_ops: {
+ put_char(tty, val) {
+ if (val === null || val === 10) {
+ err(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },
+ fsync(tty) {
+ if (tty.output && tty.output.length > 0) {
+ err(UTF8ArrayToString(tty.output));
+ tty.output = [];
+ }
+ }
+ }
+};
+
+var zeroMemory = (address, size) => {
+ GROWABLE_HEAP_U8().fill(0, address, address + size);
+};
+
+var alignMemory = (size, alignment) => Math.ceil(size / alignment) * alignment;
+
+var mmapAlloc = size => {
+ size = alignMemory(size, 65536);
+ var ptr = _emscripten_builtin_memalign(65536, size);
+ if (ptr) zeroMemory(ptr, size);
+ return ptr;
+};
+
+var MEMFS = {
+ ops_table: null,
+ mount(mount) {
+ return MEMFS.createNode(null, "/", 16895, 0);
+ },
+ createNode(parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(63);
+ }
+ MEMFS.ops_table ||= {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0;
+ // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ parent.timestamp = node.timestamp;
+ }
+ return node;
+ },
+ getFileDataAsTypedArray(node) {
+ if (!node.contents) return new Uint8Array(0);
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes);
+ // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },
+ expandFileStorage(node, newCapacity) {
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return;
+ // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125)) >>> 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256);
+ // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity);
+ // Allocate new storage.
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0);
+ },
+ // Copy old data over to the new storage.
+ resizeFileStorage(node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null;
+ // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ } else {
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newSize);
+ // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes)));
+ }
+ // Copy old data over to the new storage.
+ node.usedBytes = newSize;
+ }
+ },
+ node_ops: {
+ getattr(node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },
+ setattr(node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },
+ lookup(parent, name) {
+ throw MEMFS.doesNotExistError;
+ },
+ mknod(parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },
+ rename(old_node, new_dir, new_name) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {}
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ }
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ old_node.parent.timestamp = Date.now();
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ new_dir.timestamp = old_node.parent.timestamp;
+ },
+ unlink(parent, name) {
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },
+ rmdir(parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },
+ readdir(node) {
+ var entries = [ ".", ".." ];
+ for (var key of Object.keys(node.contents)) {
+ entries.push(key);
+ }
+ return entries;
+ },
+ symlink(parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },
+ readlink(node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ return node.link;
+ }
+ },
+ stream_ops: {
+ read(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ if (size > 8 && contents.subarray) {
+ // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },
+ write(stream, buffer, offset, length, position, canOwn) {
+ // If the buffer is located in main memory (HEAP), and if
+ // memory can grow, we can't hold on to references of the
+ // memory buffer, as they may get invalidated. That means we
+ // need to do copy its contents.
+ if (buffer.buffer === GROWABLE_HEAP_I8().buffer) {
+ canOwn = false;
+ }
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) {
+ // This write is from a typed array to a typed array?
+ if (canOwn) {
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) {
+ // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = buffer.slice(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) {
+ // Writing to an already allocated and used subrange of the file?
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position + length);
+ if (node.contents.subarray && buffer.subarray) {
+ // Use typed array write which is available.
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ } else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i];
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position + length);
+ return length;
+ },
+ llseek(stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) {
+ position += stream.position;
+ } else if (whence === 2) {
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ return position;
+ },
+ allocate(stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },
+ mmap(stream, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if (!(flags & 2) && contents && contents.buffer === GROWABLE_HEAP_I8().buffer) {
+ // We can't emulate MAP_SHARED when the file is not backed by the
+ // buffer we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ allocated = true;
+ ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ if (contents) {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < contents.length) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ GROWABLE_HEAP_I8().set(contents, ptr);
+ }
+ }
+ return {
+ ptr,
+ allocated
+ };
+ },
+ msync(stream, buffer, offset, length, mmapFlags) {
+ MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ }
+ }
+};
+
+/** @param {boolean=} noRunDep */ var asyncLoad = (url, onload, onerror, noRunDep) => {
+ var dep = !noRunDep ? getUniqueRunDependency(`al ${url}`) : "";
+ readAsync(url).then(arrayBuffer => {
+ onload(new Uint8Array(arrayBuffer));
+ if (dep) removeRunDependency(dep);
+ }, err => {
+ if (onerror) {
+ onerror();
+ } else {
+ throw `Loading data file "${url}" failed.`;
+ }
+ });
+ if (dep) addRunDependency(dep);
+};
+
+var FS_createDataFile = (parent, name, fileData, canRead, canWrite, canOwn) => {
+ FS.createDataFile(parent, name, fileData, canRead, canWrite, canOwn);
+};
+
+var preloadPlugins = Module["preloadPlugins"] || [];
+
+var FS_handledByPreloadPlugin = (byteArray, fullname, finish, onerror) => {
+ // Ensure plugins are ready.
+ if (typeof Browser != "undefined") Browser.init();
+ var handled = false;
+ preloadPlugins.forEach(plugin => {
+ if (handled) return;
+ if (plugin["canHandle"](fullname)) {
+ plugin["handle"](byteArray, fullname, finish, onerror);
+ handled = true;
+ }
+ });
+ return handled;
+};
+
+var FS_createPreloadedFile = (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => {
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency(`cp ${fullname}`);
+ // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ preFinish?.();
+ if (!dontCreateFile) {
+ FS_createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ onload?.();
+ removeRunDependency(dep);
+ }
+ if (FS_handledByPreloadPlugin(byteArray, fullname, finish, () => {
+ onerror?.();
+ removeRunDependency(dep);
+ })) {
+ return;
+ }
+ finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == "string") {
+ asyncLoad(url, processData, onerror);
+ } else {
+ processData(url);
+ }
+};
+
+var FS_modeStringToFlags = str => {
+ var flagModes = {
+ "r": 0,
+ "r+": 2,
+ "w": 512 | 64 | 1,
+ "w+": 512 | 64 | 2,
+ "a": 1024 | 64 | 1,
+ "a+": 1024 | 64 | 2
+ };
+ var flags = flagModes[str];
+ if (typeof flags == "undefined") {
+ throw new Error(`Unknown file open mode: ${str}`);
+ }
+ return flags;
+};
+
+var FS_getMode = (canRead, canWrite) => {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+};
+
+var IDBFS = {
+ dbs: {},
+ indexedDB: () => {
+ if (typeof indexedDB != "undefined") return indexedDB;
+ var ret = null;
+ if (typeof window == "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ return ret;
+ },
+ DB_VERSION: 21,
+ DB_STORE_NAME: "FILE_DATA",
+ queuePersist: mount => {
+ function onPersistComplete() {
+ if (mount.idbPersistState === "again") startPersist(); else // If a new sync request has appeared in between, kick off a new sync
+ mount.idbPersistState = 0;
+ }
+ // Otherwise reset sync state back to idle to wait for a new sync later
+ function startPersist() {
+ mount.idbPersistState = "idb";
+ // Mark that we are currently running a sync operation
+ IDBFS.syncfs(mount, /*populate:*/ false, onPersistComplete);
+ }
+ if (!mount.idbPersistState) {
+ // Programs typically write/copy/move multiple files in the in-memory
+ // filesystem within a single app frame, so when a filesystem sync
+ // command is triggered, do not start it immediately, but only after
+ // the current frame is finished. This way all the modified files
+ // inside the main loop tick will be batched up to the same sync.
+ mount.idbPersistState = setTimeout(startPersist, 0);
+ } else if (mount.idbPersistState === "idb") {
+ // There is an active IndexedDB sync operation in-flight, but we now
+ // have accumulated more files to sync. We should therefore queue up
+ // a new sync after the current one finishes so that all writes
+ // will be properly persisted.
+ mount.idbPersistState = "again";
+ }
+ },
+ mount: mount => {
+ // reuse core MEMFS functionality
+ var mnt = MEMFS.mount(mount);
+ // If the automatic IDBFS persistence option has been selected, then automatically persist
+ // all modifications to the filesystem as they occur.
+ if (mount?.opts?.autoPersist) {
+ mnt.idbPersistState = 0;
+ // IndexedDB sync starts in idle state
+ var memfs_node_ops = mnt.node_ops;
+ mnt.node_ops = Object.assign({}, mnt.node_ops);
+ // Clone node_ops to inject write tracking
+ mnt.node_ops.mknod = (parent, name, mode, dev) => {
+ var node = memfs_node_ops.mknod(parent, name, mode, dev);
+ // Propagate injected node_ops to the newly created child node
+ node.node_ops = mnt.node_ops;
+ // Remember for each IDBFS node which IDBFS mount point they came from so we know which mount to persist on modification.
+ node.idbfs_mount = mnt.mount;
+ // Remember original MEMFS stream_ops for this node
+ node.memfs_stream_ops = node.stream_ops;
+ // Clone stream_ops to inject write tracking
+ node.stream_ops = Object.assign({}, node.stream_ops);
+ // Track all file writes
+ node.stream_ops.write = (stream, buffer, offset, length, position, canOwn) => {
+ // This file has been modified, we must persist IndexedDB when this file closes
+ stream.node.isModified = true;
+ return node.memfs_stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ };
+ // Persist IndexedDB on file close
+ node.stream_ops.close = stream => {
+ var n = stream.node;
+ if (n.isModified) {
+ IDBFS.queuePersist(n.idbfs_mount);
+ n.isModified = false;
+ }
+ if (n.memfs_stream_ops.close) return n.memfs_stream_ops.close(stream);
+ };
+ return node;
+ };
+ // Also kick off persisting the filesystem on other operations that modify the filesystem.
+ mnt.node_ops.mkdir = (...args) => (IDBFS.queuePersist(mnt.mount), memfs_node_ops.mkdir(...args));
+ mnt.node_ops.rmdir = (...args) => (IDBFS.queuePersist(mnt.mount), memfs_node_ops.rmdir(...args));
+ mnt.node_ops.symlink = (...args) => (IDBFS.queuePersist(mnt.mount), memfs_node_ops.symlink(...args));
+ mnt.node_ops.unlink = (...args) => (IDBFS.queuePersist(mnt.mount), memfs_node_ops.unlink(...args));
+ mnt.node_ops.rename = (...args) => (IDBFS.queuePersist(mnt.mount), memfs_node_ops.rename(...args));
+ }
+ return mnt;
+ },
+ syncfs: (mount, populate, callback) => {
+ IDBFS.getLocalSet(mount, (err, local) => {
+ if (err) return callback(err);
+ IDBFS.getRemoteSet(mount, (err, remote) => {
+ if (err) return callback(err);
+ var src = populate ? remote : local;
+ var dst = populate ? local : remote;
+ IDBFS.reconcile(src, dst, callback);
+ });
+ });
+ },
+ quit: () => {
+ Object.values(IDBFS.dbs).forEach(value => value.close());
+ IDBFS.dbs = {};
+ },
+ getDB: (name, callback) => {
+ // check the cache first
+ var db = IDBFS.dbs[name];
+ if (db) {
+ return callback(null, db);
+ }
+ var req;
+ try {
+ req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+ } catch (e) {
+ return callback(e);
+ }
+ if (!req) {
+ return callback("Unable to connect to IndexedDB");
+ }
+ req.onupgradeneeded = e => {
+ var db = /** @type {IDBDatabase} */ (e.target.result);
+ var transaction = e.target.transaction;
+ var fileStore;
+ if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+ fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ } else {
+ fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+ }
+ if (!fileStore.indexNames.contains("timestamp")) {
+ fileStore.createIndex("timestamp", "timestamp", {
+ unique: false
+ });
+ }
+ };
+ req.onsuccess = () => {
+ db = /** @type {IDBDatabase} */ (req.result);
+ // add to the cache
+ IDBFS.dbs[name] = db;
+ callback(null, db);
+ };
+ req.onerror = e => {
+ callback(e.target.error);
+ e.preventDefault();
+ };
+ },
+ getLocalSet: (mount, callback) => {
+ var entries = {};
+ function isRealDir(p) {
+ return p !== "." && p !== "..";
+ }
+ function toAbsolute(root) {
+ return p => PATH.join2(root, p);
+ }
+ var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+ while (check.length) {
+ var path = check.pop();
+ var stat;
+ try {
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+ if (FS.isDir(stat.mode)) {
+ check.push(...FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+ }
+ entries[path] = {
+ "timestamp": stat.mtime
+ };
+ }
+ return callback(null, {
+ type: "local",
+ entries
+ });
+ },
+ getRemoteSet: (mount, callback) => {
+ var entries = {};
+ IDBFS.getDB(mount.mountpoint, (err, db) => {
+ if (err) return callback(err);
+ try {
+ var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readonly");
+ transaction.onerror = e => {
+ callback(e.target.error);
+ e.preventDefault();
+ };
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ var index = store.index("timestamp");
+ index.openKeyCursor().onsuccess = event => {
+ var cursor = event.target.result;
+ if (!cursor) {
+ return callback(null, {
+ type: "remote",
+ db,
+ entries
+ });
+ }
+ entries[cursor.primaryKey] = {
+ "timestamp": cursor.key
+ };
+ cursor.continue();
+ };
+ } catch (e) {
+ return callback(e);
+ }
+ });
+ },
+ loadLocalEntry: (path, callback) => {
+ var stat, node;
+ try {
+ var lookup = FS.lookupPath(path);
+ node = lookup.node;
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+ if (FS.isDir(stat.mode)) {
+ return callback(null, {
+ "timestamp": stat.mtime,
+ "mode": stat.mode
+ });
+ } else if (FS.isFile(stat.mode)) {
+ // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
+ // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
+ node.contents = MEMFS.getFileDataAsTypedArray(node);
+ return callback(null, {
+ "timestamp": stat.mtime,
+ "mode": stat.mode,
+ "contents": node.contents
+ });
+ } else {
+ return callback(new Error("node type not supported"));
+ }
+ },
+ storeLocalEntry: (path, entry, callback) => {
+ try {
+ if (FS.isDir(entry["mode"])) {
+ FS.mkdirTree(path, entry["mode"]);
+ } else if (FS.isFile(entry["mode"])) {
+ FS.writeFile(path, entry["contents"], {
+ canOwn: true
+ });
+ } else {
+ return callback(new Error("node type not supported"));
+ }
+ FS.chmod(path, entry["mode"]);
+ FS.utime(path, entry["timestamp"], entry["timestamp"]);
+ } catch (e) {
+ return callback(e);
+ }
+ callback(null);
+ },
+ removeLocalEntry: (path, callback) => {
+ try {
+ var stat = FS.stat(path);
+ if (FS.isDir(stat.mode)) {
+ FS.rmdir(path);
+ } else if (FS.isFile(stat.mode)) {
+ FS.unlink(path);
+ }
+ } catch (e) {
+ return callback(e);
+ }
+ callback(null);
+ },
+ loadRemoteEntry: (store, path, callback) => {
+ var req = store.get(path);
+ req.onsuccess = event => callback(null, event.target.result);
+ req.onerror = e => {
+ callback(e.target.error);
+ e.preventDefault();
+ };
+ },
+ storeRemoteEntry: (store, path, entry, callback) => {
+ try {
+ var req = store.put(entry, path);
+ } catch (e) {
+ callback(e);
+ return;
+ }
+ req.onsuccess = event => callback();
+ req.onerror = e => {
+ callback(e.target.error);
+ e.preventDefault();
+ };
+ },
+ removeRemoteEntry: (store, path, callback) => {
+ var req = store.delete(path);
+ req.onsuccess = event => callback();
+ req.onerror = e => {
+ callback(e.target.error);
+ e.preventDefault();
+ };
+ },
+ reconcile: (src, dst, callback) => {
+ var total = 0;
+ var create = [];
+ Object.keys(src.entries).forEach(key => {
+ var e = src.entries[key];
+ var e2 = dst.entries[key];
+ if (!e2 || e["timestamp"].getTime() != e2["timestamp"].getTime()) {
+ create.push(key);
+ total++;
+ }
+ });
+ var remove = [];
+ Object.keys(dst.entries).forEach(key => {
+ if (!src.entries[key]) {
+ remove.push(key);
+ total++;
+ }
+ });
+ if (!total) {
+ return callback(null);
+ }
+ var errored = false;
+ var db = src.type === "remote" ? src.db : dst.db;
+ var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readwrite");
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ function done(err) {
+ if (err && !errored) {
+ errored = true;
+ return callback(err);
+ }
+ }
+ // transaction may abort if (for example) there is a QuotaExceededError
+ transaction.onerror = transaction.onabort = e => {
+ done(e.target.error);
+ e.preventDefault();
+ };
+ transaction.oncomplete = e => {
+ if (!errored) {
+ callback(null);
+ }
+ };
+ // sort paths in ascending order so directory entries are created
+ // before the files inside them
+ create.sort().forEach(path => {
+ if (dst.type === "local") {
+ IDBFS.loadRemoteEntry(store, path, (err, entry) => {
+ if (err) return done(err);
+ IDBFS.storeLocalEntry(path, entry, done);
+ });
+ } else {
+ IDBFS.loadLocalEntry(path, (err, entry) => {
+ if (err) return done(err);
+ IDBFS.storeRemoteEntry(store, path, entry, done);
+ });
+ }
+ });
+ // sort paths in descending order so files are deleted before their
+ // parent directories
+ remove.sort().reverse().forEach(path => {
+ if (dst.type === "local") {
+ IDBFS.removeLocalEntry(path, done);
+ } else {
+ IDBFS.removeRemoteEntry(store, path, done);
+ }
+ });
+ }
+};
+
+var FS = {
+ root: null,
+ mounts: [],
+ devices: {},
+ streams: [],
+ nextInode: 1,
+ nameTable: null,
+ currentPath: "/",
+ initialized: false,
+ ignorePermissions: true,
+ ErrnoError: class {
+ name="ErrnoError";
+ // We set the `name` property to be able to identify `FS.ErrnoError`
+ // - the `name` is a standard ECMA-262 property of error objects. Kind of good to have it anyway.
+ // - when using PROXYFS, an error can come from an underlying FS
+ // as different FS objects have their own FS.ErrnoError each,
+ // the test `err instanceof FS.ErrnoError` won't detect an error coming from another filesystem, causing bugs.
+ // we'll use the reliable test `err.name == "ErrnoError"` instead
+ constructor(errno) {
+ this.errno = errno;
+ }
+ },
+ filesystems: null,
+ syncFSRequests: 0,
+ readFiles: {},
+ FSStream: class {
+ shared={};
+ get object() {
+ return this.node;
+ }
+ set object(val) {
+ this.node = val;
+ }
+ get isRead() {
+ return (this.flags & 2097155) !== 1;
+ }
+ get isWrite() {
+ return (this.flags & 2097155) !== 0;
+ }
+ get isAppend() {
+ return (this.flags & 1024);
+ }
+ get flags() {
+ return this.shared.flags;
+ }
+ set flags(val) {
+ this.shared.flags = val;
+ }
+ get position() {
+ return this.shared.position;
+ }
+ set position(val) {
+ this.shared.position = val;
+ }
+ },
+ FSNode: class {
+ node_ops={};
+ stream_ops={};
+ readMode=292 | 73;
+ writeMode=146;
+ mounted=null;
+ constructor(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this;
+ }
+ // root node sets parent to itself
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.rdev = rdev;
+ }
+ get read() {
+ return (this.mode & this.readMode) === this.readMode;
+ }
+ set read(val) {
+ val ? this.mode |= this.readMode : this.mode &= ~this.readMode;
+ }
+ get write() {
+ return (this.mode & this.writeMode) === this.writeMode;
+ }
+ set write(val) {
+ val ? this.mode |= this.writeMode : this.mode &= ~this.writeMode;
+ }
+ get isFolder() {
+ return FS.isDir(this.mode);
+ }
+ get isDevice() {
+ return FS.isChrdev(this.mode);
+ }
+ },
+ lookupPath(path, opts = {}) {
+ path = PATH_FS.resolve(path);
+ if (!path) return {
+ path: "",
+ node: null
+ };
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ opts = Object.assign(defaults, opts);
+ if (opts.recurse_count > 8) {
+ // max recursive lookup of 8
+ throw new FS.ErrnoError(32);
+ }
+ // split the absolute path
+ var parts = path.split("/").filter(p => !!p);
+ // start at the root
+ var current = FS.root;
+ var current_path = "/";
+ for (var i = 0; i < parts.length; i++) {
+ var islast = (i === parts.length - 1);
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current)) {
+ if (!islast || (islast && opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+ }
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
+ var lookup = FS.lookupPath(current_path, {
+ recurse_count: opts.recurse_count + 1
+ });
+ current = lookup.node;
+ if (count++ > 40) {
+ // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ throw new FS.ErrnoError(32);
+ }
+ }
+ }
+ }
+ return {
+ path: current_path,
+ node: current
+ };
+ },
+ getPath(node) {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length - 1] !== "/" ? `${mount}/${path}` : mount + path;
+ }
+ path = path ? `${node.name}/${path}` : node.name;
+ node = node.parent;
+ }
+ },
+ hashName(parentid, name) {
+ var hash = 0;
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },
+ hashAddNode(node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },
+ hashRemoveNode(node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },
+ lookupNode(parent, name) {
+ var errCode = FS.mayLookup(parent);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },
+ createNode(parent, name, mode, rdev) {
+ var node = new FS.FSNode(parent, name, mode, rdev);
+ FS.hashAddNode(node);
+ return node;
+ },
+ destroyNode(node) {
+ FS.hashRemoveNode(node);
+ },
+ isRoot(node) {
+ return node === node.parent;
+ },
+ isMountpoint(node) {
+ return !!node.mounted;
+ },
+ isFile(mode) {
+ return (mode & 61440) === 32768;
+ },
+ isDir(mode) {
+ return (mode & 61440) === 16384;
+ },
+ isLink(mode) {
+ return (mode & 61440) === 40960;
+ },
+ isChrdev(mode) {
+ return (mode & 61440) === 8192;
+ },
+ isBlkdev(mode) {
+ return (mode & 61440) === 24576;
+ },
+ isFIFO(mode) {
+ return (mode & 61440) === 4096;
+ },
+ isSocket(mode) {
+ return (mode & 49152) === 49152;
+ },
+ flagsToPermissionString(flag) {
+ var perms = [ "r", "w", "rw" ][flag & 3];
+ if ((flag & 512)) {
+ perms += "w";
+ }
+ return perms;
+ },
+ nodePermissions(node, perms) {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.includes("r") && !(node.mode & 292)) {
+ return 2;
+ } else if (perms.includes("w") && !(node.mode & 146)) {
+ return 2;
+ } else if (perms.includes("x") && !(node.mode & 73)) {
+ return 2;
+ }
+ return 0;
+ },
+ mayLookup(dir) {
+ if (!FS.isDir(dir.mode)) return 54;
+ var errCode = FS.nodePermissions(dir, "x");
+ if (errCode) return errCode;
+ if (!dir.node_ops.lookup) return 2;
+ return 0;
+ },
+ mayCreate(dir, name) {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return 20;
+ } catch (e) {}
+ return FS.nodePermissions(dir, "wx");
+ },
+ mayDelete(dir, name, isdir) {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var errCode = FS.nodePermissions(dir, "wx");
+ if (errCode) {
+ return errCode;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return 54;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return 10;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return 31;
+ }
+ }
+ return 0;
+ },
+ mayOpen(node, flags) {
+ if (!node) {
+ return 44;
+ }
+ if (FS.isLink(node.mode)) {
+ return 32;
+ } else if (FS.isDir(node.mode)) {
+ if (FS.flagsToPermissionString(flags) !== "r" || // opening for write
+ (flags & 512)) {
+ // TODO: check for O_SEARCH? (== search for dir only)
+ return 31;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },
+ MAX_OPEN_FDS: 4096,
+ nextfd() {
+ for (var fd = 0; fd <= FS.MAX_OPEN_FDS; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(33);
+ },
+ getStreamChecked(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ return stream;
+ },
+ getStream: fd => FS.streams[fd],
+ createStream(stream, fd = -1) {
+ // clone it, so we can return an instance of FSStream
+ stream = Object.assign(new FS.FSStream, stream);
+ if (fd == -1) {
+ fd = FS.nextfd();
+ }
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },
+ closeStream(fd) {
+ FS.streams[fd] = null;
+ },
+ dupStream(origStream, fd = -1) {
+ var stream = FS.createStream(origStream, fd);
+ stream.stream_ops?.dup?.(stream);
+ return stream;
+ },
+ chrdev_stream_ops: {
+ open(stream) {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ stream.stream_ops.open?.(stream);
+ },
+ llseek() {
+ throw new FS.ErrnoError(70);
+ }
+ },
+ major: dev => ((dev) >> 8),
+ minor: dev => ((dev) & 255),
+ makedev: (ma, mi) => ((ma) << 8 | (mi)),
+ registerDevice(dev, ops) {
+ FS.devices[dev] = {
+ stream_ops: ops
+ };
+ },
+ getDevice: dev => FS.devices[dev],
+ getMounts(mount) {
+ var mounts = [];
+ var check = [ mount ];
+ while (check.length) {
+ var m = check.pop();
+ mounts.push(m);
+ check.push(...m.mounts);
+ }
+ return mounts;
+ },
+ syncfs(populate, callback) {
+ if (typeof populate == "function") {
+ callback = populate;
+ populate = false;
+ }
+ FS.syncFSRequests++;
+ if (FS.syncFSRequests > 1) {
+ err(`warning: ${FS.syncFSRequests} FS.syncfs operations in flight at once, probably just doing extra work`);
+ }
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+ function doCallback(errCode) {
+ FS.syncFSRequests--;
+ return callback(errCode);
+ }
+ function done(errCode) {
+ if (errCode) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(errCode);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ }
+ // sync all mounts
+ mounts.forEach(mount => {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },
+ mount(type, opts, mountpoint) {
+ var root = mountpoint === "/";
+ var pseudo = !mountpoint;
+ var node;
+ if (root && FS.root) {
+ throw new FS.ErrnoError(10);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, {
+ follow_mount: false
+ });
+ mountpoint = lookup.path;
+ // use the absolute path
+ node = lookup.node;
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ }
+ var mount = {
+ type,
+ opts,
+ mountpoint,
+ mounts: []
+ };
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+ return mountRoot;
+ },
+ unmount(mountpoint) {
+ var lookup = FS.lookupPath(mountpoint, {
+ follow_mount: false
+ });
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(28);
+ }
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+ Object.keys(FS.nameTable).forEach(hash => {
+ var current = FS.nameTable[hash];
+ while (current) {
+ var next = current.name_next;
+ if (mounts.includes(current.mount)) {
+ FS.destroyNode(current);
+ }
+ current = next;
+ }
+ });
+ // no longer a mountpoint
+ node.mounted = null;
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ node.mount.mounts.splice(idx, 1);
+ },
+ lookup(parent, name) {
+ return parent.node_ops.lookup(parent, name);
+ },
+ mknod(path, mode, dev) {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === "." || name === "..") {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.mayCreate(parent, name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },
+ statfs(path) {
+ // NOTE: None of the defaults here are true. We're just returning safe and
+ // sane values.
+ var rtn = {
+ bsize: 4096,
+ frsize: 4096,
+ blocks: 1e6,
+ bfree: 5e5,
+ bavail: 5e5,
+ files: FS.nextInode,
+ ffree: FS.nextInode - 1,
+ fsid: 42,
+ flags: 2,
+ namelen: 255
+ };
+ var parent = FS.lookupPath(path, {
+ follow: true
+ }).node;
+ if (parent?.node_ops.statfs) {
+ Object.assign(rtn, parent.node_ops.statfs(parent.mount.opts.root));
+ }
+ return rtn;
+ },
+ create(path, mode = 438) {
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdir(path, mode = 511) {
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },
+ mkdirTree(path, mode) {
+ var dirs = path.split("/");
+ var d = "";
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += "/" + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch (e) {
+ if (e.errno != 20) throw e;
+ }
+ }
+ },
+ mkdev(path, mode, dev) {
+ if (typeof dev == "undefined") {
+ dev = mode;
+ mode = 438;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },
+ symlink(oldpath, newpath) {
+ if (!PATH_FS.resolve(oldpath)) {
+ throw new FS.ErrnoError(44);
+ }
+ var lookup = FS.lookupPath(newpath, {
+ parent: true
+ });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var newname = PATH.basename(newpath);
+ var errCode = FS.mayCreate(parent, newname);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },
+ rename(old_path, new_path) {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+ // let the errors from non existent directories percolate up
+ lookup = FS.lookupPath(old_path, {
+ parent: true
+ });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, {
+ parent: true
+ });
+ new_dir = lookup.node;
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(75);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH_FS.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== ".") {
+ throw new FS.ErrnoError(28);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH_FS.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== ".") {
+ throw new FS.ErrnoError(55);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {}
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var errCode = FS.mayDelete(old_dir, old_name, isdir);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ errCode = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+ throw new FS.ErrnoError(10);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ errCode = FS.nodePermissions(old_dir, "w");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ // update old node (we do this here to avoid each backend
+ // needing to)
+ old_node.parent = new_dir;
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ },
+ rmdir(path) {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, true);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ },
+ readdir(path) {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(54);
+ }
+ return node.node_ops.readdir(node);
+ },
+ unlink(path) {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, false);
+ if (errCode) {
+ // According to POSIX, we should map EISDIR to EPERM, but
+ // we instead do what Linux does (and we must, as we use
+ // the musl linux libc).
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ },
+ readlink(path) {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(28);
+ }
+ return link.node_ops.readlink(link);
+ },
+ stat(path, dontFollow) {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontFollow
+ });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(63);
+ }
+ return node.node_ops.getattr(node);
+ },
+ lstat(path) {
+ return FS.stat(path, true);
+ },
+ chmod(path, mode, dontFollow) {
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontFollow
+ });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ timestamp: Date.now()
+ });
+ },
+ lchmod(path, mode) {
+ FS.chmod(path, mode, true);
+ },
+ fchmod(fd, mode) {
+ var stream = FS.getStreamChecked(fd);
+ FS.chmod(stream.node, mode);
+ },
+ chown(path, uid, gid, dontFollow) {
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontFollow
+ });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ });
+ },
+ // we ignore the uid / gid for now
+ lchown(path, uid, gid) {
+ FS.chown(path, uid, gid, true);
+ },
+ fchown(fd, uid, gid) {
+ var stream = FS.getStreamChecked(fd);
+ FS.chown(stream.node, uid, gid);
+ },
+ truncate(path, len) {
+ if (len < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ var node;
+ if (typeof path == "string") {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.nodePermissions(node, "w");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },
+ ftruncate(fd, len) {
+ var stream = FS.getStreamChecked(fd);
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(28);
+ }
+ FS.truncate(stream.node, len);
+ },
+ utime(path, atime, mtime) {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },
+ open(path, flags, mode = 438) {
+ if (path === "") {
+ throw new FS.ErrnoError(44);
+ }
+ flags = typeof flags == "string" ? FS_modeStringToFlags(flags) : flags;
+ if ((flags & 64)) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path == "object") {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {}
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if ((flags & 64)) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if ((flags & 128)) {
+ throw new FS.ErrnoError(20);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if ((flags & 65536) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var errCode = FS.mayOpen(node, flags);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // do truncation if necessary
+ if ((flags & 512) && !created) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512 | 131072);
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node,
+ path: FS.getPath(node),
+ // we want the absolute path to the node
+ flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false
+ });
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module["logReadFiles"] && !(flags & 1)) {
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ }
+ }
+ return stream;
+ },
+ close(stream) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (stream.getdents) stream.getdents = null;
+ // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ stream.fd = null;
+ },
+ isClosed(stream) {
+ return stream.fd === null;
+ },
+ llseek(stream, offset, whence) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(70);
+ }
+ if (whence != 0 && whence != 1 && whence != 2) {
+ throw new FS.ErrnoError(28);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },
+ read(stream, buffer, offset, length, position) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(28);
+ }
+ var seeking = typeof position != "undefined";
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, position, canOwn) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(28);
+ }
+ if (stream.seekable && stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = typeof position != "undefined";
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ return bytesWritten;
+ },
+ allocate(stream, offset, length) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(138);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },
+ mmap(stream, length, position, prot, flags) {
+ // User requests writing to file (prot & PROT_WRITE != 0).
+ // Checking if we have permissions to write to the file unless
+ // MAP_PRIVATE flag is set. According to POSIX spec it is possible
+ // to write to file opened in read-only mode with MAP_PRIVATE flag,
+ // as all modifications will be visible only in the memory of
+ // the current process.
+ if ((prot & 2) !== 0 && (flags & 2) === 0 && (stream.flags & 2097155) !== 2) {
+ throw new FS.ErrnoError(2);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(2);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(43);
+ }
+ if (!length) {
+ throw new FS.ErrnoError(28);
+ }
+ return stream.stream_ops.mmap(stream, length, position, prot, flags);
+ },
+ msync(stream, buffer, offset, length, mmapFlags) {
+ if (!stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },
+ ioctl(stream, cmd, arg) {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(59);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },
+ readFile(path, opts = {}) {
+ opts.flags = opts.flags || 0;
+ opts.encoding = opts.encoding || "binary";
+ if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
+ throw new Error(`Invalid encoding type "${opts.encoding}"`);
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === "utf8") {
+ ret = UTF8ArrayToString(buf);
+ } else if (opts.encoding === "binary") {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },
+ writeFile(path, data, opts = {}) {
+ opts.flags = opts.flags || 577;
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (typeof data == "string") {
+ var buf = new Uint8Array(lengthBytesUTF8(data) + 1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+ } else if (ArrayBuffer.isView(data)) {
+ FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+ } else {
+ throw new Error("Unsupported data type");
+ }
+ FS.close(stream);
+ },
+ cwd: () => FS.currentPath,
+ chdir(path) {
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ var errCode = FS.nodePermissions(lookup.node, "x");
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ FS.currentPath = lookup.path;
+ },
+ createDefaultDirectories() {
+ FS.mkdir("/tmp");
+ FS.mkdir("/home");
+ FS.mkdir("/home/web_user");
+ },
+ createDefaultDevices() {
+ // create /dev
+ FS.mkdir("/dev");
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: () => 0,
+ write: (stream, buffer, offset, length, pos) => length,
+ llseek: () => 0
+ });
+ FS.mkdev("/dev/null", FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using err() rather than out()
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev("/dev/tty", FS.makedev(5, 0));
+ FS.mkdev("/dev/tty1", FS.makedev(6, 0));
+ // setup /dev/[u]random
+ // use a buffer to avoid overhead of individual crypto calls per byte
+ var randomBuffer = new Uint8Array(1024), randomLeft = 0;
+ var randomByte = () => {
+ if (randomLeft === 0) {
+ randomLeft = randomFill(randomBuffer).byteLength;
+ }
+ return randomBuffer[--randomLeft];
+ };
+ FS.createDevice("/dev", "random", randomByte);
+ FS.createDevice("/dev", "urandom", randomByte);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir("/dev/shm");
+ FS.mkdir("/dev/shm/tmp");
+ },
+ createSpecialDirectories() {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the
+ // name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir("/proc");
+ var proc_self = FS.mkdir("/proc/self");
+ FS.mkdir("/proc/self/fd");
+ FS.mount({
+ mount() {
+ var node = FS.createNode(proc_self, "fd", 16895, 73);
+ node.node_ops = {
+ lookup(parent, name) {
+ var fd = +name;
+ var stream = FS.getStreamChecked(fd);
+ var ret = {
+ parent: null,
+ mount: {
+ mountpoint: "fake"
+ },
+ node_ops: {
+ readlink: () => stream.path
+ }
+ };
+ ret.parent = ret;
+ // make it look like a simple root node
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, "/proc/self/fd");
+ },
+ createStandardStreams(input, output, error) {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (input) {
+ FS.createDevice("/dev", "stdin", input);
+ } else {
+ FS.symlink("/dev/tty", "/dev/stdin");
+ }
+ if (output) {
+ FS.createDevice("/dev", "stdout", null, output);
+ } else {
+ FS.symlink("/dev/tty", "/dev/stdout");
+ }
+ if (error) {
+ FS.createDevice("/dev", "stderr", null, error);
+ } else {
+ FS.symlink("/dev/tty1", "/dev/stderr");
+ }
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open("/dev/stdin", 0);
+ var stdout = FS.open("/dev/stdout", 1);
+ var stderr = FS.open("/dev/stderr", 1);
+ },
+ staticInit() {
+ FS.nameTable = new Array(4096);
+ FS.mount(MEMFS, {}, "/");
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+ FS.filesystems = {
+ "MEMFS": MEMFS,
+ "IDBFS": IDBFS
+ };
+ },
+ init(input, output, error) {
+ FS.initialized = true;
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ input ??= Module["stdin"];
+ output ??= Module["stdout"];
+ error ??= Module["stderr"];
+ FS.createStandardStreams(input, output, error);
+ },
+ quit() {
+ FS.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },
+ findObject(path, dontResolveLastLink) {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (!ret.exists) {
+ return null;
+ }
+ return ret.object;
+ },
+ analyzePath(path, dontResolveLastLink) {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !dontResolveLastLink
+ });
+ path = lookup.path;
+ } catch (e) {}
+ var ret = {
+ isRoot: false,
+ exists: false,
+ error: 0,
+ name: null,
+ path: null,
+ object: null,
+ parentExists: false,
+ parentPath: null,
+ parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, {
+ parent: true
+ });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, {
+ follow: !dontResolveLastLink
+ });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === "/";
+ } catch (e) {
+ ret.error = e.errno;
+ }
+ return ret;
+ },
+ createPath(parent, path, canRead, canWrite) {
+ parent = typeof parent == "string" ? parent : FS.getPath(parent);
+ var parts = path.split("/").reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {}
+ // ignore EEXIST
+ parent = current;
+ }
+ return current;
+ },
+ createFile(parent, name, properties, canRead, canWrite) {
+ var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name);
+ var mode = FS_getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },
+ createDataFile(parent, name, data, canRead, canWrite, canOwn) {
+ var path = name;
+ if (parent) {
+ parent = typeof parent == "string" ? parent : FS.getPath(parent);
+ path = name ? PATH.join2(parent, name) : parent;
+ }
+ var mode = FS_getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data == "string") {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 577);
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ },
+ createDevice(parent, name, input, output) {
+ var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name);
+ var mode = FS_getMode(!!input, !!output);
+ FS.createDevice.major ??= 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open(stream) {
+ stream.seekable = false;
+ },
+ close(stream) {
+ // flush any pending line data
+ if (output?.buffer?.length) {
+ output(10);
+ }
+ },
+ read(stream, buffer, offset, length, pos) {
+ /* ignored */ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset + i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write(stream, buffer, offset, length, pos) {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset + i]);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },
+ forceLoadFile(obj) {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ if (typeof XMLHttpRequest != "undefined") {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else {
+ // Command-line.
+ try {
+ obj.contents = readBinary(obj.url);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ }
+ },
+ createLazyFile(parent, name, url, canRead, canWrite) {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array).
+ // Actual getting is abstracted away for eventual reuse.
+ class LazyUint8Array {
+ lengthKnown=false;
+ chunks=[];
+ // Loaded chunks. Index is the chunk number
+ get(idx) {
+ if (idx > this.length - 1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize) | 0;
+ return this.getter(chunkNum)[chunkOffset];
+ }
+ setDataGetter(getter) {
+ this.getter = getter;
+ }
+ cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest;
+ xhr.open("HEAD", url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+ var chunkSize = 1024 * 1024;
+ // Chunk size in bytes
+ if (!hasByteServing) chunkSize = datalength;
+ // Function to get a range from the remote URL.
+ var doXHR = (from, to) => {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!");
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest;
+ xhr.open("GET", url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+ // Some hints to the browser that we want binary data.
+ xhr.responseType = "arraybuffer";
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType("text/plain; charset=x-user-defined");
+ }
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(/** @type{Array} */ (xhr.response || []));
+ }
+ return intArrayFromString(xhr.responseText || "", true);
+ };
+ var lazyArray = this;
+ lazyArray.setDataGetter(chunkNum => {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum + 1) * chunkSize - 1;
+ // including this byte
+ end = Math.min(end, datalength - 1);
+ // if datalength-1 is selected, this is the last block
+ if (typeof lazyArray.chunks[chunkNum] == "undefined") {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof lazyArray.chunks[chunkNum] == "undefined") throw new Error("doXHR failed!");
+ return lazyArray.chunks[chunkNum];
+ });
+ if (usesGzip || !datalength) {
+ // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+ chunkSize = datalength = 1;
+ // this will force getter(0)/doXHR do download the whole file
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ out("LazyFiles on gzip forces download of the whole file when length is accessed");
+ }
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ }
+ get length() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ get chunkSize() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+ if (typeof XMLHttpRequest != "undefined") {
+ if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";
+ var lazyArray = new LazyUint8Array;
+ var properties = {
+ isDevice: false,
+ contents: lazyArray
+ };
+ } else {
+ var properties = {
+ isDevice: false,
+ url
+ };
+ }
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: function() {
+ return this.contents.length;
+ }
+ }
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach(key => {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = (...args) => {
+ FS.forceLoadFile(node);
+ return fn(...args);
+ };
+ });
+ function writeChunks(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= contents.length) return 0;
+ var size = Math.min(contents.length - position, length);
+ if (contents.slice) {
+ // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) {
+ // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ }
+ // use a custom read function
+ stream_ops.read = (stream, buffer, offset, length, position) => {
+ FS.forceLoadFile(node);
+ return writeChunks(stream, buffer, offset, length, position);
+ };
+ // use a custom mmap function
+ stream_ops.mmap = (stream, length, position, prot, flags) => {
+ FS.forceLoadFile(node);
+ var ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ writeChunks(stream, GROWABLE_HEAP_I8(), ptr, length, position);
+ return {
+ ptr,
+ allocated: true
+ };
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ }
+};
+
+var SYSCALLS = {
+ DEFAULT_POLLMASK: 5,
+ calculateAt(dirfd, path, allowEmpty) {
+ if (PATH.isAbs(path)) {
+ return path;
+ }
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = SYSCALLS.getStreamFromFD(dirfd);
+ dir = dirstream.path;
+ }
+ if (path.length == 0) {
+ if (!allowEmpty) {
+ throw new FS.ErrnoError(44);
+ }
+ return dir;
+ }
+ return PATH.join2(dir, path);
+ },
+ doStat(func, path, buf) {
+ var stat = func(path);
+ GROWABLE_HEAP_I32()[((buf) >> 2)] = stat.dev;
+ GROWABLE_HEAP_I32()[(((buf) + (4)) >> 2)] = stat.mode;
+ GROWABLE_HEAP_U32()[(((buf) + (8)) >> 2)] = stat.nlink;
+ GROWABLE_HEAP_I32()[(((buf) + (12)) >> 2)] = stat.uid;
+ GROWABLE_HEAP_I32()[(((buf) + (16)) >> 2)] = stat.gid;
+ GROWABLE_HEAP_I32()[(((buf) + (20)) >> 2)] = stat.rdev;
+ (tempI64 = [ stat.size >>> 0, (tempDouble = stat.size, (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[(((buf) + (24)) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((buf) + (28)) >> 2)] = tempI64[1]);
+ GROWABLE_HEAP_I32()[(((buf) + (32)) >> 2)] = 4096;
+ GROWABLE_HEAP_I32()[(((buf) + (36)) >> 2)] = stat.blocks;
+ var atime = stat.atime.getTime();
+ var mtime = stat.mtime.getTime();
+ var ctime = stat.ctime.getTime();
+ (tempI64 = [ Math.floor(atime / 1e3) >>> 0, (tempDouble = Math.floor(atime / 1e3),
+ (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[(((buf) + (40)) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((buf) + (44)) >> 2)] = tempI64[1]);
+ GROWABLE_HEAP_U32()[(((buf) + (48)) >> 2)] = (atime % 1e3) * 1e3 * 1e3;
+ (tempI64 = [ Math.floor(mtime / 1e3) >>> 0, (tempDouble = Math.floor(mtime / 1e3),
+ (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[(((buf) + (56)) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((buf) + (60)) >> 2)] = tempI64[1]);
+ GROWABLE_HEAP_U32()[(((buf) + (64)) >> 2)] = (mtime % 1e3) * 1e3 * 1e3;
+ (tempI64 = [ Math.floor(ctime / 1e3) >>> 0, (tempDouble = Math.floor(ctime / 1e3),
+ (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[(((buf) + (72)) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((buf) + (76)) >> 2)] = tempI64[1]);
+ GROWABLE_HEAP_U32()[(((buf) + (80)) >> 2)] = (ctime % 1e3) * 1e3 * 1e3;
+ (tempI64 = [ stat.ino >>> 0, (tempDouble = stat.ino, (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[(((buf) + (88)) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((buf) + (92)) >> 2)] = tempI64[1]);
+ return 0;
+ },
+ doMsync(addr, stream, len, flags, offset) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (flags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+ var buffer = GROWABLE_HEAP_U8().slice(addr, addr + len);
+ FS.msync(stream, buffer, offset, len, flags);
+ },
+ getStreamFromFD(fd) {
+ var stream = FS.getStreamChecked(fd);
+ return stream;
+ },
+ varargs: undefined,
+ getStr(ptr) {
+ var ret = UTF8ToString(ptr);
+ return ret;
+ }
+};
+
+function ___syscall_faccessat(dirfd, path, amode, flags) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(3, 0, 1, dirfd, path, amode, flags);
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (amode & ~7) {
+ // need a valid mode
+ return -28;
+ }
+ var lookup = FS.lookupPath(path, {
+ follow: true
+ });
+ var node = lookup.node;
+ if (!node) {
+ return -44;
+ }
+ var perms = "";
+ if (amode & 4) perms += "r";
+ if (amode & 2) perms += "w";
+ if (amode & 1) perms += "x";
+ if (perms && /* otherwise, they've just passed F_OK */ FS.nodePermissions(node, perms)) {
+ return -2;
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+/** @suppress {duplicate } */ var syscallGetVarargI = () => {
+ // the `+` prepended here is necessary to convince the JSCompiler that varargs is indeed a number.
+ var ret = GROWABLE_HEAP_I32()[((+SYSCALLS.varargs) >> 2)];
+ SYSCALLS.varargs += 4;
+ return ret;
+};
+
+var syscallGetVarargP = syscallGetVarargI;
+
+function ___syscall_fcntl64(fd, cmd, varargs) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(4, 0, 1, fd, cmd, varargs);
+ SYSCALLS.varargs = varargs;
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (cmd) {
+ case 0:
+ {
+ var arg = syscallGetVarargI();
+ if (arg < 0) {
+ return -28;
+ }
+ while (FS.streams[arg]) {
+ arg++;
+ }
+ var newStream;
+ newStream = FS.dupStream(stream, arg);
+ return newStream.fd;
+ }
+
+ case 1:
+ case 2:
+ return 0;
+
+ // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+
+ case 4:
+ {
+ var arg = syscallGetVarargI();
+ stream.flags |= arg;
+ return 0;
+ }
+
+ case 12:
+ {
+ var arg = syscallGetVarargP();
+ var offset = 0;
+ // We're always unlocked.
+ GROWABLE_HEAP_I16()[(((arg) + (offset)) >> 1)] = 2;
+ return 0;
+ }
+
+ case 13:
+ case 14:
+ return 0;
+ }
+ // Pretend that the locking is successful.
+ return -28;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_fstat64(fd, buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(5, 0, 1, fd, buf);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ return SYSCALLS.doStat(FS.stat, stream.path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_ftruncate64(fd, length_low, length_high) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(6, 0, 1, fd, length_low, length_high);
+ var length = convertI32PairToI53Checked(length_low, length_high);
+ try {
+ if (isNaN(length)) return 61;
+ FS.ftruncate(fd, length);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var stringToUTF8 = (str, outPtr, maxBytesToWrite) => stringToUTF8Array(str, GROWABLE_HEAP_U8(), outPtr, maxBytesToWrite);
+
+function ___syscall_getdents64(fd, dirp, count) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(7, 0, 1, fd, dirp, count);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ stream.getdents ||= FS.readdir(stream.path);
+ var struct_size = 280;
+ var pos = 0;
+ var off = FS.llseek(stream, 0, 1);
+ var idx = Math.floor(off / struct_size);
+ while (idx < stream.getdents.length && pos + struct_size <= count) {
+ var id;
+ var type;
+ var name = stream.getdents[idx];
+ if (name === ".") {
+ id = stream.node.id;
+ type = 4;
+ } else // DT_DIR
+ if (name === "..") {
+ var lookup = FS.lookupPath(stream.path, {
+ parent: true
+ });
+ id = lookup.node.id;
+ type = 4;
+ } else // DT_DIR
+ {
+ var child = FS.lookupNode(stream.node, name);
+ id = child.id;
+ type = FS.isChrdev(child.mode) ? 2 : // DT_CHR, character device.
+ FS.isDir(child.mode) ? 4 : // DT_DIR, directory.
+ FS.isLink(child.mode) ? 10 : // DT_LNK, symbolic link.
+ 8;
+ }
+ // DT_REG, regular file.
+ (tempI64 = [ id >>> 0, (tempDouble = id, (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[((dirp + pos) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((dirp + pos) + (4)) >> 2)] = tempI64[1]);
+ (tempI64 = [ (idx + 1) * struct_size >>> 0, (tempDouble = (idx + 1) * struct_size,
+ (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[(((dirp + pos) + (8)) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((dirp + pos) + (12)) >> 2)] = tempI64[1]);
+ GROWABLE_HEAP_I16()[(((dirp + pos) + (16)) >> 1)] = 280;
+ GROWABLE_HEAP_I8()[(dirp + pos) + (18)] = type;
+ stringToUTF8(name, dirp + pos + 19, 256);
+ pos += struct_size;
+ idx += 1;
+ }
+ FS.llseek(stream, idx * struct_size, 0);
+ return pos;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_ioctl(fd, op, varargs) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(8, 0, 1, fd, op, varargs);
+ SYSCALLS.varargs = varargs;
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (op) {
+ case 21509:
+ {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ case 21505:
+ {
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tcgets) {
+ var termios = stream.tty.ops.ioctl_tcgets(stream);
+ var argp = syscallGetVarargP();
+ GROWABLE_HEAP_I32()[((argp) >> 2)] = termios.c_iflag || 0;
+ GROWABLE_HEAP_I32()[(((argp) + (4)) >> 2)] = termios.c_oflag || 0;
+ GROWABLE_HEAP_I32()[(((argp) + (8)) >> 2)] = termios.c_cflag || 0;
+ GROWABLE_HEAP_I32()[(((argp) + (12)) >> 2)] = termios.c_lflag || 0;
+ for (var i = 0; i < 32; i++) {
+ GROWABLE_HEAP_I8()[(argp + i) + (17)] = termios.c_cc[i] || 0;
+ }
+ return 0;
+ }
+ return 0;
+ }
+
+ case 21510:
+ case 21511:
+ case 21512:
+ {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ // no-op, not actually adjusting terminal settings
+ case 21506:
+ case 21507:
+ case 21508:
+ {
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tcsets) {
+ var argp = syscallGetVarargP();
+ var c_iflag = GROWABLE_HEAP_I32()[((argp) >> 2)];
+ var c_oflag = GROWABLE_HEAP_I32()[(((argp) + (4)) >> 2)];
+ var c_cflag = GROWABLE_HEAP_I32()[(((argp) + (8)) >> 2)];
+ var c_lflag = GROWABLE_HEAP_I32()[(((argp) + (12)) >> 2)];
+ var c_cc = [];
+ for (var i = 0; i < 32; i++) {
+ c_cc.push(GROWABLE_HEAP_I8()[(argp + i) + (17)]);
+ }
+ return stream.tty.ops.ioctl_tcsets(stream.tty, op, {
+ c_iflag,
+ c_oflag,
+ c_cflag,
+ c_lflag,
+ c_cc
+ });
+ }
+ return 0;
+ }
+
+ // no-op, not actually adjusting terminal settings
+ case 21519:
+ {
+ if (!stream.tty) return -59;
+ var argp = syscallGetVarargP();
+ GROWABLE_HEAP_I32()[((argp) >> 2)] = 0;
+ return 0;
+ }
+
+ case 21520:
+ {
+ if (!stream.tty) return -59;
+ return -28;
+ }
+
+ // not supported
+ case 21531:
+ {
+ var argp = syscallGetVarargP();
+ return FS.ioctl(stream, op, argp);
+ }
+
+ case 21523:
+ {
+ // TODO: in theory we should write to the winsize struct that gets
+ // passed in, but for now musl doesn't read anything on it
+ if (!stream.tty) return -59;
+ if (stream.tty.ops.ioctl_tiocgwinsz) {
+ var winsize = stream.tty.ops.ioctl_tiocgwinsz(stream.tty);
+ var argp = syscallGetVarargP();
+ GROWABLE_HEAP_I16()[((argp) >> 1)] = winsize[0];
+ GROWABLE_HEAP_I16()[(((argp) + (2)) >> 1)] = winsize[1];
+ }
+ return 0;
+ }
+
+ case 21524:
+ {
+ // TODO: technically, this ioctl call should change the window size.
+ // but, since emscripten doesn't have any concept of a terminal window
+ // yet, we'll just silently throw it away as we do TIOCGWINSZ
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ case 21515:
+ {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+
+ default:
+ return -28;
+ }
+ } // not supported
+ catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_lstat64(path, buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(9, 0, 1, path, buf);
+ try {
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.lstat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_mkdirat(dirfd, path, mode) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(10, 0, 1, dirfd, path, mode);
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ // remove a trailing slash, if one - /a/b/ has basename of '', but
+ // we want to create b in the context of this function
+ path = PATH.normalize(path);
+ if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_newfstatat(dirfd, path, buf, flags) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(11, 0, 1, dirfd, path, buf, flags);
+ try {
+ path = SYSCALLS.getStr(path);
+ var nofollow = flags & 256;
+ var allowEmpty = flags & 4096;
+ flags = flags & (~6400);
+ path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
+ return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_openat(dirfd, path, flags, varargs) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(12, 0, 1, dirfd, path, flags, varargs);
+ SYSCALLS.varargs = varargs;
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ var mode = varargs ? syscallGetVarargI() : 0;
+ return FS.open(path, flags, mode).fd;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var PIPEFS = {
+ BUCKET_BUFFER_SIZE: 8192,
+ mount(mount) {
+ // Do not pollute the real root directory or its child nodes with pipes
+ // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way
+ return FS.createNode(null, "/", 16384 | 511, 0);
+ },
+ createPipe() {
+ var pipe = {
+ buckets: [],
+ // refcnt 2 because pipe has a read end and a write end. We need to be
+ // able to read from the read end after write end is closed.
+ refcnt: 2
+ };
+ pipe.buckets.push({
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0
+ });
+ var rName = PIPEFS.nextname();
+ var wName = PIPEFS.nextname();
+ var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0);
+ var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0);
+ rNode.pipe = pipe;
+ wNode.pipe = pipe;
+ var readableStream = FS.createStream({
+ path: rName,
+ node: rNode,
+ flags: 0,
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops
+ });
+ rNode.stream = readableStream;
+ var writableStream = FS.createStream({
+ path: wName,
+ node: wNode,
+ flags: 1,
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops
+ });
+ wNode.stream = writableStream;
+ return {
+ readable_fd: readableStream.fd,
+ writable_fd: writableStream.fd
+ };
+ },
+ stream_ops: {
+ poll(stream) {
+ var pipe = stream.node.pipe;
+ if ((stream.flags & 2097155) === 1) {
+ return (256 | 4);
+ }
+ if (pipe.buckets.length > 0) {
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ if (bucket.offset - bucket.roffset > 0) {
+ return (64 | 1);
+ }
+ }
+ }
+ return 0;
+ },
+ ioctl(stream, request, varargs) {
+ return 28;
+ },
+ fsync(stream) {
+ return 28;
+ },
+ read(stream, buffer, offset, length, position) {
+ /* ignored */ var pipe = stream.node.pipe;
+ var currentLength = 0;
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ currentLength += bucket.offset - bucket.roffset;
+ }
+ var data = buffer.subarray(offset, offset + length);
+ if (length <= 0) {
+ return 0;
+ }
+ if (currentLength == 0) {
+ // Behave as if the read end is always non-blocking
+ throw new FS.ErrnoError(6);
+ }
+ var toRead = Math.min(currentLength, length);
+ var totalRead = toRead;
+ var toRemove = 0;
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var currBucket = pipe.buckets[i];
+ var bucketSize = currBucket.offset - currBucket.roffset;
+ if (toRead <= bucketSize) {
+ var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+ if (toRead < bucketSize) {
+ tmpSlice = tmpSlice.subarray(0, toRead);
+ currBucket.roffset += toRead;
+ } else {
+ toRemove++;
+ }
+ data.set(tmpSlice);
+ break;
+ } else {
+ var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+ data.set(tmpSlice);
+ data = data.subarray(tmpSlice.byteLength);
+ toRead -= tmpSlice.byteLength;
+ toRemove++;
+ }
+ }
+ if (toRemove && toRemove == pipe.buckets.length) {
+ // Do not generate excessive garbage in use cases such as
+ // write several bytes, read everything, write several bytes, read everything...
+ toRemove--;
+ pipe.buckets[toRemove].offset = 0;
+ pipe.buckets[toRemove].roffset = 0;
+ }
+ pipe.buckets.splice(0, toRemove);
+ return totalRead;
+ },
+ write(stream, buffer, offset, length, position) {
+ /* ignored */ var pipe = stream.node.pipe;
+ var data = buffer.subarray(offset, offset + length);
+ var dataLen = data.byteLength;
+ if (dataLen <= 0) {
+ return 0;
+ }
+ var currBucket = null;
+ if (pipe.buckets.length == 0) {
+ currBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0
+ };
+ pipe.buckets.push(currBucket);
+ } else {
+ currBucket = pipe.buckets[pipe.buckets.length - 1];
+ }
+ assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE);
+ var freeBytesInCurrBuffer = PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset;
+ if (freeBytesInCurrBuffer >= dataLen) {
+ currBucket.buffer.set(data, currBucket.offset);
+ currBucket.offset += dataLen;
+ return dataLen;
+ } else if (freeBytesInCurrBuffer > 0) {
+ currBucket.buffer.set(data.subarray(0, freeBytesInCurrBuffer), currBucket.offset);
+ currBucket.offset += freeBytesInCurrBuffer;
+ data = data.subarray(freeBytesInCurrBuffer, data.byteLength);
+ }
+ var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0;
+ var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE;
+ for (var i = 0; i < numBuckets; i++) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: PIPEFS.BUCKET_BUFFER_SIZE,
+ roffset: 0
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE));
+ data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength);
+ }
+ if (remElements > 0) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: data.byteLength,
+ roffset: 0
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data);
+ }
+ return dataLen;
+ },
+ close(stream) {
+ var pipe = stream.node.pipe;
+ pipe.refcnt--;
+ if (pipe.refcnt === 0) {
+ pipe.buckets = null;
+ }
+ }
+ },
+ nextname() {
+ if (!PIPEFS.nextname.current) {
+ PIPEFS.nextname.current = 0;
+ }
+ return "pipe[" + (PIPEFS.nextname.current++) + "]";
+ }
+};
+
+function ___syscall_pipe(fdPtr) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(13, 0, 1, fdPtr);
+ try {
+ if (fdPtr == 0) {
+ throw new FS.ErrnoError(21);
+ }
+ var res = PIPEFS.createPipe();
+ GROWABLE_HEAP_I32()[((fdPtr) >> 2)] = res.readable_fd;
+ GROWABLE_HEAP_I32()[(((fdPtr) + (4)) >> 2)] = res.writable_fd;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var SOCKFS = {
+ websocketArgs: {},
+ callbacks: {},
+ on(event, callback) {
+ SOCKFS.callbacks[event] = callback;
+ },
+ emit(event, param) {
+ SOCKFS.callbacks[event]?.(param);
+ },
+ mount(mount) {
+ // The incomming Module['websocket'] can be used for configuring
+ // configuring subprotocol/url, etc
+ SOCKFS.websocketArgs = Module["websocket"] || {};
+ // Add the Event registration mechanism to the exported websocket configuration
+ // object so we can register network callbacks from native JavaScript too.
+ // For more documentation see system/include/emscripten/emscripten.h
+ (Module["websocket"] ??= {})["on"] = SOCKFS.on;
+ return FS.createNode(null, "/", 16895, 0);
+ },
+ createSocket(family, type, protocol) {
+ type &= ~526336;
+ // Some applications may pass it; it makes no sense for a single process.
+ var streaming = type == 1;
+ if (streaming && protocol && protocol != 6) {
+ throw new FS.ErrnoError(66);
+ }
+ // create our internal socket structure
+ var sock = {
+ family,
+ type,
+ protocol,
+ server: null,
+ error: null,
+ // Used in getsockopt for SOL_SOCKET/SO_ERROR test
+ peers: {},
+ pending: [],
+ recv_queue: [],
+ sock_ops: SOCKFS.websocket_sock_ops
+ };
+ // create the filesystem node to store the socket structure
+ var name = SOCKFS.nextname();
+ var node = FS.createNode(SOCKFS.root, name, 49152, 0);
+ node.sock = sock;
+ // and the wrapping stream that enables library functions such
+ // as read and write to indirectly interact with the socket
+ var stream = FS.createStream({
+ path: name,
+ node,
+ flags: 2,
+ seekable: false,
+ stream_ops: SOCKFS.stream_ops
+ });
+ // map the new stream to the socket structure (sockets have a 1:1
+ // relationship with a stream)
+ sock.stream = stream;
+ return sock;
+ },
+ getSocket(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream || !FS.isSocket(stream.node.mode)) {
+ return null;
+ }
+ return stream.node.sock;
+ },
+ stream_ops: {
+ poll(stream) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.poll(sock);
+ },
+ ioctl(stream, request, varargs) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.ioctl(sock, request, varargs);
+ },
+ read(stream, buffer, offset, length, position) {
+ /* ignored */ var sock = stream.node.sock;
+ var msg = sock.sock_ops.recvmsg(sock, length);
+ if (!msg) {
+ // socket is closed
+ return 0;
+ }
+ buffer.set(msg.buffer, offset);
+ return msg.buffer.length;
+ },
+ write(stream, buffer, offset, length, position) {
+ /* ignored */ var sock = stream.node.sock;
+ return sock.sock_ops.sendmsg(sock, buffer, offset, length);
+ },
+ close(stream) {
+ var sock = stream.node.sock;
+ sock.sock_ops.close(sock);
+ }
+ },
+ nextname() {
+ if (!SOCKFS.nextname.current) {
+ SOCKFS.nextname.current = 0;
+ }
+ return `socket[${SOCKFS.nextname.current++}]`;
+ },
+ websocket_sock_ops: {
+ createPeer(sock, addr, port) {
+ var ws;
+ if (typeof addr == "object") {
+ ws = addr;
+ addr = null;
+ port = null;
+ }
+ if (ws) {
+ // for sockets that've already connected (e.g. we're the server)
+ // we can inspect the _socket property for the address
+ if (ws._socket) {
+ addr = ws._socket.remoteAddress;
+ port = ws._socket.remotePort;
+ } else // if we're just now initializing a connection to the remote,
+ // inspect the url property
+ {
+ var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
+ if (!result) {
+ throw new Error("WebSocket URL must be in the format ws(s)://address:port");
+ }
+ addr = result[1];
+ port = parseInt(result[2], 10);
+ }
+ } else {
+ // create the actual websocket object and connect
+ try {
+ // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
+ // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
+ var url = "ws:#".replace("#", "//");
+ // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
+ var subProtocols = "binary";
+ // The default value is 'binary'
+ // The default WebSocket options
+ var opts = undefined;
+ // Fetch runtime WebSocket URL config.
+ if (SOCKFS.websocketArgs["url"]) {
+ url = SOCKFS.websocketArgs["url"];
+ }
+ // Fetch runtime WebSocket subprotocol config.
+ if (SOCKFS.websocketArgs["subprotocol"]) {
+ subProtocols = SOCKFS.websocketArgs["subprotocol"];
+ } else if (SOCKFS.websocketArgs["subprotocol"] === null) {
+ subProtocols = "null";
+ }
+ if (url === "ws://" || url === "wss://") {
+ // Is the supplied URL config just a prefix, if so complete it.
+ var parts = addr.split("/");
+ url = url + parts[0] + ":" + port + "/" + parts.slice(1).join("/");
+ }
+ if (subProtocols !== "null") {
+ // The regex trims the string (removes spaces at the beginning and end, then splits the string by
+ // , into an Array. Whitespace removal is important for Websockify and ws.
+ subProtocols = subProtocols.replace(/^ +| +$/g, "").split(/ *, */);
+ opts = subProtocols;
+ }
+ // If node we use the ws library.
+ var WebSocketConstructor;
+ if (ENVIRONMENT_IS_NODE) {
+ WebSocketConstructor = /** @type{(typeof WebSocket)} */ (require("ws"));
+ } else {
+ WebSocketConstructor = WebSocket;
+ }
+ ws = new WebSocketConstructor(url, opts);
+ ws.binaryType = "arraybuffer";
+ } catch (e) {
+ throw new FS.ErrnoError(23);
+ }
+ }
+ var peer = {
+ addr,
+ port,
+ socket: ws,
+ msg_send_queue: []
+ };
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
+ // if this is a bound dgram socket, send the port number first to allow
+ // us to override the ephemeral port reported to us by remotePort on the
+ // remote end.
+ if (sock.type === 2 && typeof sock.sport != "undefined") {
+ peer.msg_send_queue.push(new Uint8Array([ 255, 255, 255, 255, "p".charCodeAt(0), "o".charCodeAt(0), "r".charCodeAt(0), "t".charCodeAt(0), ((sock.sport & 65280) >> 8), (sock.sport & 255) ]));
+ }
+ return peer;
+ },
+ getPeer(sock, addr, port) {
+ return sock.peers[addr + ":" + port];
+ },
+ addPeer(sock, peer) {
+ sock.peers[peer.addr + ":" + peer.port] = peer;
+ },
+ removePeer(sock, peer) {
+ delete sock.peers[peer.addr + ":" + peer.port];
+ },
+ handlePeerEvents(sock, peer) {
+ var first = true;
+ var handleOpen = function() {
+ sock.connecting = false;
+ SOCKFS.emit("open", sock.stream.fd);
+ try {
+ var queued = peer.msg_send_queue.shift();
+ while (queued) {
+ peer.socket.send(queued);
+ queued = peer.msg_send_queue.shift();
+ }
+ } catch (e) {
+ // not much we can do here in the way of proper error handling as we've already
+ // lied and said this data was sent. shut it down.
+ peer.socket.close();
+ }
+ };
+ function handleMessage(data) {
+ if (typeof data == "string") {
+ var encoder = new TextEncoder;
+ // should be utf-8
+ data = encoder.encode(data);
+ } else // make a typed array from the string
+ {
+ assert(data.byteLength !== undefined);
+ // must receive an ArrayBuffer
+ if (data.byteLength == 0) {
+ // An empty ArrayBuffer will emit a pseudo disconnect event
+ // as recv/recvmsg will return zero which indicates that a socket
+ // has performed a shutdown although the connection has not been disconnected yet.
+ return;
+ }
+ data = new Uint8Array(data);
+ }
+ // if this is the port message, override the peer's port with it
+ var wasfirst = first;
+ first = false;
+ if (wasfirst && data.length === 10 && data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && data[4] === "p".charCodeAt(0) && data[5] === "o".charCodeAt(0) && data[6] === "r".charCodeAt(0) && data[7] === "t".charCodeAt(0)) {
+ // update the peer's port and it's key in the peer map
+ var newport = ((data[8] << 8) | data[9]);
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ peer.port = newport;
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ return;
+ }
+ sock.recv_queue.push({
+ addr: peer.addr,
+ port: peer.port,
+ data
+ });
+ SOCKFS.emit("message", sock.stream.fd);
+ }
+ if (ENVIRONMENT_IS_NODE) {
+ peer.socket.on("open", handleOpen);
+ peer.socket.on("message", function(data, isBinary) {
+ if (!isBinary) {
+ return;
+ }
+ handleMessage((new Uint8Array(data)).buffer);
+ });
+ // copy from node Buffer -> ArrayBuffer
+ peer.socket.on("close", function() {
+ SOCKFS.emit("close", sock.stream.fd);
+ });
+ peer.socket.on("error", function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
+ // is still probably the most useful thing to do.
+ sock.error = 14;
+ // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ SOCKFS.emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]);
+ });
+ } else {
+ peer.socket.onopen = handleOpen;
+ peer.socket.onclose = function() {
+ SOCKFS.emit("close", sock.stream.fd);
+ };
+ peer.socket.onmessage = function peer_socket_onmessage(event) {
+ handleMessage(event.data);
+ };
+ peer.socket.onerror = function(error) {
+ // The WebSocket spec only allows a 'simple event' to be thrown on error,
+ // so we only really know as much as ECONNREFUSED.
+ sock.error = 14;
+ // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ SOCKFS.emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]);
+ };
+ }
+ },
+ poll(sock) {
+ if (sock.type === 1 && sock.server) {
+ // listen sockets should only say they're available for reading
+ // if there are pending clients.
+ return sock.pending.length ? (64 | 1) : 0;
+ }
+ var mask = 0;
+ var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets
+ SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : null;
+ if (sock.recv_queue.length || !dest || // connection-less sockets are always ready to read
+ (dest && dest.socket.readyState === dest.socket.CLOSING) || (dest && dest.socket.readyState === dest.socket.CLOSED)) {
+ // let recv return 0 once closed
+ mask |= (64 | 1);
+ }
+ if (!dest || // connection-less sockets are always ready to write
+ (dest && dest.socket.readyState === dest.socket.OPEN)) {
+ mask |= 4;
+ }
+ if ((dest && dest.socket.readyState === dest.socket.CLOSING) || (dest && dest.socket.readyState === dest.socket.CLOSED)) {
+ // When an non-blocking connect fails mark the socket as writable.
+ // Its up to the calling code to then use getsockopt with SO_ERROR to
+ // retrieve the error.
+ // See https://man7.org/linux/man-pages/man2/connect.2.html
+ if (sock.connecting) {
+ mask |= 4;
+ } else {
+ mask |= 16;
+ }
+ }
+ return mask;
+ },
+ ioctl(sock, request, arg) {
+ switch (request) {
+ case 21531:
+ var bytes = 0;
+ if (sock.recv_queue.length) {
+ bytes = sock.recv_queue[0].data.length;
+ }
+ GROWABLE_HEAP_I32()[((arg) >> 2)] = bytes;
+ return 0;
+
+ default:
+ return 28;
+ }
+ },
+ close(sock) {
+ // if we've spawned a listen server, close it
+ if (sock.server) {
+ try {
+ sock.server.close();
+ } catch (e) {}
+ sock.server = null;
+ }
+ // close any peer connections
+ var peers = Object.keys(sock.peers);
+ for (var i = 0; i < peers.length; i++) {
+ var peer = sock.peers[peers[i]];
+ try {
+ peer.socket.close();
+ } catch (e) {}
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ }
+ return 0;
+ },
+ bind(sock, addr, port) {
+ if (typeof sock.saddr != "undefined" || typeof sock.sport != "undefined") {
+ throw new FS.ErrnoError(28);
+ }
+ // already bound
+ sock.saddr = addr;
+ sock.sport = port;
+ // in order to emulate dgram sockets, we need to launch a listen server when
+ // binding on a connection-less socket
+ // note: this is only required on the server side
+ if (sock.type === 2) {
+ // close the existing server if it exists
+ if (sock.server) {
+ sock.server.close();
+ sock.server = null;
+ }
+ // swallow error operation not supported error that occurs when binding in the
+ // browser where this isn't supported
+ try {
+ sock.sock_ops.listen(sock, 0);
+ } catch (e) {
+ if (!(e.name === "ErrnoError")) throw e;
+ if (e.errno !== 138) throw e;
+ }
+ }
+ },
+ connect(sock, addr, port) {
+ if (sock.server) {
+ throw new FS.ErrnoError(138);
+ }
+ // TODO autobind
+ // if (!sock.addr && sock.type == 2) {
+ // }
+ // early out if we're already connected / in the middle of connecting
+ if (typeof sock.daddr != "undefined" && typeof sock.dport != "undefined") {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+ if (dest) {
+ if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(7);
+ } else {
+ throw new FS.ErrnoError(30);
+ }
+ }
+ }
+ // add the socket to our peer list and set our
+ // destination address / port to match
+ var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ sock.daddr = peer.addr;
+ sock.dport = peer.port;
+ // because we cannot synchronously block to wait for the WebSocket
+ // connection to complete, we return here pretending that the connection
+ // was a success.
+ sock.connecting = true;
+ },
+ listen(sock, backlog) {
+ if (!ENVIRONMENT_IS_NODE) {
+ throw new FS.ErrnoError(138);
+ }
+ if (sock.server) {
+ throw new FS.ErrnoError(28);
+ }
+ // already listening
+ var WebSocketServer = require("ws").Server;
+ var host = sock.saddr;
+ sock.server = new WebSocketServer({
+ host,
+ port: sock.sport
+ });
+ // TODO support backlog
+ SOCKFS.emit("listen", sock.stream.fd);
+ // Send Event with listen fd.
+ sock.server.on("connection", function(ws) {
+ if (sock.type === 1) {
+ var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
+ // create a peer on the new socket
+ var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
+ newsock.daddr = peer.addr;
+ newsock.dport = peer.port;
+ // push to queue for accept to pick up
+ sock.pending.push(newsock);
+ SOCKFS.emit("connection", newsock.stream.fd);
+ } else {
+ // create a peer on the listen socket so calling sendto
+ // with the listen socket and an address will resolve
+ // to the correct client
+ SOCKFS.websocket_sock_ops.createPeer(sock, ws);
+ SOCKFS.emit("connection", sock.stream.fd);
+ }
+ });
+ sock.server.on("close", function() {
+ SOCKFS.emit("close", sock.stream.fd);
+ sock.server = null;
+ });
+ sock.server.on("error", function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH
+ // is still probably the most useful thing to do. This error shouldn't
+ // occur in a well written app as errors should get trapped in the compiled
+ // app's own getaddrinfo call.
+ sock.error = 23;
+ // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ SOCKFS.emit("error", [ sock.stream.fd, sock.error, "EHOSTUNREACH: Host is unreachable" ]);
+ });
+ },
+ // don't throw
+ accept(listensock) {
+ if (!listensock.server || !listensock.pending.length) {
+ throw new FS.ErrnoError(28);
+ }
+ var newsock = listensock.pending.shift();
+ newsock.stream.flags = listensock.stream.flags;
+ return newsock;
+ },
+ getname(sock, peer) {
+ var addr, port;
+ if (peer) {
+ if (sock.daddr === undefined || sock.dport === undefined) {
+ throw new FS.ErrnoError(53);
+ }
+ addr = sock.daddr;
+ port = sock.dport;
+ } else {
+ // TODO saddr and sport will be set for bind()'d UDP sockets, but what
+ // should we be returning for TCP sockets that've been connect()'d?
+ addr = sock.saddr || 0;
+ port = sock.sport || 0;
+ }
+ return {
+ addr,
+ port
+ };
+ },
+ sendmsg(sock, buffer, offset, length, addr, port) {
+ if (sock.type === 2) {
+ // connection-less sockets will honor the message address,
+ // and otherwise fall back to the bound destination address
+ if (addr === undefined || port === undefined) {
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ // if there was no address to fall back to, error out
+ if (addr === undefined || port === undefined) {
+ throw new FS.ErrnoError(17);
+ }
+ } else {
+ // connection-based sockets will only use the bound
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ // find the peer for the destination address
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
+ // early out if not connected with a connection-based socket
+ if (sock.type === 1) {
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ throw new FS.ErrnoError(53);
+ }
+ }
+ // create a copy of the incoming data to send, as the WebSocket API
+ // doesn't work entirely with an ArrayBufferView, it'll just send
+ // the entire underlying buffer
+ if (ArrayBuffer.isView(buffer)) {
+ offset += buffer.byteOffset;
+ buffer = buffer.buffer;
+ }
+ var data = buffer.slice(offset, offset + length);
+ // WebSockets .send() does not allow passing a SharedArrayBuffer, so
+ // clone the the SharedArrayBuffer as regular ArrayBuffer before
+ // sending.
+ if (data instanceof SharedArrayBuffer) {
+ data = new Uint8Array(new Uint8Array(data)).buffer;
+ }
+ // if we don't have a cached connectionless UDP datagram connection, or
+ // the TCP socket is still connecting, queue the message to be sent upon
+ // connect, and lie, saying the data was sent now.
+ if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
+ // if we're not connected, open a new connection
+ if (sock.type === 2) {
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ }
+ }
+ dest.msg_send_queue.push(data);
+ return length;
+ }
+ try {
+ // send the actual data
+ dest.socket.send(data);
+ return length;
+ } catch (e) {
+ throw new FS.ErrnoError(28);
+ }
+ },
+ recvmsg(sock, length) {
+ // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
+ if (sock.type === 1 && sock.server) {
+ // tcp servers should not be recv()'ing on the listen socket
+ throw new FS.ErrnoError(53);
+ }
+ var queued = sock.recv_queue.shift();
+ if (!queued) {
+ if (sock.type === 1) {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+ if (!dest) {
+ // if we have a destination address but are not connected, error out
+ throw new FS.ErrnoError(53);
+ }
+ if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ // return null if the socket has closed
+ return null;
+ }
+ // else, our socket is in a valid state but truly has nothing available
+ throw new FS.ErrnoError(6);
+ }
+ throw new FS.ErrnoError(6);
+ }
+ // queued.data will be an ArrayBuffer if it's unadulterated, but if it's
+ // requeued TCP data it'll be an ArrayBufferView
+ var queuedLength = queued.data.byteLength || queued.data.length;
+ var queuedOffset = queued.data.byteOffset || 0;
+ var queuedBuffer = queued.data.buffer || queued.data;
+ var bytesRead = Math.min(length, queuedLength);
+ var res = {
+ buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
+ addr: queued.addr,
+ port: queued.port
+ };
+ // push back any unread data for TCP connections
+ if (sock.type === 1 && bytesRead < queuedLength) {
+ var bytesRemaining = queuedLength - bytesRead;
+ queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
+ sock.recv_queue.unshift(queued);
+ }
+ return res;
+ }
+ }
+};
+
+var getSocketFromFD = fd => {
+ var socket = SOCKFS.getSocket(fd);
+ if (!socket) throw new FS.ErrnoError(8);
+ return socket;
+};
+
+var Sockets = {
+ BUFFER_SIZE: 10240,
+ MAX_BUFFER_SIZE: 10485760,
+ nextFd: 1,
+ fds: {},
+ nextport: 1,
+ maxport: 65535,
+ peer: null,
+ connections: {},
+ portmap: {},
+ localAddr: 4261412874,
+ addrPool: [ 33554442, 50331658, 67108874, 83886090, 100663306, 117440522, 134217738, 150994954, 167772170, 184549386, 201326602, 218103818, 234881034 ]
+};
+
+var inetPton4 = str => {
+ var b = str.split(".");
+ for (var i = 0; i < 4; i++) {
+ var tmp = Number(b[i]);
+ if (isNaN(tmp)) return null;
+ b[i] = tmp;
+ }
+ return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
+};
+
+/** @suppress {checkTypes} */ var jstoi_q = str => parseInt(str);
+
+var inetPton6 = str => {
+ var words;
+ var w, offset, z, i;
+ /* http://home.deds.nl/~aeron/regex/ */ var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i;
+ var parts = [];
+ if (!valid6regx.test(str)) {
+ return null;
+ }
+ if (str === "::") {
+ return [ 0, 0, 0, 0, 0, 0, 0, 0 ];
+ }
+ // Z placeholder to keep track of zeros when splitting the string on ":"
+ if (str.startsWith("::")) {
+ str = str.replace("::", "Z:");
+ } else // leading zeros case
+ {
+ str = str.replace("::", ":Z:");
+ }
+ if (str.indexOf(".") > 0) {
+ // parse IPv4 embedded stress
+ str = str.replace(new RegExp("[.]", "g"), ":");
+ words = str.split(":");
+ words[words.length - 4] = jstoi_q(words[words.length - 4]) + jstoi_q(words[words.length - 3]) * 256;
+ words[words.length - 3] = jstoi_q(words[words.length - 2]) + jstoi_q(words[words.length - 1]) * 256;
+ words = words.slice(0, words.length - 2);
+ } else {
+ words = str.split(":");
+ }
+ offset = 0;
+ z = 0;
+ for (w = 0; w < words.length; w++) {
+ if (typeof words[w] == "string") {
+ if (words[w] === "Z") {
+ // compressed zeros - write appropriate number of zero words
+ for (z = 0; z < (8 - words.length + 1); z++) {
+ parts[w + z] = 0;
+ }
+ offset = z - 1;
+ } else {
+ // parse hex to field to 16-bit value and write it in network byte-order
+ parts[w + offset] = _htons(parseInt(words[w], 16));
+ }
+ } else {
+ // parsed IPv4 words
+ parts[w + offset] = words[w];
+ }
+ }
+ return [ (parts[1] << 16) | parts[0], (parts[3] << 16) | parts[2], (parts[5] << 16) | parts[4], (parts[7] << 16) | parts[6] ];
+};
+
+/** @param {number=} addrlen */ var writeSockaddr = (sa, family, addr, port, addrlen) => {
+ switch (family) {
+ case 2:
+ addr = inetPton4(addr);
+ zeroMemory(sa, 16);
+ if (addrlen) {
+ GROWABLE_HEAP_I32()[((addrlen) >> 2)] = 16;
+ }
+ GROWABLE_HEAP_I16()[((sa) >> 1)] = family;
+ GROWABLE_HEAP_I32()[(((sa) + (4)) >> 2)] = addr;
+ GROWABLE_HEAP_I16()[(((sa) + (2)) >> 1)] = _htons(port);
+ break;
+
+ case 10:
+ addr = inetPton6(addr);
+ zeroMemory(sa, 28);
+ if (addrlen) {
+ GROWABLE_HEAP_I32()[((addrlen) >> 2)] = 28;
+ }
+ GROWABLE_HEAP_I32()[((sa) >> 2)] = family;
+ GROWABLE_HEAP_I32()[(((sa) + (8)) >> 2)] = addr[0];
+ GROWABLE_HEAP_I32()[(((sa) + (12)) >> 2)] = addr[1];
+ GROWABLE_HEAP_I32()[(((sa) + (16)) >> 2)] = addr[2];
+ GROWABLE_HEAP_I32()[(((sa) + (20)) >> 2)] = addr[3];
+ GROWABLE_HEAP_I16()[(((sa) + (2)) >> 1)] = _htons(port);
+ break;
+
+ default:
+ return 5;
+ }
+ return 0;
+};
+
+var DNS = {
+ address_map: {
+ id: 1,
+ addrs: {},
+ names: {}
+ },
+ lookup_name(name) {
+ // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
+ var res = inetPton4(name);
+ if (res !== null) {
+ return name;
+ }
+ res = inetPton6(name);
+ if (res !== null) {
+ return name;
+ }
+ // See if this name is already mapped.
+ var addr;
+ if (DNS.address_map.addrs[name]) {
+ addr = DNS.address_map.addrs[name];
+ } else {
+ var id = DNS.address_map.id++;
+ assert(id < 65535, "exceeded max address mappings of 65535");
+ addr = "172.29." + (id & 255) + "." + (id & 65280);
+ DNS.address_map.names[addr] = name;
+ DNS.address_map.addrs[name] = addr;
+ }
+ return addr;
+ },
+ lookup_addr(addr) {
+ if (DNS.address_map.names[addr]) {
+ return DNS.address_map.names[addr];
+ }
+ return null;
+ }
+};
+
+function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(14, 0, 1, fd, buf, len, flags, addr, addrlen);
+ try {
+ var sock = getSocketFromFD(fd);
+ var msg = sock.sock_ops.recvmsg(sock, len);
+ if (!msg) return 0;
+ // socket is closed
+ if (addr) {
+ var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen);
+ }
+ GROWABLE_HEAP_U8().set(msg.buffer, buf);
+ return msg.buffer.byteLength;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(15, 0, 1, olddirfd, oldpath, newdirfd, newpath);
+ try {
+ oldpath = SYSCALLS.getStr(oldpath);
+ newpath = SYSCALLS.getStr(newpath);
+ oldpath = SYSCALLS.calculateAt(olddirfd, oldpath);
+ newpath = SYSCALLS.calculateAt(newdirfd, newpath);
+ FS.rename(oldpath, newpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_rmdir(path) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(16, 0, 1, path);
+ try {
+ path = SYSCALLS.getStr(path);
+ FS.rmdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var inetNtop4 = addr => (addr & 255) + "." + ((addr >> 8) & 255) + "." + ((addr >> 16) & 255) + "." + ((addr >> 24) & 255);
+
+var inetNtop6 = ints => {
+ // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
+ // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses
+ // 128-bits are split into eight 16-bit words
+ // stored in network byte order (big-endian)
+ // | 80 bits | 16 | 32 bits |
+ // +-----------------------------------------------------------------+
+ // | 10 bytes | 2 | 4 bytes |
+ // +--------------------------------------+--------------------------+
+ // + 5 words | 1 | 2 words |
+ // +--------------------------------------+--------------------------+
+ // |0000..............................0000|0000| IPv4 ADDRESS | (compatible)
+ // +--------------------------------------+----+---------------------+
+ // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped)
+ // +--------------------------------------+----+---------------------+
+ var str = "";
+ var word = 0;
+ var longest = 0;
+ var lastzero = 0;
+ var zstart = 0;
+ var len = 0;
+ var i = 0;
+ var parts = [ ints[0] & 65535, (ints[0] >> 16), ints[1] & 65535, (ints[1] >> 16), ints[2] & 65535, (ints[2] >> 16), ints[3] & 65535, (ints[3] >> 16) ];
+ // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
+ var hasipv4 = true;
+ var v4part = "";
+ // check if the 10 high-order bytes are all zeros (first 5 words)
+ for (i = 0; i < 5; i++) {
+ if (parts[i] !== 0) {
+ hasipv4 = false;
+ break;
+ }
+ }
+ if (hasipv4) {
+ // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
+ v4part = inetNtop4(parts[6] | (parts[7] << 16));
+ // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
+ if (parts[5] === -1) {
+ str = "::ffff:";
+ str += v4part;
+ return str;
+ }
+ // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
+ if (parts[5] === 0) {
+ str = "::";
+ //special case IPv6 addresses
+ if (v4part === "0.0.0.0") v4part = "";
+ // any/unspecified address
+ if (v4part === "0.0.0.1") v4part = "1";
+ // loopback address
+ str += v4part;
+ return str;
+ }
+ }
+ // Handle all other IPv6 addresses
+ // first run to find the longest contiguous zero words
+ for (word = 0; word < 8; word++) {
+ if (parts[word] === 0) {
+ if (word - lastzero > 1) {
+ len = 0;
+ }
+ lastzero = word;
+ len++;
+ }
+ if (len > longest) {
+ longest = len;
+ zstart = word - longest + 1;
+ }
+ }
+ for (word = 0; word < 8; word++) {
+ if (longest > 1) {
+ // compress contiguous zeros - to produce "::"
+ if (parts[word] === 0 && word >= zstart && word < (zstart + longest)) {
+ if (word === zstart) {
+ str += ":";
+ if (zstart === 0) str += ":";
+ }
+ //leading zeros case
+ continue;
+ }
+ }
+ // converts 16-bit words from big-endian to little-endian before converting to hex string
+ str += Number(_ntohs(parts[word] & 65535)).toString(16);
+ str += word < 7 ? ":" : "";
+ }
+ return str;
+};
+
+var readSockaddr = (sa, salen) => {
+ // family / port offsets are common to both sockaddr_in and sockaddr_in6
+ var family = GROWABLE_HEAP_I16()[((sa) >> 1)];
+ var port = _ntohs(GROWABLE_HEAP_U16()[(((sa) + (2)) >> 1)]);
+ var addr;
+ switch (family) {
+ case 2:
+ if (salen !== 16) {
+ return {
+ errno: 28
+ };
+ }
+ addr = GROWABLE_HEAP_I32()[(((sa) + (4)) >> 2)];
+ addr = inetNtop4(addr);
+ break;
+
+ case 10:
+ if (salen !== 28) {
+ return {
+ errno: 28
+ };
+ }
+ addr = [ GROWABLE_HEAP_I32()[(((sa) + (8)) >> 2)], GROWABLE_HEAP_I32()[(((sa) + (12)) >> 2)], GROWABLE_HEAP_I32()[(((sa) + (16)) >> 2)], GROWABLE_HEAP_I32()[(((sa) + (20)) >> 2)] ];
+ addr = inetNtop6(addr);
+ break;
+
+ default:
+ return {
+ errno: 5
+ };
+ }
+ return {
+ family,
+ addr,
+ port
+ };
+};
+
+var getSocketAddress = (addrp, addrlen) => {
+ var info = readSockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+};
+
+function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(17, 0, 1, fd, message, length, flags, addr, addr_len);
+ try {
+ var sock = getSocketFromFD(fd);
+ if (!addr) {
+ // send, no address provided
+ return FS.write(sock.stream, GROWABLE_HEAP_I8(), message, length);
+ }
+ var dest = getSocketAddress(addr, addr_len);
+ // sendto an address
+ return sock.sock_ops.sendmsg(sock, GROWABLE_HEAP_I8(), message, length, dest.addr, dest.port);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_stat64(path, buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(18, 0, 1, path, buf);
+ try {
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function ___syscall_unlinkat(dirfd, path, flags) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(19, 0, 1, dirfd, path, flags);
+ try {
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (flags === 0) {
+ FS.unlink(path);
+ } else if (flags === 512) {
+ FS.rmdir(path);
+ } else {
+ abort("Invalid flags passed to unlinkat");
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var __abort_js = () => abort("");
+
+var nowIsMonotonic = 1;
+
+var __emscripten_get_now_is_monotonic = () => nowIsMonotonic;
+
+var __emscripten_init_main_thread_js = tb => {
+ // Pass the thread address to the native code where they stored in wasm
+ // globals which act as a form of TLS. Global constructors trying
+ // to access this value will read the wrong value, but that is UB anyway.
+ __emscripten_thread_init(tb, /*is_main=*/ !ENVIRONMENT_IS_WORKER, /*is_runtime=*/ 1, /*can_block=*/ !ENVIRONMENT_IS_WEB, /*default_stacksize=*/ 4194304, /*start_profiling=*/ false);
+ PThread.threadInitTLS();
+};
+
+var maybeExit = () => {
+ if (!keepRuntimeAlive()) {
+ try {
+ if (ENVIRONMENT_IS_PTHREAD) __emscripten_thread_exit(EXITSTATUS); else _exit(EXITSTATUS);
+ } catch (e) {
+ handleException(e);
+ }
+ }
+};
+
+var callUserCallback = func => {
+ if (ABORT) {
+ return;
+ }
+ try {
+ func();
+ maybeExit();
+ } catch (e) {
+ handleException(e);
+ }
+};
+
+var __emscripten_thread_mailbox_await = pthread_ptr => {
+ if (typeof Atomics.waitAsync === "function") {
+ // Wait on the pthread's initial self-pointer field because it is easy and
+ // safe to access from sending threads that need to notify the waiting
+ // thread.
+ // TODO: How to make this work with wasm64?
+ var wait = Atomics.waitAsync(GROWABLE_HEAP_I32(), ((pthread_ptr) >> 2), pthread_ptr);
+ wait.value.then(checkMailbox);
+ var waitingAsync = pthread_ptr + 128;
+ Atomics.store(GROWABLE_HEAP_I32(), ((waitingAsync) >> 2), 1);
+ }
+};
+
+// If `Atomics.waitAsync` is not implemented, then we will always fall back
+// to postMessage and there is no need to do anything here.
+var checkMailbox = () => {
+ // Only check the mailbox if we have a live pthread runtime. We implement
+ // pthread_self to return 0 if there is no live runtime.
+ var pthread_ptr = _pthread_self();
+ if (pthread_ptr) {
+ // If we are using Atomics.waitAsync as our notification mechanism, wait
+ // for a notification before processing the mailbox to avoid missing any
+ // work that could otherwise arrive after we've finished processing the
+ // mailbox and before we're ready for the next notification.
+ __emscripten_thread_mailbox_await(pthread_ptr);
+ callUserCallback(__emscripten_check_mailbox);
+ }
+};
+
+var __emscripten_notify_mailbox_postmessage = (targetThread, currThreadId) => {
+ if (targetThread == currThreadId) {
+ setTimeout(checkMailbox);
+ } else if (ENVIRONMENT_IS_PTHREAD) {
+ postMessage({
+ targetThread,
+ cmd: "checkMailbox"
+ });
+ } else {
+ var worker = PThread.pthreads[targetThread];
+ if (!worker) {
+ return;
+ }
+ worker.postMessage({
+ cmd: "checkMailbox"
+ });
+ }
+};
+
+var proxiedJSCallArgs = [];
+
+var __emscripten_receive_on_main_thread_js = (funcIndex, emAsmAddr, callingThread, numCallArgs, args) => {
+ // Sometimes we need to backproxy events to the calling thread (e.g.
+ // HTML5 DOM events handlers such as
+ // emscripten_set_mousemove_callback()), so keep track in a globally
+ // accessible variable about the thread that initiated the proxying.
+ proxiedJSCallArgs.length = numCallArgs;
+ var b = ((args) >> 3);
+ for (var i = 0; i < numCallArgs; i++) {
+ proxiedJSCallArgs[i] = GROWABLE_HEAP_F64()[b + i];
+ }
+ // Proxied JS library funcs use funcIndex and EM_ASM functions use emAsmAddr
+ var func = emAsmAddr ? ASM_CONSTS[emAsmAddr] : proxiedFunctionTable[funcIndex];
+ PThread.currentProxiedOperationCallerThread = callingThread;
+ var rtn = func(...proxiedJSCallArgs);
+ PThread.currentProxiedOperationCallerThread = 0;
+ return rtn;
+};
+
+var __emscripten_runtime_keepalive_clear = () => {
+ noExitRuntime = false;
+ runtimeKeepaliveCounter = 0;
+};
+
+var __emscripten_thread_cleanup = thread => {
+ // Called when a thread needs to be cleaned up so it can be reused.
+ // A thread is considered reusable when it either returns from its
+ // entry point, calls pthread_exit, or acts upon a cancellation.
+ // Detached threads are responsible for calling this themselves,
+ // otherwise pthread_join is responsible for calling this.
+ if (!ENVIRONMENT_IS_PTHREAD) cleanupThread(thread); else postMessage({
+ cmd: "cleanupThread",
+ thread
+ });
+};
+
+var __emscripten_thread_set_strongref = thread => {
+ // Called when a thread needs to be strongly referenced.
+ // Currently only used for:
+ // - keeping the "main" thread alive in PROXY_TO_PTHREAD mode;
+ // - crashed threads that needs to propagate the uncaught exception
+ // back to the main thread.
+ if (ENVIRONMENT_IS_NODE) {
+ PThread.pthreads[thread].ref();
+ }
+};
+
+var __emscripten_throw_longjmp = () => {
+ throw Infinity;
+};
+
+var isLeapYear = year => year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);
+
+var MONTH_DAYS_LEAP_CUMULATIVE = [ 0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335 ];
+
+var MONTH_DAYS_REGULAR_CUMULATIVE = [ 0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334 ];
+
+var ydayFromDate = date => {
+ var leap = isLeapYear(date.getFullYear());
+ var monthDaysCumulative = (leap ? MONTH_DAYS_LEAP_CUMULATIVE : MONTH_DAYS_REGULAR_CUMULATIVE);
+ var yday = monthDaysCumulative[date.getMonth()] + date.getDate() - 1;
+ // -1 since it's days since Jan 1
+ return yday;
+};
+
+function __localtime_js(time_low, time_high, tmPtr) {
+ var time = convertI32PairToI53Checked(time_low, time_high);
+ var date = new Date(time * 1e3);
+ GROWABLE_HEAP_I32()[((tmPtr) >> 2)] = date.getSeconds();
+ GROWABLE_HEAP_I32()[(((tmPtr) + (4)) >> 2)] = date.getMinutes();
+ GROWABLE_HEAP_I32()[(((tmPtr) + (8)) >> 2)] = date.getHours();
+ GROWABLE_HEAP_I32()[(((tmPtr) + (12)) >> 2)] = date.getDate();
+ GROWABLE_HEAP_I32()[(((tmPtr) + (16)) >> 2)] = date.getMonth();
+ GROWABLE_HEAP_I32()[(((tmPtr) + (20)) >> 2)] = date.getFullYear() - 1900;
+ GROWABLE_HEAP_I32()[(((tmPtr) + (24)) >> 2)] = date.getDay();
+ var yday = ydayFromDate(date) | 0;
+ GROWABLE_HEAP_I32()[(((tmPtr) + (28)) >> 2)] = yday;
+ GROWABLE_HEAP_I32()[(((tmPtr) + (36)) >> 2)] = -(date.getTimezoneOffset() * 60);
+ // Attention: DST is in December in South, and some regions don't have DST at all.
+ var start = new Date(date.getFullYear(), 0, 1);
+ var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+ var winterOffset = start.getTimezoneOffset();
+ var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0;
+ GROWABLE_HEAP_I32()[(((tmPtr) + (32)) >> 2)] = dst;
+}
+
+function __mmap_js(len, prot, flags, fd, offset_low, offset_high, allocated, addr) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(20, 0, 1, len, prot, flags, fd, offset_low, offset_high, allocated, addr);
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);
+ try {
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var res = FS.mmap(stream, len, offset, prot, flags);
+ var ptr = res.ptr;
+ GROWABLE_HEAP_I32()[((allocated) >> 2)] = res.allocated;
+ GROWABLE_HEAP_U32()[((addr) >> 2)] = ptr;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+function __munmap_js(addr, len, prot, flags, fd, offset_low, offset_high) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(21, 0, 1, addr, len, prot, flags, fd, offset_low, offset_high);
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ if (prot & 2) {
+ SYSCALLS.doMsync(addr, stream, len, flags, offset);
+ }
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return -e.errno;
+ }
+}
+
+var __tzset_js = (timezone, daylight, std_name, dst_name) => {
+ // TODO: Use (malleable) environment variables instead of system settings.
+ var currentYear = (new Date).getFullYear();
+ var winter = new Date(currentYear, 0, 1);
+ var summer = new Date(currentYear, 6, 1);
+ var winterOffset = winter.getTimezoneOffset();
+ var summerOffset = summer.getTimezoneOffset();
+ // Local standard timezone offset. Local standard time is not adjusted for
+ // daylight savings. This code uses the fact that getTimezoneOffset returns
+ // a greater value during Standard Time versus Daylight Saving Time (DST).
+ // Thus it determines the expected output during Standard Time, and it
+ // compares whether the output of the given date the same (Standard) or less
+ // (DST).
+ var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
+ // timezone is specified as seconds west of UTC ("The external variable
+ // `timezone` shall be set to the difference, in seconds, between
+ // Coordinated Universal Time (UTC) and local standard time."), the same
+ // as returned by stdTimezoneOffset.
+ // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html
+ GROWABLE_HEAP_U32()[((timezone) >> 2)] = stdTimezoneOffset * 60;
+ GROWABLE_HEAP_I32()[((daylight) >> 2)] = Number(winterOffset != summerOffset);
+ var extractZone = timezoneOffset => {
+ // Why inverse sign?
+ // Read here https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/getTimezoneOffset
+ var sign = timezoneOffset >= 0 ? "-" : "+";
+ var absOffset = Math.abs(timezoneOffset);
+ var hours = String(Math.floor(absOffset / 60)).padStart(2, "0");
+ var minutes = String(absOffset % 60).padStart(2, "0");
+ return `UTC${sign}${hours}${minutes}`;
+ };
+ var winterName = extractZone(winterOffset);
+ var summerName = extractZone(summerOffset);
+ if (summerOffset < winterOffset) {
+ // Northern hemisphere
+ stringToUTF8(winterName, std_name, 17);
+ stringToUTF8(summerName, dst_name, 17);
+ } else {
+ stringToUTF8(winterName, dst_name, 17);
+ stringToUTF8(summerName, std_name, 17);
+ }
+};
+
+var runtimeKeepalivePush = () => {
+ runtimeKeepaliveCounter += 1;
+};
+
+var _emscripten_set_main_loop_timing = (mode, value) => {
+ MainLoop.timingMode = mode;
+ MainLoop.timingValue = value;
+ if (!MainLoop.func) {
+ return 1;
+ }
+ // Return non-zero on failure, can't set timing mode when there is no main loop.
+ if (!MainLoop.running) {
+ runtimeKeepalivePush();
+ MainLoop.running = true;
+ }
+ if (mode == 0) {
+ MainLoop.scheduler = function MainLoop_scheduler_setTimeout() {
+ var timeUntilNextTick = Math.max(0, MainLoop.tickStartTime + value - _emscripten_get_now()) | 0;
+ setTimeout(MainLoop.runner, timeUntilNextTick);
+ };
+ // doing this each time means that on exception, we stop
+ MainLoop.method = "timeout";
+ } else if (mode == 1) {
+ MainLoop.scheduler = function MainLoop_scheduler_rAF() {
+ MainLoop.requestAnimationFrame(MainLoop.runner);
+ };
+ MainLoop.method = "rAF";
+ } else if (mode == 2) {
+ if (typeof MainLoop.setImmediate == "undefined") {
+ if (typeof setImmediate == "undefined") {
+ // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
+ var setImmediates = [];
+ var emscriptenMainLoopMessageId = "setimmediate";
+ /** @param {Event} event */ var MainLoop_setImmediate_messageHandler = event => {
+ // When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events,
+ // so check for both cases.
+ if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) {
+ event.stopPropagation();
+ setImmediates.shift()();
+ }
+ };
+ addEventListener("message", MainLoop_setImmediate_messageHandler, true);
+ MainLoop.setImmediate = /** @type{function(function(): ?, ...?): number} */ (func => {
+ setImmediates.push(func);
+ if (ENVIRONMENT_IS_WORKER) {
+ Module["setImmediates"] ??= [];
+ Module["setImmediates"].push(func);
+ postMessage({
+ target: emscriptenMainLoopMessageId
+ });
+ } else // In --proxy-to-worker, route the message via proxyClient.js
+ postMessage(emscriptenMainLoopMessageId, "*");
+ });
+ } else {
+ MainLoop.setImmediate = setImmediate;
+ }
+ }
+ MainLoop.scheduler = function MainLoop_scheduler_setImmediate() {
+ MainLoop.setImmediate(MainLoop.runner);
+ };
+ MainLoop.method = "immediate";
+ }
+ return 0;
+};
+
+var _emscripten_get_now = () => performance.timeOrigin + performance.now();
+
+var runtimeKeepalivePop = () => {
+ runtimeKeepaliveCounter -= 1;
+};
+
+/**
+ * @param {number=} arg
+ * @param {boolean=} noSetTiming
+ */ var setMainLoop = (iterFunc, fps, simulateInfiniteLoop, arg, noSetTiming) => {
+ MainLoop.func = iterFunc;
+ MainLoop.arg = arg;
+ var thisMainLoopId = MainLoop.currentlyRunningMainloop;
+ function checkIsRunning() {
+ if (thisMainLoopId < MainLoop.currentlyRunningMainloop) {
+ runtimeKeepalivePop();
+ maybeExit();
+ return false;
+ }
+ return true;
+ }
+ // We create the loop runner here but it is not actually running until
+ // _emscripten_set_main_loop_timing is called (which might happen a
+ // later time). This member signifies that the current runner has not
+ // yet been started so that we can call runtimeKeepalivePush when it
+ // gets it timing set for the first time.
+ MainLoop.running = false;
+ MainLoop.runner = function MainLoop_runner() {
+ if (ABORT) return;
+ if (MainLoop.queue.length > 0) {
+ var start = Date.now();
+ var blocker = MainLoop.queue.shift();
+ blocker.func(blocker.arg);
+ if (MainLoop.remainingBlockers) {
+ var remaining = MainLoop.remainingBlockers;
+ var next = remaining % 1 == 0 ? remaining - 1 : Math.floor(remaining);
+ if (blocker.counted) {
+ MainLoop.remainingBlockers = next;
+ } else {
+ // not counted, but move the progress along a tiny bit
+ next = next + .5;
+ // do not steal all the next one's progress
+ MainLoop.remainingBlockers = (8 * remaining + next) / 9;
+ }
+ }
+ MainLoop.updateStatus();
+ // catches pause/resume main loop from blocker execution
+ if (!checkIsRunning()) return;
+ setTimeout(MainLoop.runner, 0);
+ return;
+ }
+ // catch pauses from non-main loop sources
+ if (!checkIsRunning()) return;
+ // Implement very basic swap interval control
+ MainLoop.currentFrameNumber = MainLoop.currentFrameNumber + 1 | 0;
+ if (MainLoop.timingMode == 1 && MainLoop.timingValue > 1 && MainLoop.currentFrameNumber % MainLoop.timingValue != 0) {
+ // Not the scheduled time to render this frame - skip.
+ MainLoop.scheduler();
+ return;
+ } else if (MainLoop.timingMode == 0) {
+ MainLoop.tickStartTime = _emscripten_get_now();
+ }
+ MainLoop.runIter(iterFunc);
+ // catch pauses from the main loop itself
+ if (!checkIsRunning()) return;
+ MainLoop.scheduler();
+ };
+ if (!noSetTiming) {
+ if (fps && fps > 0) {
+ _emscripten_set_main_loop_timing(0, 1e3 / fps);
+ } else {
+ // Do rAF by rendering each frame (no decimating)
+ _emscripten_set_main_loop_timing(1, 1);
+ }
+ MainLoop.scheduler();
+ }
+ if (simulateInfiniteLoop) {
+ throw "unwind";
+ }
+};
+
+var MainLoop = {
+ running: false,
+ scheduler: null,
+ method: "",
+ currentlyRunningMainloop: 0,
+ func: null,
+ arg: 0,
+ timingMode: 0,
+ timingValue: 0,
+ currentFrameNumber: 0,
+ queue: [],
+ preMainLoop: [],
+ postMainLoop: [],
+ pause() {
+ MainLoop.scheduler = null;
+ // Incrementing this signals the previous main loop that it's now become old, and it must return.
+ MainLoop.currentlyRunningMainloop++;
+ },
+ resume() {
+ MainLoop.currentlyRunningMainloop++;
+ var timingMode = MainLoop.timingMode;
+ var timingValue = MainLoop.timingValue;
+ var func = MainLoop.func;
+ MainLoop.func = null;
+ // do not set timing and call scheduler, we will do it on the next lines
+ setMainLoop(func, 0, false, MainLoop.arg, true);
+ _emscripten_set_main_loop_timing(timingMode, timingValue);
+ MainLoop.scheduler();
+ },
+ updateStatus() {
+ if (Module["setStatus"]) {
+ var message = Module["statusMessage"] || "Please wait...";
+ var remaining = MainLoop.remainingBlockers ?? 0;
+ var expected = MainLoop.expectedBlockers ?? 0;
+ if (remaining) {
+ if (remaining < expected) {
+ Module["setStatus"](`{message} ({expected - remaining}/{expected})`);
+ } else {
+ Module["setStatus"](message);
+ }
+ } else {
+ Module["setStatus"]("");
+ }
+ }
+ },
+ init() {
+ Module["preMainLoop"] && MainLoop.preMainLoop.push(Module["preMainLoop"]);
+ Module["postMainLoop"] && MainLoop.postMainLoop.push(Module["postMainLoop"]);
+ },
+ runIter(func) {
+ if (ABORT) return;
+ for (var pre of MainLoop.preMainLoop) {
+ if (pre() === false) {
+ return;
+ }
+ }
+ callUserCallback(func);
+ for (var post of MainLoop.postMainLoop) {
+ post();
+ }
+ },
+ nextRAF: 0,
+ fakeRequestAnimationFrame(func) {
+ // try to keep 60fps between calls to here
+ var now = Date.now();
+ if (MainLoop.nextRAF === 0) {
+ MainLoop.nextRAF = now + 1e3 / 60;
+ } else {
+ while (now + 2 >= MainLoop.nextRAF) {
+ // fudge a little, to avoid timer jitter causing us to do lots of delay:0
+ MainLoop.nextRAF += 1e3 / 60;
+ }
+ }
+ var delay = Math.max(MainLoop.nextRAF - now, 0);
+ setTimeout(func, delay);
+ },
+ requestAnimationFrame(func) {
+ if (typeof requestAnimationFrame == "function") {
+ requestAnimationFrame(func);
+ return;
+ }
+ var RAF = MainLoop.fakeRequestAnimationFrame;
+ RAF(func);
+ }
+};
+
+var AL = {
+ QUEUE_INTERVAL: 25,
+ QUEUE_LOOKAHEAD: .1,
+ DEVICE_NAME: "Emscripten OpenAL",
+ CAPTURE_DEVICE_NAME: "Emscripten OpenAL capture",
+ ALC_EXTENSIONS: {
+ ALC_SOFT_pause_device: true,
+ ALC_SOFT_HRTF: true
+ },
+ AL_EXTENSIONS: {
+ AL_EXT_float32: true,
+ AL_SOFT_loop_points: true,
+ AL_SOFT_source_length: true,
+ AL_EXT_source_distance_model: true,
+ AL_SOFT_source_spatialize: true
+ },
+ _alcErr: 0,
+ alcErr: 0,
+ deviceRefCounts: {},
+ alcStringCache: {},
+ paused: false,
+ stringCache: {},
+ contexts: {},
+ currentCtx: null,
+ buffers: {
+ 0: {
+ id: 0,
+ refCount: 0,
+ audioBuf: null,
+ frequency: 0,
+ bytesPerSample: 2,
+ channels: 1,
+ length: 0
+ }
+ },
+ paramArray: [],
+ _nextId: 1,
+ newId: () => AL.freeIds.length > 0 ? AL.freeIds.pop() : AL._nextId++,
+ freeIds: [],
+ scheduleContextAudio: ctx => {
+ // If we are animating using the requestAnimationFrame method, then the main loop does not run when in the background.
+ // To give a perfect glitch-free audio stop when switching from foreground to background, we need to avoid updating
+ // audio altogether when in the background, so detect that case and kill audio buffer streaming if so.
+ if (MainLoop.timingMode === 1 && document["visibilityState"] != "visible") {
+ return;
+ }
+ for (var i in ctx.sources) {
+ AL.scheduleSourceAudio(ctx.sources[i]);
+ }
+ },
+ scheduleSourceAudio: (src, lookahead) => {
+ // See comment on scheduleContextAudio above.
+ if (MainLoop.timingMode === 1 && document["visibilityState"] != "visible") {
+ return;
+ }
+ if (src.state !== 4114) {
+ return;
+ }
+ var currentTime = AL.updateSourceTime(src);
+ var startTime = src.bufStartTime;
+ var startOffset = src.bufOffset;
+ var bufCursor = src.bufsProcessed;
+ // Advance past any audio that is already scheduled
+ for (var i = 0; i < src.audioQueue.length; i++) {
+ var audioSrc = src.audioQueue[i];
+ startTime = audioSrc._startTime + audioSrc._duration;
+ startOffset = 0;
+ bufCursor += audioSrc._skipCount + 1;
+ }
+ if (!lookahead) {
+ lookahead = AL.QUEUE_LOOKAHEAD;
+ }
+ var lookaheadTime = currentTime + lookahead;
+ var skipCount = 0;
+ while (startTime < lookaheadTime) {
+ if (bufCursor >= src.bufQueue.length) {
+ if (src.looping) {
+ bufCursor %= src.bufQueue.length;
+ } else {
+ break;
+ }
+ }
+ var buf = src.bufQueue[bufCursor % src.bufQueue.length];
+ // If the buffer contains no data, skip it
+ if (buf.length === 0) {
+ skipCount++;
+ // If we've gone through the whole queue and everything is 0 length, just give up
+ if (skipCount === src.bufQueue.length) {
+ break;
+ }
+ } else {
+ var audioSrc = src.context.audioCtx.createBufferSource();
+ audioSrc.buffer = buf.audioBuf;
+ audioSrc.playbackRate.value = src.playbackRate;
+ if (buf.audioBuf._loopStart || buf.audioBuf._loopEnd) {
+ audioSrc.loopStart = buf.audioBuf._loopStart;
+ audioSrc.loopEnd = buf.audioBuf._loopEnd;
+ }
+ var duration = 0;
+ // If the source is a looping static buffer, use native looping for gapless playback
+ if (src.type === 4136 && src.looping) {
+ duration = Number.POSITIVE_INFINITY;
+ audioSrc.loop = true;
+ if (buf.audioBuf._loopStart) {
+ audioSrc.loopStart = buf.audioBuf._loopStart;
+ }
+ if (buf.audioBuf._loopEnd) {
+ audioSrc.loopEnd = buf.audioBuf._loopEnd;
+ }
+ } else {
+ duration = (buf.audioBuf.duration - startOffset) / src.playbackRate;
+ }
+ audioSrc._startOffset = startOffset;
+ audioSrc._duration = duration;
+ audioSrc._skipCount = skipCount;
+ skipCount = 0;
+ audioSrc.connect(src.gain);
+ if (typeof audioSrc.start != "undefined") {
+ // Sample the current time as late as possible to mitigate drift
+ startTime = Math.max(startTime, src.context.audioCtx.currentTime);
+ audioSrc.start(startTime, startOffset);
+ } else if (typeof audioSrc.noteOn != "undefined") {
+ startTime = Math.max(startTime, src.context.audioCtx.currentTime);
+ audioSrc.noteOn(startTime);
+ }
+ audioSrc._startTime = startTime;
+ src.audioQueue.push(audioSrc);
+ startTime += duration;
+ }
+ startOffset = 0;
+ bufCursor++;
+ }
+ },
+ updateSourceTime: src => {
+ var currentTime = src.context.audioCtx.currentTime;
+ if (src.state !== 4114) {
+ return currentTime;
+ }
+ // if the start time is unset, determine it based on the current offset.
+ // This will be the case when a source is resumed after being paused, and
+ // allows us to pretend that the source actually started playing some time
+ // in the past such that it would just now have reached the stored offset.
+ if (!isFinite(src.bufStartTime)) {
+ src.bufStartTime = currentTime - src.bufOffset / src.playbackRate;
+ src.bufOffset = 0;
+ }
+ var nextStartTime = 0;
+ while (src.audioQueue.length) {
+ var audioSrc = src.audioQueue[0];
+ src.bufsProcessed += audioSrc._skipCount;
+ nextStartTime = audioSrc._startTime + audioSrc._duration;
+ // n.b. audioSrc._duration already factors in playbackRate, so no divide by src.playbackRate on it.
+ if (currentTime < nextStartTime) {
+ break;
+ }
+ src.audioQueue.shift();
+ src.bufStartTime = nextStartTime;
+ src.bufOffset = 0;
+ src.bufsProcessed++;
+ }
+ if (src.bufsProcessed >= src.bufQueue.length && !src.looping) {
+ // The source has played its entire queue and is non-looping, so just mark it as stopped.
+ AL.setSourceState(src, 4116);
+ } else if (src.type === 4136 && src.looping) {
+ // If the source is a looping static buffer, determine the buffer offset based on the loop points
+ var buf = src.bufQueue[0];
+ if (buf.length === 0) {
+ src.bufOffset = 0;
+ } else {
+ var delta = (currentTime - src.bufStartTime) * src.playbackRate;
+ var loopStart = buf.audioBuf._loopStart || 0;
+ var loopEnd = buf.audioBuf._loopEnd || buf.audioBuf.duration;
+ if (loopEnd <= loopStart) {
+ loopEnd = buf.audioBuf.duration;
+ }
+ if (delta < loopEnd) {
+ src.bufOffset = delta;
+ } else {
+ src.bufOffset = loopStart + (delta - loopStart) % (loopEnd - loopStart);
+ }
+ }
+ } else if (src.audioQueue[0]) {
+ // The source is still actively playing, so we just need to calculate where we are in the current buffer
+ // so it can be remembered if the source gets paused.
+ src.bufOffset = (currentTime - src.audioQueue[0]._startTime) * src.playbackRate;
+ } else {
+ // The source hasn't finished yet, but there is no scheduled audio left for it. This can be because
+ // the source has just been started/resumed, or due to an underrun caused by a long blocking operation.
+ // We need to determine what state we would be in by this point in time so that when we next schedule
+ // audio playback, it will be just as if no underrun occurred.
+ if (src.type !== 4136 && src.looping) {
+ // if the source is a looping buffer queue, let's first calculate the queue duration, so we can
+ // quickly fast forward past any full loops of the queue and only worry about the remainder.
+ var srcDuration = AL.sourceDuration(src) / src.playbackRate;
+ if (srcDuration > 0) {
+ src.bufStartTime += Math.floor((currentTime - src.bufStartTime) / srcDuration) * srcDuration;
+ }
+ }
+ // Since we've already skipped any full-queue loops if there were any, we just need to find
+ // out where in the queue the remaining time puts us, which won't require stepping through the
+ // entire queue more than once.
+ for (var i = 0; i < src.bufQueue.length; i++) {
+ if (src.bufsProcessed >= src.bufQueue.length) {
+ if (src.looping) {
+ src.bufsProcessed %= src.bufQueue.length;
+ } else {
+ AL.setSourceState(src, 4116);
+ break;
+ }
+ }
+ var buf = src.bufQueue[src.bufsProcessed];
+ if (buf.length > 0) {
+ nextStartTime = src.bufStartTime + buf.audioBuf.duration / src.playbackRate;
+ if (currentTime < nextStartTime) {
+ src.bufOffset = (currentTime - src.bufStartTime) * src.playbackRate;
+ break;
+ }
+ src.bufStartTime = nextStartTime;
+ }
+ src.bufOffset = 0;
+ src.bufsProcessed++;
+ }
+ }
+ return currentTime;
+ },
+ cancelPendingSourceAudio: src => {
+ AL.updateSourceTime(src);
+ for (var i = 1; i < src.audioQueue.length; i++) {
+ var audioSrc = src.audioQueue[i];
+ audioSrc.stop();
+ }
+ if (src.audioQueue.length > 1) {
+ src.audioQueue.length = 1;
+ }
+ },
+ stopSourceAudio: src => {
+ for (var i = 0; i < src.audioQueue.length; i++) {
+ src.audioQueue[i].stop();
+ }
+ src.audioQueue.length = 0;
+ },
+ setSourceState: (src, state) => {
+ if (state === 4114) {
+ if (src.state === 4114 || src.state == 4116) {
+ src.bufsProcessed = 0;
+ src.bufOffset = 0;
+ } else {}
+ AL.stopSourceAudio(src);
+ src.state = 4114;
+ src.bufStartTime = Number.NEGATIVE_INFINITY;
+ AL.scheduleSourceAudio(src);
+ } else if (state === 4115) {
+ if (src.state === 4114) {
+ // Store off the current offset to restore with on resume.
+ AL.updateSourceTime(src);
+ AL.stopSourceAudio(src);
+ src.state = 4115;
+ }
+ } else if (state === 4116) {
+ if (src.state !== 4113) {
+ src.state = 4116;
+ src.bufsProcessed = src.bufQueue.length;
+ src.bufStartTime = Number.NEGATIVE_INFINITY;
+ src.bufOffset = 0;
+ AL.stopSourceAudio(src);
+ }
+ } else if (state === 4113) {
+ if (src.state !== 4113) {
+ src.state = 4113;
+ src.bufsProcessed = 0;
+ src.bufStartTime = Number.NEGATIVE_INFINITY;
+ src.bufOffset = 0;
+ AL.stopSourceAudio(src);
+ }
+ }
+ },
+ initSourcePanner: src => {
+ if (src.type === 4144) /* AL_UNDETERMINED */ {
+ return;
+ }
+ // Find the first non-zero buffer in the queue to determine the proper format
+ var templateBuf = AL.buffers[0];
+ for (var i = 0; i < src.bufQueue.length; i++) {
+ if (src.bufQueue[i].id !== 0) {
+ templateBuf = src.bufQueue[i];
+ break;
+ }
+ }
+ // Create a panner if AL_SOURCE_SPATIALIZE_SOFT is set to true, or alternatively if it's set to auto and the source is mono
+ if (src.spatialize === 1 || (src.spatialize === 2 && /* AL_AUTO_SOFT */ templateBuf.channels === 1)) {
+ if (src.panner) {
+ return;
+ }
+ src.panner = src.context.audioCtx.createPanner();
+ AL.updateSourceGlobal(src);
+ AL.updateSourceSpace(src);
+ src.panner.connect(src.context.gain);
+ src.gain.disconnect();
+ src.gain.connect(src.panner);
+ } else {
+ if (!src.panner) {
+ return;
+ }
+ src.panner.disconnect();
+ src.gain.disconnect();
+ src.gain.connect(src.context.gain);
+ src.panner = null;
+ }
+ },
+ updateContextGlobal: ctx => {
+ for (var i in ctx.sources) {
+ AL.updateSourceGlobal(ctx.sources[i]);
+ }
+ },
+ updateSourceGlobal: src => {
+ var panner = src.panner;
+ if (!panner) {
+ return;
+ }
+ panner.refDistance = src.refDistance;
+ panner.maxDistance = src.maxDistance;
+ panner.rolloffFactor = src.rolloffFactor;
+ panner.panningModel = src.context.hrtf ? "HRTF" : "equalpower";
+ // Use the source's distance model if AL_SOURCE_DISTANCE_MODEL is enabled
+ var distanceModel = src.context.sourceDistanceModel ? src.distanceModel : src.context.distanceModel;
+ switch (distanceModel) {
+ case 0:
+ panner.distanceModel = "inverse";
+ panner.refDistance = 340282e33;
+ /* FLT_MAX */ break;
+
+ case 53249:
+ /* AL_INVERSE_DISTANCE */ case 53250:
+ /* AL_INVERSE_DISTANCE_CLAMPED */ panner.distanceModel = "inverse";
+ break;
+
+ case 53251:
+ /* AL_LINEAR_DISTANCE */ case 53252:
+ /* AL_LINEAR_DISTANCE_CLAMPED */ panner.distanceModel = "linear";
+ break;
+
+ case 53253:
+ /* AL_EXPONENT_DISTANCE */ case 53254:
+ /* AL_EXPONENT_DISTANCE_CLAMPED */ panner.distanceModel = "exponential";
+ break;
+ }
+ },
+ updateListenerSpace: ctx => {
+ var listener = ctx.audioCtx.listener;
+ if (listener.positionX) {
+ listener.positionX.value = ctx.listener.position[0];
+ listener.positionY.value = ctx.listener.position[1];
+ listener.positionZ.value = ctx.listener.position[2];
+ } else {
+ listener.setPosition(ctx.listener.position[0], ctx.listener.position[1], ctx.listener.position[2]);
+ }
+ if (listener.forwardX) {
+ listener.forwardX.value = ctx.listener.direction[0];
+ listener.forwardY.value = ctx.listener.direction[1];
+ listener.forwardZ.value = ctx.listener.direction[2];
+ listener.upX.value = ctx.listener.up[0];
+ listener.upY.value = ctx.listener.up[1];
+ listener.upZ.value = ctx.listener.up[2];
+ } else {
+ listener.setOrientation(ctx.listener.direction[0], ctx.listener.direction[1], ctx.listener.direction[2], ctx.listener.up[0], ctx.listener.up[1], ctx.listener.up[2]);
+ }
+ // Update sources that are relative to the listener
+ for (var i in ctx.sources) {
+ AL.updateSourceSpace(ctx.sources[i]);
+ }
+ },
+ updateSourceSpace: src => {
+ if (!src.panner) {
+ return;
+ }
+ var panner = src.panner;
+ var posX = src.position[0];
+ var posY = src.position[1];
+ var posZ = src.position[2];
+ var dirX = src.direction[0];
+ var dirY = src.direction[1];
+ var dirZ = src.direction[2];
+ var listener = src.context.listener;
+ var lPosX = listener.position[0];
+ var lPosY = listener.position[1];
+ var lPosZ = listener.position[2];
+ // WebAudio does spatialization in world-space coordinates, meaning both the buffer sources and
+ // the listener position are in the same absolute coordinate system relative to a fixed origin.
+ // By default, OpenAL works this way as well, but it also provides a "listener relative" mode, where
+ // a buffer source's coordinate are interpreted not in absolute world space, but as being relative
+ // to the listener object itself, so as the listener moves the source appears to move with it
+ // with no update required. Since web audio does not support this mode, we must transform the source
+ // coordinates from listener-relative space to absolute world space.
+ // We do this via affine transformation matrices applied to the source position and source direction.
+ // A change-of-basis converts from listener-space displacements to world-space displacements,
+ // which must be done for both the source position and direction. Lastly, the source position must be
+ // added to the listener position to get the final source position, since the source position represents
+ // a displacement from the listener.
+ if (src.relative) {
+ // Negate the listener direction since forward is -Z.
+ var lBackX = -listener.direction[0];
+ var lBackY = -listener.direction[1];
+ var lBackZ = -listener.direction[2];
+ var lUpX = listener.up[0];
+ var lUpY = listener.up[1];
+ var lUpZ = listener.up[2];
+ var inverseMagnitude = (x, y, z) => {
+ var length = Math.sqrt(x * x + y * y + z * z);
+ if (length < Number.EPSILON) {
+ return 0;
+ }
+ return 1 / length;
+ };
+ // Normalize the Back vector
+ var invMag = inverseMagnitude(lBackX, lBackY, lBackZ);
+ lBackX *= invMag;
+ lBackY *= invMag;
+ lBackZ *= invMag;
+ // ...and the Up vector
+ invMag = inverseMagnitude(lUpX, lUpY, lUpZ);
+ lUpX *= invMag;
+ lUpY *= invMag;
+ lUpZ *= invMag;
+ // Calculate the Right vector as the cross product of the Up and Back vectors
+ var lRightX = (lUpY * lBackZ - lUpZ * lBackY);
+ var lRightY = (lUpZ * lBackX - lUpX * lBackZ);
+ var lRightZ = (lUpX * lBackY - lUpY * lBackX);
+ // Back and Up might not be exactly perpendicular, so the cross product also needs normalization
+ invMag = inverseMagnitude(lRightX, lRightY, lRightZ);
+ lRightX *= invMag;
+ lRightY *= invMag;
+ lRightZ *= invMag;
+ // Recompute Up from the now orthonormal Right and Back vectors so we have a fully orthonormal basis
+ lUpX = (lBackY * lRightZ - lBackZ * lRightY);
+ lUpY = (lBackZ * lRightX - lBackX * lRightZ);
+ lUpZ = (lBackX * lRightY - lBackY * lRightX);
+ var oldX = dirX;
+ var oldY = dirY;
+ var oldZ = dirZ;
+ // Use our 3 vectors to apply a change-of-basis matrix to the source direction
+ dirX = oldX * lRightX + oldY * lUpX + oldZ * lBackX;
+ dirY = oldX * lRightY + oldY * lUpY + oldZ * lBackY;
+ dirZ = oldX * lRightZ + oldY * lUpZ + oldZ * lBackZ;
+ oldX = posX;
+ oldY = posY;
+ oldZ = posZ;
+ // ...and to the source position
+ posX = oldX * lRightX + oldY * lUpX + oldZ * lBackX;
+ posY = oldX * lRightY + oldY * lUpY + oldZ * lBackY;
+ posZ = oldX * lRightZ + oldY * lUpZ + oldZ * lBackZ;
+ // The change-of-basis corrects the orientation, but the origin is still the listener.
+ // Translate the source position by the listener position to finish.
+ posX += lPosX;
+ posY += lPosY;
+ posZ += lPosZ;
+ }
+ if (panner.positionX) {
+ // Assigning to panner.positionX/Y/Z unnecessarily seems to cause performance issues
+ // See https://github.com/emscripten-core/emscripten/issues/15847
+ if (posX != panner.positionX.value) panner.positionX.value = posX;
+ if (posY != panner.positionY.value) panner.positionY.value = posY;
+ if (posZ != panner.positionZ.value) panner.positionZ.value = posZ;
+ } else {
+ panner.setPosition(posX, posY, posZ);
+ }
+ if (panner.orientationX) {
+ // Assigning to panner.orientation/Y/Z unnecessarily seems to cause performance issues
+ // See https://github.com/emscripten-core/emscripten/issues/15847
+ if (dirX != panner.orientationX.value) panner.orientationX.value = dirX;
+ if (dirY != panner.orientationY.value) panner.orientationY.value = dirY;
+ if (dirZ != panner.orientationZ.value) panner.orientationZ.value = dirZ;
+ } else {
+ panner.setOrientation(dirX, dirY, dirZ);
+ }
+ var oldShift = src.dopplerShift;
+ var velX = src.velocity[0];
+ var velY = src.velocity[1];
+ var velZ = src.velocity[2];
+ var lVelX = listener.velocity[0];
+ var lVelY = listener.velocity[1];
+ var lVelZ = listener.velocity[2];
+ if (posX === lPosX && posY === lPosY && posZ === lPosZ || velX === lVelX && velY === lVelY && velZ === lVelZ) {
+ src.dopplerShift = 1;
+ } else {
+ // Doppler algorithm from 1.1 spec
+ var speedOfSound = src.context.speedOfSound;
+ var dopplerFactor = src.context.dopplerFactor;
+ var slX = lPosX - posX;
+ var slY = lPosY - posY;
+ var slZ = lPosZ - posZ;
+ var magSl = Math.sqrt(slX * slX + slY * slY + slZ * slZ);
+ var vls = (slX * lVelX + slY * lVelY + slZ * lVelZ) / magSl;
+ var vss = (slX * velX + slY * velY + slZ * velZ) / magSl;
+ vls = Math.min(vls, speedOfSound / dopplerFactor);
+ vss = Math.min(vss, speedOfSound / dopplerFactor);
+ src.dopplerShift = (speedOfSound - dopplerFactor * vls) / (speedOfSound - dopplerFactor * vss);
+ }
+ if (src.dopplerShift !== oldShift) {
+ AL.updateSourceRate(src);
+ }
+ },
+ updateSourceRate: src => {
+ if (src.state === 4114) {
+ // clear scheduled buffers
+ AL.cancelPendingSourceAudio(src);
+ var audioSrc = src.audioQueue[0];
+ if (!audioSrc) {
+ return;
+ }
+ // It is possible that AL.scheduleContextAudio() has not yet fed the next buffer, if so, skip.
+ var duration;
+ if (src.type === 4136 && src.looping) {
+ duration = Number.POSITIVE_INFINITY;
+ } else {
+ // audioSrc._duration is expressed after factoring in playbackRate, so when changing playback rate, need
+ // to recompute/rescale the rate to the new playback speed.
+ duration = (audioSrc.buffer.duration - audioSrc._startOffset) / src.playbackRate;
+ }
+ audioSrc._duration = duration;
+ audioSrc.playbackRate.value = src.playbackRate;
+ // reschedule buffers with the new playbackRate
+ AL.scheduleSourceAudio(src);
+ }
+ },
+ sourceDuration: src => {
+ var length = 0;
+ for (var i = 0; i < src.bufQueue.length; i++) {
+ var audioBuf = src.bufQueue[i].audioBuf;
+ length += audioBuf ? audioBuf.duration : 0;
+ }
+ return length;
+ },
+ sourceTell: src => {
+ AL.updateSourceTime(src);
+ var offset = 0;
+ for (var i = 0; i < src.bufsProcessed; i++) {
+ if (src.bufQueue[i].audioBuf) {
+ offset += src.bufQueue[i].audioBuf.duration;
+ }
+ }
+ offset += src.bufOffset;
+ return offset;
+ },
+ sourceSeek: (src, offset) => {
+ var playing = src.state == 4114;
+ if (playing) {
+ AL.setSourceState(src, 4113);
+ }
+ if (src.bufQueue[src.bufsProcessed].audioBuf !== null) {
+ src.bufsProcessed = 0;
+ while (offset > src.bufQueue[src.bufsProcessed].audioBuf.duration) {
+ offset -= src.bufQueue[src.bufsProcessed].audioBuf.duration;
+ src.bufsProcessed++;
+ }
+ src.bufOffset = offset;
+ }
+ if (playing) {
+ AL.setSourceState(src, 4114);
+ }
+ },
+ getGlobalParam: (funcname, param) => {
+ if (!AL.currentCtx) {
+ return null;
+ }
+ switch (param) {
+ case 49152:
+ return AL.currentCtx.dopplerFactor;
+
+ case 49155:
+ return AL.currentCtx.speedOfSound;
+
+ case 53248:
+ return AL.currentCtx.distanceModel;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return null;
+ }
+ },
+ setGlobalParam: (funcname, param, value) => {
+ if (!AL.currentCtx) {
+ return;
+ }
+ switch (param) {
+ case 49152:
+ if (!Number.isFinite(value) || value < 0) {
+ // Strictly negative values are disallowed
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ AL.currentCtx.dopplerFactor = value;
+ AL.updateListenerSpace(AL.currentCtx);
+ break;
+
+ case 49155:
+ if (!Number.isFinite(value) || value <= 0) {
+ // Negative or zero values are disallowed
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ AL.currentCtx.speedOfSound = value;
+ AL.updateListenerSpace(AL.currentCtx);
+ break;
+
+ case 53248:
+ switch (value) {
+ case 0:
+ case 53249:
+ /* AL_INVERSE_DISTANCE */ case 53250:
+ /* AL_INVERSE_DISTANCE_CLAMPED */ case 53251:
+ /* AL_LINEAR_DISTANCE */ case 53252:
+ /* AL_LINEAR_DISTANCE_CLAMPED */ case 53253:
+ /* AL_EXPONENT_DISTANCE */ case 53254:
+ /* AL_EXPONENT_DISTANCE_CLAMPED */ AL.currentCtx.distanceModel = value;
+ AL.updateContextGlobal(AL.currentCtx);
+ break;
+
+ default:
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ break;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return;
+ }
+ },
+ getListenerParam: (funcname, param) => {
+ if (!AL.currentCtx) {
+ return null;
+ }
+ switch (param) {
+ case 4100:
+ return AL.currentCtx.listener.position;
+
+ case 4102:
+ return AL.currentCtx.listener.velocity;
+
+ case 4111:
+ return AL.currentCtx.listener.direction.concat(AL.currentCtx.listener.up);
+
+ case 4106:
+ return AL.currentCtx.gain.gain.value;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return null;
+ }
+ },
+ setListenerParam: (funcname, param, value) => {
+ if (!AL.currentCtx) {
+ return;
+ }
+ if (value === null) {
+ AL.currentCtx.err = 40962;
+ return;
+ }
+ var listener = AL.currentCtx.listener;
+ switch (param) {
+ case 4100:
+ if (!Number.isFinite(value[0]) || !Number.isFinite(value[1]) || !Number.isFinite(value[2])) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ listener.position[0] = value[0];
+ listener.position[1] = value[1];
+ listener.position[2] = value[2];
+ AL.updateListenerSpace(AL.currentCtx);
+ break;
+
+ case 4102:
+ if (!Number.isFinite(value[0]) || !Number.isFinite(value[1]) || !Number.isFinite(value[2])) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ listener.velocity[0] = value[0];
+ listener.velocity[1] = value[1];
+ listener.velocity[2] = value[2];
+ AL.updateListenerSpace(AL.currentCtx);
+ break;
+
+ case 4106:
+ if (!Number.isFinite(value) || value < 0) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ AL.currentCtx.gain.gain.value = value;
+ break;
+
+ case 4111:
+ if (!Number.isFinite(value[0]) || !Number.isFinite(value[1]) || !Number.isFinite(value[2]) || !Number.isFinite(value[3]) || !Number.isFinite(value[4]) || !Number.isFinite(value[5])) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ listener.direction[0] = value[0];
+ listener.direction[1] = value[1];
+ listener.direction[2] = value[2];
+ listener.up[0] = value[3];
+ listener.up[1] = value[4];
+ listener.up[2] = value[5];
+ AL.updateListenerSpace(AL.currentCtx);
+ break;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return;
+ }
+ },
+ getBufferParam: (funcname, bufferId, param) => {
+ if (!AL.currentCtx) {
+ return;
+ }
+ var buf = AL.buffers[bufferId];
+ if (!buf || bufferId === 0) {
+ AL.currentCtx.err = 40961;
+ return;
+ }
+ switch (param) {
+ case 8193:
+ /* AL_FREQUENCY */ return buf.frequency;
+
+ case 8194:
+ /* AL_BITS */ return buf.bytesPerSample * 8;
+
+ case 8195:
+ /* AL_CHANNELS */ return buf.channels;
+
+ case 8196:
+ /* AL_SIZE */ return buf.length * buf.bytesPerSample * buf.channels;
+
+ case 8213:
+ /* AL_LOOP_POINTS_SOFT */ if (buf.length === 0) {
+ return [ 0, 0 ];
+ }
+ return [ (buf.audioBuf._loopStart || 0) * buf.frequency, (buf.audioBuf._loopEnd || buf.length) * buf.frequency ];
+
+ default:
+ AL.currentCtx.err = 40962;
+ return null;
+ }
+ },
+ setBufferParam: (funcname, bufferId, param, value) => {
+ if (!AL.currentCtx) {
+ return;
+ }
+ var buf = AL.buffers[bufferId];
+ if (!buf || bufferId === 0) {
+ AL.currentCtx.err = 40961;
+ return;
+ }
+ if (value === null) {
+ AL.currentCtx.err = 40962;
+ return;
+ }
+ switch (param) {
+ case 8196:
+ /* AL_SIZE */ if (value !== 0) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ // Per the spec, setting AL_SIZE to 0 is a legal NOP.
+ break;
+
+ case 8213:
+ /* AL_LOOP_POINTS_SOFT */ if (value[0] < 0 || value[0] > buf.length || value[1] < 0 || value[1] > buf.Length || value[0] >= value[1]) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ if (buf.refCount > 0) {
+ AL.currentCtx.err = 40964;
+ return;
+ }
+ if (buf.audioBuf) {
+ buf.audioBuf._loopStart = value[0] / buf.frequency;
+ buf.audioBuf._loopEnd = value[1] / buf.frequency;
+ }
+ break;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return;
+ }
+ },
+ getSourceParam: (funcname, sourceId, param) => {
+ if (!AL.currentCtx) {
+ return null;
+ }
+ var src = AL.currentCtx.sources[sourceId];
+ if (!src) {
+ AL.currentCtx.err = 40961;
+ return null;
+ }
+ switch (param) {
+ case 514:
+ /* AL_SOURCE_RELATIVE */ return src.relative;
+
+ case 4097:
+ /* AL_CONE_INNER_ANGLE */ return src.coneInnerAngle;
+
+ case 4098:
+ /* AL_CONE_OUTER_ANGLE */ return src.coneOuterAngle;
+
+ case 4099:
+ /* AL_PITCH */ return src.pitch;
+
+ case 4100:
+ return src.position;
+
+ case 4101:
+ return src.direction;
+
+ case 4102:
+ return src.velocity;
+
+ case 4103:
+ /* AL_LOOPING */ return src.looping;
+
+ case 4105:
+ /* AL_BUFFER */ if (src.type === 4136) {
+ return src.bufQueue[0].id;
+ }
+ return 0;
+
+ case 4106:
+ return src.gain.gain.value;
+
+ case 4109:
+ /* AL_MIN_GAIN */ return src.minGain;
+
+ case 4110:
+ /* AL_MAX_GAIN */ return src.maxGain;
+
+ case 4112:
+ /* AL_SOURCE_STATE */ return src.state;
+
+ case 4117:
+ /* AL_BUFFERS_QUEUED */ if (src.bufQueue.length === 1 && src.bufQueue[0].id === 0) {
+ return 0;
+ }
+ return src.bufQueue.length;
+
+ case 4118:
+ /* AL_BUFFERS_PROCESSED */ if ((src.bufQueue.length === 1 && src.bufQueue[0].id === 0) || src.looping) {
+ return 0;
+ }
+ return src.bufsProcessed;
+
+ case 4128:
+ /* AL_REFERENCE_DISTANCE */ return src.refDistance;
+
+ case 4129:
+ /* AL_ROLLOFF_FACTOR */ return src.rolloffFactor;
+
+ case 4130:
+ /* AL_CONE_OUTER_GAIN */ return src.coneOuterGain;
+
+ case 4131:
+ /* AL_MAX_DISTANCE */ return src.maxDistance;
+
+ case 4132:
+ /* AL_SEC_OFFSET */ return AL.sourceTell(src);
+
+ case 4133:
+ /* AL_SAMPLE_OFFSET */ var offset = AL.sourceTell(src);
+ if (offset > 0) {
+ offset *= src.bufQueue[0].frequency;
+ }
+ return offset;
+
+ case 4134:
+ /* AL_BYTE_OFFSET */ var offset = AL.sourceTell(src);
+ if (offset > 0) {
+ offset *= src.bufQueue[0].frequency * src.bufQueue[0].bytesPerSample;
+ }
+ return offset;
+
+ case 4135:
+ /* AL_SOURCE_TYPE */ return src.type;
+
+ case 4628:
+ /* AL_SOURCE_SPATIALIZE_SOFT */ return src.spatialize;
+
+ case 8201:
+ /* AL_BYTE_LENGTH_SOFT */ var length = 0;
+ var bytesPerFrame = 0;
+ for (var i = 0; i < src.bufQueue.length; i++) {
+ length += src.bufQueue[i].length;
+ if (src.bufQueue[i].id !== 0) {
+ bytesPerFrame = src.bufQueue[i].bytesPerSample * src.bufQueue[i].channels;
+ }
+ }
+ return length * bytesPerFrame;
+
+ case 8202:
+ /* AL_SAMPLE_LENGTH_SOFT */ var length = 0;
+ for (var i = 0; i < src.bufQueue.length; i++) {
+ length += src.bufQueue[i].length;
+ }
+ return length;
+
+ case 8203:
+ /* AL_SEC_LENGTH_SOFT */ return AL.sourceDuration(src);
+
+ case 53248:
+ return src.distanceModel;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return null;
+ }
+ },
+ setSourceParam: (funcname, sourceId, param, value) => {
+ if (!AL.currentCtx) {
+ return;
+ }
+ var src = AL.currentCtx.sources[sourceId];
+ if (!src) {
+ AL.currentCtx.err = 40961;
+ return;
+ }
+ if (value === null) {
+ AL.currentCtx.err = 40962;
+ return;
+ }
+ switch (param) {
+ case 514:
+ /* AL_SOURCE_RELATIVE */ if (value === 1) {
+ src.relative = true;
+ AL.updateSourceSpace(src);
+ } else if (value === 0) {
+ src.relative = false;
+ AL.updateSourceSpace(src);
+ } else {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ break;
+
+ case 4097:
+ /* AL_CONE_INNER_ANGLE */ if (!Number.isFinite(value)) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.coneInnerAngle = value;
+ if (src.panner) {
+ src.panner.coneInnerAngle = value % 360;
+ }
+ break;
+
+ case 4098:
+ /* AL_CONE_OUTER_ANGLE */ if (!Number.isFinite(value)) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.coneOuterAngle = value;
+ if (src.panner) {
+ src.panner.coneOuterAngle = value % 360;
+ }
+ break;
+
+ case 4099:
+ /* AL_PITCH */ if (!Number.isFinite(value) || value <= 0) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ if (src.pitch === value) {
+ break;
+ }
+ src.pitch = value;
+ AL.updateSourceRate(src);
+ break;
+
+ case 4100:
+ if (!Number.isFinite(value[0]) || !Number.isFinite(value[1]) || !Number.isFinite(value[2])) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.position[0] = value[0];
+ src.position[1] = value[1];
+ src.position[2] = value[2];
+ AL.updateSourceSpace(src);
+ break;
+
+ case 4101:
+ if (!Number.isFinite(value[0]) || !Number.isFinite(value[1]) || !Number.isFinite(value[2])) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.direction[0] = value[0];
+ src.direction[1] = value[1];
+ src.direction[2] = value[2];
+ AL.updateSourceSpace(src);
+ break;
+
+ case 4102:
+ if (!Number.isFinite(value[0]) || !Number.isFinite(value[1]) || !Number.isFinite(value[2])) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.velocity[0] = value[0];
+ src.velocity[1] = value[1];
+ src.velocity[2] = value[2];
+ AL.updateSourceSpace(src);
+ break;
+
+ case 4103:
+ /* AL_LOOPING */ if (value === 1) {
+ src.looping = true;
+ AL.updateSourceTime(src);
+ if (src.type === 4136 && src.audioQueue.length > 0) {
+ var audioSrc = src.audioQueue[0];
+ audioSrc.loop = true;
+ audioSrc._duration = Number.POSITIVE_INFINITY;
+ }
+ } else if (value === 0) {
+ src.looping = false;
+ var currentTime = AL.updateSourceTime(src);
+ if (src.type === 4136 && src.audioQueue.length > 0) {
+ var audioSrc = src.audioQueue[0];
+ audioSrc.loop = false;
+ audioSrc._duration = src.bufQueue[0].audioBuf.duration / src.playbackRate;
+ audioSrc._startTime = currentTime - src.bufOffset / src.playbackRate;
+ }
+ } else {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ break;
+
+ case 4105:
+ /* AL_BUFFER */ if (src.state === 4114 || src.state === 4115) {
+ AL.currentCtx.err = 40964;
+ return;
+ }
+ if (value === 0) {
+ for (var i in src.bufQueue) {
+ src.bufQueue[i].refCount--;
+ }
+ src.bufQueue.length = 1;
+ src.bufQueue[0] = AL.buffers[0];
+ src.bufsProcessed = 0;
+ src.type = 4144;
+ } else /* AL_UNDETERMINED */ {
+ var buf = AL.buffers[value];
+ if (!buf) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ for (var i in src.bufQueue) {
+ src.bufQueue[i].refCount--;
+ }
+ src.bufQueue.length = 0;
+ buf.refCount++;
+ src.bufQueue = [ buf ];
+ src.bufsProcessed = 0;
+ src.type = 4136;
+ }
+ AL.initSourcePanner(src);
+ AL.scheduleSourceAudio(src);
+ break;
+
+ case 4106:
+ if (!Number.isFinite(value) || value < 0) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.gain.gain.value = value;
+ break;
+
+ case 4109:
+ /* AL_MIN_GAIN */ if (!Number.isFinite(value) || value < 0 || value > Math.min(src.maxGain, 1)) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.minGain = value;
+ break;
+
+ case 4110:
+ /* AL_MAX_GAIN */ if (!Number.isFinite(value) || value < Math.max(0, src.minGain) || value > 1) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.maxGain = value;
+ break;
+
+ case 4128:
+ /* AL_REFERENCE_DISTANCE */ if (!Number.isFinite(value) || value < 0) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.refDistance = value;
+ if (src.panner) {
+ src.panner.refDistance = value;
+ }
+ break;
+
+ case 4129:
+ /* AL_ROLLOFF_FACTOR */ if (!Number.isFinite(value) || value < 0) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.rolloffFactor = value;
+ if (src.panner) {
+ src.panner.rolloffFactor = value;
+ }
+ break;
+
+ case 4130:
+ /* AL_CONE_OUTER_GAIN */ if (!Number.isFinite(value) || value < 0 || value > 1) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.coneOuterGain = value;
+ if (src.panner) {
+ src.panner.coneOuterGain = value;
+ }
+ break;
+
+ case 4131:
+ /* AL_MAX_DISTANCE */ if (!Number.isFinite(value) || value < 0) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.maxDistance = value;
+ if (src.panner) {
+ src.panner.maxDistance = value;
+ }
+ break;
+
+ case 4132:
+ /* AL_SEC_OFFSET */ if (value < 0 || value > AL.sourceDuration(src)) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ AL.sourceSeek(src, value);
+ break;
+
+ case 4133:
+ /* AL_SAMPLE_OFFSET */ var srcLen = AL.sourceDuration(src);
+ if (srcLen > 0) {
+ var frequency;
+ for (var bufId in src.bufQueue) {
+ if (bufId) {
+ frequency = src.bufQueue[bufId].frequency;
+ break;
+ }
+ }
+ value /= frequency;
+ }
+ if (value < 0 || value > srcLen) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ AL.sourceSeek(src, value);
+ break;
+
+ case 4134:
+ /* AL_BYTE_OFFSET */ var srcLen = AL.sourceDuration(src);
+ if (srcLen > 0) {
+ var bytesPerSec;
+ for (var bufId in src.bufQueue) {
+ if (bufId) {
+ var buf = src.bufQueue[bufId];
+ bytesPerSec = buf.frequency * buf.bytesPerSample * buf.channels;
+ break;
+ }
+ }
+ value /= bytesPerSec;
+ }
+ if (value < 0 || value > srcLen) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ AL.sourceSeek(src, value);
+ break;
+
+ case 4628:
+ /* AL_SOURCE_SPATIALIZE_SOFT */ if (value !== 0 && value !== 1 && value !== 2) /* AL_AUTO_SOFT */ {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ src.spatialize = value;
+ AL.initSourcePanner(src);
+ break;
+
+ case 8201:
+ /* AL_BYTE_LENGTH_SOFT */ case 8202:
+ /* AL_SAMPLE_LENGTH_SOFT */ case 8203:
+ /* AL_SEC_LENGTH_SOFT */ AL.currentCtx.err = 40964;
+ break;
+
+ case 53248:
+ switch (value) {
+ case 0:
+ case 53249:
+ /* AL_INVERSE_DISTANCE */ case 53250:
+ /* AL_INVERSE_DISTANCE_CLAMPED */ case 53251:
+ /* AL_LINEAR_DISTANCE */ case 53252:
+ /* AL_LINEAR_DISTANCE_CLAMPED */ case 53253:
+ /* AL_EXPONENT_DISTANCE */ case 53254:
+ /* AL_EXPONENT_DISTANCE_CLAMPED */ src.distanceModel = value;
+ if (AL.currentCtx.sourceDistanceModel) {
+ AL.updateContextGlobal(AL.currentCtx);
+ }
+ break;
+
+ default:
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ break;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return;
+ }
+ },
+ captures: {},
+ sharedCaptureAudioCtx: null,
+ requireValidCaptureDevice: (deviceId, funcname) => {
+ if (deviceId === 0) {
+ AL.alcErr = 40961;
+ return null;
+ }
+ var c = AL.captures[deviceId];
+ if (!c) {
+ AL.alcErr = 40961;
+ return null;
+ }
+ var err = c.mediaStreamError;
+ if (err) {
+ AL.alcErr = 40961;
+ return null;
+ }
+ return c;
+ }
+};
+
+function _alDeleteBuffers(count, pBufferIds) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(22, 0, 1, count, pBufferIds);
+ if (!AL.currentCtx) {
+ return;
+ }
+ for (var i = 0; i < count; ++i) {
+ var bufId = GROWABLE_HEAP_I32()[(((pBufferIds) + (i * 4)) >> 2)];
+ /// Deleting the zero buffer is a legal NOP, so ignore it
+ if (bufId === 0) {
+ continue;
+ }
+ // Make sure the buffer index is valid.
+ if (!AL.buffers[bufId]) {
+ AL.currentCtx.err = 40961;
+ return;
+ }
+ // Make sure the buffer is no longer in use.
+ if (AL.buffers[bufId].refCount) {
+ AL.currentCtx.err = 40964;
+ return;
+ }
+ }
+ for (var i = 0; i < count; ++i) {
+ var bufId = GROWABLE_HEAP_I32()[(((pBufferIds) + (i * 4)) >> 2)];
+ if (bufId === 0) {
+ continue;
+ }
+ AL.deviceRefCounts[AL.buffers[bufId].deviceId]--;
+ delete AL.buffers[bufId];
+ AL.freeIds.push(bufId);
+ }
+}
+
+function _alGetError() {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(23, 0, 1);
+ if (!AL.currentCtx) {
+ return 40964;
+ }
+ // Reset error on get.
+ var err = AL.currentCtx.err;
+ AL.currentCtx.err = 0;
+ return err;
+}
+
+function _alGetSourcei(sourceId, param, pValue) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(24, 0, 1, sourceId, param, pValue);
+ var val = AL.getSourceParam("alGetSourcei", sourceId, param);
+ if (val === null) {
+ return;
+ }
+ if (!pValue) {
+ AL.currentCtx.err = 40963;
+ return;
+ }
+ switch (param) {
+ case 514:
+ /* AL_SOURCE_RELATIVE */ case 4097:
+ /* AL_CONE_INNER_ANGLE */ case 4098:
+ /* AL_CONE_OUTER_ANGLE */ case 4103:
+ /* AL_LOOPING */ case 4105:
+ /* AL_BUFFER */ case 4112:
+ /* AL_SOURCE_STATE */ case 4117:
+ /* AL_BUFFERS_QUEUED */ case 4118:
+ /* AL_BUFFERS_PROCESSED */ case 4128:
+ /* AL_REFERENCE_DISTANCE */ case 4129:
+ /* AL_ROLLOFF_FACTOR */ case 4131:
+ /* AL_MAX_DISTANCE */ case 4132:
+ /* AL_SEC_OFFSET */ case 4133:
+ /* AL_SAMPLE_OFFSET */ case 4134:
+ /* AL_BYTE_OFFSET */ case 4135:
+ /* AL_SOURCE_TYPE */ case 4628:
+ /* AL_SOURCE_SPATIALIZE_SOFT */ case 8201:
+ /* AL_BYTE_LENGTH_SOFT */ case 8202:
+ /* AL_SAMPLE_LENGTH_SOFT */ case 53248:
+ GROWABLE_HEAP_I32()[((pValue) >> 2)] = val;
+ break;
+
+ default:
+ AL.currentCtx.err = 40962;
+ return;
+ }
+}
+
+function _alIsBuffer(bufferId) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(25, 0, 1, bufferId);
+ if (!AL.currentCtx) {
+ return false;
+ }
+ if (bufferId > AL.buffers.length) {
+ return false;
+ }
+ if (!AL.buffers[bufferId]) {
+ return false;
+ }
+ return true;
+}
+
+function _alSourcePause(sourceId) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(26, 0, 1, sourceId);
+ if (!AL.currentCtx) {
+ return;
+ }
+ var src = AL.currentCtx.sources[sourceId];
+ if (!src) {
+ AL.currentCtx.err = 40961;
+ return;
+ }
+ AL.setSourceState(src, 4115);
+}
+
+function _alSourcePlay(sourceId) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(27, 0, 1, sourceId);
+ if (!AL.currentCtx) {
+ return;
+ }
+ var src = AL.currentCtx.sources[sourceId];
+ if (!src) {
+ AL.currentCtx.err = 40961;
+ return;
+ }
+ AL.setSourceState(src, 4114);
+}
+
+function _alSourceStop(sourceId) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(28, 0, 1, sourceId);
+ if (!AL.currentCtx) {
+ return;
+ }
+ var src = AL.currentCtx.sources[sourceId];
+ if (!src) {
+ AL.currentCtx.err = 40961;
+ return;
+ }
+ AL.setSourceState(src, 4116);
+}
+
+function _alSourcei(sourceId, param, value) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(29, 0, 1, sourceId, param, value);
+ switch (param) {
+ case 514:
+ /* AL_SOURCE_RELATIVE */ case 4097:
+ /* AL_CONE_INNER_ANGLE */ case 4098:
+ /* AL_CONE_OUTER_ANGLE */ case 4103:
+ /* AL_LOOPING */ case 4105:
+ /* AL_BUFFER */ case 4128:
+ /* AL_REFERENCE_DISTANCE */ case 4129:
+ /* AL_ROLLOFF_FACTOR */ case 4131:
+ /* AL_MAX_DISTANCE */ case 4132:
+ /* AL_SEC_OFFSET */ case 4133:
+ /* AL_SAMPLE_OFFSET */ case 4134:
+ /* AL_BYTE_OFFSET */ case 4628:
+ /* AL_SOURCE_SPATIALIZE_SOFT */ case 8201:
+ /* AL_BYTE_LENGTH_SOFT */ case 8202:
+ /* AL_SAMPLE_LENGTH_SOFT */ case 53248:
+ AL.setSourceParam("alSourcei", sourceId, param, value);
+ break;
+
+ default:
+ AL.setSourceParam("alSourcei", sourceId, param, null);
+ break;
+ }
+}
+
+var readEmAsmArgsArray = [];
+
+var readEmAsmArgs = (sigPtr, buf) => {
+ readEmAsmArgsArray.length = 0;
+ var ch;
+ // Most arguments are i32s, so shift the buffer pointer so it is a plain
+ // index into HEAP32.
+ while (ch = GROWABLE_HEAP_U8()[sigPtr++]) {
+ // Floats are always passed as doubles, so all types except for 'i'
+ // are 8 bytes and require alignment.
+ var wide = (ch != 105);
+ wide &= (ch != 112);
+ buf += wide && (buf % 8) ? 4 : 0;
+ readEmAsmArgsArray.push(// Special case for pointers under wasm64 or CAN_ADDRESS_2GB mode.
+ ch == 112 ? GROWABLE_HEAP_U32()[((buf) >> 2)] : ch == 105 ? GROWABLE_HEAP_I32()[((buf) >> 2)] : GROWABLE_HEAP_F64()[((buf) >> 3)]);
+ buf += wide ? 8 : 4;
+ }
+ return readEmAsmArgsArray;
+};
+
+var runEmAsmFunction = (code, sigPtr, argbuf) => {
+ var args = readEmAsmArgs(sigPtr, argbuf);
+ return ASM_CONSTS[code](...args);
+};
+
+var _emscripten_asm_const_int = (code, sigPtr, argbuf) => runEmAsmFunction(code, sigPtr, argbuf);
+
+var _emscripten_asm_const_ptr = (code, sigPtr, argbuf) => runEmAsmFunction(code, sigPtr, argbuf);
+
+var _emscripten_cancel_main_loop = () => {
+ MainLoop.pause();
+ MainLoop.func = null;
+};
+
+var warnOnce = text => {
+ warnOnce.shown ||= {};
+ if (!warnOnce.shown[text]) {
+ warnOnce.shown[text] = 1;
+ if (ENVIRONMENT_IS_NODE) text = "warning: " + text;
+ err(text);
+ }
+};
+
+var _emscripten_check_blocking_allowed = () => {};
+
+var _emscripten_date_now = () => Date.now();
+
+var _emscripten_exit_with_live_runtime = () => {
+ runtimeKeepalivePush();
+ throw "unwind";
+};
+
+var JSEvents = {
+ memcpy(target, src, size) {
+ GROWABLE_HEAP_I8().set(GROWABLE_HEAP_I8().subarray(src, src + size), target);
+ },
+ removeAllEventListeners() {
+ while (JSEvents.eventHandlers.length) {
+ JSEvents._removeHandler(JSEvents.eventHandlers.length - 1);
+ }
+ JSEvents.deferredCalls = [];
+ },
+ inEventHandler: 0,
+ deferredCalls: [],
+ deferCall(targetFunction, precedence, argsList) {
+ function arraysHaveEqualContent(arrA, arrB) {
+ if (arrA.length != arrB.length) return false;
+ for (var i in arrA) {
+ if (arrA[i] != arrB[i]) return false;
+ }
+ return true;
+ }
+ // Test if the given call was already queued, and if so, don't add it again.
+ for (var call of JSEvents.deferredCalls) {
+ if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
+ return;
+ }
+ }
+ JSEvents.deferredCalls.push({
+ targetFunction,
+ precedence,
+ argsList
+ });
+ JSEvents.deferredCalls.sort((x, y) => x.precedence < y.precedence);
+ },
+ removeDeferredCalls(targetFunction) {
+ JSEvents.deferredCalls = JSEvents.deferredCalls.filter(call => call.targetFunction != targetFunction);
+ },
+ canPerformEventHandlerRequests() {
+ if (navigator.userActivation) {
+ // Verify against transient activation status from UserActivation API
+ // whether it is possible to perform a request here without needing to defer. See
+ // https://developer.mozilla.org/en-US/docs/Web/Security/User_activation#transient_activation
+ // and https://caniuse.com/mdn-api_useractivation
+ // At the time of writing, Firefox does not support this API: https://bugzilla.mozilla.org/show_bug.cgi?id=1791079
+ return navigator.userActivation.isActive;
+ }
+ return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
+ },
+ runDeferredCalls() {
+ if (!JSEvents.canPerformEventHandlerRequests()) {
+ return;
+ }
+ var deferredCalls = JSEvents.deferredCalls;
+ JSEvents.deferredCalls = [];
+ for (var call of deferredCalls) {
+ call.targetFunction(...call.argsList);
+ }
+ },
+ eventHandlers: [],
+ removeAllHandlersOnTarget: (target, eventTypeString) => {
+ for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ },
+ _removeHandler(i) {
+ var h = JSEvents.eventHandlers[i];
+ h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
+ JSEvents.eventHandlers.splice(i, 1);
+ },
+ registerOrRemoveHandler(eventHandler) {
+ if (!eventHandler.target) {
+ return -4;
+ }
+ if (eventHandler.callbackfunc) {
+ eventHandler.eventListenerFunc = function(event) {
+ // Increment nesting count for the event handler.
+ ++JSEvents.inEventHandler;
+ JSEvents.currentEventHandler = eventHandler;
+ // Process any old deferred calls the user has placed.
+ JSEvents.runDeferredCalls();
+ // Process the actual event, calls back to user C code handler.
+ eventHandler.handlerFunc(event);
+ // Process any new deferred calls that were placed right now from this event handler.
+ JSEvents.runDeferredCalls();
+ // Out of event handler - restore nesting count.
+ --JSEvents.inEventHandler;
+ };
+ eventHandler.target.addEventListener(eventHandler.eventTypeString, eventHandler.eventListenerFunc, eventHandler.useCapture);
+ JSEvents.eventHandlers.push(eventHandler);
+ } else {
+ for (var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ }
+ return 0;
+ },
+ getTargetThreadForEventCallback(targetThread) {
+ switch (targetThread) {
+ case 1:
+ // The event callback for the current event should be called on the
+ // main browser thread. (0 == don't proxy)
+ return 0;
+
+ case 2:
+ // The event callback for the current event should be backproxied to
+ // the thread that is registering the event.
+ // This can be 0 in the case that the caller uses
+ // EM_CALLBACK_THREAD_CONTEXT_CALLING_THREAD but on the main thread
+ // itself.
+ return PThread.currentProxiedOperationCallerThread;
+
+ default:
+ // The event callback for the current event should be proxied to the
+ // given specific thread.
+ return targetThread;
+ }
+ },
+ getNodeNameForTarget(target) {
+ if (!target) return "";
+ if (target == window) return "#window";
+ if (target == screen) return "#screen";
+ return target?.nodeName || "";
+ },
+ fullscreenEnabled() {
+ return document.fullscreenEnabled || // Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitFullscreenEnabled.
+ // TODO: If Safari at some point ships with unprefixed version, update the version check above.
+ document.webkitFullscreenEnabled;
+ }
+};
+
+var maybeCStringToJsString = cString => cString > 2 ? UTF8ToString(cString) : cString;
+
+/** @type {Object} */ var specialHTMLTargets = [ 0, typeof document != "undefined" ? document : 0, typeof window != "undefined" ? window : 0 ];
+
+/** @suppress {duplicate } */ var findEventTarget = target => {
+ target = maybeCStringToJsString(target);
+ var domElement = specialHTMLTargets[target] || (typeof document != "undefined" ? document.querySelector(target) : null);
+ return domElement;
+};
+
+var findCanvasEventTarget = findEventTarget;
+
+var getCanvasSizeCallingThread = (target, width, height) => {
+ var canvas = findCanvasEventTarget(target);
+ if (!canvas) return -4;
+ if (!canvas.controlTransferredOffscreen) {
+ GROWABLE_HEAP_I32()[((width) >> 2)] = canvas.width;
+ GROWABLE_HEAP_I32()[((height) >> 2)] = canvas.height;
+ } else {
+ return -4;
+ }
+ return 0;
+};
+
+function getCanvasSizeMainThread(target, width, height) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(30, 0, 1, target, width, height);
+ return getCanvasSizeCallingThread(target, width, height);
+}
+
+var _emscripten_get_canvas_element_size = (target, width, height) => {
+ var canvas = findCanvasEventTarget(target);
+ if (canvas) {
+ return getCanvasSizeCallingThread(target, width, height);
+ }
+ return getCanvasSizeMainThread(target, width, height);
+};
+
+var getBoundingClientRect = e => specialHTMLTargets.indexOf(e) < 0 ? e.getBoundingClientRect() : {
+ "left": 0,
+ "top": 0
+};
+
+function _emscripten_get_element_css_size(target, width, height) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(31, 0, 1, target, width, height);
+ target = findEventTarget(target);
+ if (!target) return -4;
+ var rect = getBoundingClientRect(target);
+ GROWABLE_HEAP_F64()[((width) >> 3)] = rect.width;
+ GROWABLE_HEAP_F64()[((height) >> 3)] = rect.height;
+ return 0;
+}
+
+var getHeapMax = () => // Stay one Wasm page short of 4GB: while e.g. Chrome is able to allocate
+// full 4GB Wasm memories, the size will wrap back to 0 bytes in Wasm side
+// for any code that deals with heap sizes, which would require special
+// casing all heap size related code to treat 0 specially.
+2147483648;
+
+var _emscripten_get_heap_max = () => getHeapMax();
+
+var GLctx;
+
+var webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance = ctx => // Closure is expected to be allowed to minify the '.dibvbi' property, so not accessing it quoted.
+!!(ctx.dibvbi = ctx.getExtension("WEBGL_draw_instanced_base_vertex_base_instance"));
+
+var webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance = ctx => !!(ctx.mdibvbi = ctx.getExtension("WEBGL_multi_draw_instanced_base_vertex_base_instance"));
+
+var webgl_enable_EXT_polygon_offset_clamp = ctx => !!(ctx.extPolygonOffsetClamp = ctx.getExtension("EXT_polygon_offset_clamp"));
+
+var webgl_enable_EXT_clip_control = ctx => !!(ctx.extClipControl = ctx.getExtension("EXT_clip_control"));
+
+var webgl_enable_WEBGL_polygon_mode = ctx => !!(ctx.webglPolygonMode = ctx.getExtension("WEBGL_polygon_mode"));
+
+var webgl_enable_WEBGL_multi_draw = ctx => // Closure is expected to be allowed to minify the '.multiDrawWebgl' property, so not accessing it quoted.
+!!(ctx.multiDrawWebgl = ctx.getExtension("WEBGL_multi_draw"));
+
+var getEmscriptenSupportedExtensions = ctx => {
+ // Restrict the list of advertised extensions to those that we actually
+ // support.
+ var supportedExtensions = [ // WebGL 2 extensions
+ "EXT_color_buffer_float", "EXT_conservative_depth", "EXT_disjoint_timer_query_webgl2", "EXT_texture_norm16", "NV_shader_noperspective_interpolation", "WEBGL_clip_cull_distance", // WebGL 1 and WebGL 2 extensions
+ "EXT_clip_control", "EXT_color_buffer_half_float", "EXT_depth_clamp", "EXT_float_blend", "EXT_polygon_offset_clamp", "EXT_texture_compression_bptc", "EXT_texture_compression_rgtc", "EXT_texture_filter_anisotropic", "KHR_parallel_shader_compile", "OES_texture_float_linear", "WEBGL_blend_func_extended", "WEBGL_compressed_texture_astc", "WEBGL_compressed_texture_etc", "WEBGL_compressed_texture_etc1", "WEBGL_compressed_texture_s3tc", "WEBGL_compressed_texture_s3tc_srgb", "WEBGL_debug_renderer_info", "WEBGL_debug_shaders", "WEBGL_lose_context", "WEBGL_multi_draw", "WEBGL_polygon_mode" ];
+ // .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
+ return (ctx.getSupportedExtensions() || []).filter(ext => supportedExtensions.includes(ext));
+};
+
+var GL = {
+ counter: 1,
+ buffers: [],
+ programs: [],
+ framebuffers: [],
+ renderbuffers: [],
+ textures: [],
+ shaders: [],
+ vaos: [],
+ contexts: {},
+ offscreenCanvases: {},
+ queries: [],
+ samplers: [],
+ transformFeedbacks: [],
+ syncs: [],
+ stringCache: {},
+ stringiCache: {},
+ unpackAlignment: 4,
+ unpackRowLength: 0,
+ recordError: errorCode => {
+ if (!GL.lastError) {
+ GL.lastError = errorCode;
+ }
+ },
+ getNewId: table => {
+ var ret = GL.counter++;
+ for (var i = table.length; i < ret; i++) {
+ table[i] = null;
+ }
+ return ret;
+ },
+ genObject: (n, buffers, createFunction, objectTable) => {
+ for (var i = 0; i < n; i++) {
+ var buffer = GLctx[createFunction]();
+ var id = buffer && GL.getNewId(objectTable);
+ if (buffer) {
+ buffer.name = id;
+ objectTable[id] = buffer;
+ } else {
+ GL.recordError(1282);
+ }
+ GROWABLE_HEAP_I32()[(((buffers) + (i * 4)) >> 2)] = id;
+ }
+ },
+ getSource: (shader, count, string, length) => {
+ var source = "";
+ for (var i = 0; i < count; ++i) {
+ var len = length ? GROWABLE_HEAP_U32()[(((length) + (i * 4)) >> 2)] : undefined;
+ source += UTF8ToString(GROWABLE_HEAP_U32()[(((string) + (i * 4)) >> 2)], len);
+ }
+ return source;
+ },
+ createContext: (/** @type {HTMLCanvasElement} */ canvas, webGLContextAttributes) => {
+ // BUG: Workaround Safari WebGL issue: After successfully acquiring WebGL
+ // context on a canvas, calling .getContext() will always return that
+ // context independent of which 'webgl' or 'webgl2'
+ // context version was passed. See:
+ // https://bugs.webkit.org/show_bug.cgi?id=222758
+ // and:
+ // https://github.com/emscripten-core/emscripten/issues/13295.
+ // TODO: Once the bug is fixed and shipped in Safari, adjust the Safari
+ // version field in above check.
+ if (!canvas.getContextSafariWebGL2Fixed) {
+ canvas.getContextSafariWebGL2Fixed = canvas.getContext;
+ /** @type {function(this:HTMLCanvasElement, string, (Object|null)=): (Object|null)} */ function fixedGetContext(ver, attrs) {
+ var gl = canvas.getContextSafariWebGL2Fixed(ver, attrs);
+ return ((ver == "webgl") == (gl instanceof WebGLRenderingContext)) ? gl : null;
+ }
+ canvas.getContext = fixedGetContext;
+ }
+ var ctx = canvas.getContext("webgl2", webGLContextAttributes);
+ if (!ctx) return 0;
+ var handle = GL.registerContext(ctx, webGLContextAttributes);
+ return handle;
+ },
+ registerContext: (ctx, webGLContextAttributes) => {
+ // with pthreads a context is a location in memory with some synchronized
+ // data between threads
+ var handle = _malloc(8);
+ GROWABLE_HEAP_U32()[(((handle) + (4)) >> 2)] = _pthread_self();
+ // the thread pointer of the thread that owns the control of the context
+ var context = {
+ handle,
+ attributes: webGLContextAttributes,
+ version: webGLContextAttributes.majorVersion,
+ GLctx: ctx
+ };
+ // Store the created context object so that we can access the context
+ // given a canvas without having to pass the parameters again.
+ if (ctx.canvas) ctx.canvas.GLctxObject = context;
+ GL.contexts[handle] = context;
+ if (typeof webGLContextAttributes.enableExtensionsByDefault == "undefined" || webGLContextAttributes.enableExtensionsByDefault) {
+ GL.initExtensions(context);
+ }
+ return handle;
+ },
+ makeContextCurrent: contextHandle => {
+ // Active Emscripten GL layer context object.
+ GL.currentContext = GL.contexts[contextHandle];
+ // Active WebGL context object.
+ Module["ctx"] = GLctx = GL.currentContext?.GLctx;
+ return !(contextHandle && !GLctx);
+ },
+ getContext: contextHandle => GL.contexts[contextHandle],
+ deleteContext: contextHandle => {
+ if (GL.currentContext === GL.contexts[contextHandle]) {
+ GL.currentContext = null;
+ }
+ if (typeof JSEvents == "object") {
+ // Release all JS event handlers on the DOM element that the GL context is
+ // associated with since the context is now deleted.
+ JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);
+ }
+ // Make sure the canvas object no longer refers to the context object so
+ // there are no GC surprises.
+ if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) {
+ GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined;
+ }
+ _free(GL.contexts[contextHandle].handle);
+ GL.contexts[contextHandle] = null;
+ },
+ initExtensions: context => {
+ // If this function is called without a specific context object, init the
+ // extensions of the currently active context.
+ context ||= GL.currentContext;
+ if (context.initExtensionsDone) return;
+ context.initExtensionsDone = true;
+ var GLctx = context.GLctx;
+ // Detect the presence of a few extensions manually, ction GL interop
+ // layer itself will need to know if they exist.
+ // Extensions that are available in both WebGL 1 and WebGL 2
+ webgl_enable_WEBGL_multi_draw(GLctx);
+ webgl_enable_EXT_polygon_offset_clamp(GLctx);
+ webgl_enable_EXT_clip_control(GLctx);
+ webgl_enable_WEBGL_polygon_mode(GLctx);
+ // Extensions that are available from WebGL >= 2 (no-op if called on a WebGL 1 context active)
+ webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx);
+ webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx);
+ // On WebGL 2, EXT_disjoint_timer_query is replaced with an alternative
+ // that's based on core APIs, and exposes only the queryCounterEXT()
+ // entrypoint.
+ if (context.version >= 2) {
+ GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query_webgl2");
+ }
+ // However, Firefox exposes the WebGL 1 version on WebGL 2 as well and
+ // thus we look for the WebGL 1 version again if the WebGL 2 version
+ // isn't present. https://bugzilla.mozilla.org/show_bug.cgi?id=1328882
+ if (context.version < 2 || !GLctx.disjointTimerQueryExt) {
+ GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
+ }
+ getEmscriptenSupportedExtensions(GLctx).forEach(ext => {
+ // WEBGL_lose_context, WEBGL_debug_renderer_info and WEBGL_debug_shaders
+ // are not enabled by default.
+ if (!ext.includes("lose_context") && !ext.includes("debug")) {
+ // Call .getExtension() to enable that extension permanently.
+ GLctx.getExtension(ext);
+ }
+ });
+ }
+};
+
+/** @suppress {duplicate } */ var _glActiveTexture = x0 => GLctx.activeTexture(x0);
+
+var _emscripten_glActiveTexture = _glActiveTexture;
+
+/** @suppress {duplicate } */ var _glAttachShader = (program, shader) => {
+ GLctx.attachShader(GL.programs[program], GL.shaders[shader]);
+};
+
+var _emscripten_glAttachShader = _glAttachShader;
+
+/** @suppress {duplicate } */ var _glBeginQuery = (target, id) => {
+ GLctx.beginQuery(target, GL.queries[id]);
+};
+
+var _emscripten_glBeginQuery = _glBeginQuery;
+
+/** @suppress {duplicate } */ var _glBeginQueryEXT = (target, id) => {
+ GLctx.disjointTimerQueryExt["beginQueryEXT"](target, GL.queries[id]);
+};
+
+var _emscripten_glBeginQueryEXT = _glBeginQueryEXT;
+
+/** @suppress {duplicate } */ var _glBeginTransformFeedback = x0 => GLctx.beginTransformFeedback(x0);
+
+var _emscripten_glBeginTransformFeedback = _glBeginTransformFeedback;
+
+/** @suppress {duplicate } */ var _glBindAttribLocation = (program, index, name) => {
+ GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name));
+};
+
+var _emscripten_glBindAttribLocation = _glBindAttribLocation;
+
+/** @suppress {duplicate } */ var _glBindBuffer = (target, buffer) => {
+ if (target == 35051) /*GL_PIXEL_PACK_BUFFER*/ {
+ // In WebGL 2 glReadPixels entry point, we need to use a different WebGL 2
+ // API function call when a buffer is bound to
+ // GL_PIXEL_PACK_BUFFER_BINDING point, so must keep track whether that
+ // binding point is non-null to know what is the proper API function to
+ // call.
+ GLctx.currentPixelPackBufferBinding = buffer;
+ } else if (target == 35052) /*GL_PIXEL_UNPACK_BUFFER*/ {
+ // In WebGL 2 gl(Compressed)Tex(Sub)Image[23]D entry points, we need to
+ // use a different WebGL 2 API function call when a buffer is bound to
+ // GL_PIXEL_UNPACK_BUFFER_BINDING point, so must keep track whether that
+ // binding point is non-null to know what is the proper API function to
+ // call.
+ GLctx.currentPixelUnpackBufferBinding = buffer;
+ }
+ GLctx.bindBuffer(target, GL.buffers[buffer]);
+};
+
+var _emscripten_glBindBuffer = _glBindBuffer;
+
+/** @suppress {duplicate } */ var _glBindBufferBase = (target, index, buffer) => {
+ GLctx.bindBufferBase(target, index, GL.buffers[buffer]);
+};
+
+var _emscripten_glBindBufferBase = _glBindBufferBase;
+
+/** @suppress {duplicate } */ var _glBindBufferRange = (target, index, buffer, offset, ptrsize) => {
+ GLctx.bindBufferRange(target, index, GL.buffers[buffer], offset, ptrsize);
+};
+
+var _emscripten_glBindBufferRange = _glBindBufferRange;
+
+/** @suppress {duplicate } */ var _glBindFramebuffer = (target, framebuffer) => {
+ GLctx.bindFramebuffer(target, GL.framebuffers[framebuffer]);
+};
+
+var _emscripten_glBindFramebuffer = _glBindFramebuffer;
+
+/** @suppress {duplicate } */ var _glBindRenderbuffer = (target, renderbuffer) => {
+ GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]);
+};
+
+var _emscripten_glBindRenderbuffer = _glBindRenderbuffer;
+
+/** @suppress {duplicate } */ var _glBindSampler = (unit, sampler) => {
+ GLctx.bindSampler(unit, GL.samplers[sampler]);
+};
+
+var _emscripten_glBindSampler = _glBindSampler;
+
+/** @suppress {duplicate } */ var _glBindTexture = (target, texture) => {
+ GLctx.bindTexture(target, GL.textures[texture]);
+};
+
+var _emscripten_glBindTexture = _glBindTexture;
+
+/** @suppress {duplicate } */ var _glBindTransformFeedback = (target, id) => {
+ GLctx.bindTransformFeedback(target, GL.transformFeedbacks[id]);
+};
+
+var _emscripten_glBindTransformFeedback = _glBindTransformFeedback;
+
+/** @suppress {duplicate } */ var _glBindVertexArray = vao => {
+ GLctx.bindVertexArray(GL.vaos[vao]);
+};
+
+var _emscripten_glBindVertexArray = _glBindVertexArray;
+
+/** @suppress {duplicate } */ var _glBindVertexArrayOES = _glBindVertexArray;
+
+var _emscripten_glBindVertexArrayOES = _glBindVertexArrayOES;
+
+/** @suppress {duplicate } */ var _glBlendColor = (x0, x1, x2, x3) => GLctx.blendColor(x0, x1, x2, x3);
+
+var _emscripten_glBlendColor = _glBlendColor;
+
+/** @suppress {duplicate } */ var _glBlendEquation = x0 => GLctx.blendEquation(x0);
+
+var _emscripten_glBlendEquation = _glBlendEquation;
+
+/** @suppress {duplicate } */ var _glBlendEquationSeparate = (x0, x1) => GLctx.blendEquationSeparate(x0, x1);
+
+var _emscripten_glBlendEquationSeparate = _glBlendEquationSeparate;
+
+/** @suppress {duplicate } */ var _glBlendFunc = (x0, x1) => GLctx.blendFunc(x0, x1);
+
+var _emscripten_glBlendFunc = _glBlendFunc;
+
+/** @suppress {duplicate } */ var _glBlendFuncSeparate = (x0, x1, x2, x3) => GLctx.blendFuncSeparate(x0, x1, x2, x3);
+
+var _emscripten_glBlendFuncSeparate = _glBlendFuncSeparate;
+
+/** @suppress {duplicate } */ var _glBlitFramebuffer = (x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) => GLctx.blitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9);
+
+var _emscripten_glBlitFramebuffer = _glBlitFramebuffer;
+
+/** @suppress {duplicate } */ var _glBufferData = (target, size, data, usage) => {
+ if (true) {
+ // If size is zero, WebGL would interpret uploading the whole input
+ // arraybuffer (starting from given offset), which would not make sense in
+ // WebAssembly, so avoid uploading if size is zero. However we must still
+ // call bufferData to establish a backing storage of zero bytes.
+ if (data && size) {
+ GLctx.bufferData(target, GROWABLE_HEAP_U8(), usage, data, size);
+ } else {
+ GLctx.bufferData(target, size, usage);
+ }
+ return;
+ }
+};
+
+var _emscripten_glBufferData = _glBufferData;
+
+/** @suppress {duplicate } */ var _glBufferSubData = (target, offset, size, data) => {
+ if (true) {
+ size && GLctx.bufferSubData(target, offset, GROWABLE_HEAP_U8(), data, size);
+ return;
+ }
+};
+
+var _emscripten_glBufferSubData = _glBufferSubData;
+
+/** @suppress {duplicate } */ var _glCheckFramebufferStatus = x0 => GLctx.checkFramebufferStatus(x0);
+
+var _emscripten_glCheckFramebufferStatus = _glCheckFramebufferStatus;
+
+/** @suppress {duplicate } */ var _glClear = x0 => GLctx.clear(x0);
+
+var _emscripten_glClear = _glClear;
+
+/** @suppress {duplicate } */ var _glClearBufferfi = (x0, x1, x2, x3) => GLctx.clearBufferfi(x0, x1, x2, x3);
+
+var _emscripten_glClearBufferfi = _glClearBufferfi;
+
+/** @suppress {duplicate } */ var _glClearBufferfv = (buffer, drawbuffer, value) => {
+ GLctx.clearBufferfv(buffer, drawbuffer, GROWABLE_HEAP_F32(), ((value) >> 2));
+};
+
+var _emscripten_glClearBufferfv = _glClearBufferfv;
+
+/** @suppress {duplicate } */ var _glClearBufferiv = (buffer, drawbuffer, value) => {
+ GLctx.clearBufferiv(buffer, drawbuffer, GROWABLE_HEAP_I32(), ((value) >> 2));
+};
+
+var _emscripten_glClearBufferiv = _glClearBufferiv;
+
+/** @suppress {duplicate } */ var _glClearBufferuiv = (buffer, drawbuffer, value) => {
+ GLctx.clearBufferuiv(buffer, drawbuffer, GROWABLE_HEAP_U32(), ((value) >> 2));
+};
+
+var _emscripten_glClearBufferuiv = _glClearBufferuiv;
+
+/** @suppress {duplicate } */ var _glClearColor = (x0, x1, x2, x3) => GLctx.clearColor(x0, x1, x2, x3);
+
+var _emscripten_glClearColor = _glClearColor;
+
+/** @suppress {duplicate } */ var _glClearDepthf = x0 => GLctx.clearDepth(x0);
+
+var _emscripten_glClearDepthf = _glClearDepthf;
+
+/** @suppress {duplicate } */ var _glClearStencil = x0 => GLctx.clearStencil(x0);
+
+var _emscripten_glClearStencil = _glClearStencil;
+
+var convertI32PairToI53 = (lo, hi) => (lo >>> 0) + hi * 4294967296;
+
+/** @suppress {duplicate } */ var _glClientWaitSync = (sync, flags, timeout_low, timeout_high) => {
+ // WebGL2 vs GLES3 differences: in GLES3, the timeout parameter is a uint64, where 0xFFFFFFFFFFFFFFFFULL means GL_TIMEOUT_IGNORED.
+ // In JS, there's no 64-bit value types, so instead timeout is taken to be signed, and GL_TIMEOUT_IGNORED is given value -1.
+ // Inherently the value accepted in the timeout is lossy, and can't take in arbitrary u64 bit pattern (but most likely doesn't matter)
+ // See https://www.khronos.org/registry/webgl/specs/latest/2.0/#5.15
+ var timeout = convertI32PairToI53(timeout_low, timeout_high);
+ return GLctx.clientWaitSync(GL.syncs[sync], flags, timeout);
+};
+
+var _emscripten_glClientWaitSync = _glClientWaitSync;
+
+/** @suppress {duplicate } */ var _glClipControlEXT = (origin, depth) => {
+ GLctx.extClipControl["clipControlEXT"](origin, depth);
+};
+
+var _emscripten_glClipControlEXT = _glClipControlEXT;
+
+/** @suppress {duplicate } */ var _glColorMask = (red, green, blue, alpha) => {
+ GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
+};
+
+var _emscripten_glColorMask = _glColorMask;
+
+/** @suppress {duplicate } */ var _glCompileShader = shader => {
+ GLctx.compileShader(GL.shaders[shader]);
+};
+
+var _emscripten_glCompileShader = _glCompileShader;
+
+/** @suppress {duplicate } */ var _glCompressedTexImage2D = (target, level, internalFormat, width, height, border, imageSize, data) => {
+ // `data` may be null here, which means "allocate uniniitalized space but
+ // don't upload" in GLES parlance, but `compressedTexImage2D` requires the
+ // final data parameter, so we simply pass a heap view starting at zero
+ // effectively uploading whatever happens to be near address zero. See
+ // https://github.com/emscripten-core/emscripten/issues/19300.
+ if (true) {
+ if (GLctx.currentPixelUnpackBufferBinding || !imageSize) {
+ GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data);
+ return;
+ }
+ GLctx.compressedTexImage2D(target, level, internalFormat, width, height, border, GROWABLE_HEAP_U8(), data, imageSize);
+ return;
+ }
+};
+
+var _emscripten_glCompressedTexImage2D = _glCompressedTexImage2D;
+
+/** @suppress {duplicate } */ var _glCompressedTexImage3D = (target, level, internalFormat, width, height, depth, border, imageSize, data) => {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.compressedTexImage3D(target, level, internalFormat, width, height, depth, border, imageSize, data);
+ } else {
+ GLctx.compressedTexImage3D(target, level, internalFormat, width, height, depth, border, GROWABLE_HEAP_U8(), data, imageSize);
+ }
+};
+
+var _emscripten_glCompressedTexImage3D = _glCompressedTexImage3D;
+
+/** @suppress {duplicate } */ var _glCompressedTexSubImage2D = (target, level, xoffset, yoffset, width, height, format, imageSize, data) => {
+ if (true) {
+ if (GLctx.currentPixelUnpackBufferBinding || !imageSize) {
+ GLctx.compressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data);
+ return;
+ }
+ GLctx.compressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, GROWABLE_HEAP_U8(), data, imageSize);
+ return;
+ }
+};
+
+var _emscripten_glCompressedTexSubImage2D = _glCompressedTexSubImage2D;
+
+/** @suppress {duplicate } */ var _glCompressedTexSubImage3D = (target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) => {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.compressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data);
+ } else {
+ GLctx.compressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, GROWABLE_HEAP_U8(), data, imageSize);
+ }
+};
+
+var _emscripten_glCompressedTexSubImage3D = _glCompressedTexSubImage3D;
+
+/** @suppress {duplicate } */ var _glCopyBufferSubData = (x0, x1, x2, x3, x4) => GLctx.copyBufferSubData(x0, x1, x2, x3, x4);
+
+var _emscripten_glCopyBufferSubData = _glCopyBufferSubData;
+
+/** @suppress {duplicate } */ var _glCopyTexImage2D = (x0, x1, x2, x3, x4, x5, x6, x7) => GLctx.copyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7);
+
+var _emscripten_glCopyTexImage2D = _glCopyTexImage2D;
+
+/** @suppress {duplicate } */ var _glCopyTexSubImage2D = (x0, x1, x2, x3, x4, x5, x6, x7) => GLctx.copyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7);
+
+var _emscripten_glCopyTexSubImage2D = _glCopyTexSubImage2D;
+
+/** @suppress {duplicate } */ var _glCopyTexSubImage3D = (x0, x1, x2, x3, x4, x5, x6, x7, x8) => GLctx.copyTexSubImage3D(x0, x1, x2, x3, x4, x5, x6, x7, x8);
+
+var _emscripten_glCopyTexSubImage3D = _glCopyTexSubImage3D;
+
+/** @suppress {duplicate } */ var _glCreateProgram = () => {
+ var id = GL.getNewId(GL.programs);
+ var program = GLctx.createProgram();
+ // Store additional information needed for each shader program:
+ program.name = id;
+ // Lazy cache results of
+ // glGetProgramiv(GL_ACTIVE_UNIFORM_MAX_LENGTH/GL_ACTIVE_ATTRIBUTE_MAX_LENGTH/GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH)
+ program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0;
+ program.uniformIdCounter = 1;
+ GL.programs[id] = program;
+ return id;
+};
+
+var _emscripten_glCreateProgram = _glCreateProgram;
+
+/** @suppress {duplicate } */ var _glCreateShader = shaderType => {
+ var id = GL.getNewId(GL.shaders);
+ GL.shaders[id] = GLctx.createShader(shaderType);
+ return id;
+};
+
+var _emscripten_glCreateShader = _glCreateShader;
+
+/** @suppress {duplicate } */ var _glCullFace = x0 => GLctx.cullFace(x0);
+
+var _emscripten_glCullFace = _glCullFace;
+
+/** @suppress {duplicate } */ var _glDeleteBuffers = (n, buffers) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((buffers) + (i * 4)) >> 2)];
+ var buffer = GL.buffers[id];
+ // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+ // correspond to existing buffer objects."
+ if (!buffer) continue;
+ GLctx.deleteBuffer(buffer);
+ buffer.name = 0;
+ GL.buffers[id] = null;
+ if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0;
+ if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0;
+ }
+};
+
+var _emscripten_glDeleteBuffers = _glDeleteBuffers;
+
+/** @suppress {duplicate } */ var _glDeleteFramebuffers = (n, framebuffers) => {
+ for (var i = 0; i < n; ++i) {
+ var id = GROWABLE_HEAP_I32()[(((framebuffers) + (i * 4)) >> 2)];
+ var framebuffer = GL.framebuffers[id];
+ if (!framebuffer) continue;
+ // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
+ GLctx.deleteFramebuffer(framebuffer);
+ framebuffer.name = 0;
+ GL.framebuffers[id] = null;
+ }
+};
+
+var _emscripten_glDeleteFramebuffers = _glDeleteFramebuffers;
+
+/** @suppress {duplicate } */ var _glDeleteProgram = id => {
+ if (!id) return;
+ var program = GL.programs[id];
+ if (!program) {
+ // glDeleteProgram actually signals an error when deleting a nonexisting
+ // object, unlike some other GL delete functions.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GLctx.deleteProgram(program);
+ program.name = 0;
+ GL.programs[id] = null;
+};
+
+var _emscripten_glDeleteProgram = _glDeleteProgram;
+
+/** @suppress {duplicate } */ var _glDeleteQueries = (n, ids) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((ids) + (i * 4)) >> 2)];
+ var query = GL.queries[id];
+ if (!query) continue;
+ // GL spec: "unused names in ids are ignored, as is the name zero."
+ GLctx.deleteQuery(query);
+ GL.queries[id] = null;
+ }
+};
+
+var _emscripten_glDeleteQueries = _glDeleteQueries;
+
+/** @suppress {duplicate } */ var _glDeleteQueriesEXT = (n, ids) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((ids) + (i * 4)) >> 2)];
+ var query = GL.queries[id];
+ if (!query) continue;
+ // GL spec: "unused names in ids are ignored, as is the name zero."
+ GLctx.disjointTimerQueryExt["deleteQueryEXT"](query);
+ GL.queries[id] = null;
+ }
+};
+
+var _emscripten_glDeleteQueriesEXT = _glDeleteQueriesEXT;
+
+/** @suppress {duplicate } */ var _glDeleteRenderbuffers = (n, renderbuffers) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((renderbuffers) + (i * 4)) >> 2)];
+ var renderbuffer = GL.renderbuffers[id];
+ if (!renderbuffer) continue;
+ // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
+ GLctx.deleteRenderbuffer(renderbuffer);
+ renderbuffer.name = 0;
+ GL.renderbuffers[id] = null;
+ }
+};
+
+var _emscripten_glDeleteRenderbuffers = _glDeleteRenderbuffers;
+
+/** @suppress {duplicate } */ var _glDeleteSamplers = (n, samplers) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((samplers) + (i * 4)) >> 2)];
+ var sampler = GL.samplers[id];
+ if (!sampler) continue;
+ GLctx.deleteSampler(sampler);
+ sampler.name = 0;
+ GL.samplers[id] = null;
+ }
+};
+
+var _emscripten_glDeleteSamplers = _glDeleteSamplers;
+
+/** @suppress {duplicate } */ var _glDeleteShader = id => {
+ if (!id) return;
+ var shader = GL.shaders[id];
+ if (!shader) {
+ // glDeleteShader actually signals an error when deleting a nonexisting
+ // object, unlike some other GL delete functions.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GLctx.deleteShader(shader);
+ GL.shaders[id] = null;
+};
+
+var _emscripten_glDeleteShader = _glDeleteShader;
+
+/** @suppress {duplicate } */ var _glDeleteSync = id => {
+ if (!id) return;
+ var sync = GL.syncs[id];
+ if (!sync) {
+ // glDeleteSync signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GLctx.deleteSync(sync);
+ sync.name = 0;
+ GL.syncs[id] = null;
+};
+
+var _emscripten_glDeleteSync = _glDeleteSync;
+
+/** @suppress {duplicate } */ var _glDeleteTextures = (n, textures) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((textures) + (i * 4)) >> 2)];
+ var texture = GL.textures[id];
+ // GL spec: "glDeleteTextures silently ignores 0s and names that do not
+ // correspond to existing textures".
+ if (!texture) continue;
+ GLctx.deleteTexture(texture);
+ texture.name = 0;
+ GL.textures[id] = null;
+ }
+};
+
+var _emscripten_glDeleteTextures = _glDeleteTextures;
+
+/** @suppress {duplicate } */ var _glDeleteTransformFeedbacks = (n, ids) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((ids) + (i * 4)) >> 2)];
+ var transformFeedback = GL.transformFeedbacks[id];
+ if (!transformFeedback) continue;
+ // GL spec: "unused names in ids are ignored, as is the name zero."
+ GLctx.deleteTransformFeedback(transformFeedback);
+ transformFeedback.name = 0;
+ GL.transformFeedbacks[id] = null;
+ }
+};
+
+var _emscripten_glDeleteTransformFeedbacks = _glDeleteTransformFeedbacks;
+
+/** @suppress {duplicate } */ var _glDeleteVertexArrays = (n, vaos) => {
+ for (var i = 0; i < n; i++) {
+ var id = GROWABLE_HEAP_I32()[(((vaos) + (i * 4)) >> 2)];
+ GLctx.deleteVertexArray(GL.vaos[id]);
+ GL.vaos[id] = null;
+ }
+};
+
+var _emscripten_glDeleteVertexArrays = _glDeleteVertexArrays;
+
+/** @suppress {duplicate } */ var _glDeleteVertexArraysOES = _glDeleteVertexArrays;
+
+var _emscripten_glDeleteVertexArraysOES = _glDeleteVertexArraysOES;
+
+/** @suppress {duplicate } */ var _glDepthFunc = x0 => GLctx.depthFunc(x0);
+
+var _emscripten_glDepthFunc = _glDepthFunc;
+
+/** @suppress {duplicate } */ var _glDepthMask = flag => {
+ GLctx.depthMask(!!flag);
+};
+
+var _emscripten_glDepthMask = _glDepthMask;
+
+/** @suppress {duplicate } */ var _glDepthRangef = (x0, x1) => GLctx.depthRange(x0, x1);
+
+var _emscripten_glDepthRangef = _glDepthRangef;
+
+/** @suppress {duplicate } */ var _glDetachShader = (program, shader) => {
+ GLctx.detachShader(GL.programs[program], GL.shaders[shader]);
+};
+
+var _emscripten_glDetachShader = _glDetachShader;
+
+/** @suppress {duplicate } */ var _glDisable = x0 => GLctx.disable(x0);
+
+var _emscripten_glDisable = _glDisable;
+
+/** @suppress {duplicate } */ var _glDisableVertexAttribArray = index => {
+ GLctx.disableVertexAttribArray(index);
+};
+
+var _emscripten_glDisableVertexAttribArray = _glDisableVertexAttribArray;
+
+/** @suppress {duplicate } */ var _glDrawArrays = (mode, first, count) => {
+ GLctx.drawArrays(mode, first, count);
+};
+
+var _emscripten_glDrawArrays = _glDrawArrays;
+
+/** @suppress {duplicate } */ var _glDrawArraysInstanced = (mode, first, count, primcount) => {
+ GLctx.drawArraysInstanced(mode, first, count, primcount);
+};
+
+var _emscripten_glDrawArraysInstanced = _glDrawArraysInstanced;
+
+/** @suppress {duplicate } */ var _glDrawArraysInstancedANGLE = _glDrawArraysInstanced;
+
+var _emscripten_glDrawArraysInstancedANGLE = _glDrawArraysInstancedANGLE;
+
+/** @suppress {duplicate } */ var _glDrawArraysInstancedARB = _glDrawArraysInstanced;
+
+var _emscripten_glDrawArraysInstancedARB = _glDrawArraysInstancedARB;
+
+/** @suppress {duplicate } */ var _glDrawArraysInstancedEXT = _glDrawArraysInstanced;
+
+var _emscripten_glDrawArraysInstancedEXT = _glDrawArraysInstancedEXT;
+
+/** @suppress {duplicate } */ var _glDrawArraysInstancedNV = _glDrawArraysInstanced;
+
+var _emscripten_glDrawArraysInstancedNV = _glDrawArraysInstancedNV;
+
+var tempFixedLengthArray = [];
+
+/** @suppress {duplicate } */ var _glDrawBuffers = (n, bufs) => {
+ var bufArray = tempFixedLengthArray[n];
+ for (var i = 0; i < n; i++) {
+ bufArray[i] = GROWABLE_HEAP_I32()[(((bufs) + (i * 4)) >> 2)];
+ }
+ GLctx.drawBuffers(bufArray);
+};
+
+var _emscripten_glDrawBuffers = _glDrawBuffers;
+
+/** @suppress {duplicate } */ var _glDrawBuffersEXT = _glDrawBuffers;
+
+var _emscripten_glDrawBuffersEXT = _glDrawBuffersEXT;
+
+/** @suppress {duplicate } */ var _glDrawBuffersWEBGL = _glDrawBuffers;
+
+var _emscripten_glDrawBuffersWEBGL = _glDrawBuffersWEBGL;
+
+/** @suppress {duplicate } */ var _glDrawElements = (mode, count, type, indices) => {
+ GLctx.drawElements(mode, count, type, indices);
+};
+
+var _emscripten_glDrawElements = _glDrawElements;
+
+/** @suppress {duplicate } */ var _glDrawElementsInstanced = (mode, count, type, indices, primcount) => {
+ GLctx.drawElementsInstanced(mode, count, type, indices, primcount);
+};
+
+var _emscripten_glDrawElementsInstanced = _glDrawElementsInstanced;
+
+/** @suppress {duplicate } */ var _glDrawElementsInstancedANGLE = _glDrawElementsInstanced;
+
+var _emscripten_glDrawElementsInstancedANGLE = _glDrawElementsInstancedANGLE;
+
+/** @suppress {duplicate } */ var _glDrawElementsInstancedARB = _glDrawElementsInstanced;
+
+var _emscripten_glDrawElementsInstancedARB = _glDrawElementsInstancedARB;
+
+/** @suppress {duplicate } */ var _glDrawElementsInstancedEXT = _glDrawElementsInstanced;
+
+var _emscripten_glDrawElementsInstancedEXT = _glDrawElementsInstancedEXT;
+
+/** @suppress {duplicate } */ var _glDrawElementsInstancedNV = _glDrawElementsInstanced;
+
+var _emscripten_glDrawElementsInstancedNV = _glDrawElementsInstancedNV;
+
+/** @suppress {duplicate } */ var _glDrawRangeElements = (mode, start, end, count, type, indices) => {
+ // TODO: This should be a trivial pass-though function registered at the bottom of this page as
+ // glFuncs[6][1] += ' drawRangeElements';
+ // but due to https://bugzilla.mozilla.org/show_bug.cgi?id=1202427,
+ // we work around by ignoring the range.
+ _glDrawElements(mode, count, type, indices);
+};
+
+var _emscripten_glDrawRangeElements = _glDrawRangeElements;
+
+/** @suppress {duplicate } */ var _glEnable = x0 => GLctx.enable(x0);
+
+var _emscripten_glEnable = _glEnable;
+
+/** @suppress {duplicate } */ var _glEnableVertexAttribArray = index => {
+ GLctx.enableVertexAttribArray(index);
+};
+
+var _emscripten_glEnableVertexAttribArray = _glEnableVertexAttribArray;
+
+/** @suppress {duplicate } */ var _glEndQuery = x0 => GLctx.endQuery(x0);
+
+var _emscripten_glEndQuery = _glEndQuery;
+
+/** @suppress {duplicate } */ var _glEndQueryEXT = target => {
+ GLctx.disjointTimerQueryExt["endQueryEXT"](target);
+};
+
+var _emscripten_glEndQueryEXT = _glEndQueryEXT;
+
+/** @suppress {duplicate } */ var _glEndTransformFeedback = () => GLctx.endTransformFeedback();
+
+var _emscripten_glEndTransformFeedback = _glEndTransformFeedback;
+
+/** @suppress {duplicate } */ var _glFenceSync = (condition, flags) => {
+ var sync = GLctx.fenceSync(condition, flags);
+ if (sync) {
+ var id = GL.getNewId(GL.syncs);
+ sync.name = id;
+ GL.syncs[id] = sync;
+ return id;
+ }
+ return 0;
+};
+
+// Failed to create a sync object
+var _emscripten_glFenceSync = _glFenceSync;
+
+/** @suppress {duplicate } */ var _glFinish = () => GLctx.finish();
+
+var _emscripten_glFinish = _glFinish;
+
+/** @suppress {duplicate } */ var _glFlush = () => GLctx.flush();
+
+var _emscripten_glFlush = _glFlush;
+
+/** @suppress {duplicate } */ var _glFramebufferRenderbuffer = (target, attachment, renderbuffertarget, renderbuffer) => {
+ GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]);
+};
+
+var _emscripten_glFramebufferRenderbuffer = _glFramebufferRenderbuffer;
+
+/** @suppress {duplicate } */ var _glFramebufferTexture2D = (target, attachment, textarget, texture, level) => {
+ GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level);
+};
+
+var _emscripten_glFramebufferTexture2D = _glFramebufferTexture2D;
+
+/** @suppress {duplicate } */ var _glFramebufferTextureLayer = (target, attachment, texture, level, layer) => {
+ GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer);
+};
+
+var _emscripten_glFramebufferTextureLayer = _glFramebufferTextureLayer;
+
+/** @suppress {duplicate } */ var _glFrontFace = x0 => GLctx.frontFace(x0);
+
+var _emscripten_glFrontFace = _glFrontFace;
+
+/** @suppress {duplicate } */ var _glGenBuffers = (n, buffers) => {
+ GL.genObject(n, buffers, "createBuffer", GL.buffers);
+};
+
+var _emscripten_glGenBuffers = _glGenBuffers;
+
+/** @suppress {duplicate } */ var _glGenFramebuffers = (n, ids) => {
+ GL.genObject(n, ids, "createFramebuffer", GL.framebuffers);
+};
+
+var _emscripten_glGenFramebuffers = _glGenFramebuffers;
+
+/** @suppress {duplicate } */ var _glGenQueries = (n, ids) => {
+ GL.genObject(n, ids, "createQuery", GL.queries);
+};
+
+var _emscripten_glGenQueries = _glGenQueries;
+
+/** @suppress {duplicate } */ var _glGenQueriesEXT = (n, ids) => {
+ for (var i = 0; i < n; i++) {
+ var query = GLctx.disjointTimerQueryExt["createQueryEXT"]();
+ if (!query) {
+ GL.recordError(1282);
+ /* GL_INVALID_OPERATION */ while (i < n) GROWABLE_HEAP_I32()[(((ids) + (i++ * 4)) >> 2)] = 0;
+ return;
+ }
+ var id = GL.getNewId(GL.queries);
+ query.name = id;
+ GL.queries[id] = query;
+ GROWABLE_HEAP_I32()[(((ids) + (i * 4)) >> 2)] = id;
+ }
+};
+
+var _emscripten_glGenQueriesEXT = _glGenQueriesEXT;
+
+/** @suppress {duplicate } */ var _glGenRenderbuffers = (n, renderbuffers) => {
+ GL.genObject(n, renderbuffers, "createRenderbuffer", GL.renderbuffers);
+};
+
+var _emscripten_glGenRenderbuffers = _glGenRenderbuffers;
+
+/** @suppress {duplicate } */ var _glGenSamplers = (n, samplers) => {
+ GL.genObject(n, samplers, "createSampler", GL.samplers);
+};
+
+var _emscripten_glGenSamplers = _glGenSamplers;
+
+/** @suppress {duplicate } */ var _glGenTextures = (n, textures) => {
+ GL.genObject(n, textures, "createTexture", GL.textures);
+};
+
+var _emscripten_glGenTextures = _glGenTextures;
+
+/** @suppress {duplicate } */ var _glGenTransformFeedbacks = (n, ids) => {
+ GL.genObject(n, ids, "createTransformFeedback", GL.transformFeedbacks);
+};
+
+var _emscripten_glGenTransformFeedbacks = _glGenTransformFeedbacks;
+
+/** @suppress {duplicate } */ var _glGenVertexArrays = (n, arrays) => {
+ GL.genObject(n, arrays, "createVertexArray", GL.vaos);
+};
+
+var _emscripten_glGenVertexArrays = _glGenVertexArrays;
+
+/** @suppress {duplicate } */ var _glGenVertexArraysOES = _glGenVertexArrays;
+
+var _emscripten_glGenVertexArraysOES = _glGenVertexArraysOES;
+
+/** @suppress {duplicate } */ var _glGenerateMipmap = x0 => GLctx.generateMipmap(x0);
+
+var _emscripten_glGenerateMipmap = _glGenerateMipmap;
+
+var __glGetActiveAttribOrUniform = (funcName, program, index, bufSize, length, size, type, name) => {
+ program = GL.programs[program];
+ var info = GLctx[funcName](program, index);
+ if (info) {
+ // If an error occurs, nothing will be written to length, size and type and name.
+ var numBytesWrittenExclNull = name && stringToUTF8(info.name, name, bufSize);
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = numBytesWrittenExclNull;
+ if (size) GROWABLE_HEAP_I32()[((size) >> 2)] = info.size;
+ if (type) GROWABLE_HEAP_I32()[((type) >> 2)] = info.type;
+ }
+};
+
+/** @suppress {duplicate } */ var _glGetActiveAttrib = (program, index, bufSize, length, size, type, name) => __glGetActiveAttribOrUniform("getActiveAttrib", program, index, bufSize, length, size, type, name);
+
+var _emscripten_glGetActiveAttrib = _glGetActiveAttrib;
+
+/** @suppress {duplicate } */ var _glGetActiveUniform = (program, index, bufSize, length, size, type, name) => __glGetActiveAttribOrUniform("getActiveUniform", program, index, bufSize, length, size, type, name);
+
+var _emscripten_glGetActiveUniform = _glGetActiveUniform;
+
+/** @suppress {duplicate } */ var _glGetActiveUniformBlockName = (program, uniformBlockIndex, bufSize, length, uniformBlockName) => {
+ program = GL.programs[program];
+ var result = GLctx.getActiveUniformBlockName(program, uniformBlockIndex);
+ if (!result) return;
+ // If an error occurs, nothing will be written to uniformBlockName or length.
+ if (uniformBlockName && bufSize > 0) {
+ var numBytesWrittenExclNull = stringToUTF8(result, uniformBlockName, bufSize);
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = numBytesWrittenExclNull;
+ } else {
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = 0;
+ }
+};
+
+var _emscripten_glGetActiveUniformBlockName = _glGetActiveUniformBlockName;
+
+/** @suppress {duplicate } */ var _glGetActiveUniformBlockiv = (program, uniformBlockIndex, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ program = GL.programs[program];
+ if (pname == 35393) /* GL_UNIFORM_BLOCK_NAME_LENGTH */ {
+ var name = GLctx.getActiveUniformBlockName(program, uniformBlockIndex);
+ GROWABLE_HEAP_I32()[((params) >> 2)] = name.length + 1;
+ return;
+ }
+ var result = GLctx.getActiveUniformBlockParameter(program, uniformBlockIndex, pname);
+ if (result === null) return;
+ // If an error occurs, nothing should be written to params.
+ if (pname == 35395) /*GL_UNIFORM_BLOCK_ACTIVE_UNIFORM_INDICES*/ {
+ for (var i = 0; i < result.length; i++) {
+ GROWABLE_HEAP_I32()[(((params) + (i * 4)) >> 2)] = result[i];
+ }
+ } else {
+ GROWABLE_HEAP_I32()[((params) >> 2)] = result;
+ }
+};
+
+var _emscripten_glGetActiveUniformBlockiv = _glGetActiveUniformBlockiv;
+
+/** @suppress {duplicate } */ var _glGetActiveUniformsiv = (program, uniformCount, uniformIndices, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ if (uniformCount > 0 && uniformIndices == 0) {
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ program = GL.programs[program];
+ var ids = [];
+ for (var i = 0; i < uniformCount; i++) {
+ ids.push(GROWABLE_HEAP_I32()[(((uniformIndices) + (i * 4)) >> 2)]);
+ }
+ var result = GLctx.getActiveUniforms(program, ids, pname);
+ if (!result) return;
+ // GL spec: If an error is generated, nothing is written out to params.
+ var len = result.length;
+ for (var i = 0; i < len; i++) {
+ GROWABLE_HEAP_I32()[(((params) + (i * 4)) >> 2)] = result[i];
+ }
+};
+
+var _emscripten_glGetActiveUniformsiv = _glGetActiveUniformsiv;
+
+/** @suppress {duplicate } */ var _glGetAttachedShaders = (program, maxCount, count, shaders) => {
+ var result = GLctx.getAttachedShaders(GL.programs[program]);
+ var len = result.length;
+ if (len > maxCount) {
+ len = maxCount;
+ }
+ GROWABLE_HEAP_I32()[((count) >> 2)] = len;
+ for (var i = 0; i < len; ++i) {
+ var id = GL.shaders.indexOf(result[i]);
+ GROWABLE_HEAP_I32()[(((shaders) + (i * 4)) >> 2)] = id;
+ }
+};
+
+var _emscripten_glGetAttachedShaders = _glGetAttachedShaders;
+
+/** @suppress {duplicate } */ var _glGetAttribLocation = (program, name) => GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name));
+
+var _emscripten_glGetAttribLocation = _glGetAttribLocation;
+
+var writeI53ToI64 = (ptr, num) => {
+ GROWABLE_HEAP_U32()[((ptr) >> 2)] = num;
+ var lower = GROWABLE_HEAP_U32()[((ptr) >> 2)];
+ GROWABLE_HEAP_U32()[(((ptr) + (4)) >> 2)] = (num - lower) / 4294967296;
+};
+
+var webglGetExtensions = () => {
+ var exts = getEmscriptenSupportedExtensions(GLctx);
+ exts = exts.concat(exts.map(e => "GL_" + e));
+ return exts;
+};
+
+var emscriptenWebGLGet = (name_, p, type) => {
+ // Guard against user passing a null pointer.
+ // Note that GLES2 spec does not say anything about how passing a null
+ // pointer should be treated. Testing on desktop core GL 3, the application
+ // crashes on glGetIntegerv to a null pointer, but better to report an error
+ // instead of doing anything random.
+ if (!p) {
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var ret = undefined;
+ switch (name_) {
+ // Handle a few trivial GLES values
+ case 36346:
+ // GL_SHADER_COMPILER
+ ret = 1;
+ break;
+
+ case 36344:
+ // GL_SHADER_BINARY_FORMATS
+ if (type != 0 && type != 1) {
+ GL.recordError(1280);
+ }
+ // Do not write anything to the out pointer, since no binary formats are
+ // supported.
+ return;
+
+ case 34814:
+ // GL_NUM_PROGRAM_BINARY_FORMATS
+ case 36345:
+ // GL_NUM_SHADER_BINARY_FORMATS
+ ret = 0;
+ break;
+
+ case 34466:
+ // GL_NUM_COMPRESSED_TEXTURE_FORMATS
+ // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete
+ // since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be
+ // queried for length), so implement it ourselves to allow C++ GLES2
+ // code get the length.
+ var formats = GLctx.getParameter(34467);
+ /*GL_COMPRESSED_TEXTURE_FORMATS*/ ret = formats ? formats.length : 0;
+ break;
+
+ case 33309:
+ // GL_NUM_EXTENSIONS
+ if (GL.currentContext.version < 2) {
+ // Calling GLES3/WebGL2 function with a GLES2/WebGL1 context
+ GL.recordError(1282);
+ /* GL_INVALID_OPERATION */ return;
+ }
+ ret = webglGetExtensions().length;
+ break;
+
+ case 33307:
+ // GL_MAJOR_VERSION
+ case 33308:
+ // GL_MINOR_VERSION
+ if (GL.currentContext.version < 2) {
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ return;
+ }
+ ret = name_ == 33307 ? 3 : 0;
+ // return version 3.0
+ break;
+ }
+ if (ret === undefined) {
+ var result = GLctx.getParameter(name_);
+ switch (typeof result) {
+ case "number":
+ ret = result;
+ break;
+
+ case "boolean":
+ ret = result ? 1 : 0;
+ break;
+
+ case "string":
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ return;
+
+ case "object":
+ if (result === null) {
+ // null is a valid result for some (e.g., which buffer is bound -
+ // perhaps nothing is bound), but otherwise can mean an invalid
+ // name_, which we need to report as an error
+ switch (name_) {
+ case 34964:
+ // ARRAY_BUFFER_BINDING
+ case 35725:
+ // CURRENT_PROGRAM
+ case 34965:
+ // ELEMENT_ARRAY_BUFFER_BINDING
+ case 36006:
+ // FRAMEBUFFER_BINDING or DRAW_FRAMEBUFFER_BINDING
+ case 36007:
+ // RENDERBUFFER_BINDING
+ case 32873:
+ // TEXTURE_BINDING_2D
+ case 34229:
+ // WebGL 2 GL_VERTEX_ARRAY_BINDING, or WebGL 1 extension OES_vertex_array_object GL_VERTEX_ARRAY_BINDING_OES
+ case 36662:
+ // COPY_READ_BUFFER_BINDING or COPY_READ_BUFFER
+ case 36663:
+ // COPY_WRITE_BUFFER_BINDING or COPY_WRITE_BUFFER
+ case 35053:
+ // PIXEL_PACK_BUFFER_BINDING
+ case 35055:
+ // PIXEL_UNPACK_BUFFER_BINDING
+ case 36010:
+ // READ_FRAMEBUFFER_BINDING
+ case 35097:
+ // SAMPLER_BINDING
+ case 35869:
+ // TEXTURE_BINDING_2D_ARRAY
+ case 32874:
+ // TEXTURE_BINDING_3D
+ case 36389:
+ // TRANSFORM_FEEDBACK_BINDING
+ case 35983:
+ // TRANSFORM_FEEDBACK_BUFFER_BINDING
+ case 35368:
+ // UNIFORM_BUFFER_BINDING
+ case 34068:
+ {
+ // TEXTURE_BINDING_CUBE_MAP
+ ret = 0;
+ break;
+ }
+
+ default:
+ {
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ return;
+ }
+ }
+ } else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) {
+ for (var i = 0; i < result.length; ++i) {
+ switch (type) {
+ case 0:
+ GROWABLE_HEAP_I32()[(((p) + (i * 4)) >> 2)] = result[i];
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[(((p) + (i * 4)) >> 2)] = result[i];
+ break;
+
+ case 4:
+ GROWABLE_HEAP_I8()[(p) + (i)] = result[i] ? 1 : 0;
+ break;
+ }
+ }
+ return;
+ } else {
+ try {
+ ret = result.name | 0;
+ } catch (e) {
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ err(`GL_INVALID_ENUM in glGet${type}v: Unknown object returned from WebGL getParameter(${name_})! (error: ${e})`);
+ return;
+ }
+ }
+ break;
+
+ default:
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ err(`GL_INVALID_ENUM in glGet${type}v: Native code calling glGet${type}v(${name_}) and it returns ${result} of type ${typeof (result)}!`);
+ return;
+ }
+ }
+ switch (type) {
+ case 1:
+ writeI53ToI64(p, ret);
+ break;
+
+ case 0:
+ GROWABLE_HEAP_I32()[((p) >> 2)] = ret;
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[((p) >> 2)] = ret;
+ break;
+
+ case 4:
+ GROWABLE_HEAP_I8()[p] = ret ? 1 : 0;
+ break;
+ }
+};
+
+/** @suppress {duplicate } */ var _glGetBooleanv = (name_, p) => emscriptenWebGLGet(name_, p, 4);
+
+var _emscripten_glGetBooleanv = _glGetBooleanv;
+
+/** @suppress {duplicate } */ var _glGetBufferParameteri64v = (target, value, data) => {
+ if (!data) {
+ // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
+ // if data == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ writeI53ToI64(data, GLctx.getBufferParameter(target, value));
+};
+
+var _emscripten_glGetBufferParameteri64v = _glGetBufferParameteri64v;
+
+/** @suppress {duplicate } */ var _glGetBufferParameteriv = (target, value, data) => {
+ if (!data) {
+ // GLES2 specification does not specify how to behave if data is a null
+ // pointer. Since calling this function does not make sense if data ==
+ // null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_I32()[((data) >> 2)] = GLctx.getBufferParameter(target, value);
+};
+
+var _emscripten_glGetBufferParameteriv = _glGetBufferParameteriv;
+
+/** @suppress {duplicate } */ var _glGetError = () => {
+ var error = GLctx.getError() || GL.lastError;
+ GL.lastError = 0;
+ /*GL_NO_ERROR*/ return error;
+};
+
+var _emscripten_glGetError = _glGetError;
+
+/** @suppress {duplicate } */ var _glGetFloatv = (name_, p) => emscriptenWebGLGet(name_, p, 2);
+
+var _emscripten_glGetFloatv = _glGetFloatv;
+
+/** @suppress {duplicate } */ var _glGetFragDataLocation = (program, name) => GLctx.getFragDataLocation(GL.programs[program], UTF8ToString(name));
+
+var _emscripten_glGetFragDataLocation = _glGetFragDataLocation;
+
+/** @suppress {duplicate } */ var _glGetFramebufferAttachmentParameteriv = (target, attachment, pname, params) => {
+ var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
+ if (result instanceof WebGLRenderbuffer || result instanceof WebGLTexture) {
+ result = result.name | 0;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = result;
+};
+
+var _emscripten_glGetFramebufferAttachmentParameteriv = _glGetFramebufferAttachmentParameteriv;
+
+var emscriptenWebGLGetIndexed = (target, index, data, type) => {
+ if (!data) {
+ // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
+ // if data == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var result = GLctx.getIndexedParameter(target, index);
+ var ret;
+ switch (typeof result) {
+ case "boolean":
+ ret = result ? 1 : 0;
+ break;
+
+ case "number":
+ ret = result;
+ break;
+
+ case "object":
+ if (result === null) {
+ switch (target) {
+ case 35983:
+ // TRANSFORM_FEEDBACK_BUFFER_BINDING
+ case 35368:
+ // UNIFORM_BUFFER_BINDING
+ ret = 0;
+ break;
+
+ default:
+ {
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ return;
+ }
+ }
+ } else if (result instanceof WebGLBuffer) {
+ ret = result.name | 0;
+ } else {
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ return;
+ }
+ break;
+
+ default:
+ GL.recordError(1280);
+ // GL_INVALID_ENUM
+ return;
+ }
+ switch (type) {
+ case 1:
+ writeI53ToI64(data, ret);
+ break;
+
+ case 0:
+ GROWABLE_HEAP_I32()[((data) >> 2)] = ret;
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[((data) >> 2)] = ret;
+ break;
+
+ case 4:
+ GROWABLE_HEAP_I8()[data] = ret ? 1 : 0;
+ break;
+
+ default:
+ throw "internal emscriptenWebGLGetIndexed() error, bad type: " + type;
+ }
+};
+
+/** @suppress {duplicate } */ var _glGetInteger64i_v = (target, index, data) => emscriptenWebGLGetIndexed(target, index, data, 1);
+
+var _emscripten_glGetInteger64i_v = _glGetInteger64i_v;
+
+/** @suppress {duplicate } */ var _glGetInteger64v = (name_, p) => {
+ emscriptenWebGLGet(name_, p, 1);
+};
+
+var _emscripten_glGetInteger64v = _glGetInteger64v;
+
+/** @suppress {duplicate } */ var _glGetIntegeri_v = (target, index, data) => emscriptenWebGLGetIndexed(target, index, data, 0);
+
+var _emscripten_glGetIntegeri_v = _glGetIntegeri_v;
+
+/** @suppress {duplicate } */ var _glGetIntegerv = (name_, p) => emscriptenWebGLGet(name_, p, 0);
+
+var _emscripten_glGetIntegerv = _glGetIntegerv;
+
+/** @suppress {duplicate } */ var _glGetInternalformativ = (target, internalformat, pname, bufSize, params) => {
+ if (bufSize < 0) {
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ if (!params) {
+ // GLES3 specification does not specify how to behave if values is a null pointer. Since calling this function does not make sense
+ // if values == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var ret = GLctx.getInternalformatParameter(target, internalformat, pname);
+ if (ret === null) return;
+ for (var i = 0; i < ret.length && i < bufSize; ++i) {
+ GROWABLE_HEAP_I32()[(((params) + (i * 4)) >> 2)] = ret[i];
+ }
+};
+
+var _emscripten_glGetInternalformativ = _glGetInternalformativ;
+
+/** @suppress {duplicate } */ var _glGetProgramBinary = (program, bufSize, length, binaryFormat, binary) => {
+ GL.recordError(1282);
+};
+
+/*GL_INVALID_OPERATION*/ var _emscripten_glGetProgramBinary = _glGetProgramBinary;
+
+/** @suppress {duplicate } */ var _glGetProgramInfoLog = (program, maxLength, length, infoLog) => {
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = "(unknown error)";
+ var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = numBytesWrittenExclNull;
+};
+
+var _emscripten_glGetProgramInfoLog = _glGetProgramInfoLog;
+
+/** @suppress {duplicate } */ var _glGetProgramiv = (program, pname, p) => {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null
+ // pointer. Since calling this function does not make sense if p == null,
+ // issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ if (program >= GL.counter) {
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ program = GL.programs[program];
+ if (pname == 35716) {
+ // GL_INFO_LOG_LENGTH
+ var log = GLctx.getProgramInfoLog(program);
+ if (log === null) log = "(unknown error)";
+ GROWABLE_HEAP_I32()[((p) >> 2)] = log.length + 1;
+ } else if (pname == 35719) /* GL_ACTIVE_UNIFORM_MAX_LENGTH */ {
+ if (!program.maxUniformLength) {
+ var numActiveUniforms = GLctx.getProgramParameter(program, 35718);
+ /*GL_ACTIVE_UNIFORMS*/ for (var i = 0; i < numActiveUniforms; ++i) {
+ program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length + 1);
+ }
+ }
+ GROWABLE_HEAP_I32()[((p) >> 2)] = program.maxUniformLength;
+ } else if (pname == 35722) /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */ {
+ if (!program.maxAttributeLength) {
+ var numActiveAttributes = GLctx.getProgramParameter(program, 35721);
+ /*GL_ACTIVE_ATTRIBUTES*/ for (var i = 0; i < numActiveAttributes; ++i) {
+ program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length + 1);
+ }
+ }
+ GROWABLE_HEAP_I32()[((p) >> 2)] = program.maxAttributeLength;
+ } else if (pname == 35381) /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */ {
+ if (!program.maxUniformBlockNameLength) {
+ var numActiveUniformBlocks = GLctx.getProgramParameter(program, 35382);
+ /*GL_ACTIVE_UNIFORM_BLOCKS*/ for (var i = 0; i < numActiveUniformBlocks; ++i) {
+ program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length + 1);
+ }
+ }
+ GROWABLE_HEAP_I32()[((p) >> 2)] = program.maxUniformBlockNameLength;
+ } else {
+ GROWABLE_HEAP_I32()[((p) >> 2)] = GLctx.getProgramParameter(program, pname);
+ }
+};
+
+var _emscripten_glGetProgramiv = _glGetProgramiv;
+
+/** @suppress {duplicate } */ var _glGetQueryObjecti64vEXT = (id, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var query = GL.queries[id];
+ var param;
+ if (GL.currentContext.version < 2) {
+ param = GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query, pname);
+ } else {
+ param = GLctx.getQueryParameter(query, pname);
+ }
+ var ret;
+ if (typeof param == "boolean") {
+ ret = param ? 1 : 0;
+ } else {
+ ret = param;
+ }
+ writeI53ToI64(params, ret);
+};
+
+var _emscripten_glGetQueryObjecti64vEXT = _glGetQueryObjecti64vEXT;
+
+/** @suppress {duplicate } */ var _glGetQueryObjectivEXT = (id, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var query = GL.queries[id];
+ var param = GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query, pname);
+ var ret;
+ if (typeof param == "boolean") {
+ ret = param ? 1 : 0;
+ } else {
+ ret = param;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = ret;
+};
+
+var _emscripten_glGetQueryObjectivEXT = _glGetQueryObjectivEXT;
+
+/** @suppress {duplicate } */ var _glGetQueryObjectui64vEXT = _glGetQueryObjecti64vEXT;
+
+var _emscripten_glGetQueryObjectui64vEXT = _glGetQueryObjectui64vEXT;
+
+/** @suppress {duplicate } */ var _glGetQueryObjectuiv = (id, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var query = GL.queries[id];
+ var param = GLctx.getQueryParameter(query, pname);
+ var ret;
+ if (typeof param == "boolean") {
+ ret = param ? 1 : 0;
+ } else {
+ ret = param;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = ret;
+};
+
+var _emscripten_glGetQueryObjectuiv = _glGetQueryObjectuiv;
+
+/** @suppress {duplicate } */ var _glGetQueryObjectuivEXT = _glGetQueryObjectivEXT;
+
+var _emscripten_glGetQueryObjectuivEXT = _glGetQueryObjectuivEXT;
+
+/** @suppress {duplicate } */ var _glGetQueryiv = (target, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = GLctx.getQuery(target, pname);
+};
+
+var _emscripten_glGetQueryiv = _glGetQueryiv;
+
+/** @suppress {duplicate } */ var _glGetQueryivEXT = (target, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = GLctx.disjointTimerQueryExt["getQueryEXT"](target, pname);
+};
+
+var _emscripten_glGetQueryivEXT = _glGetQueryivEXT;
+
+/** @suppress {duplicate } */ var _glGetRenderbufferParameteriv = (target, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = GLctx.getRenderbufferParameter(target, pname);
+};
+
+var _emscripten_glGetRenderbufferParameteriv = _glGetRenderbufferParameteriv;
+
+/** @suppress {duplicate } */ var _glGetSamplerParameterfv = (sampler, pname, params) => {
+ if (!params) {
+ // GLES3 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_F32()[((params) >> 2)] = GLctx.getSamplerParameter(GL.samplers[sampler], pname);
+};
+
+var _emscripten_glGetSamplerParameterfv = _glGetSamplerParameterfv;
+
+/** @suppress {duplicate } */ var _glGetSamplerParameteriv = (sampler, pname, params) => {
+ if (!params) {
+ // GLES3 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = GLctx.getSamplerParameter(GL.samplers[sampler], pname);
+};
+
+var _emscripten_glGetSamplerParameteriv = _glGetSamplerParameteriv;
+
+/** @suppress {duplicate } */ var _glGetShaderInfoLog = (shader, maxLength, length, infoLog) => {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = "(unknown error)";
+ var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = numBytesWrittenExclNull;
+};
+
+var _emscripten_glGetShaderInfoLog = _glGetShaderInfoLog;
+
+/** @suppress {duplicate } */ var _glGetShaderPrecisionFormat = (shaderType, precisionType, range, precision) => {
+ var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
+ GROWABLE_HEAP_I32()[((range) >> 2)] = result.rangeMin;
+ GROWABLE_HEAP_I32()[(((range) + (4)) >> 2)] = result.rangeMax;
+ GROWABLE_HEAP_I32()[((precision) >> 2)] = result.precision;
+};
+
+var _emscripten_glGetShaderPrecisionFormat = _glGetShaderPrecisionFormat;
+
+/** @suppress {duplicate } */ var _glGetShaderSource = (shader, bufSize, length, source) => {
+ var result = GLctx.getShaderSource(GL.shaders[shader]);
+ if (!result) return;
+ // If an error occurs, nothing will be written to length or source.
+ var numBytesWrittenExclNull = (bufSize > 0 && source) ? stringToUTF8(result, source, bufSize) : 0;
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = numBytesWrittenExclNull;
+};
+
+var _emscripten_glGetShaderSource = _glGetShaderSource;
+
+/** @suppress {duplicate } */ var _glGetShaderiv = (shader, pname, p) => {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null
+ // pointer. Since calling this function does not make sense if p == null,
+ // issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ if (pname == 35716) {
+ // GL_INFO_LOG_LENGTH
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = "(unknown error)";
+ // The GLES2 specification says that if the shader has an empty info log,
+ // a value of 0 is returned. Otherwise the log has a null char appended.
+ // (An empty string is falsey, so we can just check that instead of
+ // looking at log.length.)
+ var logLength = log ? log.length + 1 : 0;
+ GROWABLE_HEAP_I32()[((p) >> 2)] = logLength;
+ } else if (pname == 35720) {
+ // GL_SHADER_SOURCE_LENGTH
+ var source = GLctx.getShaderSource(GL.shaders[shader]);
+ // source may be a null, or the empty string, both of which are falsey
+ // values that we report a 0 length for.
+ var sourceLength = source ? source.length + 1 : 0;
+ GROWABLE_HEAP_I32()[((p) >> 2)] = sourceLength;
+ } else {
+ GROWABLE_HEAP_I32()[((p) >> 2)] = GLctx.getShaderParameter(GL.shaders[shader], pname);
+ }
+};
+
+var _emscripten_glGetShaderiv = _glGetShaderiv;
+
+var stringToNewUTF8 = str => {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = _malloc(size);
+ if (ret) stringToUTF8(str, ret, size);
+ return ret;
+};
+
+/** @suppress {duplicate } */ var _glGetString = name_ => {
+ var ret = GL.stringCache[name_];
+ if (!ret) {
+ switch (name_) {
+ case 7939:
+ /* GL_EXTENSIONS */ ret = stringToNewUTF8(webglGetExtensions().join(" "));
+ break;
+
+ case 7936:
+ /* GL_VENDOR */ case 7937:
+ /* GL_RENDERER */ case 37445:
+ /* UNMASKED_VENDOR_WEBGL */ case 37446:
+ /* UNMASKED_RENDERER_WEBGL */ var s = GLctx.getParameter(name_);
+ if (!s) {
+ GL.recordError(1280);
+ }
+ ret = s ? stringToNewUTF8(s) : 0;
+ break;
+
+ case 7938:
+ /* GL_VERSION */ var webGLVersion = GLctx.getParameter(7938);
+ // return GLES version string corresponding to the version of the WebGL context
+ var glVersion = `OpenGL ES 2.0 (${webGLVersion})`;
+ if (true) glVersion = `OpenGL ES 3.0 (${webGLVersion})`;
+ ret = stringToNewUTF8(glVersion);
+ break;
+
+ case 35724:
+ /* GL_SHADING_LANGUAGE_VERSION */ var glslVersion = GLctx.getParameter(35724);
+ // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+ var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+ var ver_num = glslVersion.match(ver_re);
+ if (ver_num !== null) {
+ if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0";
+ // ensure minor version has 2 digits
+ glslVersion = `OpenGL ES GLSL ES ${ver_num[1]} (${glslVersion})`;
+ }
+ ret = stringToNewUTF8(glslVersion);
+ break;
+
+ default:
+ GL.recordError(1280);
+ }
+ // fall through
+ GL.stringCache[name_] = ret;
+ }
+ return ret;
+};
+
+var _emscripten_glGetString = _glGetString;
+
+/** @suppress {duplicate } */ var _glGetStringi = (name, index) => {
+ if (GL.currentContext.version < 2) {
+ GL.recordError(1282);
+ // Calling GLES3/WebGL2 function with a GLES2/WebGL1 context
+ return 0;
+ }
+ var stringiCache = GL.stringiCache[name];
+ if (stringiCache) {
+ if (index < 0 || index >= stringiCache.length) {
+ GL.recordError(1281);
+ /*GL_INVALID_VALUE*/ return 0;
+ }
+ return stringiCache[index];
+ }
+ switch (name) {
+ case 7939:
+ /* GL_EXTENSIONS */ var exts = webglGetExtensions().map(stringToNewUTF8);
+ stringiCache = GL.stringiCache[name] = exts;
+ if (index < 0 || index >= stringiCache.length) {
+ GL.recordError(1281);
+ /*GL_INVALID_VALUE*/ return 0;
+ }
+ return stringiCache[index];
+
+ default:
+ GL.recordError(1280);
+ /*GL_INVALID_ENUM*/ return 0;
+ }
+};
+
+var _emscripten_glGetStringi = _glGetStringi;
+
+/** @suppress {duplicate } */ var _glGetSynciv = (sync, pname, bufSize, length, values) => {
+ if (bufSize < 0) {
+ // GLES3 specification does not specify how to behave if bufSize < 0, however in the spec wording for glGetInternalformativ, it does say that GL_INVALID_VALUE should be raised,
+ // so raise GL_INVALID_VALUE here as well.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ if (!values) {
+ // GLES3 specification does not specify how to behave if values is a null pointer. Since calling this function does not make sense
+ // if values == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var ret = GLctx.getSyncParameter(GL.syncs[sync], pname);
+ if (ret !== null) {
+ GROWABLE_HEAP_I32()[((values) >> 2)] = ret;
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = 1;
+ }
+};
+
+// Report a single value outputted.
+var _emscripten_glGetSynciv = _glGetSynciv;
+
+/** @suppress {duplicate } */ var _glGetTexParameterfv = (target, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null
+ // pointer. Since calling this function does not make sense if p == null,
+ // issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_F32()[((params) >> 2)] = GLctx.getTexParameter(target, pname);
+};
+
+var _emscripten_glGetTexParameterfv = _glGetTexParameterfv;
+
+/** @suppress {duplicate } */ var _glGetTexParameteriv = (target, pname, params) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null
+ // pointer. Since calling this function does not make sense if p == null,
+ // issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_I32()[((params) >> 2)] = GLctx.getTexParameter(target, pname);
+};
+
+var _emscripten_glGetTexParameteriv = _glGetTexParameteriv;
+
+/** @suppress {duplicate } */ var _glGetTransformFeedbackVarying = (program, index, bufSize, length, size, type, name) => {
+ program = GL.programs[program];
+ var info = GLctx.getTransformFeedbackVarying(program, index);
+ if (!info) return;
+ // If an error occurred, the return parameters length, size, type and name will be unmodified.
+ if (name && bufSize > 0) {
+ var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = numBytesWrittenExclNull;
+ } else {
+ if (length) GROWABLE_HEAP_I32()[((length) >> 2)] = 0;
+ }
+ if (size) GROWABLE_HEAP_I32()[((size) >> 2)] = info.size;
+ if (type) GROWABLE_HEAP_I32()[((type) >> 2)] = info.type;
+};
+
+var _emscripten_glGetTransformFeedbackVarying = _glGetTransformFeedbackVarying;
+
+/** @suppress {duplicate } */ var _glGetUniformBlockIndex = (program, uniformBlockName) => GLctx.getUniformBlockIndex(GL.programs[program], UTF8ToString(uniformBlockName));
+
+var _emscripten_glGetUniformBlockIndex = _glGetUniformBlockIndex;
+
+/** @suppress {duplicate } */ var _glGetUniformIndices = (program, uniformCount, uniformNames, uniformIndices) => {
+ if (!uniformIndices) {
+ // GLES2 specification does not specify how to behave if uniformIndices is a null pointer. Since calling this function does not make sense
+ // if uniformIndices == null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ if (uniformCount > 0 && (uniformNames == 0 || uniformIndices == 0)) {
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ program = GL.programs[program];
+ var names = [];
+ for (var i = 0; i < uniformCount; i++) names.push(UTF8ToString(GROWABLE_HEAP_I32()[(((uniformNames) + (i * 4)) >> 2)]));
+ var result = GLctx.getUniformIndices(program, names);
+ if (!result) return;
+ // GL spec: If an error is generated, nothing is written out to uniformIndices.
+ var len = result.length;
+ for (var i = 0; i < len; i++) {
+ GROWABLE_HEAP_I32()[(((uniformIndices) + (i * 4)) >> 2)] = result[i];
+ }
+};
+
+var _emscripten_glGetUniformIndices = _glGetUniformIndices;
+
+/** @noinline */ var webglGetLeftBracePos = name => name.slice(-1) == "]" && name.lastIndexOf("[");
+
+var webglPrepareUniformLocationsBeforeFirstUse = program => {
+ var uniformLocsById = program.uniformLocsById, // Maps GLuint -> WebGLUniformLocation
+ uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, // Maps name -> [uniform array length, GLuint]
+ i, j;
+ // On the first time invocation of glGetUniformLocation on this shader program:
+ // initialize cache data structures and discover which uniforms are arrays.
+ if (!uniformLocsById) {
+ // maps GLint integer locations to WebGLUniformLocations
+ program.uniformLocsById = uniformLocsById = {};
+ // maps integer locations back to uniform name strings, so that we can lazily fetch uniform array locations
+ program.uniformArrayNamesById = {};
+ var numActiveUniforms = GLctx.getProgramParameter(program, 35718);
+ /*GL_ACTIVE_UNIFORMS*/ for (i = 0; i < numActiveUniforms; ++i) {
+ var u = GLctx.getActiveUniform(program, i);
+ var nm = u.name;
+ var sz = u.size;
+ var lb = webglGetLeftBracePos(nm);
+ var arrayName = lb > 0 ? nm.slice(0, lb) : nm;
+ // Assign a new location.
+ var id = program.uniformIdCounter;
+ program.uniformIdCounter += sz;
+ // Eagerly get the location of the uniformArray[0] base element.
+ // The remaining indices >0 will be left for lazy evaluation to
+ // improve performance. Those may never be needed to fetch, if the
+ // application fills arrays always in full starting from the first
+ // element of the array.
+ uniformSizeAndIdsByName[arrayName] = [ sz, id ];
+ // Store placeholder integers in place that highlight that these
+ // >0 index locations are array indices pending population.
+ for (j = 0; j < sz; ++j) {
+ uniformLocsById[id] = j;
+ program.uniformArrayNamesById[id++] = arrayName;
+ }
+ }
+ }
+};
+
+/** @suppress {duplicate } */ var _glGetUniformLocation = (program, name) => {
+ name = UTF8ToString(name);
+ if (program = GL.programs[program]) {
+ webglPrepareUniformLocationsBeforeFirstUse(program);
+ var uniformLocsById = program.uniformLocsById;
+ // Maps GLuint -> WebGLUniformLocation
+ var arrayIndex = 0;
+ var uniformBaseName = name;
+ // Invariant: when populating integer IDs for uniform locations, we must
+ // maintain the precondition that arrays reside in contiguous addresses,
+ // i.e. for a 'vec4 colors[10];', colors[4] must be at location
+ // colors[0]+4. However, user might call glGetUniformLocation(program,
+ // "colors") for an array, so we cannot discover based on the user input
+ // arguments whether the uniform we are dealing with is an array. The only
+ // way to discover which uniforms are arrays is to enumerate over all the
+ // active uniforms in the program.
+ var leftBrace = webglGetLeftBracePos(name);
+ // If user passed an array accessor "[index]", parse the array index off the accessor.
+ if (leftBrace > 0) {
+ arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0;
+ // "index]", coerce parseInt(']') with >>>0 to treat "foo[]" as "foo[0]" and foo[-1] as unsigned out-of-bounds.
+ uniformBaseName = name.slice(0, leftBrace);
+ }
+ // Have we cached the location of this uniform before?
+ // A pair [array length, GLint of the uniform location]
+ var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName];
+ // If an uniform with this name exists, and if its index is within the
+ // array limits (if it's even an array), query the WebGLlocation, or
+ // return an existing cached location.
+ if (sizeAndId && arrayIndex < sizeAndId[0]) {
+ arrayIndex += sizeAndId[1];
+ // Add the base location of the uniform to the array index offset.
+ if ((uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name))) {
+ return arrayIndex;
+ }
+ }
+ } else {
+ // N.b. we are currently unable to distinguish between GL program IDs that
+ // never existed vs GL program IDs that have been deleted, so report
+ // GL_INVALID_VALUE in both cases.
+ GL.recordError(1281);
+ }
+ /* GL_INVALID_VALUE */ return -1;
+};
+
+var _emscripten_glGetUniformLocation = _glGetUniformLocation;
+
+var webglGetUniformLocation = location => {
+ var p = GLctx.currentProgram;
+ if (p) {
+ var webglLoc = p.uniformLocsById[location];
+ // p.uniformLocsById[location] stores either an integer, or a
+ // WebGLUniformLocation.
+ // If an integer, we have not yet bound the location, so do it now. The
+ // integer value specifies the array index we should bind to.
+ if (typeof webglLoc == "number") {
+ p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? `[${webglLoc}]` : ""));
+ }
+ // Else an already cached WebGLUniformLocation, return it.
+ return webglLoc;
+ } else {
+ GL.recordError(1282);
+ }
+};
+
+/** @suppress{checkTypes} */ var emscriptenWebGLGetUniform = (program, location, params, type) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null
+ // pointer. Since calling this function does not make sense if params ==
+ // null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ program = GL.programs[program];
+ webglPrepareUniformLocationsBeforeFirstUse(program);
+ var data = GLctx.getUniform(program, webglGetUniformLocation(location));
+ if (typeof data == "number" || typeof data == "boolean") {
+ switch (type) {
+ case 0:
+ GROWABLE_HEAP_I32()[((params) >> 2)] = data;
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[((params) >> 2)] = data;
+ break;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 0:
+ GROWABLE_HEAP_I32()[(((params) + (i * 4)) >> 2)] = data[i];
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[(((params) + (i * 4)) >> 2)] = data[i];
+ break;
+ }
+ }
+ }
+};
+
+/** @suppress {duplicate } */ var _glGetUniformfv = (program, location, params) => {
+ emscriptenWebGLGetUniform(program, location, params, 2);
+};
+
+var _emscripten_glGetUniformfv = _glGetUniformfv;
+
+/** @suppress {duplicate } */ var _glGetUniformiv = (program, location, params) => {
+ emscriptenWebGLGetUniform(program, location, params, 0);
+};
+
+var _emscripten_glGetUniformiv = _glGetUniformiv;
+
+/** @suppress {duplicate } */ var _glGetUniformuiv = (program, location, params) => emscriptenWebGLGetUniform(program, location, params, 0);
+
+var _emscripten_glGetUniformuiv = _glGetUniformuiv;
+
+/** @suppress{checkTypes} */ var emscriptenWebGLGetVertexAttrib = (index, pname, params, type) => {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null
+ // pointer. Since calling this function does not make sense if params ==
+ // null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ var data = GLctx.getVertexAttrib(index, pname);
+ if (pname == 34975) /*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/ {
+ GROWABLE_HEAP_I32()[((params) >> 2)] = data && data["name"];
+ } else if (typeof data == "number" || typeof data == "boolean") {
+ switch (type) {
+ case 0:
+ GROWABLE_HEAP_I32()[((params) >> 2)] = data;
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[((params) >> 2)] = data;
+ break;
+
+ case 5:
+ GROWABLE_HEAP_I32()[((params) >> 2)] = Math.fround(data);
+ break;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 0:
+ GROWABLE_HEAP_I32()[(((params) + (i * 4)) >> 2)] = data[i];
+ break;
+
+ case 2:
+ GROWABLE_HEAP_F32()[(((params) + (i * 4)) >> 2)] = data[i];
+ break;
+
+ case 5:
+ GROWABLE_HEAP_I32()[(((params) + (i * 4)) >> 2)] = Math.fround(data[i]);
+ break;
+ }
+ }
+ }
+};
+
+/** @suppress {duplicate } */ var _glGetVertexAttribIiv = (index, pname, params) => {
+ // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttribI4iv(),
+ // otherwise the results are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 0);
+};
+
+var _emscripten_glGetVertexAttribIiv = _glGetVertexAttribIiv;
+
+/** @suppress {duplicate } */ var _glGetVertexAttribIuiv = _glGetVertexAttribIiv;
+
+var _emscripten_glGetVertexAttribIuiv = _glGetVertexAttribIuiv;
+
+/** @suppress {duplicate } */ var _glGetVertexAttribPointerv = (index, pname, pointer) => {
+ if (!pointer) {
+ // GLES2 specification does not specify how to behave if pointer is a null
+ // pointer. Since calling this function does not make sense if pointer ==
+ // null, issue a GL error to notify user about it.
+ GL.recordError(1281);
+ /* GL_INVALID_VALUE */ return;
+ }
+ GROWABLE_HEAP_I32()[((pointer) >> 2)] = GLctx.getVertexAttribOffset(index, pname);
+};
+
+var _emscripten_glGetVertexAttribPointerv = _glGetVertexAttribPointerv;
+
+/** @suppress {duplicate } */ var _glGetVertexAttribfv = (index, pname, params) => {
+ // N.B. This function may only be called if the vertex attribute was
+ // specified using the function glVertexAttrib*f(), otherwise the results
+ // are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 2);
+};
+
+var _emscripten_glGetVertexAttribfv = _glGetVertexAttribfv;
+
+/** @suppress {duplicate } */ var _glGetVertexAttribiv = (index, pname, params) => {
+ // N.B. This function may only be called if the vertex attribute was
+ // specified using the function glVertexAttrib*f(), otherwise the results
+ // are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 5);
+};
+
+var _emscripten_glGetVertexAttribiv = _glGetVertexAttribiv;
+
+/** @suppress {duplicate } */ var _glHint = (x0, x1) => GLctx.hint(x0, x1);
+
+var _emscripten_glHint = _glHint;
+
+/** @suppress {duplicate } */ var _glInvalidateFramebuffer = (target, numAttachments, attachments) => {
+ var list = tempFixedLengthArray[numAttachments];
+ for (var i = 0; i < numAttachments; i++) {
+ list[i] = GROWABLE_HEAP_I32()[(((attachments) + (i * 4)) >> 2)];
+ }
+ GLctx.invalidateFramebuffer(target, list);
+};
+
+var _emscripten_glInvalidateFramebuffer = _glInvalidateFramebuffer;
+
+/** @suppress {duplicate } */ var _glInvalidateSubFramebuffer = (target, numAttachments, attachments, x, y, width, height) => {
+ var list = tempFixedLengthArray[numAttachments];
+ for (var i = 0; i < numAttachments; i++) {
+ list[i] = GROWABLE_HEAP_I32()[(((attachments) + (i * 4)) >> 2)];
+ }
+ GLctx.invalidateSubFramebuffer(target, list, x, y, width, height);
+};
+
+var _emscripten_glInvalidateSubFramebuffer = _glInvalidateSubFramebuffer;
+
+/** @suppress {duplicate } */ var _glIsBuffer = buffer => {
+ var b = GL.buffers[buffer];
+ if (!b) return 0;
+ return GLctx.isBuffer(b);
+};
+
+var _emscripten_glIsBuffer = _glIsBuffer;
+
+/** @suppress {duplicate } */ var _glIsEnabled = x0 => GLctx.isEnabled(x0);
+
+var _emscripten_glIsEnabled = _glIsEnabled;
+
+/** @suppress {duplicate } */ var _glIsFramebuffer = framebuffer => {
+ var fb = GL.framebuffers[framebuffer];
+ if (!fb) return 0;
+ return GLctx.isFramebuffer(fb);
+};
+
+var _emscripten_glIsFramebuffer = _glIsFramebuffer;
+
+/** @suppress {duplicate } */ var _glIsProgram = program => {
+ program = GL.programs[program];
+ if (!program) return 0;
+ return GLctx.isProgram(program);
+};
+
+var _emscripten_glIsProgram = _glIsProgram;
+
+/** @suppress {duplicate } */ var _glIsQuery = id => {
+ var query = GL.queries[id];
+ if (!query) return 0;
+ return GLctx.isQuery(query);
+};
+
+var _emscripten_glIsQuery = _glIsQuery;
+
+/** @suppress {duplicate } */ var _glIsQueryEXT = id => {
+ var query = GL.queries[id];
+ if (!query) return 0;
+ return GLctx.disjointTimerQueryExt["isQueryEXT"](query);
+};
+
+var _emscripten_glIsQueryEXT = _glIsQueryEXT;
+
+/** @suppress {duplicate } */ var _glIsRenderbuffer = renderbuffer => {
+ var rb = GL.renderbuffers[renderbuffer];
+ if (!rb) return 0;
+ return GLctx.isRenderbuffer(rb);
+};
+
+var _emscripten_glIsRenderbuffer = _glIsRenderbuffer;
+
+/** @suppress {duplicate } */ var _glIsSampler = id => {
+ var sampler = GL.samplers[id];
+ if (!sampler) return 0;
+ return GLctx.isSampler(sampler);
+};
+
+var _emscripten_glIsSampler = _glIsSampler;
+
+/** @suppress {duplicate } */ var _glIsShader = shader => {
+ var s = GL.shaders[shader];
+ if (!s) return 0;
+ return GLctx.isShader(s);
+};
+
+var _emscripten_glIsShader = _glIsShader;
+
+/** @suppress {duplicate } */ var _glIsSync = sync => GLctx.isSync(GL.syncs[sync]);
+
+var _emscripten_glIsSync = _glIsSync;
+
+/** @suppress {duplicate } */ var _glIsTexture = id => {
+ var texture = GL.textures[id];
+ if (!texture) return 0;
+ return GLctx.isTexture(texture);
+};
+
+var _emscripten_glIsTexture = _glIsTexture;
+
+/** @suppress {duplicate } */ var _glIsTransformFeedback = id => GLctx.isTransformFeedback(GL.transformFeedbacks[id]);
+
+var _emscripten_glIsTransformFeedback = _glIsTransformFeedback;
+
+/** @suppress {duplicate } */ var _glIsVertexArray = array => {
+ var vao = GL.vaos[array];
+ if (!vao) return 0;
+ return GLctx.isVertexArray(vao);
+};
+
+var _emscripten_glIsVertexArray = _glIsVertexArray;
+
+/** @suppress {duplicate } */ var _glIsVertexArrayOES = _glIsVertexArray;
+
+var _emscripten_glIsVertexArrayOES = _glIsVertexArrayOES;
+
+/** @suppress {duplicate } */ var _glLineWidth = x0 => GLctx.lineWidth(x0);
+
+var _emscripten_glLineWidth = _glLineWidth;
+
+/** @suppress {duplicate } */ var _glLinkProgram = program => {
+ program = GL.programs[program];
+ GLctx.linkProgram(program);
+ // Invalidate earlier computed uniform->ID mappings, those have now become stale
+ program.uniformLocsById = 0;
+ // Mark as null-like so that glGetUniformLocation() knows to populate this again.
+ program.uniformSizeAndIdsByName = {};
+};
+
+var _emscripten_glLinkProgram = _glLinkProgram;
+
+/** @suppress {duplicate } */ var _glPauseTransformFeedback = () => GLctx.pauseTransformFeedback();
+
+var _emscripten_glPauseTransformFeedback = _glPauseTransformFeedback;
+
+/** @suppress {duplicate } */ var _glPixelStorei = (pname, param) => {
+ if (pname == 3317) {
+ GL.unpackAlignment = param;
+ } else if (pname == 3314) {
+ GL.unpackRowLength = param;
+ }
+ GLctx.pixelStorei(pname, param);
+};
+
+var _emscripten_glPixelStorei = _glPixelStorei;
+
+/** @suppress {duplicate } */ var _glPolygonModeWEBGL = (face, mode) => {
+ GLctx.webglPolygonMode["polygonModeWEBGL"](face, mode);
+};
+
+var _emscripten_glPolygonModeWEBGL = _glPolygonModeWEBGL;
+
+/** @suppress {duplicate } */ var _glPolygonOffset = (x0, x1) => GLctx.polygonOffset(x0, x1);
+
+var _emscripten_glPolygonOffset = _glPolygonOffset;
+
+/** @suppress {duplicate } */ var _glPolygonOffsetClampEXT = (factor, units, clamp) => {
+ GLctx.extPolygonOffsetClamp["polygonOffsetClampEXT"](factor, units, clamp);
+};
+
+var _emscripten_glPolygonOffsetClampEXT = _glPolygonOffsetClampEXT;
+
+/** @suppress {duplicate } */ var _glProgramBinary = (program, binaryFormat, binary, length) => {
+ GL.recordError(1280);
+};
+
+/*GL_INVALID_ENUM*/ var _emscripten_glProgramBinary = _glProgramBinary;
+
+/** @suppress {duplicate } */ var _glProgramParameteri = (program, pname, value) => {
+ GL.recordError(1280);
+};
+
+/*GL_INVALID_ENUM*/ var _emscripten_glProgramParameteri = _glProgramParameteri;
+
+/** @suppress {duplicate } */ var _glQueryCounterEXT = (id, target) => {
+ GLctx.disjointTimerQueryExt["queryCounterEXT"](GL.queries[id], target);
+};
+
+var _emscripten_glQueryCounterEXT = _glQueryCounterEXT;
+
+/** @suppress {duplicate } */ var _glReadBuffer = x0 => GLctx.readBuffer(x0);
+
+var _emscripten_glReadBuffer = _glReadBuffer;
+
+var computeUnpackAlignedImageSize = (width, height, sizePerPixel) => {
+ function roundedToNextMultipleOf(x, y) {
+ return (x + y - 1) & -y;
+ }
+ var plainRowSize = (GL.unpackRowLength || width) * sizePerPixel;
+ var alignedRowSize = roundedToNextMultipleOf(plainRowSize, GL.unpackAlignment);
+ return height * alignedRowSize;
+};
+
+var colorChannelsInGlTextureFormat = format => {
+ // Micro-optimizations for size: map format to size by subtracting smallest
+ // enum value (0x1902) from all values first. Also omit the most common
+ // size value (1) from the list, which is assumed by formats not on the
+ // list.
+ var colorChannels = {
+ // 0x1902 /* GL_DEPTH_COMPONENT */ - 0x1902: 1,
+ // 0x1906 /* GL_ALPHA */ - 0x1902: 1,
+ 5: 3,
+ 6: 4,
+ // 0x1909 /* GL_LUMINANCE */ - 0x1902: 1,
+ 8: 2,
+ 29502: 3,
+ 29504: 4,
+ // 0x1903 /* GL_RED */ - 0x1902: 1,
+ 26917: 2,
+ 26918: 2,
+ // 0x8D94 /* GL_RED_INTEGER */ - 0x1902: 1,
+ 29846: 3,
+ 29847: 4
+ };
+ return colorChannels[format - 6402] || 1;
+};
+
+var heapObjectForWebGLType = type => {
+ // Micro-optimization for size: Subtract lowest GL enum number (0x1400/* GL_BYTE */) from type to compare
+ // smaller values for the heap, for shorter generated code size.
+ // Also the type HEAPU16 is not tested for explicitly, but any unrecognized type will return out HEAPU16.
+ // (since most types are HEAPU16)
+ type -= 5120;
+ if (type == 0) return GROWABLE_HEAP_I8();
+ if (type == 1) return GROWABLE_HEAP_U8();
+ if (type == 2) return GROWABLE_HEAP_I16();
+ if (type == 4) return GROWABLE_HEAP_I32();
+ if (type == 6) return GROWABLE_HEAP_F32();
+ if (type == 5 || type == 28922 || type == 28520 || type == 30779 || type == 30782) return GROWABLE_HEAP_U32();
+ return GROWABLE_HEAP_U16();
+};
+
+var toTypedArrayIndex = (pointer, heap) => pointer >>> (31 - Math.clz32(heap.BYTES_PER_ELEMENT));
+
+var emscriptenWebGLGetTexPixelData = (type, format, width, height, pixels, internalFormat) => {
+ var heap = heapObjectForWebGLType(type);
+ var sizePerPixel = colorChannelsInGlTextureFormat(format) * heap.BYTES_PER_ELEMENT;
+ var bytes = computeUnpackAlignedImageSize(width, height, sizePerPixel);
+ return heap.subarray(toTypedArrayIndex(pixels, heap), toTypedArrayIndex(pixels + bytes, heap));
+};
+
+/** @suppress {duplicate } */ var _glReadPixels = (x, y, width, height, format, type, pixels) => {
+ if (true) {
+ if (GLctx.currentPixelPackBufferBinding) {
+ GLctx.readPixels(x, y, width, height, format, type, pixels);
+ return;
+ }
+ var heap = heapObjectForWebGLType(type);
+ var target = toTypedArrayIndex(pixels, heap);
+ GLctx.readPixels(x, y, width, height, format, type, heap, target);
+ return;
+ }
+};
+
+var _emscripten_glReadPixels = _glReadPixels;
+
+/** @suppress {duplicate } */ var _glReleaseShaderCompiler = () => {};
+
+// NOP (as allowed by GLES 2.0 spec)
+var _emscripten_glReleaseShaderCompiler = _glReleaseShaderCompiler;
+
+/** @suppress {duplicate } */ var _glRenderbufferStorage = (x0, x1, x2, x3) => GLctx.renderbufferStorage(x0, x1, x2, x3);
+
+var _emscripten_glRenderbufferStorage = _glRenderbufferStorage;
+
+/** @suppress {duplicate } */ var _glRenderbufferStorageMultisample = (x0, x1, x2, x3, x4) => GLctx.renderbufferStorageMultisample(x0, x1, x2, x3, x4);
+
+var _emscripten_glRenderbufferStorageMultisample = _glRenderbufferStorageMultisample;
+
+/** @suppress {duplicate } */ var _glResumeTransformFeedback = () => GLctx.resumeTransformFeedback();
+
+var _emscripten_glResumeTransformFeedback = _glResumeTransformFeedback;
+
+/** @suppress {duplicate } */ var _glSampleCoverage = (value, invert) => {
+ GLctx.sampleCoverage(value, !!invert);
+};
+
+var _emscripten_glSampleCoverage = _glSampleCoverage;
+
+/** @suppress {duplicate } */ var _glSamplerParameterf = (sampler, pname, param) => {
+ GLctx.samplerParameterf(GL.samplers[sampler], pname, param);
+};
+
+var _emscripten_glSamplerParameterf = _glSamplerParameterf;
+
+/** @suppress {duplicate } */ var _glSamplerParameterfv = (sampler, pname, params) => {
+ var param = GROWABLE_HEAP_F32()[((params) >> 2)];
+ GLctx.samplerParameterf(GL.samplers[sampler], pname, param);
+};
+
+var _emscripten_glSamplerParameterfv = _glSamplerParameterfv;
+
+/** @suppress {duplicate } */ var _glSamplerParameteri = (sampler, pname, param) => {
+ GLctx.samplerParameteri(GL.samplers[sampler], pname, param);
+};
+
+var _emscripten_glSamplerParameteri = _glSamplerParameteri;
+
+/** @suppress {duplicate } */ var _glSamplerParameteriv = (sampler, pname, params) => {
+ var param = GROWABLE_HEAP_I32()[((params) >> 2)];
+ GLctx.samplerParameteri(GL.samplers[sampler], pname, param);
+};
+
+var _emscripten_glSamplerParameteriv = _glSamplerParameteriv;
+
+/** @suppress {duplicate } */ var _glScissor = (x0, x1, x2, x3) => GLctx.scissor(x0, x1, x2, x3);
+
+var _emscripten_glScissor = _glScissor;
+
+/** @suppress {duplicate } */ var _glShaderBinary = (count, shaders, binaryformat, binary, length) => {
+ GL.recordError(1280);
+};
+
+/*GL_INVALID_ENUM*/ var _emscripten_glShaderBinary = _glShaderBinary;
+
+/** @suppress {duplicate } */ var _glShaderSource = (shader, count, string, length) => {
+ var source = GL.getSource(shader, count, string, length);
+ GLctx.shaderSource(GL.shaders[shader], source);
+};
+
+var _emscripten_glShaderSource = _glShaderSource;
+
+/** @suppress {duplicate } */ var _glStencilFunc = (x0, x1, x2) => GLctx.stencilFunc(x0, x1, x2);
+
+var _emscripten_glStencilFunc = _glStencilFunc;
+
+/** @suppress {duplicate } */ var _glStencilFuncSeparate = (x0, x1, x2, x3) => GLctx.stencilFuncSeparate(x0, x1, x2, x3);
+
+var _emscripten_glStencilFuncSeparate = _glStencilFuncSeparate;
+
+/** @suppress {duplicate } */ var _glStencilMask = x0 => GLctx.stencilMask(x0);
+
+var _emscripten_glStencilMask = _glStencilMask;
+
+/** @suppress {duplicate } */ var _glStencilMaskSeparate = (x0, x1) => GLctx.stencilMaskSeparate(x0, x1);
+
+var _emscripten_glStencilMaskSeparate = _glStencilMaskSeparate;
+
+/** @suppress {duplicate } */ var _glStencilOp = (x0, x1, x2) => GLctx.stencilOp(x0, x1, x2);
+
+var _emscripten_glStencilOp = _glStencilOp;
+
+/** @suppress {duplicate } */ var _glStencilOpSeparate = (x0, x1, x2, x3) => GLctx.stencilOpSeparate(x0, x1, x2, x3);
+
+var _emscripten_glStencilOpSeparate = _glStencilOpSeparate;
+
+/** @suppress {duplicate } */ var _glTexImage2D = (target, level, internalFormat, width, height, border, format, type, pixels) => {
+ if (true) {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels);
+ return;
+ }
+ if (pixels) {
+ var heap = heapObjectForWebGLType(type);
+ var index = toTypedArrayIndex(pixels, heap);
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, index);
+ return;
+ }
+ }
+ var pixelData = pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null;
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
+};
+
+var _emscripten_glTexImage2D = _glTexImage2D;
+
+/** @suppress {duplicate } */ var _glTexImage3D = (target, level, internalFormat, width, height, depth, border, format, type, pixels) => {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels);
+ } else if (pixels) {
+ var heap = heapObjectForWebGLType(type);
+ GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, heap, toTypedArrayIndex(pixels, heap));
+ } else {
+ GLctx.texImage3D(target, level, internalFormat, width, height, depth, border, format, type, null);
+ }
+};
+
+var _emscripten_glTexImage3D = _glTexImage3D;
+
+/** @suppress {duplicate } */ var _glTexParameterf = (x0, x1, x2) => GLctx.texParameterf(x0, x1, x2);
+
+var _emscripten_glTexParameterf = _glTexParameterf;
+
+/** @suppress {duplicate } */ var _glTexParameterfv = (target, pname, params) => {
+ var param = GROWABLE_HEAP_F32()[((params) >> 2)];
+ GLctx.texParameterf(target, pname, param);
+};
+
+var _emscripten_glTexParameterfv = _glTexParameterfv;
+
+/** @suppress {duplicate } */ var _glTexParameteri = (x0, x1, x2) => GLctx.texParameteri(x0, x1, x2);
+
+var _emscripten_glTexParameteri = _glTexParameteri;
+
+/** @suppress {duplicate } */ var _glTexParameteriv = (target, pname, params) => {
+ var param = GROWABLE_HEAP_I32()[((params) >> 2)];
+ GLctx.texParameteri(target, pname, param);
+};
+
+var _emscripten_glTexParameteriv = _glTexParameteriv;
+
+/** @suppress {duplicate } */ var _glTexStorage2D = (x0, x1, x2, x3, x4) => GLctx.texStorage2D(x0, x1, x2, x3, x4);
+
+var _emscripten_glTexStorage2D = _glTexStorage2D;
+
+/** @suppress {duplicate } */ var _glTexStorage3D = (x0, x1, x2, x3, x4, x5) => GLctx.texStorage3D(x0, x1, x2, x3, x4, x5);
+
+var _emscripten_glTexStorage3D = _glTexStorage3D;
+
+/** @suppress {duplicate } */ var _glTexSubImage2D = (target, level, xoffset, yoffset, width, height, format, type, pixels) => {
+ if (true) {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels);
+ return;
+ }
+ if (pixels) {
+ var heap = heapObjectForWebGLType(type);
+ GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, heap, toTypedArrayIndex(pixels, heap));
+ return;
+ }
+ }
+ var pixelData = pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0) : null;
+ GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
+};
+
+var _emscripten_glTexSubImage2D = _glTexSubImage2D;
+
+/** @suppress {duplicate } */ var _glTexSubImage3D = (target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) => {
+ if (GLctx.currentPixelUnpackBufferBinding) {
+ GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels);
+ } else if (pixels) {
+ var heap = heapObjectForWebGLType(type);
+ GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, toTypedArrayIndex(pixels, heap));
+ } else {
+ GLctx.texSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null);
+ }
+};
+
+var _emscripten_glTexSubImage3D = _glTexSubImage3D;
+
+/** @suppress {duplicate } */ var _glTransformFeedbackVaryings = (program, count, varyings, bufferMode) => {
+ program = GL.programs[program];
+ var vars = [];
+ for (var i = 0; i < count; i++) vars.push(UTF8ToString(GROWABLE_HEAP_I32()[(((varyings) + (i * 4)) >> 2)]));
+ GLctx.transformFeedbackVaryings(program, vars, bufferMode);
+};
+
+var _emscripten_glTransformFeedbackVaryings = _glTransformFeedbackVaryings;
+
+/** @suppress {duplicate } */ var _glUniform1f = (location, v0) => {
+ GLctx.uniform1f(webglGetUniformLocation(location), v0);
+};
+
+var _emscripten_glUniform1f = _glUniform1f;
+
+/** @suppress {duplicate } */ var _glUniform1fv = (location, count, value) => {
+ count && GLctx.uniform1fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), ((value) >> 2), count);
+};
+
+var _emscripten_glUniform1fv = _glUniform1fv;
+
+/** @suppress {duplicate } */ var _glUniform1i = (location, v0) => {
+ GLctx.uniform1i(webglGetUniformLocation(location), v0);
+};
+
+var _emscripten_glUniform1i = _glUniform1i;
+
+/** @suppress {duplicate } */ var _glUniform1iv = (location, count, value) => {
+ count && GLctx.uniform1iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), ((value) >> 2), count);
+};
+
+var _emscripten_glUniform1iv = _glUniform1iv;
+
+/** @suppress {duplicate } */ var _glUniform1ui = (location, v0) => {
+ GLctx.uniform1ui(webglGetUniformLocation(location), v0);
+};
+
+var _emscripten_glUniform1ui = _glUniform1ui;
+
+/** @suppress {duplicate } */ var _glUniform1uiv = (location, count, value) => {
+ count && GLctx.uniform1uiv(webglGetUniformLocation(location), GROWABLE_HEAP_U32(), ((value) >> 2), count);
+};
+
+var _emscripten_glUniform1uiv = _glUniform1uiv;
+
+/** @suppress {duplicate } */ var _glUniform2f = (location, v0, v1) => {
+ GLctx.uniform2f(webglGetUniformLocation(location), v0, v1);
+};
+
+var _emscripten_glUniform2f = _glUniform2f;
+
+/** @suppress {duplicate } */ var _glUniform2fv = (location, count, value) => {
+ count && GLctx.uniform2fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), ((value) >> 2), count * 2);
+};
+
+var _emscripten_glUniform2fv = _glUniform2fv;
+
+/** @suppress {duplicate } */ var _glUniform2i = (location, v0, v1) => {
+ GLctx.uniform2i(webglGetUniformLocation(location), v0, v1);
+};
+
+var _emscripten_glUniform2i = _glUniform2i;
+
+/** @suppress {duplicate } */ var _glUniform2iv = (location, count, value) => {
+ count && GLctx.uniform2iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), ((value) >> 2), count * 2);
+};
+
+var _emscripten_glUniform2iv = _glUniform2iv;
+
+/** @suppress {duplicate } */ var _glUniform2ui = (location, v0, v1) => {
+ GLctx.uniform2ui(webglGetUniformLocation(location), v0, v1);
+};
+
+var _emscripten_glUniform2ui = _glUniform2ui;
+
+/** @suppress {duplicate } */ var _glUniform2uiv = (location, count, value) => {
+ count && GLctx.uniform2uiv(webglGetUniformLocation(location), GROWABLE_HEAP_U32(), ((value) >> 2), count * 2);
+};
+
+var _emscripten_glUniform2uiv = _glUniform2uiv;
+
+/** @suppress {duplicate } */ var _glUniform3f = (location, v0, v1, v2) => {
+ GLctx.uniform3f(webglGetUniformLocation(location), v0, v1, v2);
+};
+
+var _emscripten_glUniform3f = _glUniform3f;
+
+/** @suppress {duplicate } */ var _glUniform3fv = (location, count, value) => {
+ count && GLctx.uniform3fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), ((value) >> 2), count * 3);
+};
+
+var _emscripten_glUniform3fv = _glUniform3fv;
+
+/** @suppress {duplicate } */ var _glUniform3i = (location, v0, v1, v2) => {
+ GLctx.uniform3i(webglGetUniformLocation(location), v0, v1, v2);
+};
+
+var _emscripten_glUniform3i = _glUniform3i;
+
+/** @suppress {duplicate } */ var _glUniform3iv = (location, count, value) => {
+ count && GLctx.uniform3iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), ((value) >> 2), count * 3);
+};
+
+var _emscripten_glUniform3iv = _glUniform3iv;
+
+/** @suppress {duplicate } */ var _glUniform3ui = (location, v0, v1, v2) => {
+ GLctx.uniform3ui(webglGetUniformLocation(location), v0, v1, v2);
+};
+
+var _emscripten_glUniform3ui = _glUniform3ui;
+
+/** @suppress {duplicate } */ var _glUniform3uiv = (location, count, value) => {
+ count && GLctx.uniform3uiv(webglGetUniformLocation(location), GROWABLE_HEAP_U32(), ((value) >> 2), count * 3);
+};
+
+var _emscripten_glUniform3uiv = _glUniform3uiv;
+
+/** @suppress {duplicate } */ var _glUniform4f = (location, v0, v1, v2, v3) => {
+ GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3);
+};
+
+var _emscripten_glUniform4f = _glUniform4f;
+
+/** @suppress {duplicate } */ var _glUniform4fv = (location, count, value) => {
+ count && GLctx.uniform4fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), ((value) >> 2), count * 4);
+};
+
+var _emscripten_glUniform4fv = _glUniform4fv;
+
+/** @suppress {duplicate } */ var _glUniform4i = (location, v0, v1, v2, v3) => {
+ GLctx.uniform4i(webglGetUniformLocation(location), v0, v1, v2, v3);
+};
+
+var _emscripten_glUniform4i = _glUniform4i;
+
+/** @suppress {duplicate } */ var _glUniform4iv = (location, count, value) => {
+ count && GLctx.uniform4iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), ((value) >> 2), count * 4);
+};
+
+var _emscripten_glUniform4iv = _glUniform4iv;
+
+/** @suppress {duplicate } */ var _glUniform4ui = (location, v0, v1, v2, v3) => {
+ GLctx.uniform4ui(webglGetUniformLocation(location), v0, v1, v2, v3);
+};
+
+var _emscripten_glUniform4ui = _glUniform4ui;
+
+/** @suppress {duplicate } */ var _glUniform4uiv = (location, count, value) => {
+ count && GLctx.uniform4uiv(webglGetUniformLocation(location), GROWABLE_HEAP_U32(), ((value) >> 2), count * 4);
+};
+
+var _emscripten_glUniform4uiv = _glUniform4uiv;
+
+/** @suppress {duplicate } */ var _glUniformBlockBinding = (program, uniformBlockIndex, uniformBlockBinding) => {
+ program = GL.programs[program];
+ GLctx.uniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding);
+};
+
+var _emscripten_glUniformBlockBinding = _glUniformBlockBinding;
+
+/** @suppress {duplicate } */ var _glUniformMatrix2fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 4);
+};
+
+var _emscripten_glUniformMatrix2fv = _glUniformMatrix2fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix2x3fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix2x3fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 6);
+};
+
+var _emscripten_glUniformMatrix2x3fv = _glUniformMatrix2x3fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix2x4fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix2x4fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 8);
+};
+
+var _emscripten_glUniformMatrix2x4fv = _glUniformMatrix2x4fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix3fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 9);
+};
+
+var _emscripten_glUniformMatrix3fv = _glUniformMatrix3fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix3x2fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix3x2fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 6);
+};
+
+var _emscripten_glUniformMatrix3x2fv = _glUniformMatrix3x2fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix3x4fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix3x4fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 12);
+};
+
+var _emscripten_glUniformMatrix3x4fv = _glUniformMatrix3x4fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix4fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 16);
+};
+
+var _emscripten_glUniformMatrix4fv = _glUniformMatrix4fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix4x2fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix4x2fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 8);
+};
+
+var _emscripten_glUniformMatrix4x2fv = _glUniformMatrix4x2fv;
+
+/** @suppress {duplicate } */ var _glUniformMatrix4x3fv = (location, count, transpose, value) => {
+ count && GLctx.uniformMatrix4x3fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), ((value) >> 2), count * 12);
+};
+
+var _emscripten_glUniformMatrix4x3fv = _glUniformMatrix4x3fv;
+
+/** @suppress {duplicate } */ var _glUseProgram = program => {
+ program = GL.programs[program];
+ GLctx.useProgram(program);
+ // Record the currently active program so that we can access the uniform
+ // mapping table of that program.
+ GLctx.currentProgram = program;
+};
+
+var _emscripten_glUseProgram = _glUseProgram;
+
+/** @suppress {duplicate } */ var _glValidateProgram = program => {
+ GLctx.validateProgram(GL.programs[program]);
+};
+
+var _emscripten_glValidateProgram = _glValidateProgram;
+
+/** @suppress {duplicate } */ var _glVertexAttrib1f = (x0, x1) => GLctx.vertexAttrib1f(x0, x1);
+
+var _emscripten_glVertexAttrib1f = _glVertexAttrib1f;
+
+/** @suppress {duplicate } */ var _glVertexAttrib1fv = (index, v) => {
+ GLctx.vertexAttrib1f(index, GROWABLE_HEAP_F32()[v >> 2]);
+};
+
+var _emscripten_glVertexAttrib1fv = _glVertexAttrib1fv;
+
+/** @suppress {duplicate } */ var _glVertexAttrib2f = (x0, x1, x2) => GLctx.vertexAttrib2f(x0, x1, x2);
+
+var _emscripten_glVertexAttrib2f = _glVertexAttrib2f;
+
+/** @suppress {duplicate } */ var _glVertexAttrib2fv = (index, v) => {
+ GLctx.vertexAttrib2f(index, GROWABLE_HEAP_F32()[v >> 2], GROWABLE_HEAP_F32()[v + 4 >> 2]);
+};
+
+var _emscripten_glVertexAttrib2fv = _glVertexAttrib2fv;
+
+/** @suppress {duplicate } */ var _glVertexAttrib3f = (x0, x1, x2, x3) => GLctx.vertexAttrib3f(x0, x1, x2, x3);
+
+var _emscripten_glVertexAttrib3f = _glVertexAttrib3f;
+
+/** @suppress {duplicate } */ var _glVertexAttrib3fv = (index, v) => {
+ GLctx.vertexAttrib3f(index, GROWABLE_HEAP_F32()[v >> 2], GROWABLE_HEAP_F32()[v + 4 >> 2], GROWABLE_HEAP_F32()[v + 8 >> 2]);
+};
+
+var _emscripten_glVertexAttrib3fv = _glVertexAttrib3fv;
+
+/** @suppress {duplicate } */ var _glVertexAttrib4f = (x0, x1, x2, x3, x4) => GLctx.vertexAttrib4f(x0, x1, x2, x3, x4);
+
+var _emscripten_glVertexAttrib4f = _glVertexAttrib4f;
+
+/** @suppress {duplicate } */ var _glVertexAttrib4fv = (index, v) => {
+ GLctx.vertexAttrib4f(index, GROWABLE_HEAP_F32()[v >> 2], GROWABLE_HEAP_F32()[v + 4 >> 2], GROWABLE_HEAP_F32()[v + 8 >> 2], GROWABLE_HEAP_F32()[v + 12 >> 2]);
+};
+
+var _emscripten_glVertexAttrib4fv = _glVertexAttrib4fv;
+
+/** @suppress {duplicate } */ var _glVertexAttribDivisor = (index, divisor) => {
+ GLctx.vertexAttribDivisor(index, divisor);
+};
+
+var _emscripten_glVertexAttribDivisor = _glVertexAttribDivisor;
+
+/** @suppress {duplicate } */ var _glVertexAttribDivisorANGLE = _glVertexAttribDivisor;
+
+var _emscripten_glVertexAttribDivisorANGLE = _glVertexAttribDivisorANGLE;
+
+/** @suppress {duplicate } */ var _glVertexAttribDivisorARB = _glVertexAttribDivisor;
+
+var _emscripten_glVertexAttribDivisorARB = _glVertexAttribDivisorARB;
+
+/** @suppress {duplicate } */ var _glVertexAttribDivisorEXT = _glVertexAttribDivisor;
+
+var _emscripten_glVertexAttribDivisorEXT = _glVertexAttribDivisorEXT;
+
+/** @suppress {duplicate } */ var _glVertexAttribDivisorNV = _glVertexAttribDivisor;
+
+var _emscripten_glVertexAttribDivisorNV = _glVertexAttribDivisorNV;
+
+/** @suppress {duplicate } */ var _glVertexAttribI4i = (x0, x1, x2, x3, x4) => GLctx.vertexAttribI4i(x0, x1, x2, x3, x4);
+
+var _emscripten_glVertexAttribI4i = _glVertexAttribI4i;
+
+/** @suppress {duplicate } */ var _glVertexAttribI4iv = (index, v) => {
+ GLctx.vertexAttribI4i(index, GROWABLE_HEAP_I32()[v >> 2], GROWABLE_HEAP_I32()[v + 4 >> 2], GROWABLE_HEAP_I32()[v + 8 >> 2], GROWABLE_HEAP_I32()[v + 12 >> 2]);
+};
+
+var _emscripten_glVertexAttribI4iv = _glVertexAttribI4iv;
+
+/** @suppress {duplicate } */ var _glVertexAttribI4ui = (x0, x1, x2, x3, x4) => GLctx.vertexAttribI4ui(x0, x1, x2, x3, x4);
+
+var _emscripten_glVertexAttribI4ui = _glVertexAttribI4ui;
+
+/** @suppress {duplicate } */ var _glVertexAttribI4uiv = (index, v) => {
+ GLctx.vertexAttribI4ui(index, GROWABLE_HEAP_U32()[v >> 2], GROWABLE_HEAP_U32()[v + 4 >> 2], GROWABLE_HEAP_U32()[v + 8 >> 2], GROWABLE_HEAP_U32()[v + 12 >> 2]);
+};
+
+var _emscripten_glVertexAttribI4uiv = _glVertexAttribI4uiv;
+
+/** @suppress {duplicate } */ var _glVertexAttribIPointer = (index, size, type, stride, ptr) => {
+ GLctx.vertexAttribIPointer(index, size, type, stride, ptr);
+};
+
+var _emscripten_glVertexAttribIPointer = _glVertexAttribIPointer;
+
+/** @suppress {duplicate } */ var _glVertexAttribPointer = (index, size, type, normalized, stride, ptr) => {
+ GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+};
+
+var _emscripten_glVertexAttribPointer = _glVertexAttribPointer;
+
+/** @suppress {duplicate } */ var _glViewport = (x0, x1, x2, x3) => GLctx.viewport(x0, x1, x2, x3);
+
+var _emscripten_glViewport = _glViewport;
+
+/** @suppress {duplicate } */ var _glWaitSync = (sync, flags, timeout_low, timeout_high) => {
+ // See WebGL2 vs GLES3 difference on GL_TIMEOUT_IGNORED above (https://www.khronos.org/registry/webgl/specs/latest/2.0/#5.15)
+ var timeout = convertI32PairToI53(timeout_low, timeout_high);
+ GLctx.waitSync(GL.syncs[sync], flags, timeout);
+};
+
+var _emscripten_glWaitSync = _glWaitSync;
+
+var _emscripten_num_logical_cores = () => ENVIRONMENT_IS_NODE ? require("os").cpus().length : navigator["hardwareConcurrency"];
+
+var growMemory = size => {
+ var b = wasmMemory.buffer;
+ var pages = ((size - b.byteLength + 65535) / 65536) | 0;
+ try {
+ // round size grow request up to wasm page size (fixed 64KB per spec)
+ wasmMemory.grow(pages);
+ // .grow() takes a delta compared to the previous size
+ updateMemoryViews();
+ return 1;
+ } /*success*/ catch (e) {}
+};
+
+// implicit 0 return to save code size (caller will cast "undefined" into 0
+// anyhow)
+var _emscripten_resize_heap = requestedSize => {
+ var oldSize = GROWABLE_HEAP_U8().length;
+ // With CAN_ADDRESS_2GB or MEMORY64, pointers are already unsigned.
+ requestedSize >>>= 0;
+ // With multithreaded builds, races can happen (another thread might increase the size
+ // in between), so return a failure, and let the caller retry.
+ if (requestedSize <= oldSize) {
+ return false;
+ }
+ // Memory resize rules:
+ // 1. Always increase heap size to at least the requested size, rounded up
+ // to next page multiple.
+ // 2a. If MEMORY_GROWTH_LINEAR_STEP == -1, excessively resize the heap
+ // geometrically: increase the heap size according to
+ // MEMORY_GROWTH_GEOMETRIC_STEP factor (default +20%), At most
+ // overreserve by MEMORY_GROWTH_GEOMETRIC_CAP bytes (default 96MB).
+ // 2b. If MEMORY_GROWTH_LINEAR_STEP != -1, excessively resize the heap
+ // linearly: increase the heap size by at least
+ // MEMORY_GROWTH_LINEAR_STEP bytes.
+ // 3. Max size for the heap is capped at 2048MB-WASM_PAGE_SIZE, or by
+ // MAXIMUM_MEMORY, or by ASAN limit, depending on which is smallest
+ // 4. If we were unable to allocate as much memory, it may be due to
+ // over-eager decision to excessively reserve due to (3) above.
+ // Hence if an allocation fails, cut down on the amount of excess
+ // growth, in an attempt to succeed to perform a smaller allocation.
+ // A limit is set for how much we can grow. We should not exceed that
+ // (the wasm binary specifies it, so if we tried, we'd fail anyhow).
+ var maxHeapSize = getHeapMax();
+ if (requestedSize > maxHeapSize) {
+ return false;
+ }
+ // Loop through potential heap size increases. If we attempt a too eager
+ // reservation that fails, cut down on the attempted size and reserve a
+ // smaller bump instead. (max 3 times, chosen somewhat arbitrarily)
+ for (var cutDown = 1; cutDown <= 4; cutDown *= 2) {
+ var overGrownHeapSize = oldSize * (1 + .2 / cutDown);
+ // ensure geometric growth
+ // but limit overreserving (default to capping at +96MB overgrowth at most)
+ overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296);
+ var newSize = Math.min(maxHeapSize, alignMemory(Math.max(requestedSize, overGrownHeapSize), 65536));
+ var replacement = growMemory(newSize);
+ if (replacement) {
+ return true;
+ }
+ }
+ return false;
+};
+
+var _emscripten_set_main_loop = (func, fps, simulateInfiniteLoop) => {
+ var iterFunc = getWasmTableEntry(func);
+ setMainLoop(iterFunc, fps, simulateInfiniteLoop);
+};
+
+var registerTouchEventCallback = (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) => {
+ targetThread = JSEvents.getTargetThreadForEventCallback(targetThread);
+ JSEvents.touchEvent ||= _malloc(1552);
+ target = findEventTarget(target);
+ var touchEventHandlerFunc = e => {
+ var t, touches = {}, et = e.touches;
+ // To ease marshalling different kinds of touches that browser reports (all touches are listed in e.touches,
+ // only changed touches in e.changedTouches, and touches on target at a.targetTouches), mark a boolean in
+ // each Touch object so that we can later loop only once over all touches we see to marshall over to Wasm.
+ for (let t of et) {
+ // Browser might recycle the generated Touch objects between each frame (Firefox on Android), so reset any
+ // changed/target states we may have set from previous frame.
+ t.isChanged = t.onTarget = 0;
+ touches[t.identifier] = t;
+ }
+ // Mark which touches are part of the changedTouches list.
+ for (let t of e.changedTouches) {
+ t.isChanged = 1;
+ touches[t.identifier] = t;
+ }
+ // Mark which touches are part of the targetTouches list.
+ for (let t of e.targetTouches) {
+ touches[t.identifier].onTarget = 1;
+ }
+ var touchEvent = targetThread ? _malloc(1552) : JSEvents.touchEvent;
+ GROWABLE_HEAP_F64()[((touchEvent) >> 3)] = e.timeStamp;
+ GROWABLE_HEAP_I8()[touchEvent + 12] = e.ctrlKey;
+ GROWABLE_HEAP_I8()[touchEvent + 13] = e.shiftKey;
+ GROWABLE_HEAP_I8()[touchEvent + 14] = e.altKey;
+ GROWABLE_HEAP_I8()[touchEvent + 15] = e.metaKey;
+ var idx = touchEvent + 16;
+ var targetRect = getBoundingClientRect(target);
+ var numTouches = 0;
+ for (let t of Object.values(touches)) {
+ var idx32 = ((idx) >> 2);
+ // Pre-shift the ptr to index to HEAP32 to save code size
+ GROWABLE_HEAP_I32()[idx32 + 0] = t.identifier;
+ GROWABLE_HEAP_I32()[idx32 + 1] = t.screenX;
+ GROWABLE_HEAP_I32()[idx32 + 2] = t.screenY;
+ GROWABLE_HEAP_I32()[idx32 + 3] = t.clientX;
+ GROWABLE_HEAP_I32()[idx32 + 4] = t.clientY;
+ GROWABLE_HEAP_I32()[idx32 + 5] = t.pageX;
+ GROWABLE_HEAP_I32()[idx32 + 6] = t.pageY;
+ GROWABLE_HEAP_I8()[idx + 28] = t.isChanged;
+ GROWABLE_HEAP_I8()[idx + 29] = t.onTarget;
+ GROWABLE_HEAP_I32()[idx32 + 8] = t.clientX - (targetRect.left | 0);
+ GROWABLE_HEAP_I32()[idx32 + 9] = t.clientY - (targetRect.top | 0);
+ idx += 48;
+ if (++numTouches > 31) {
+ break;
+ }
+ }
+ GROWABLE_HEAP_I32()[(((touchEvent) + (8)) >> 2)] = numTouches;
+ if (targetThread) __emscripten_run_callback_on_thread(targetThread, callbackfunc, eventTypeId, touchEvent, userData); else if (getWasmTableEntry(callbackfunc)(eventTypeId, touchEvent, userData)) e.preventDefault();
+ };
+ var eventHandler = {
+ target,
+ allowsDeferredCalls: eventTypeString == "touchstart" || eventTypeString == "touchend",
+ eventTypeString,
+ callbackfunc,
+ handlerFunc: touchEventHandlerFunc,
+ useCapture
+ };
+ return JSEvents.registerOrRemoveHandler(eventHandler);
+};
+
+function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(32, 0, 1, target, userData, useCapture, callbackfunc, targetThread);
+ return registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread);
+}
+
+function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(33, 0, 1, target, userData, useCapture, callbackfunc, targetThread);
+ return registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread);
+}
+
+function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(34, 0, 1, target, userData, useCapture, callbackfunc, targetThread);
+ return registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread);
+}
+
+function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(35, 0, 1, target, userData, useCapture, callbackfunc, targetThread);
+ return registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread);
+}
+
+var ENV = {};
+
+var getExecutableName = () => thisProgram || "./this.program";
+
+var getEnvStrings = () => {
+ if (!getEnvStrings.strings) {
+ // Default values.
+ // Browser language detection #8751
+ var lang = ((typeof navigator == "object" && navigator.languages && navigator.languages[0]) || "C").replace("-", "_") + ".UTF-8";
+ var env = {
+ "USER": "web_user",
+ "LOGNAME": "web_user",
+ "PATH": "/",
+ "PWD": "/",
+ "HOME": "/home/web_user",
+ "LANG": lang,
+ "_": getExecutableName()
+ };
+ // Apply the user-provided values, if any.
+ for (var x in ENV) {
+ // x is a key in ENV; if ENV[x] is undefined, that means it was
+ // explicitly set to be so. We allow user code to do that to
+ // force variables with default values to remain unset.
+ if (ENV[x] === undefined) delete env[x]; else env[x] = ENV[x];
+ }
+ var strings = [];
+ for (var x in env) {
+ strings.push(`${x}=${env[x]}`);
+ }
+ getEnvStrings.strings = strings;
+ }
+ return getEnvStrings.strings;
+};
+
+var stringToAscii = (str, buffer) => {
+ for (var i = 0; i < str.length; ++i) {
+ GROWABLE_HEAP_I8()[buffer++] = str.charCodeAt(i);
+ }
+ // Null-terminate the string
+ GROWABLE_HEAP_I8()[buffer] = 0;
+};
+
+var _environ_get = function(__environ, environ_buf) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(36, 0, 1, __environ, environ_buf);
+ var bufSize = 0;
+ getEnvStrings().forEach((string, i) => {
+ var ptr = environ_buf + bufSize;
+ GROWABLE_HEAP_U32()[(((__environ) + (i * 4)) >> 2)] = ptr;
+ stringToAscii(string, ptr);
+ bufSize += string.length + 1;
+ });
+ return 0;
+};
+
+var _environ_sizes_get = function(penviron_count, penviron_buf_size) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(37, 0, 1, penviron_count, penviron_buf_size);
+ var strings = getEnvStrings();
+ GROWABLE_HEAP_U32()[((penviron_count) >> 2)] = strings.length;
+ var bufSize = 0;
+ strings.forEach(string => bufSize += string.length + 1);
+ GROWABLE_HEAP_U32()[((penviron_buf_size) >> 2)] = bufSize;
+ return 0;
+};
+
+function _fd_close(fd) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(38, 0, 1, fd);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+/** @param {number=} offset */ var doReadv = (stream, iov, iovcnt, offset) => {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = GROWABLE_HEAP_U32()[((iov) >> 2)];
+ var len = GROWABLE_HEAP_U32()[(((iov) + (4)) >> 2)];
+ iov += 8;
+ var curr = FS.read(stream, GROWABLE_HEAP_I8(), ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break;
+ // nothing more to read
+ if (typeof offset != "undefined") {
+ offset += curr;
+ }
+ }
+ return ret;
+};
+
+function _fd_read(fd, iov, iovcnt, pnum) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(39, 0, 1, fd, iov, iovcnt, pnum);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doReadv(stream, iov, iovcnt);
+ GROWABLE_HEAP_U32()[((pnum) >> 2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+function _fd_seek(fd, offset_low, offset_high, whence, newOffset) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(40, 0, 1, fd, offset_low, offset_high, whence, newOffset);
+ var offset = convertI32PairToI53Checked(offset_low, offset_high);
+ try {
+ if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.llseek(stream, offset, whence);
+ (tempI64 = [ stream.position >>> 0, (tempDouble = stream.position, (+(Math.abs(tempDouble))) >= 1 ? (tempDouble > 0 ? (+(Math.floor((tempDouble) / 4294967296))) >>> 0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble))) >>> 0)) / 4294967296))))) >>> 0) : 0) ],
+ GROWABLE_HEAP_I32()[((newOffset) >> 2)] = tempI64[0], GROWABLE_HEAP_I32()[(((newOffset) + (4)) >> 2)] = tempI64[1]);
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null;
+ // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+/** @param {number=} offset */ var doWritev = (stream, iov, iovcnt, offset) => {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = GROWABLE_HEAP_U32()[((iov) >> 2)];
+ var len = GROWABLE_HEAP_U32()[(((iov) + (4)) >> 2)];
+ iov += 8;
+ var curr = FS.write(stream, GROWABLE_HEAP_I8(), ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) {
+ // No more space to write.
+ break;
+ }
+ if (typeof offset != "undefined") {
+ offset += curr;
+ }
+ }
+ return ret;
+};
+
+function _fd_write(fd, iov, iovcnt, pnum) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(41, 0, 1, fd, iov, iovcnt, pnum);
+ try {
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doWritev(stream, iov, iovcnt);
+ GROWABLE_HEAP_U32()[((pnum) >> 2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == "undefined" || !(e.name === "ErrnoError")) throw e;
+ return e.errno;
+ }
+}
+
+/** @param {number=} timeout */ var safeSetTimeout = (func, timeout) => {
+ runtimeKeepalivePush();
+ return setTimeout(() => {
+ runtimeKeepalivePop();
+ callUserCallback(func);
+ }, timeout);
+};
+
+var Browser = {
+ useWebGL: false,
+ isFullscreen: false,
+ pointerLock: false,
+ moduleContextCreatedCallbacks: [],
+ workers: [],
+ preloadedImages: {},
+ preloadedAudios: {},
+ init() {
+ if (Browser.initted) return;
+ Browser.initted = true;
+ // Support for plugins that can process preloaded files. You can add more of these to
+ // your app by creating and appending to preloadPlugins.
+ // Each plugin is asked if it can handle a file based on the file's name. If it can,
+ // it is given the file's raw data. When it is done, it calls a callback with the file's
+ // (possibly modified) data. For example, a plugin might decompress a file, or it
+ // might create some side data structure for use later (like an Image element, etc.).
+ var imagePlugin = {};
+ imagePlugin["canHandle"] = function imagePlugin_canHandle(name) {
+ return !Module["noImageDecoding"] && /\.(jpg|jpeg|png|bmp|webp)$/i.test(name);
+ };
+ imagePlugin["handle"] = function imagePlugin_handle(byteArray, name, onload, onerror) {
+ var b = new Blob([ byteArray ], {
+ type: Browser.getMimetype(name)
+ });
+ if (b.size !== byteArray.length) {
+ // Safari bug #118630
+ // Safari's Blob can only take an ArrayBuffer
+ b = new Blob([ (new Uint8Array(byteArray)).buffer ], {
+ type: Browser.getMimetype(name)
+ });
+ }
+ var url = URL.createObjectURL(b);
+ var img = new Image;
+ img.onload = () => {
+ var canvas = /** @type {!HTMLCanvasElement} */ (document.createElement("canvas"));
+ canvas.width = img.width;
+ canvas.height = img.height;
+ var ctx = canvas.getContext("2d");
+ ctx.drawImage(img, 0, 0);
+ Browser.preloadedImages[name] = canvas;
+ URL.revokeObjectURL(url);
+ onload?.(byteArray);
+ };
+ img.onerror = event => {
+ err(`Image ${url} could not be decoded`);
+ onerror?.();
+ };
+ img.src = url;
+ };
+ preloadPlugins.push(imagePlugin);
+ var audioPlugin = {};
+ audioPlugin["canHandle"] = function audioPlugin_canHandle(name) {
+ return !Module["noAudioDecoding"] && name.substr(-4) in {
+ ".ogg": 1,
+ ".wav": 1,
+ ".mp3": 1
+ };
+ };
+ audioPlugin["handle"] = function audioPlugin_handle(byteArray, name, onload, onerror) {
+ var done = false;
+ function finish(audio) {
+ if (done) return;
+ done = true;
+ Browser.preloadedAudios[name] = audio;
+ onload?.(byteArray);
+ }
+ function fail() {
+ if (done) return;
+ done = true;
+ Browser.preloadedAudios[name] = new Audio;
+ // empty shim
+ onerror?.();
+ }
+ var b = new Blob([ byteArray ], {
+ type: Browser.getMimetype(name)
+ });
+ var url = URL.createObjectURL(b);
+ // XXX we never revoke this!
+ var audio = new Audio;
+ audio.addEventListener("canplaythrough", () => finish(audio), false);
+ // use addEventListener due to chromium bug 124926
+ audio.onerror = function audio_onerror(event) {
+ if (done) return;
+ err(`warning: browser could not fully decode audio ${name}, trying slower base64 approach`);
+ function encode64(data) {
+ var BASE = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
+ var PAD = "=";
+ var ret = "";
+ var leftchar = 0;
+ var leftbits = 0;
+ for (var i = 0; i < data.length; i++) {
+ leftchar = (leftchar << 8) | data[i];
+ leftbits += 8;
+ while (leftbits >= 6) {
+ var curr = (leftchar >> (leftbits - 6)) & 63;
+ leftbits -= 6;
+ ret += BASE[curr];
+ }
+ }
+ if (leftbits == 2) {
+ ret += BASE[(leftchar & 3) << 4];
+ ret += PAD + PAD;
+ } else if (leftbits == 4) {
+ ret += BASE[(leftchar & 15) << 2];
+ ret += PAD;
+ }
+ return ret;
+ }
+ audio.src = "data:audio/x-" + name.substr(-3) + ";base64," + encode64(byteArray);
+ finish(audio);
+ };
+ // we don't wait for confirmation this worked - but it's worth trying
+ audio.src = url;
+ // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
+ safeSetTimeout(() => {
+ finish(audio);
+ }, // try to use it even though it is not necessarily ready to play
+ 1e4);
+ };
+ preloadPlugins.push(audioPlugin);
+ // Canvas event setup
+ function pointerLockChange() {
+ Browser.pointerLock = document["pointerLockElement"] === Module["canvas"] || document["mozPointerLockElement"] === Module["canvas"] || document["webkitPointerLockElement"] === Module["canvas"] || document["msPointerLockElement"] === Module["canvas"];
+ }
+ var canvas = Module["canvas"];
+ if (canvas) {
+ // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
+ // Module['forcedAspectRatio'] = 4 / 3;
+ canvas.requestPointerLock = canvas["requestPointerLock"] || canvas["mozRequestPointerLock"] || canvas["webkitRequestPointerLock"] || canvas["msRequestPointerLock"] || (() => {});
+ canvas.exitPointerLock = document["exitPointerLock"] || document["mozExitPointerLock"] || document["webkitExitPointerLock"] || document["msExitPointerLock"] || (() => {});
+ // no-op if function does not exist
+ canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
+ document.addEventListener("pointerlockchange", pointerLockChange, false);
+ document.addEventListener("mozpointerlockchange", pointerLockChange, false);
+ document.addEventListener("webkitpointerlockchange", pointerLockChange, false);
+ document.addEventListener("mspointerlockchange", pointerLockChange, false);
+ if (Module["elementPointerLock"]) {
+ canvas.addEventListener("click", ev => {
+ if (!Browser.pointerLock && Module["canvas"].requestPointerLock) {
+ Module["canvas"].requestPointerLock();
+ ev.preventDefault();
+ }
+ }, false);
+ }
+ }
+ },
+ createContext(/** @type {HTMLCanvasElement} */ canvas, useWebGL, setInModule, webGLContextAttributes) {
+ if (useWebGL && Module["ctx"] && canvas == Module["canvas"]) return Module["ctx"];
+ // no need to recreate GL context if it's already been created for this canvas.
+ var ctx;
+ var contextHandle;
+ if (useWebGL) {
+ // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
+ var contextAttributes = {
+ antialias: false,
+ alpha: false,
+ majorVersion: 2
+ };
+ if (webGLContextAttributes) {
+ for (var attribute in webGLContextAttributes) {
+ contextAttributes[attribute] = webGLContextAttributes[attribute];
+ }
+ }
+ // This check of existence of GL is here to satisfy Closure compiler, which yells if variable GL is referenced below but GL object is not
+ // actually compiled in because application is not doing any GL operations. TODO: Ideally if GL is not being used, this function
+ // Browser.createContext() should not even be emitted.
+ if (typeof GL != "undefined") {
+ contextHandle = GL.createContext(canvas, contextAttributes);
+ if (contextHandle) {
+ ctx = GL.getContext(contextHandle).GLctx;
+ }
+ }
+ } else {
+ ctx = canvas.getContext("2d");
+ }
+ if (!ctx) return null;
+ if (setInModule) {
+ Module["ctx"] = ctx;
+ if (useWebGL) GL.makeContextCurrent(contextHandle);
+ Browser.useWebGL = useWebGL;
+ Browser.moduleContextCreatedCallbacks.forEach(callback => callback());
+ Browser.init();
+ }
+ return ctx;
+ },
+ fullscreenHandlersInstalled: false,
+ lockPointer: undefined,
+ resizeCanvas: undefined,
+ requestFullscreen(lockPointer, resizeCanvas) {
+ Browser.lockPointer = lockPointer;
+ Browser.resizeCanvas = resizeCanvas;
+ if (typeof Browser.lockPointer == "undefined") Browser.lockPointer = true;
+ if (typeof Browser.resizeCanvas == "undefined") Browser.resizeCanvas = false;
+ var canvas = Module["canvas"];
+ function fullscreenChange() {
+ Browser.isFullscreen = false;
+ var canvasContainer = canvas.parentNode;
+ if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) {
+ canvas.exitFullscreen = Browser.exitFullscreen;
+ if (Browser.lockPointer) canvas.requestPointerLock();
+ Browser.isFullscreen = true;
+ if (Browser.resizeCanvas) {
+ Browser.setFullscreenCanvasSize();
+ } else {
+ Browser.updateCanvasDimensions(canvas);
+ }
+ } else {
+ // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
+ canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
+ canvasContainer.parentNode.removeChild(canvasContainer);
+ if (Browser.resizeCanvas) {
+ Browser.setWindowedCanvasSize();
+ } else {
+ Browser.updateCanvasDimensions(canvas);
+ }
+ }
+ Module["onFullScreen"]?.(Browser.isFullscreen);
+ Module["onFullscreen"]?.(Browser.isFullscreen);
+ }
+ if (!Browser.fullscreenHandlersInstalled) {
+ Browser.fullscreenHandlersInstalled = true;
+ document.addEventListener("fullscreenchange", fullscreenChange, false);
+ document.addEventListener("mozfullscreenchange", fullscreenChange, false);
+ document.addEventListener("webkitfullscreenchange", fullscreenChange, false);
+ document.addEventListener("MSFullscreenChange", fullscreenChange, false);
+ }
+ // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
+ var canvasContainer = document.createElement("div");
+ canvas.parentNode.insertBefore(canvasContainer, canvas);
+ canvasContainer.appendChild(canvas);
+ // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
+ canvasContainer.requestFullscreen = canvasContainer["requestFullscreen"] || canvasContainer["mozRequestFullScreen"] || canvasContainer["msRequestFullscreen"] || (canvasContainer["webkitRequestFullscreen"] ? () => canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null) || (canvasContainer["webkitRequestFullScreen"] ? () => canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null);
+ canvasContainer.requestFullscreen();
+ },
+ exitFullscreen() {
+ // This is workaround for chrome. Trying to exit from fullscreen
+ // not in fullscreen state will cause "TypeError: Document not active"
+ // in chrome. See https://github.com/emscripten-core/emscripten/pull/8236
+ if (!Browser.isFullscreen) {
+ return false;
+ }
+ var CFS = document["exitFullscreen"] || document["cancelFullScreen"] || document["mozCancelFullScreen"] || document["msExitFullscreen"] || document["webkitCancelFullScreen"] || (() => {});
+ CFS.apply(document, []);
+ return true;
+ },
+ safeSetTimeout(func, timeout) {
+ // Legacy function, this is used by the SDL2 port so we need to keep it
+ // around at least until that is updated.
+ // See https://github.com/libsdl-org/SDL/pull/6304
+ return safeSetTimeout(func, timeout);
+ },
+ getMimetype(name) {
+ return {
+ "jpg": "image/jpeg",
+ "jpeg": "image/jpeg",
+ "png": "image/png",
+ "bmp": "image/bmp",
+ "ogg": "audio/ogg",
+ "wav": "audio/wav",
+ "mp3": "audio/mpeg"
+ }[name.substr(name.lastIndexOf(".") + 1)];
+ },
+ getUserMedia(func) {
+ window.getUserMedia ||= navigator["getUserMedia"] || navigator["mozGetUserMedia"];
+ window.getUserMedia(func);
+ },
+ getMovementX(event) {
+ return event["movementX"] || event["mozMovementX"] || event["webkitMovementX"] || 0;
+ },
+ getMovementY(event) {
+ return event["movementY"] || event["mozMovementY"] || event["webkitMovementY"] || 0;
+ },
+ getMouseWheelDelta(event) {
+ var delta = 0;
+ switch (event.type) {
+ case "DOMMouseScroll":
+ // 3 lines make up a step
+ delta = event.detail / 3;
+ break;
+
+ case "mousewheel":
+ // 120 units make up a step
+ delta = event.wheelDelta / 120;
+ break;
+
+ case "wheel":
+ delta = event.deltaY;
+ switch (event.deltaMode) {
+ case 0:
+ // DOM_DELTA_PIXEL: 100 pixels make up a step
+ delta /= 100;
+ break;
+
+ case 1:
+ // DOM_DELTA_LINE: 3 lines make up a step
+ delta /= 3;
+ break;
+
+ case 2:
+ // DOM_DELTA_PAGE: A page makes up 80 steps
+ delta *= 80;
+ break;
+
+ default:
+ throw "unrecognized mouse wheel delta mode: " + event.deltaMode;
+ }
+ break;
+
+ default:
+ throw "unrecognized mouse wheel event: " + event.type;
+ }
+ return delta;
+ },
+ mouseX: 0,
+ mouseY: 0,
+ mouseMovementX: 0,
+ mouseMovementY: 0,
+ touches: {},
+ lastTouches: {},
+ calculateMouseCoords(pageX, pageY) {
+ // Calculate the movement based on the changes
+ // in the coordinates.
+ var rect = Module["canvas"].getBoundingClientRect();
+ var cw = Module["canvas"].width;
+ var ch = Module["canvas"].height;
+ // Neither .scrollX or .pageXOffset are defined in a spec, but
+ // we prefer .scrollX because it is currently in a spec draft.
+ // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
+ var scrollX = ((typeof window.scrollX != "undefined") ? window.scrollX : window.pageXOffset);
+ var scrollY = ((typeof window.scrollY != "undefined") ? window.scrollY : window.pageYOffset);
+ var adjustedX = pageX - (scrollX + rect.left);
+ var adjustedY = pageY - (scrollY + rect.top);
+ // the canvas might be CSS-scaled compared to its backbuffer;
+ // SDL-using content will want mouse coordinates in terms
+ // of backbuffer units.
+ adjustedX = adjustedX * (cw / rect.width);
+ adjustedY = adjustedY * (ch / rect.height);
+ return {
+ x: adjustedX,
+ y: adjustedY
+ };
+ },
+ setMouseCoords(pageX, pageY) {
+ const {x, y} = Browser.calculateMouseCoords(pageX, pageY);
+ Browser.mouseMovementX = x - Browser.mouseX;
+ Browser.mouseMovementY = y - Browser.mouseY;
+ Browser.mouseX = x;
+ Browser.mouseY = y;
+ },
+ calculateMouseEvent(event) {
+ // event should be mousemove, mousedown or mouseup
+ if (Browser.pointerLock) {
+ // When the pointer is locked, calculate the coordinates
+ // based on the movement of the mouse.
+ // Workaround for Firefox bug 764498
+ if (event.type != "mousemove" && ("mozMovementX" in event)) {
+ Browser.mouseMovementX = Browser.mouseMovementY = 0;
+ } else {
+ Browser.mouseMovementX = Browser.getMovementX(event);
+ Browser.mouseMovementY = Browser.getMovementY(event);
+ }
+ // add the mouse delta to the current absolute mouse position
+ Browser.mouseX += Browser.mouseMovementX;
+ Browser.mouseY += Browser.mouseMovementY;
+ } else {
+ if (event.type === "touchstart" || event.type === "touchend" || event.type === "touchmove") {
+ var touch = event.touch;
+ if (touch === undefined) {
+ return;
+ }
+ // the "touch" property is only defined in SDL
+ var coords = Browser.calculateMouseCoords(touch.pageX, touch.pageY);
+ if (event.type === "touchstart") {
+ Browser.lastTouches[touch.identifier] = coords;
+ Browser.touches[touch.identifier] = coords;
+ } else if (event.type === "touchend" || event.type === "touchmove") {
+ var last = Browser.touches[touch.identifier];
+ last ||= coords;
+ Browser.lastTouches[touch.identifier] = last;
+ Browser.touches[touch.identifier] = coords;
+ }
+ return;
+ }
+ Browser.setMouseCoords(event.pageX, event.pageY);
+ }
+ },
+ resizeListeners: [],
+ updateResizeListeners() {
+ var canvas = Module["canvas"];
+ Browser.resizeListeners.forEach(listener => listener(canvas.width, canvas.height));
+ },
+ setCanvasSize(width, height, noUpdates) {
+ var canvas = Module["canvas"];
+ Browser.updateCanvasDimensions(canvas, width, height);
+ if (!noUpdates) Browser.updateResizeListeners();
+ },
+ windowedWidth: 0,
+ windowedHeight: 0,
+ setFullscreenCanvasSize() {
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ var flags = GROWABLE_HEAP_U32()[((SDL.screen) >> 2)];
+ flags = flags | 8388608;
+ // set SDL_FULLSCREEN flag
+ GROWABLE_HEAP_I32()[((SDL.screen) >> 2)] = flags;
+ }
+ Browser.updateCanvasDimensions(Module["canvas"]);
+ Browser.updateResizeListeners();
+ },
+ setWindowedCanvasSize() {
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ var flags = GROWABLE_HEAP_U32()[((SDL.screen) >> 2)];
+ flags = flags & ~8388608;
+ // clear SDL_FULLSCREEN flag
+ GROWABLE_HEAP_I32()[((SDL.screen) >> 2)] = flags;
+ }
+ Browser.updateCanvasDimensions(Module["canvas"]);
+ Browser.updateResizeListeners();
+ },
+ updateCanvasDimensions(canvas, wNative, hNative) {
+ if (wNative && hNative) {
+ canvas.widthNative = wNative;
+ canvas.heightNative = hNative;
+ } else {
+ wNative = canvas.widthNative;
+ hNative = canvas.heightNative;
+ }
+ var w = wNative;
+ var h = hNative;
+ if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) {
+ if (w / h < Module["forcedAspectRatio"]) {
+ w = Math.round(h * Module["forcedAspectRatio"]);
+ } else {
+ h = Math.round(w / Module["forcedAspectRatio"]);
+ }
+ }
+ if (((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode) && (typeof screen != "undefined")) {
+ var factor = Math.min(screen.width / w, screen.height / h);
+ w = Math.round(w * factor);
+ h = Math.round(h * factor);
+ }
+ if (Browser.resizeCanvas) {
+ if (canvas.width != w) canvas.width = w;
+ if (canvas.height != h) canvas.height = h;
+ if (typeof canvas.style != "undefined") {
+ canvas.style.removeProperty("width");
+ canvas.style.removeProperty("height");
+ }
+ } else {
+ if (canvas.width != wNative) canvas.width = wNative;
+ if (canvas.height != hNative) canvas.height = hNative;
+ if (typeof canvas.style != "undefined") {
+ if (w != wNative || h != hNative) {
+ canvas.style.setProperty("width", w + "px", "important");
+ canvas.style.setProperty("height", h + "px", "important");
+ } else {
+ canvas.style.removeProperty("width");
+ canvas.style.removeProperty("height");
+ }
+ }
+ }
+ }
+};
+
+/** @constructor */ function GLFW_Window(id, width, height, framebufferWidth, framebufferHeight, title, monitor, share) {
+ this.id = id;
+ this.x = 0;
+ this.y = 0;
+ this.fullscreen = false;
+ // Used to determine if app in fullscreen mode
+ this.storedX = 0;
+ // Used to store X before fullscreen
+ this.storedY = 0;
+ // Used to store Y before fullscreen
+ this.width = width;
+ this.height = height;
+ this.framebufferWidth = framebufferWidth;
+ this.framebufferHeight = framebufferHeight;
+ this.storedWidth = width;
+ // Used to store width before fullscreen
+ this.storedHeight = height;
+ // Used to store height before fullscreen
+ this.title = title;
+ this.monitor = monitor;
+ this.share = share;
+ this.attributes = Object.assign({}, GLFW.hints);
+ this.inputModes = {
+ 208897: 212993,
+ // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
+ 208898: 0,
+ // GLFW_STICKY_KEYS
+ 208899: 0
+ };
+ // GLFW_STICKY_MOUSE_BUTTONS
+ this.buttons = 0;
+ this.keys = new Array;
+ this.domKeys = new Array;
+ this.shouldClose = 0;
+ this.title = null;
+ this.windowPosFunc = 0;
+ // GLFWwindowposfun
+ this.windowSizeFunc = 0;
+ // GLFWwindowsizefun
+ this.windowCloseFunc = 0;
+ // GLFWwindowclosefun
+ this.windowRefreshFunc = 0;
+ // GLFWwindowrefreshfun
+ this.windowFocusFunc = 0;
+ // GLFWwindowfocusfun
+ this.windowIconifyFunc = 0;
+ // GLFWwindowiconifyfun
+ this.windowMaximizeFunc = 0;
+ // GLFWwindowmaximizefun
+ this.framebufferSizeFunc = 0;
+ // GLFWframebuffersizefun
+ this.windowContentScaleFunc = 0;
+ // GLFWwindowcontentscalefun
+ this.mouseButtonFunc = 0;
+ // GLFWmousebuttonfun
+ this.cursorPosFunc = 0;
+ // GLFWcursorposfun
+ this.cursorEnterFunc = 0;
+ // GLFWcursorenterfun
+ this.scrollFunc = 0;
+ // GLFWscrollfun
+ this.dropFunc = 0;
+ // GLFWdropfun
+ this.keyFunc = 0;
+ // GLFWkeyfun
+ this.charFunc = 0;
+ // GLFWcharfun
+ this.userptr = 0;
+}
+
+function _emscripten_set_window_title(title) {
+ if (ENVIRONMENT_IS_PTHREAD) return proxyToMainThread(42, 0, 1, title);
+ return document.title = UTF8ToString(title);
+}
+
+var GLFW = {
+ WindowFromId: id => {
+ if (id <= 0 || !GLFW.windows) return null;
+ return GLFW.windows[id - 1];
+ },
+ joystickFunc: 0,
+ errorFunc: 0,
+ monitorFunc: 0,
+ active: null,
+ scale: null,
+ windows: null,
+ monitors: null,
+ monitorString: null,
+ versionString: null,
+ initialTime: null,
+ extensions: null,
+ devicePixelRatioMQL: null,
+ hints: null,
+ primaryTouchId: null,
+ defaultHints: {
+ 131073: 0,
+ 131074: 0,
+ 131075: 1,
+ 131076: 1,
+ 131077: 1,
+ 131082: 0,
+ 135169: 8,
+ 135170: 8,
+ 135171: 8,
+ 135172: 8,
+ 135173: 24,
+ 135174: 8,
+ 135175: 0,
+ 135176: 0,
+ 135177: 0,
+ 135178: 0,
+ 135179: 0,
+ 135180: 0,
+ 135181: 0,
+ 135182: 0,
+ 135183: 0,
+ 139265: 196609,
+ 139266: 1,
+ 139267: 0,
+ 139268: 0,
+ 139269: 0,
+ 139270: 0,
+ 139271: 0,
+ 139272: 0,
+ 139276: 0
+ },
+ DOMToGLFWKeyCode: keycode => {
+ switch (keycode) {
+ // these keycodes are only defined for GLFW3, assume they are the same for GLFW2
+ case 32:
+ return 32;
+
+ // DOM_VK_SPACE -> GLFW_KEY_SPACE
+ case 222:
+ return 39;
+
+ // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
+ case 188:
+ return 44;
+
+ // DOM_VK_COMMA -> GLFW_KEY_COMMA
+ case 173:
+ return 45;
+
+ // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
+ case 189:
+ return 45;
+
+ // DOM_VK_MINUS -> GLFW_KEY_MINUS
+ case 190:
+ return 46;
+
+ // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
+ case 191:
+ return 47;
+
+ // DOM_VK_SLASH -> GLFW_KEY_SLASH
+ case 48:
+ return 48;
+
+ // DOM_VK_0 -> GLFW_KEY_0
+ case 49:
+ return 49;
+
+ // DOM_VK_1 -> GLFW_KEY_1
+ case 50:
+ return 50;
+
+ // DOM_VK_2 -> GLFW_KEY_2
+ case 51:
+ return 51;
+
+ // DOM_VK_3 -> GLFW_KEY_3
+ case 52:
+ return 52;
+
+ // DOM_VK_4 -> GLFW_KEY_4
+ case 53:
+ return 53;
+
+ // DOM_VK_5 -> GLFW_KEY_5
+ case 54:
+ return 54;
+
+ // DOM_VK_6 -> GLFW_KEY_6
+ case 55:
+ return 55;
+
+ // DOM_VK_7 -> GLFW_KEY_7
+ case 56:
+ return 56;
+
+ // DOM_VK_8 -> GLFW_KEY_8
+ case 57:
+ return 57;
+
+ // DOM_VK_9 -> GLFW_KEY_9
+ case 59:
+ return 59;
+
+ // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
+ case 61:
+ return 61;
+
+ // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+ case 187:
+ return 61;
+
+ // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+ case 65:
+ return 65;
+
+ // DOM_VK_A -> GLFW_KEY_A
+ case 66:
+ return 66;
+
+ // DOM_VK_B -> GLFW_KEY_B
+ case 67:
+ return 67;
+
+ // DOM_VK_C -> GLFW_KEY_C
+ case 68:
+ return 68;
+
+ // DOM_VK_D -> GLFW_KEY_D
+ case 69:
+ return 69;
+
+ // DOM_VK_E -> GLFW_KEY_E
+ case 70:
+ return 70;
+
+ // DOM_VK_F -> GLFW_KEY_F
+ case 71:
+ return 71;
+
+ // DOM_VK_G -> GLFW_KEY_G
+ case 72:
+ return 72;
+
+ // DOM_VK_H -> GLFW_KEY_H
+ case 73:
+ return 73;
+
+ // DOM_VK_I -> GLFW_KEY_I
+ case 74:
+ return 74;
+
+ // DOM_VK_J -> GLFW_KEY_J
+ case 75:
+ return 75;
+
+ // DOM_VK_K -> GLFW_KEY_K
+ case 76:
+ return 76;
+
+ // DOM_VK_L -> GLFW_KEY_L
+ case 77:
+ return 77;
+
+ // DOM_VK_M -> GLFW_KEY_M
+ case 78:
+ return 78;
+
+ // DOM_VK_N -> GLFW_KEY_N
+ case 79:
+ return 79;
+
+ // DOM_VK_O -> GLFW_KEY_O
+ case 80:
+ return 80;
+
+ // DOM_VK_P -> GLFW_KEY_P
+ case 81:
+ return 81;
+
+ // DOM_VK_Q -> GLFW_KEY_Q
+ case 82:
+ return 82;
+
+ // DOM_VK_R -> GLFW_KEY_R
+ case 83:
+ return 83;
+
+ // DOM_VK_S -> GLFW_KEY_S
+ case 84:
+ return 84;
+
+ // DOM_VK_T -> GLFW_KEY_T
+ case 85:
+ return 85;
+
+ // DOM_VK_U -> GLFW_KEY_U
+ case 86:
+ return 86;
+
+ // DOM_VK_V -> GLFW_KEY_V
+ case 87:
+ return 87;
+
+ // DOM_VK_W -> GLFW_KEY_W
+ case 88:
+ return 88;
+
+ // DOM_VK_X -> GLFW_KEY_X
+ case 89:
+ return 89;
+
+ // DOM_VK_Y -> GLFW_KEY_Y
+ case 90:
+ return 90;
+
+ // DOM_VK_Z -> GLFW_KEY_Z
+ case 219:
+ return 91;
+
+ // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
+ case 220:
+ return 92;
+
+ // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
+ case 221:
+ return 93;
+
+ // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
+ case 192:
+ return 96;
+
+ // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
+ case 27:
+ return 256;
+
+ // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
+ case 13:
+ return 257;
+
+ // DOM_VK_RETURN -> GLFW_KEY_ENTER
+ case 9:
+ return 258;
+
+ // DOM_VK_TAB -> GLFW_KEY_TAB
+ case 8:
+ return 259;
+
+ // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
+ case 45:
+ return 260;
+
+ // DOM_VK_INSERT -> GLFW_KEY_INSERT
+ case 46:
+ return 261;
+
+ // DOM_VK_DELETE -> GLFW_KEY_DELETE
+ case 39:
+ return 262;
+
+ // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
+ case 37:
+ return 263;
+
+ // DOM_VK_LEFT -> GLFW_KEY_LEFT
+ case 40:
+ return 264;
+
+ // DOM_VK_DOWN -> GLFW_KEY_DOWN
+ case 38:
+ return 265;
+
+ // DOM_VK_UP -> GLFW_KEY_UP
+ case 33:
+ return 266;
+
+ // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
+ case 34:
+ return 267;
+
+ // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
+ case 36:
+ return 268;
+
+ // DOM_VK_HOME -> GLFW_KEY_HOME
+ case 35:
+ return 269;
+
+ // DOM_VK_END -> GLFW_KEY_END
+ case 20:
+ return 280;
+
+ // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
+ case 145:
+ return 281;
+
+ // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
+ case 144:
+ return 282;
+
+ // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
+ case 44:
+ return 283;
+
+ // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
+ case 19:
+ return 284;
+
+ // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
+ case 112:
+ return 290;
+
+ // DOM_VK_F1 -> GLFW_KEY_F1
+ case 113:
+ return 291;
+
+ // DOM_VK_F2 -> GLFW_KEY_F2
+ case 114:
+ return 292;
+
+ // DOM_VK_F3 -> GLFW_KEY_F3
+ case 115:
+ return 293;
+
+ // DOM_VK_F4 -> GLFW_KEY_F4
+ case 116:
+ return 294;
+
+ // DOM_VK_F5 -> GLFW_KEY_F5
+ case 117:
+ return 295;
+
+ // DOM_VK_F6 -> GLFW_KEY_F6
+ case 118:
+ return 296;
+
+ // DOM_VK_F7 -> GLFW_KEY_F7
+ case 119:
+ return 297;
+
+ // DOM_VK_F8 -> GLFW_KEY_F8
+ case 120:
+ return 298;
+
+ // DOM_VK_F9 -> GLFW_KEY_F9
+ case 121:
+ return 299;
+
+ // DOM_VK_F10 -> GLFW_KEY_F10
+ case 122:
+ return 300;
+
+ // DOM_VK_F11 -> GLFW_KEY_F11
+ case 123:
+ return 301;
+
+ // DOM_VK_F12 -> GLFW_KEY_F12
+ case 124:
+ return 302;
+
+ // DOM_VK_F13 -> GLFW_KEY_F13
+ case 125:
+ return 303;
+
+ // DOM_VK_F14 -> GLFW_KEY_F14
+ case 126:
+ return 304;
+
+ // DOM_VK_F15 -> GLFW_KEY_F15
+ case 127:
+ return 305;
+
+ // DOM_VK_F16 -> GLFW_KEY_F16
+ case 128:
+ return 306;
+
+ // DOM_VK_F17 -> GLFW_KEY_F17
+ case 129:
+ return 307;
+
+ // DOM_VK_F18 -> GLFW_KEY_F18
+ case 130:
+ return 308;
+
+ // DOM_VK_F19 -> GLFW_KEY_F19
+ case 131:
+ return 309;
+
+ // DOM_VK_F20 -> GLFW_KEY_F20
+ case 132:
+ return 310;
+
+ // DOM_VK_F21 -> GLFW_KEY_F21
+ case 133:
+ return 311;
+
+ // DOM_VK_F22 -> GLFW_KEY_F22
+ case 134:
+ return 312;
+
+ // DOM_VK_F23 -> GLFW_KEY_F23
+ case 135:
+ return 313;
+
+ // DOM_VK_F24 -> GLFW_KEY_F24
+ case 136:
+ return 314;
+
+ // 0x88 (not used?) -> GLFW_KEY_F25
+ case 96:
+ return 320;
+
+ // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
+ case 97:
+ return 321;
+
+ // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
+ case 98:
+ return 322;
+
+ // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
+ case 99:
+ return 323;
+
+ // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
+ case 100:
+ return 324;
+
+ // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
+ case 101:
+ return 325;
+
+ // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
+ case 102:
+ return 326;
+
+ // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
+ case 103:
+ return 327;
+
+ // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
+ case 104:
+ return 328;
+
+ // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
+ case 105:
+ return 329;
+
+ // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
+ case 110:
+ return 330;
+
+ // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
+ case 111:
+ return 331;
+
+ // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
+ case 106:
+ return 332;
+
+ // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
+ case 109:
+ return 333;
+
+ // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
+ case 107:
+ return 334;
+
+ // DOM_VK_ADD -> GLFW_KEY_KP_ADD
+ // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
+ // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
+ case 16:
+ return 340;
+
+ // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
+ case 17:
+ return 341;
+
+ // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
+ case 18:
+ return 342;
+
+ // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
+ case 91:
+ return 343;
+
+ // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
+ case 224:
+ return 343;
+
+ // DOM_VK_META -> GLFW_KEY_LEFT_SUPER
+ // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
+ // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
+ // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
+ // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
+ case 93:
+ return 348;
+
+ // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
+ // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
+ default:
+ return -1;
+ }
+ },
+ getModBits: win => {
+ var mod = 0;
+ if (win.keys[340]) mod |= 1;
+ // GLFW_MOD_SHIFT
+ if (win.keys[341]) mod |= 2;
+ // GLFW_MOD_CONTROL
+ if (win.keys[342]) mod |= 4;
+ // GLFW_MOD_ALT
+ if (win.keys[343] || win.keys[348]) mod |= 8;
+ // GLFW_MOD_SUPER
+ // add caps and num lock keys? only if lock_key_mod is set
+ return mod;
+ },
+ onKeyPress: event => {
+ if (!GLFW.active || !GLFW.active.charFunc) return;
+ if (event.ctrlKey || event.metaKey) return;
+ // correct unicode charCode is only available with onKeyPress event
+ var charCode = event.charCode;
+ if (charCode == 0 || (charCode >= 0 && charCode <= 31)) return;
+ getWasmTableEntry(GLFW.active.charFunc)(GLFW.active.id, charCode);
+ },
+ onKeyChanged: (keyCode, status) => {
+ if (!GLFW.active) return;
+ var key = GLFW.DOMToGLFWKeyCode(keyCode);
+ if (key == -1) return;
+ var repeat = status && GLFW.active.keys[key];
+ GLFW.active.keys[key] = status;
+ GLFW.active.domKeys[keyCode] = status;
+ if (GLFW.active.keyFunc) {
+ if (repeat) status = 2;
+ // GLFW_REPEAT
+ getWasmTableEntry(GLFW.active.keyFunc)(GLFW.active.id, key, keyCode, status, GLFW.getModBits(GLFW.active));
+ }
+ },
+ onGamepadConnected: event => {
+ GLFW.refreshJoysticks();
+ },
+ onGamepadDisconnected: event => {
+ GLFW.refreshJoysticks();
+ },
+ onKeydown: event => {
+ GLFW.onKeyChanged(event.keyCode, 1);
+ // GLFW_PRESS or GLFW_REPEAT
+ // This logic comes directly from the sdl implementation. We cannot
+ // call preventDefault on all keydown events otherwise onKeyPress will
+ // not get called
+ if (event.key == "Backspace" || event.key == "Tab") {
+ event.preventDefault();
+ }
+ },
+ onKeyup: event => {
+ GLFW.onKeyChanged(event.keyCode, 0);
+ },
+ // GLFW_RELEASE
+ onBlur: event => {
+ if (!GLFW.active) return;
+ for (var i = 0; i < GLFW.active.domKeys.length; ++i) {
+ if (GLFW.active.domKeys[i]) {
+ GLFW.onKeyChanged(i, 0);
+ }
+ }
+ },
+ onMousemove: event => {
+ if (!GLFW.active) return;
+ if (event.type === "touchmove") {
+ // Handling for touch events that are being converted to mouse input.
+ // Don't let the browser fire a duplicate mouse event.
+ event.preventDefault();
+ let primaryChanged = false;
+ for (let i of event.changedTouches) {
+ // If our chosen primary touch moved, update Browser mouse coords
+ if (GLFW.primaryTouchId === i.identifier) {
+ Browser.setMouseCoords(i.pageX, i.pageY);
+ primaryChanged = true;
+ break;
+ }
+ }
+ if (!primaryChanged) {
+ // Do not send mouse events if some touch other than the primary triggered this.
+ return;
+ }
+ } else {
+ // Handling for non-touch mouse input events.
+ Browser.calculateMouseEvent(event);
+ }
+ if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
+ if (GLFW.active.cursorPosFunc) {
+ getWasmTableEntry(GLFW.active.cursorPosFunc)(GLFW.active.id, Browser.mouseX, Browser.mouseY);
+ }
+ },
+ DOMToGLFWMouseButton: event => {
+ // DOM and glfw have different button codes.
+ // See http://www.w3schools.com/jsref/event_button.asp.
+ var eventButton = event["button"];
+ if (eventButton > 0) {
+ if (eventButton == 1) {
+ eventButton = 2;
+ } else {
+ eventButton = 1;
+ }
+ }
+ return eventButton;
+ },
+ onMouseenter: event => {
+ if (!GLFW.active) return;
+ if (event.target != Module["canvas"]) return;
+ if (GLFW.active.cursorEnterFunc) {
+ getWasmTableEntry(GLFW.active.cursorEnterFunc)(GLFW.active.id, 1);
+ }
+ },
+ onMouseleave: event => {
+ if (!GLFW.active) return;
+ if (event.target != Module["canvas"]) return;
+ if (GLFW.active.cursorEnterFunc) {
+ getWasmTableEntry(GLFW.active.cursorEnterFunc)(GLFW.active.id, 0);
+ }
+ },
+ onMouseButtonChanged: (event, status) => {
+ if (!GLFW.active) return;
+ if (event.target != Module["canvas"]) return;
+ // Is this from a touch event?
+ const isTouchType = event.type === "touchstart" || event.type === "touchend" || event.type === "touchcancel";
+ // Only emulating mouse left-click behavior for touches.
+ let eventButton = 0;
+ if (isTouchType) {
+ // Handling for touch events that are being converted to mouse input.
+ // Don't let the browser fire a duplicate mouse event.
+ event.preventDefault();
+ let primaryChanged = false;
+ // Set a primary touch if we have none.
+ if (GLFW.primaryTouchId === null && event.type === "touchstart" && event.targetTouches.length > 0) {
+ // Pick the first touch that started in the canvas and treat it as primary.
+ const chosenTouch = event.targetTouches[0];
+ GLFW.primaryTouchId = chosenTouch.identifier;
+ Browser.setMouseCoords(chosenTouch.pageX, chosenTouch.pageY);
+ primaryChanged = true;
+ } else if (event.type === "touchend" || event.type === "touchcancel") {
+ // Clear the primary touch if it ended.
+ for (let i of event.changedTouches) {
+ // If our chosen primary touch ended, remove it.
+ if (GLFW.primaryTouchId === i.identifier) {
+ GLFW.primaryTouchId = null;
+ primaryChanged = true;
+ break;
+ }
+ }
+ }
+ if (!primaryChanged) {
+ // Do not send mouse events if some touch other than the primary triggered this.
+ return;
+ }
+ } else {
+ // Handling for non-touch mouse input events.
+ Browser.calculateMouseEvent(event);
+ eventButton = GLFW.DOMToGLFWMouseButton(event);
+ }
+ if (status == 1) {
+ // GLFW_PRESS
+ GLFW.active.buttons |= (1 << eventButton);
+ try {
+ event.target.setCapture();
+ } catch (e) {}
+ } else {
+ // GLFW_RELEASE
+ GLFW.active.buttons &= ~(1 << eventButton);
+ }
+ // Send mouse event to GLFW.
+ if (GLFW.active.mouseButtonFunc) {
+ getWasmTableEntry(GLFW.active.mouseButtonFunc)(GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active));
+ }
+ },
+ onMouseButtonDown: event => {
+ if (!GLFW.active) return;
+ GLFW.onMouseButtonChanged(event, 1);
+ },
+ // GLFW_PRESS
+ onMouseButtonUp: event => {
+ if (!GLFW.active) return;
+ GLFW.onMouseButtonChanged(event, 0);
+ },
+ // GLFW_RELEASE
+ onMouseWheel: event => {
+ // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
+ var delta = -Browser.getMouseWheelDelta(event);
+ delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1));
+ // Quantize to integer so that minimum scroll is at least +/- 1.
+ GLFW.wheelPos += delta;
+ if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module["canvas"]) return;
+ var sx = 0;
+ var sy = delta;
+ if (event.type == "mousewheel") {
+ sx = event.wheelDeltaX;
+ } else {
+ sx = event.deltaX;
+ }
+ getWasmTableEntry(GLFW.active.scrollFunc)(GLFW.active.id, sx, sy);
+ event.preventDefault();
+ },
+ onCanvasResize: (width, height, framebufferWidth, framebufferHeight) => {
+ if (!GLFW.active) return;
+ var resizeNeeded = false;
+ // If the client is requesting fullscreen mode
+ if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
+ if (!GLFW.active.fullscreen) {
+ resizeNeeded = width != screen.width || height != screen.height;
+ GLFW.active.storedX = GLFW.active.x;
+ GLFW.active.storedY = GLFW.active.y;
+ GLFW.active.storedWidth = GLFW.active.width;
+ GLFW.active.storedHeight = GLFW.active.height;
+ GLFW.active.x = GLFW.active.y = 0;
+ GLFW.active.width = screen.width;
+ GLFW.active.height = screen.height;
+ GLFW.active.fullscreen = true;
+ }
+ } else // If the client is reverting from fullscreen mode
+ if (GLFW.active.fullscreen == true) {
+ resizeNeeded = width != GLFW.active.storedWidth || height != GLFW.active.storedHeight;
+ GLFW.active.x = GLFW.active.storedX;
+ GLFW.active.y = GLFW.active.storedY;
+ GLFW.active.width = GLFW.active.storedWidth;
+ GLFW.active.height = GLFW.active.storedHeight;
+ GLFW.active.fullscreen = false;
+ }
+ if (resizeNeeded) {
+ // width or height is changed (fullscreen / exit fullscreen) which will call this listener back
+ // with proper framebufferWidth/framebufferHeight
+ Browser.setCanvasSize(GLFW.active.width, GLFW.active.height);
+ } else if (GLFW.active.width != width || GLFW.active.height != height || GLFW.active.framebufferWidth != framebufferWidth || GLFW.active.framebufferHeight != framebufferHeight) {
+ GLFW.active.width = width;
+ GLFW.active.height = height;
+ GLFW.active.framebufferWidth = framebufferWidth;
+ GLFW.active.framebufferHeight = framebufferHeight;
+ GLFW.onWindowSizeChanged();
+ GLFW.onFramebufferSizeChanged();
+ }
+ },
+ onWindowSizeChanged: () => {
+ if (!GLFW.active) return;
+ if (GLFW.active.windowSizeFunc) {
+ getWasmTableEntry(GLFW.active.windowSizeFunc)(GLFW.active.id, GLFW.active.width, GLFW.active.height);
+ }
+ },
+ onFramebufferSizeChanged: () => {
+ if (!GLFW.active) return;
+ if (GLFW.active.framebufferSizeFunc) {
+ getWasmTableEntry(GLFW.active.framebufferSizeFunc)(GLFW.active.id, GLFW.active.framebufferWidth, GLFW.active.framebufferHeight);
+ }
+ },
+ onWindowContentScaleChanged: scale => {
+ GLFW.scale = scale;
+ if (!GLFW.active) return;
+ if (GLFW.active.windowContentScaleFunc) {
+ getWasmTableEntry(GLFW.active.windowContentScaleFunc)(GLFW.active.id, GLFW.scale, GLFW.scale);
+ }
+ },
+ getTime: () => _emscripten_get_now() / 1e3,
+ setWindowTitle: (winid, title) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.title = title;
+ if (GLFW.active.id == win.id) {
+ _emscripten_set_window_title(title);
+ }
+ },
+ setJoystickCallback: cbfun => {
+ var prevcbfun = GLFW.joystickFunc;
+ GLFW.joystickFunc = cbfun;
+ GLFW.refreshJoysticks();
+ return prevcbfun;
+ },
+ joys: {},
+ lastGamepadState: [],
+ lastGamepadStateFrame: null,
+ refreshJoysticks: () => {
+ // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
+ if (MainLoop.currentFrameNumber !== GLFW.lastGamepadStateFrame || !MainLoop.currentFrameNumber) {
+ GLFW.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads || []);
+ GLFW.lastGamepadStateFrame = MainLoop.currentFrameNumber;
+ for (var joy = 0; joy < GLFW.lastGamepadState.length; ++joy) {
+ var gamepad = GLFW.lastGamepadState[joy];
+ if (gamepad) {
+ if (!GLFW.joys[joy]) {
+ out("glfw joystick connected:", joy);
+ GLFW.joys[joy] = {
+ id: stringToNewUTF8(gamepad.id),
+ buttonsCount: gamepad.buttons.length,
+ axesCount: gamepad.axes.length,
+ buttons: _malloc(gamepad.buttons.length),
+ axes: _malloc(gamepad.axes.length * 4)
+ };
+ if (GLFW.joystickFunc) {
+ getWasmTableEntry(GLFW.joystickFunc)(joy, 262145);
+ }
+ }
+ var data = GLFW.joys[joy];
+ for (var i = 0; i < gamepad.buttons.length; ++i) {
+ GROWABLE_HEAP_I8()[data.buttons + i] = gamepad.buttons[i].pressed;
+ }
+ for (var i = 0; i < gamepad.axes.length; ++i) {
+ GROWABLE_HEAP_F32()[((data.axes + i * 4) >> 2)] = gamepad.axes[i];
+ }
+ } else {
+ if (GLFW.joys[joy]) {
+ out("glfw joystick disconnected", joy);
+ if (GLFW.joystickFunc) {
+ getWasmTableEntry(GLFW.joystickFunc)(joy, 262146);
+ }
+ _free(GLFW.joys[joy].id);
+ _free(GLFW.joys[joy].buttons);
+ _free(GLFW.joys[joy].axes);
+ delete GLFW.joys[joy];
+ }
+ }
+ }
+ }
+ },
+ setKeyCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.keyFunc;
+ win.keyFunc = cbfun;
+ return prevcbfun;
+ },
+ setCharCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.charFunc;
+ win.charFunc = cbfun;
+ return prevcbfun;
+ },
+ setMouseButtonCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.mouseButtonFunc;
+ win.mouseButtonFunc = cbfun;
+ return prevcbfun;
+ },
+ setCursorPosCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.cursorPosFunc;
+ win.cursorPosFunc = cbfun;
+ return prevcbfun;
+ },
+ setScrollCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.scrollFunc;
+ win.scrollFunc = cbfun;
+ return prevcbfun;
+ },
+ setDropCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.dropFunc;
+ win.dropFunc = cbfun;
+ return prevcbfun;
+ },
+ onDrop: event => {
+ if (!GLFW.active || !GLFW.active.dropFunc) return;
+ if (!event.dataTransfer || !event.dataTransfer.files || event.dataTransfer.files.length == 0) return;
+ event.preventDefault();
+ var filenames = _malloc(event.dataTransfer.files.length * 4);
+ var filenamesArray = [];
+ var count = event.dataTransfer.files.length;
+ // Read and save the files to emscripten's FS
+ var written = 0;
+ var drop_dir = ".glfw_dropped_files";
+ FS.createPath("/", drop_dir);
+ function save(file) {
+ var path = "/" + drop_dir + "/" + file.name.replace(/\//g, "_");
+ var reader = new FileReader;
+ reader.onloadend = e => {
+ if (reader.readyState != 2) {
+ // not DONE
+ ++written;
+ out("failed to read dropped file: " + file.name + ": " + reader.error);
+ return;
+ }
+ var data = e.target.result;
+ FS.writeFile(path, new Uint8Array(data));
+ if (++written === count) {
+ getWasmTableEntry(GLFW.active.dropFunc)(GLFW.active.id, count, filenames);
+ for (var i = 0; i < filenamesArray.length; ++i) {
+ _free(filenamesArray[i]);
+ }
+ _free(filenames);
+ }
+ };
+ reader.readAsArrayBuffer(file);
+ var filename = stringToNewUTF8(path);
+ filenamesArray.push(filename);
+ GROWABLE_HEAP_U32()[((filenames + i * 4) >> 2)] = filename;
+ }
+ for (var i = 0; i < count; ++i) {
+ save(event.dataTransfer.files[i]);
+ }
+ return false;
+ },
+ onDragover: event => {
+ if (!GLFW.active || !GLFW.active.dropFunc) return;
+ event.preventDefault();
+ return false;
+ },
+ setWindowSizeCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.windowSizeFunc;
+ win.windowSizeFunc = cbfun;
+ return prevcbfun;
+ },
+ setWindowCloseCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.windowCloseFunc;
+ win.windowCloseFunc = cbfun;
+ return prevcbfun;
+ },
+ setWindowRefreshCallback: (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.windowRefreshFunc;
+ win.windowRefreshFunc = cbfun;
+ return prevcbfun;
+ },
+ onClickRequestPointerLock: e => {
+ if (!Browser.pointerLock && Module["canvas"].requestPointerLock) {
+ Module["canvas"].requestPointerLock();
+ e.preventDefault();
+ }
+ },
+ setInputMode: (winid, mode, value) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ switch (mode) {
+ case 208897:
+ {
+ // GLFW_CURSOR
+ switch (value) {
+ case 212993:
+ {
+ // GLFW_CURSOR_NORMAL
+ win.inputModes[mode] = value;
+ Module["canvas"].removeEventListener("click", GLFW.onClickRequestPointerLock, true);
+ Module["canvas"].exitPointerLock();
+ break;
+ }
+
+ case 212994:
+ {
+ // GLFW_CURSOR_HIDDEN
+ err("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented");
+ break;
+ }
+
+ case 212995:
+ {
+ // GLFW_CURSOR_DISABLED
+ win.inputModes[mode] = value;
+ Module["canvas"].addEventListener("click", GLFW.onClickRequestPointerLock, true);
+ Module["canvas"].requestPointerLock();
+ break;
+ }
+
+ default:
+ {
+ err(`glfwSetInputMode called with unknown value parameter value: ${value}`);
+ break;
+ }
+ }
+ break;
+ }
+
+ case 208898:
+ {
+ // GLFW_STICKY_KEYS
+ err("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented");
+ break;
+ }
+
+ case 208899:
+ {
+ // GLFW_STICKY_MOUSE_BUTTONS
+ err("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented");
+ break;
+ }
+
+ case 208900:
+ {
+ // GLFW_LOCK_KEY_MODS
+ err("glfwSetInputMode called with GLFW_LOCK_KEY_MODS mode not implemented");
+ break;
+ }
+
+ case 3342341:
+ {
+ // GLFW_RAW_MOUSE_MOTION
+ err("glfwSetInputMode called with GLFW_RAW_MOUSE_MOTION mode not implemented");
+ break;
+ }
+
+ default:
+ {
+ err(`glfwSetInputMode called with unknown mode parameter value: ${mode}`);
+ break;
+ }
+ }
+ },
+ getKey: (winid, key) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return win.keys[key];
+ },
+ getMouseButton: (winid, button) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return (win.buttons & (1 << button)) > 0;
+ },
+ getCursorPos: (winid, x, y) => {
+ GROWABLE_HEAP_F64()[((x) >> 3)] = Browser.mouseX;
+ GROWABLE_HEAP_F64()[((y) >> 3)] = Browser.mouseY;
+ },
+ getMousePos: (winid, x, y) => {
+ GROWABLE_HEAP_I32()[((x) >> 2)] = Browser.mouseX;
+ GROWABLE_HEAP_I32()[((y) >> 2)] = Browser.mouseY;
+ },
+ setCursorPos: (winid, x, y) => {},
+ getWindowPos: (winid, x, y) => {
+ var wx = 0;
+ var wy = 0;
+ var win = GLFW.WindowFromId(winid);
+ if (win) {
+ wx = win.x;
+ wy = win.y;
+ }
+ if (x) {
+ GROWABLE_HEAP_I32()[((x) >> 2)] = wx;
+ }
+ if (y) {
+ GROWABLE_HEAP_I32()[((y) >> 2)] = wy;
+ }
+ },
+ setWindowPos: (winid, x, y) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.x = x;
+ win.y = y;
+ },
+ getWindowSize: (winid, width, height) => {
+ var ww = 0;
+ var wh = 0;
+ var win = GLFW.WindowFromId(winid);
+ if (win) {
+ ww = win.width;
+ wh = win.height;
+ }
+ if (width) {
+ GROWABLE_HEAP_I32()[((width) >> 2)] = ww;
+ }
+ if (height) {
+ GROWABLE_HEAP_I32()[((height) >> 2)] = wh;
+ }
+ },
+ setWindowSize: (winid, width, height) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ if (GLFW.active.id == win.id) {
+ Browser.setCanvasSize(width, height);
+ }
+ },
+ // triggers the listener (onCanvasResize) + windowSizeFunc
+ defaultWindowHints: () => {
+ GLFW.hints = Object.assign({}, GLFW.defaultHints);
+ },
+ createWindow: (width, height, title, monitor, share) => {
+ var i, id;
+ for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++) {}
+ // no-op
+ if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
+ // id for window
+ id = i + 1;
+ // not valid
+ if (width <= 0 || height <= 0) return 0;
+ if (monitor) {
+ Browser.requestFullscreen();
+ } else {
+ Browser.setCanvasSize(width, height);
+ }
+ // Create context when there are no existing alive windows
+ for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++) {}
+ // no-op
+ var useWebGL = GLFW.hints[139265] > 0;
+ // Use WebGL when we are told to based on GLFW_CLIENT_API
+ if (i == GLFW.windows.length) {
+ if (useWebGL) {
+ var contextAttributes = {
+ antialias: (GLFW.hints[135181] > 1),
+ // GLFW_SAMPLES
+ depth: (GLFW.hints[135173] > 0),
+ // GLFW_DEPTH_BITS
+ stencil: (GLFW.hints[135174] > 0),
+ // GLFW_STENCIL_BITS
+ alpha: (GLFW.hints[135172] > 0)
+ };
+ // GLFW_ALPHA_BITS
+ Browser.createContext(Module["canvas"], /*useWebGL=*/ true, /*setInModule=*/ true, contextAttributes);
+ } else {
+ Browser.init();
+ }
+ }
+ // If context creation failed, do not return a valid window
+ if (!Module["ctx"] && useWebGL) return 0;
+ // Initializes the framebuffer size from the canvas
+ const canvas = Module["canvas"];
+ var win = new GLFW_Window(id, width, height, canvas.width, canvas.height, title, monitor, share);
+ // Set window to array
+ if (id - 1 == GLFW.windows.length) {
+ GLFW.windows.push(win);
+ } else {
+ GLFW.windows[id - 1] = win;
+ }
+ GLFW.active = win;
+ GLFW.adjustCanvasDimensions();
+ return win.id;
+ },
+ destroyWindow: winid => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ if (win.windowCloseFunc) {
+ getWasmTableEntry(win.windowCloseFunc)(win.id);
+ }
+ GLFW.windows[win.id - 1] = null;
+ if (GLFW.active.id == win.id) GLFW.active = null;
+ // Destroy context when no alive windows
+ for (var i = 0; i < GLFW.windows.length; i++) if (GLFW.windows[i] !== null) return;
+ delete Module["ctx"];
+ },
+ swapBuffers: winid => {},
+ requestFullscreen(lockPointer, resizeCanvas) {
+ Browser.lockPointer = lockPointer;
+ Browser.resizeCanvas = resizeCanvas;
+ if (typeof Browser.lockPointer == "undefined") Browser.lockPointer = true;
+ if (typeof Browser.resizeCanvas == "undefined") Browser.resizeCanvas = false;
+ var canvas = Module["canvas"];
+ function fullscreenChange() {
+ Browser.isFullscreen = false;
+ var canvasContainer = canvas.parentNode;
+ if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) {
+ canvas.exitFullscreen = Browser.exitFullscreen;
+ if (Browser.lockPointer) canvas.requestPointerLock();
+ Browser.isFullscreen = true;
+ if (Browser.resizeCanvas) {
+ Browser.setFullscreenCanvasSize();
+ } else {
+ Browser.updateCanvasDimensions(canvas);
+ Browser.updateResizeListeners();
+ }
+ } else {
+ // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
+ canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
+ canvasContainer.parentNode.removeChild(canvasContainer);
+ if (Browser.resizeCanvas) {
+ Browser.setWindowedCanvasSize();
+ } else {
+ Browser.updateCanvasDimensions(canvas);
+ Browser.updateResizeListeners();
+ }
+ }
+ Module["onFullScreen"]?.(Browser.isFullscreen);
+ Module["onFullscreen"]?.(Browser.isFullscreen);
+ }
+ if (!Browser.fullscreenHandlersInstalled) {
+ Browser.fullscreenHandlersInstalled = true;
+ document.addEventListener("fullscreenchange", fullscreenChange, false);
+ document.addEventListener("mozfullscreenchange", fullscreenChange, false);
+ document.addEventListener("webkitfullscreenchange", fullscreenChange, false);
+ document.addEventListener("MSFullscreenChange", fullscreenChange, false);
+ }
+ // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
+ var canvasContainer = document.createElement("div");
+ canvas.parentNode.insertBefore(canvasContainer, canvas);
+ canvasContainer.appendChild(canvas);
+ // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
+ canvasContainer.requestFullscreen = canvasContainer["requestFullscreen"] || canvasContainer["mozRequestFullScreen"] || canvasContainer["msRequestFullscreen"] || (canvasContainer["webkitRequestFullscreen"] ? () => canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null) || (canvasContainer["webkitRequestFullScreen"] ? () => canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null);
+ canvasContainer.requestFullscreen();
+ },
+ updateCanvasDimensions(canvas, wNative, hNative) {
+ const scale = GLFW.getHiDPIScale();
+ if (wNative && hNative) {
+ canvas.widthNative = wNative;
+ canvas.heightNative = hNative;
+ } else {
+ wNative = canvas.widthNative;
+ hNative = canvas.heightNative;
+ }
+ var w = wNative;
+ var h = hNative;
+ if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) {
+ if (w / h < Module["forcedAspectRatio"]) {
+ w = Math.round(h * Module["forcedAspectRatio"]);
+ } else {
+ h = Math.round(w / Module["forcedAspectRatio"]);
+ }
+ }
+ if (((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode) && (typeof screen != "undefined")) {
+ var factor = Math.min(screen.width / w, screen.height / h);
+ w = Math.round(w * factor);
+ h = Math.round(h * factor);
+ }
+ if (Browser.resizeCanvas) {
+ wNative = w;
+ hNative = h;
+ }
+ const wNativeScaled = Math.floor(wNative * scale);
+ const hNativeScaled = Math.floor(hNative * scale);
+ if (canvas.width != wNativeScaled) canvas.width = wNativeScaled;
+ if (canvas.height != hNativeScaled) canvas.height = hNativeScaled;
+ if (typeof canvas.style != "undefined") {
+ if (!GLFW.isCSSScalingEnabled()) {
+ canvas.style.setProperty("width", wNative + "px", "important");
+ canvas.style.setProperty("height", hNative + "px", "important");
+ } else {
+ canvas.style.removeProperty("width");
+ canvas.style.removeProperty("height");
+ }
+ }
+ },
+ calculateMouseCoords(pageX, pageY) {
+ // Calculate the movement based on the changes
+ // in the coordinates.
+ const rect = Module["canvas"].getBoundingClientRect();
+ // Neither .scrollX or .pageXOffset are defined in a spec, but
+ // we prefer .scrollX because it is currently in a spec draft.
+ // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
+ var scrollX = ((typeof window.scrollX != "undefined") ? window.scrollX : window.pageXOffset);
+ var scrollY = ((typeof window.scrollY != "undefined") ? window.scrollY : window.pageYOffset);
+ var adjustedX = pageX - (scrollX + rect.left);
+ var adjustedY = pageY - (scrollY + rect.top);
+ // getBoundingClientRect() returns dimension affected by CSS, so as a result:
+ // - when CSS scaling is enabled, this will fix the mouse coordinates to match the width/height of the window
+ // - otherwise the CSS width/height are forced to the width/height of the GLFW window (see updateCanvasDimensions),
+ // so there is no need to adjust the position
+ if (GLFW.isCSSScalingEnabled() && GLFW.active) {
+ adjustedX = adjustedX * (GLFW.active.width / rect.width);
+ adjustedY = adjustedY * (GLFW.active.height / rect.height);
+ }
+ return {
+ x: adjustedX,
+ y: adjustedY
+ };
+ },
+ setWindowAttrib: (winid, attrib, value) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ const isHiDPIAware = GLFW.isHiDPIAware();
+ win.attributes[attrib] = value;
+ if (isHiDPIAware !== GLFW.isHiDPIAware()) GLFW.adjustCanvasDimensions();
+ },
+ getDevicePixelRatio() {
+ return (typeof devicePixelRatio == "number" && devicePixelRatio) || 1;
+ },
+ isHiDPIAware() {
+ if (GLFW.active) return GLFW.active.attributes[139276] > 0; else // GLFW_SCALE_TO_MONITOR
+ return false;
+ },
+ isCSSScalingEnabled() {
+ return !GLFW.isHiDPIAware();
+ },
+ adjustCanvasDimensions() {
+ if (GLFW.active) {
+ Browser.updateCanvasDimensions(Module["canvas"], GLFW.active.width, GLFW.active.height);
+ Browser.updateResizeListeners();
+ }
+ },
+ getHiDPIScale() {
+ return GLFW.isHiDPIAware() ? GLFW.scale : 1;
+ },
+ onDevicePixelRatioChange() {
+ GLFW.onWindowContentScaleChanged(GLFW.getDevicePixelRatio());
+ GLFW.adjustCanvasDimensions();
+ },
+ GLFW2ParamToGLFW3Param: param => {
+ var table = {
+ 196609: 0,
+ // GLFW_MOUSE_CURSOR
+ 196610: 0,
+ // GLFW_STICKY_KEYS
+ 196611: 0,
+ // GLFW_STICKY_MOUSE_BUTTONS
+ 196612: 0,
+ // GLFW_SYSTEM_KEYS
+ 196613: 0,
+ // GLFW_KEY_REPEAT
+ 196614: 0,
+ // GLFW_AUTO_POLL_EVENTS
+ 131073: 0,
+ // GLFW_OPENED
+ 131074: 0,
+ // GLFW_ACTIVE
+ 131075: 0,
+ // GLFW_ICONIFIED
+ 131076: 0,
+ // GLFW_ACCELERATED
+ 131077: 135169,
+ // GLFW_RED_BITS
+ 131078: 135170,
+ // GLFW_GREEN_BITS
+ 131079: 135171,
+ // GLFW_BLUE_BITS
+ 131080: 135172,
+ // GLFW_ALPHA_BITS
+ 131081: 135173,
+ // GLFW_DEPTH_BITS
+ 131082: 135174,
+ // GLFW_STENCIL_BITS
+ 131083: 135183,
+ // GLFW_REFRESH_RATE
+ 131084: 135175,
+ // GLFW_ACCUM_RED_BITS
+ 131085: 135176,
+ // GLFW_ACCUM_GREEN_BITS
+ 131086: 135177,
+ // GLFW_ACCUM_BLUE_BITS
+ 131087: 135178,
+ // GLFW_ACCUM_ALPHA_BITS
+ 131088: 135179,
+ // GLFW_AUX_BUFFERS
+ 131089: 135180,
+ // GLFW_STEREO
+ 131090: 0,
+ // GLFW_WINDOW_NO_RESIZE
+ 131091: 135181,
+ // GLFW_FSAA_SAMPLES
+ 131092: 139266,
+ // GLFW_OPENGL_VERSION_MAJOR
+ 131093: 139267,
+ // GLFW_OPENGL_VERSION_MINOR
+ 131094: 139270,
+ // GLFW_OPENGL_FORWARD_COMPAT
+ 131095: 139271,
+ // GLFW_OPENGL_DEBUG_CONTEXT
+ 131096: 139272
+ };
+ // GLFW_OPENGL_PROFILE
+ return table[param];
+ }
+};
+
+var _glfwCreateStandardCursor = shape => {};
+
+var _glfwCreateWindow = (width, height, title, monitor, share) => GLFW.createWindow(width, height, title, monitor, share);
+
+var _glfwGetClipboardString = win => {};
+
+var _glfwGetCurrentContext = () => GLFW.active ? GLFW.active.id : 0;
+
+var _glfwGetCursorPos = (winid, x, y) => GLFW.getCursorPos(winid, x, y);
+
+var _glfwGetFramebufferSize = (winid, width, height) => {
+ var ww = 0;
+ var wh = 0;
+ var win = GLFW.WindowFromId(winid);
+ if (win) {
+ ww = win.framebufferWidth;
+ wh = win.framebufferHeight;
+ }
+ if (width) {
+ GROWABLE_HEAP_I32()[((width) >> 2)] = ww;
+ }
+ if (height) {
+ GROWABLE_HEAP_I32()[((height) >> 2)] = wh;
+ }
+};
+
+var _glfwGetInputMode = (winid, mode) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ switch (mode) {
+ case 208897:
+ {
+ // GLFW_CURSOR
+ if (Browser.pointerLock) {
+ win.inputModes[mode] = 212995;
+ } else // GLFW_CURSOR_DISABLED
+ {
+ win.inputModes[mode] = 212993;
+ }
+ }
+ }
+ return win.inputModes[mode];
+};
+
+var _glfwGetJoystickAxes = (joy, count) => {
+ GLFW.refreshJoysticks();
+ var state = GLFW.joys[joy];
+ if (!state || !state.axes) {
+ GROWABLE_HEAP_I32()[((count) >> 2)] = 0;
+ return;
+ }
+ GROWABLE_HEAP_I32()[((count) >> 2)] = state.axesCount;
+ return state.axes;
+};
+
+var _glfwGetJoystickButtons = (joy, count) => {
+ GLFW.refreshJoysticks();
+ var state = GLFW.joys[joy];
+ if (!state || !state.buttons) {
+ GROWABLE_HEAP_I32()[((count) >> 2)] = 0;
+ return;
+ }
+ GROWABLE_HEAP_I32()[((count) >> 2)] = state.buttonsCount;
+ return state.buttons;
+};
+
+var _glfwGetKey = (winid, key) => GLFW.getKey(winid, key);
+
+var _glfwGetMonitorPos = (monitor, x, y) => {
+ GROWABLE_HEAP_I32()[((x) >> 2)] = 0;
+ GROWABLE_HEAP_I32()[((y) >> 2)] = 0;
+};
+
+var _glfwGetMonitorWorkarea = (monitor, x, y, w, h) => {
+ GROWABLE_HEAP_I32()[((x) >> 2)] = 0;
+ GROWABLE_HEAP_I32()[((y) >> 2)] = 0;
+ GROWABLE_HEAP_I32()[((w) >> 2)] = screen.availWidth;
+ GROWABLE_HEAP_I32()[((h) >> 2)] = screen.availHeight;
+};
+
+var _glfwGetMonitors = count => {
+ GROWABLE_HEAP_I32()[((count) >> 2)] = 1;
+ if (!GLFW.monitors) {
+ GLFW.monitors = _malloc(4);
+ GROWABLE_HEAP_I32()[((GLFW.monitors) >> 2)] = 1;
+ }
+ return GLFW.monitors;
+};
+
+var _glfwGetMouseButton = (winid, button) => GLFW.getMouseButton(winid, button);
+
+var _glfwGetTime = () => GLFW.getTime() - GLFW.initialTime;
+
+var _glfwGetVideoMode = monitor => 0;
+
+var _glfwGetWindowAttrib = (winid, attrib) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return win.attributes[attrib];
+};
+
+var _glfwGetWindowPos = (winid, x, y) => GLFW.getWindowPos(winid, x, y);
+
+var _glfwGetWindowSize = (winid, width, height) => GLFW.getWindowSize(winid, width, height);
+
+var _glfwGetWindowUserPointer = winid => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return win.userptr;
+};
+
+var _glfwInit = () => {
+ if (GLFW.windows) return 1;
+ // GL_TRUE
+ GLFW.initialTime = GLFW.getTime();
+ GLFW.defaultWindowHints();
+ GLFW.windows = new Array;
+ GLFW.active = null;
+ GLFW.scale = GLFW.getDevicePixelRatio();
+ window.addEventListener("gamepadconnected", GLFW.onGamepadConnected, true);
+ window.addEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true);
+ window.addEventListener("keydown", GLFW.onKeydown, true);
+ window.addEventListener("keypress", GLFW.onKeyPress, true);
+ window.addEventListener("keyup", GLFW.onKeyup, true);
+ window.addEventListener("blur", GLFW.onBlur, true);
+ // watch for devicePixelRatio changes
+ GLFW.devicePixelRatioMQL = window.matchMedia("(resolution: " + GLFW.getDevicePixelRatio() + "dppx)");
+ GLFW.devicePixelRatioMQL.addEventListener("change", GLFW.onDevicePixelRatioChange);
+ Module["canvas"].addEventListener("touchmove", GLFW.onMousemove, true);
+ Module["canvas"].addEventListener("touchstart", GLFW.onMouseButtonDown, true);
+ Module["canvas"].addEventListener("touchcancel", GLFW.onMouseButtonUp, true);
+ Module["canvas"].addEventListener("touchend", GLFW.onMouseButtonUp, true);
+ Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
+ Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
+ Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
+ Module["canvas"].addEventListener("wheel", GLFW.onMouseWheel, true);
+ Module["canvas"].addEventListener("mousewheel", GLFW.onMouseWheel, true);
+ Module["canvas"].addEventListener("mouseenter", GLFW.onMouseenter, true);
+ Module["canvas"].addEventListener("mouseleave", GLFW.onMouseleave, true);
+ Module["canvas"].addEventListener("drop", GLFW.onDrop, true);
+ Module["canvas"].addEventListener("dragover", GLFW.onDragover, true);
+ // Overriding implementation to account for HiDPI
+ Browser.requestFullscreen = GLFW.requestFullscreen;
+ Browser.calculateMouseCoords = GLFW.calculateMouseCoords;
+ Browser.updateCanvasDimensions = GLFW.updateCanvasDimensions;
+ Browser.resizeListeners.push((width, height) => {
+ if (GLFW.isHiDPIAware()) {
+ var canvas = Module["canvas"];
+ GLFW.onCanvasResize(canvas.clientWidth, canvas.clientHeight, width, height);
+ } else {
+ GLFW.onCanvasResize(width, height, width, height);
+ }
+ });
+ return 1;
+};
+
+// GL_TRUE
+var _glfwMakeContextCurrent = winid => {};
+
+var _glfwPollEvents = () => {};
+
+var _glfwSetCharCallback = (winid, cbfun) => GLFW.setCharCallback(winid, cbfun);
+
+var _glfwSetClipboardString = (win, string) => {};
+
+var _glfwSetCursor = (winid, cursor) => {};
+
+var _glfwSetCursorEnterCallback = (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.cursorEnterFunc;
+ win.cursorEnterFunc = cbfun;
+ return prevcbfun;
+};
+
+var _glfwSetCursorPos = (winid, x, y) => GLFW.setCursorPos(winid, x, y);
+
+var _glfwSetCursorPosCallback = (winid, cbfun) => GLFW.setCursorPosCallback(winid, cbfun);
+
+var _glfwSetErrorCallback = cbfun => {
+ var prevcbfun = GLFW.errorFunc;
+ GLFW.errorFunc = cbfun;
+ return prevcbfun;
+};
+
+var _glfwSetInputMode = (winid, mode, value) => {
+ GLFW.setInputMode(winid, mode, value);
+};
+
+var _glfwSetKeyCallback = (winid, cbfun) => GLFW.setKeyCallback(winid, cbfun);
+
+var _glfwSetMonitorCallback = cbfun => {
+ var prevcbfun = GLFW.monitorFunc;
+ GLFW.monitorFunc = cbfun;
+ return prevcbfun;
+};
+
+var _glfwSetMouseButtonCallback = (winid, cbfun) => GLFW.setMouseButtonCallback(winid, cbfun);
+
+var _glfwSetScrollCallback = (winid, cbfun) => GLFW.setScrollCallback(winid, cbfun);
+
+var _glfwSetWindowCloseCallback = (winid, cbfun) => GLFW.setWindowCloseCallback(winid, cbfun);
+
+var _glfwSetWindowFocusCallback = (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.windowFocusFunc;
+ win.windowFocusFunc = cbfun;
+ return prevcbfun;
+};
+
+var _glfwSetWindowIconifyCallback = (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.windowIconifyFunc;
+ win.windowIconifyFunc = cbfun;
+ return prevcbfun;
+};
+
+var _glfwSetWindowPosCallback = (winid, cbfun) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return null;
+ var prevcbfun = win.windowPosFunc;
+ win.windowPosFunc = cbfun;
+ return prevcbfun;
+};
+
+var _glfwSetWindowShouldClose = (winid, value) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.shouldClose = value;
+};
+
+var _glfwSetWindowSize = (winid, width, height) => GLFW.setWindowSize(winid, width, height);
+
+var _glfwSetWindowSizeCallback = (winid, cbfun) => GLFW.setWindowSizeCallback(winid, cbfun);
+
+var _glfwSetWindowUserPointer = (winid, ptr) => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.userptr = ptr;
+};
+
+var _glfwSwapBuffers = winid => GLFW.swapBuffers(winid);
+
+var _glfwTerminate = () => {
+ window.removeEventListener("gamepadconnected", GLFW.onGamepadConnected, true);
+ window.removeEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true);
+ window.removeEventListener("keydown", GLFW.onKeydown, true);
+ window.removeEventListener("keypress", GLFW.onKeyPress, true);
+ window.removeEventListener("keyup", GLFW.onKeyup, true);
+ window.removeEventListener("blur", GLFW.onBlur, true);
+ Module["canvas"].removeEventListener("touchmove", GLFW.onMousemove, true);
+ Module["canvas"].removeEventListener("touchstart", GLFW.onMouseButtonDown, true);
+ Module["canvas"].removeEventListener("touchcancel", GLFW.onMouseButtonUp, true);
+ Module["canvas"].removeEventListener("touchend", GLFW.onMouseButtonUp, true);
+ Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
+ Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
+ Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
+ Module["canvas"].removeEventListener("wheel", GLFW.onMouseWheel, true);
+ Module["canvas"].removeEventListener("mousewheel", GLFW.onMouseWheel, true);
+ Module["canvas"].removeEventListener("mouseenter", GLFW.onMouseenter, true);
+ Module["canvas"].removeEventListener("mouseleave", GLFW.onMouseleave, true);
+ Module["canvas"].removeEventListener("drop", GLFW.onDrop, true);
+ Module["canvas"].removeEventListener("dragover", GLFW.onDragover, true);
+ if (GLFW.devicePixelRatioMQL) GLFW.devicePixelRatioMQL.removeEventListener("change", GLFW.onDevicePixelRatioChange);
+ Module["canvas"].width = Module["canvas"].height = 1;
+ GLFW.windows = null;
+ GLFW.active = null;
+};
+
+var _glfwWindowHint = (target, hint) => {
+ GLFW.hints[target] = hint;
+};
+
+var _glfwWindowShouldClose = winid => {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return win.shouldClose;
+};
+
+var stringToUTF8OnStack = str => {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = stackAlloc(size);
+ stringToUTF8(str, ret, size);
+ return ret;
+};
+
+var getCFunc = ident => {
+ var func = Module["_" + ident];
+ // closure exported function
+ return func;
+};
+
+var writeArrayToMemory = (array, buffer) => {
+ GROWABLE_HEAP_I8().set(array, buffer);
+};
+
+/**
+ * @param {string|null=} returnType
+ * @param {Array=} argTypes
+ * @param {Arguments|Array=} args
+ * @param {Object=} opts
+ */ var ccall = (ident, returnType, argTypes, args, opts) => {
+ // For fast lookup of conversion functions
+ var toC = {
+ "string": str => {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) {
+ // null string
+ ret = stringToUTF8OnStack(str);
+ }
+ return ret;
+ },
+ "array": arr => {
+ var ret = stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ }
+ };
+ function convertReturnValue(ret) {
+ if (returnType === "string") {
+ return UTF8ToString(ret);
+ }
+ if (returnType === "boolean") return Boolean(ret);
+ return ret;
+ }
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func(...cArgs);
+ function onDone(ret) {
+ if (stack !== 0) stackRestore(stack);
+ return convertReturnValue(ret);
+ }
+ ret = onDone(ret);
+ return ret;
+};
+
+/**
+ * @param {string=} returnType
+ * @param {Array=} argTypes
+ * @param {Object=} opts
+ */ var cwrap = (ident, returnType, argTypes, opts) => {
+ // When the function takes numbers and returns a number, we can just return
+ // the original function
+ var numericArgs = !argTypes || argTypes.every(type => type === "number" || type === "boolean");
+ var numericRet = returnType !== "string";
+ if (numericRet && numericArgs && !opts) {
+ return getCFunc(ident);
+ }
+ return (...args) => ccall(ident, returnType, argTypes, args, opts);
+};
+
+var FS_createPath = FS.createPath;
+
+var FS_unlink = path => FS.unlink(path);
+
+var FS_createLazyFile = FS.createLazyFile;
+
+var FS_createDevice = FS.createDevice;
+
+PThread.init();
+
+FS.createPreloadedFile = FS_createPreloadedFile;
+
+FS.staticInit();
+
+// Set module methods based on EXPORTED_RUNTIME_METHODS
+Module["FS_createPath"] = FS.createPath;
+
+Module["FS_createDataFile"] = FS.createDataFile;
+
+Module["FS_createPreloadedFile"] = FS.createPreloadedFile;
+
+Module["FS_unlink"] = FS.unlink;
+
+Module["FS_createLazyFile"] = FS.createLazyFile;
+
+Module["FS_createDevice"] = FS.createDevice;
+
+// This error may happen quite a bit. To avoid overhead we reuse it (and
+// suffer a lack of stack info).
+MEMFS.doesNotExistError = new FS.ErrnoError(44);
+
+/** @suppress {checkTypes} */ MEMFS.doesNotExistError.stack = "";
+
+Module["requestAnimationFrame"] = MainLoop.requestAnimationFrame;
+
+Module["pauseMainLoop"] = MainLoop.pause;
+
+Module["resumeMainLoop"] = MainLoop.resume;
+
+MainLoop.init();
+
+for (var i = 0; i < 32; ++i) tempFixedLengthArray.push(new Array(i));
+
+// exports
+Module["requestFullscreen"] = Browser.requestFullscreen;
+
+Module["setCanvasSize"] = Browser.setCanvasSize;
+
+Module["getUserMedia"] = Browser.getUserMedia;
+
+Module["createContext"] = Browser.createContext;
+
+// proxiedFunctionTable specifies the list of functions that can be called
+// either synchronously or asynchronously from other threads in postMessage()d
+// or internally queued events. This way a pthread in a Worker can synchronously
+// access e.g. the DOM on the main thread.
+var proxiedFunctionTable = [ _proc_exit, exitOnMainThread, pthreadCreateProxied, ___syscall_faccessat, ___syscall_fcntl64, ___syscall_fstat64, ___syscall_ftruncate64, ___syscall_getdents64, ___syscall_ioctl, ___syscall_lstat64, ___syscall_mkdirat, ___syscall_newfstatat, ___syscall_openat, ___syscall_pipe, ___syscall_recvfrom, ___syscall_renameat, ___syscall_rmdir, ___syscall_sendto, ___syscall_stat64, ___syscall_unlinkat, __mmap_js, __munmap_js, _alDeleteBuffers, _alGetError, _alGetSourcei, _alIsBuffer, _alSourcePause, _alSourcePlay, _alSourceStop, _alSourcei, getCanvasSizeMainThread, _emscripten_get_element_css_size, _emscripten_set_touchcancel_callback_on_thread, _emscripten_set_touchend_callback_on_thread, _emscripten_set_touchmove_callback_on_thread, _emscripten_set_touchstart_callback_on_thread, _environ_get, _environ_sizes_get, _fd_close, _fd_read, _fd_seek, _fd_write, _emscripten_set_window_title ];
+
+var wasmImports;
+
+function assignWasmImports() {
+ wasmImports = {
+ /** @export */ ImGui_ImplGlfw_EmscriptenOpenURL,
+ /** @export */ __assert_fail: ___assert_fail,
+ /** @export */ __call_sighandler: ___call_sighandler,
+ /** @export */ __cxa_throw: ___cxa_throw,
+ /** @export */ __pthread_create_js: ___pthread_create_js,
+ /** @export */ __syscall_faccessat: ___syscall_faccessat,
+ /** @export */ __syscall_fcntl64: ___syscall_fcntl64,
+ /** @export */ __syscall_fstat64: ___syscall_fstat64,
+ /** @export */ __syscall_ftruncate64: ___syscall_ftruncate64,
+ /** @export */ __syscall_getdents64: ___syscall_getdents64,
+ /** @export */ __syscall_ioctl: ___syscall_ioctl,
+ /** @export */ __syscall_lstat64: ___syscall_lstat64,
+ /** @export */ __syscall_mkdirat: ___syscall_mkdirat,
+ /** @export */ __syscall_newfstatat: ___syscall_newfstatat,
+ /** @export */ __syscall_openat: ___syscall_openat,
+ /** @export */ __syscall_pipe: ___syscall_pipe,
+ /** @export */ __syscall_recvfrom: ___syscall_recvfrom,
+ /** @export */ __syscall_renameat: ___syscall_renameat,
+ /** @export */ __syscall_rmdir: ___syscall_rmdir,
+ /** @export */ __syscall_sendto: ___syscall_sendto,
+ /** @export */ __syscall_stat64: ___syscall_stat64,
+ /** @export */ __syscall_unlinkat: ___syscall_unlinkat,
+ /** @export */ _abort_js: __abort_js,
+ /** @export */ _emscripten_get_now_is_monotonic: __emscripten_get_now_is_monotonic,
+ /** @export */ _emscripten_init_main_thread_js: __emscripten_init_main_thread_js,
+ /** @export */ _emscripten_notify_mailbox_postmessage: __emscripten_notify_mailbox_postmessage,
+ /** @export */ _emscripten_receive_on_main_thread_js: __emscripten_receive_on_main_thread_js,
+ /** @export */ _emscripten_runtime_keepalive_clear: __emscripten_runtime_keepalive_clear,
+ /** @export */ _emscripten_thread_cleanup: __emscripten_thread_cleanup,
+ /** @export */ _emscripten_thread_mailbox_await: __emscripten_thread_mailbox_await,
+ /** @export */ _emscripten_thread_set_strongref: __emscripten_thread_set_strongref,
+ /** @export */ _emscripten_throw_longjmp: __emscripten_throw_longjmp,
+ /** @export */ _localtime_js: __localtime_js,
+ /** @export */ _mmap_js: __mmap_js,
+ /** @export */ _munmap_js: __munmap_js,
+ /** @export */ _tzset_js: __tzset_js,
+ /** @export */ alDeleteBuffers: _alDeleteBuffers,
+ /** @export */ alGetError: _alGetError,
+ /** @export */ alGetSourcei: _alGetSourcei,
+ /** @export */ alIsBuffer: _alIsBuffer,
+ /** @export */ alSourcePause: _alSourcePause,
+ /** @export */ alSourcePlay: _alSourcePlay,
+ /** @export */ alSourceStop: _alSourceStop,
+ /** @export */ alSourcei: _alSourcei,
+ /** @export */ emscripten_asm_const_int: _emscripten_asm_const_int,
+ /** @export */ emscripten_asm_const_ptr: _emscripten_asm_const_ptr,
+ /** @export */ emscripten_cancel_main_loop: _emscripten_cancel_main_loop,
+ /** @export */ emscripten_check_blocking_allowed: _emscripten_check_blocking_allowed,
+ /** @export */ emscripten_date_now: _emscripten_date_now,
+ /** @export */ emscripten_exit_with_live_runtime: _emscripten_exit_with_live_runtime,
+ /** @export */ emscripten_get_canvas_element_size: _emscripten_get_canvas_element_size,
+ /** @export */ emscripten_get_element_css_size: _emscripten_get_element_css_size,
+ /** @export */ emscripten_get_heap_max: _emscripten_get_heap_max,
+ /** @export */ emscripten_get_now: _emscripten_get_now,
+ /** @export */ emscripten_glActiveTexture: _emscripten_glActiveTexture,
+ /** @export */ emscripten_glAttachShader: _emscripten_glAttachShader,
+ /** @export */ emscripten_glBeginQuery: _emscripten_glBeginQuery,
+ /** @export */ emscripten_glBeginQueryEXT: _emscripten_glBeginQueryEXT,
+ /** @export */ emscripten_glBeginTransformFeedback: _emscripten_glBeginTransformFeedback,
+ /** @export */ emscripten_glBindAttribLocation: _emscripten_glBindAttribLocation,
+ /** @export */ emscripten_glBindBuffer: _emscripten_glBindBuffer,
+ /** @export */ emscripten_glBindBufferBase: _emscripten_glBindBufferBase,
+ /** @export */ emscripten_glBindBufferRange: _emscripten_glBindBufferRange,
+ /** @export */ emscripten_glBindFramebuffer: _emscripten_glBindFramebuffer,
+ /** @export */ emscripten_glBindRenderbuffer: _emscripten_glBindRenderbuffer,
+ /** @export */ emscripten_glBindSampler: _emscripten_glBindSampler,
+ /** @export */ emscripten_glBindTexture: _emscripten_glBindTexture,
+ /** @export */ emscripten_glBindTransformFeedback: _emscripten_glBindTransformFeedback,
+ /** @export */ emscripten_glBindVertexArray: _emscripten_glBindVertexArray,
+ /** @export */ emscripten_glBindVertexArrayOES: _emscripten_glBindVertexArrayOES,
+ /** @export */ emscripten_glBlendColor: _emscripten_glBlendColor,
+ /** @export */ emscripten_glBlendEquation: _emscripten_glBlendEquation,
+ /** @export */ emscripten_glBlendEquationSeparate: _emscripten_glBlendEquationSeparate,
+ /** @export */ emscripten_glBlendFunc: _emscripten_glBlendFunc,
+ /** @export */ emscripten_glBlendFuncSeparate: _emscripten_glBlendFuncSeparate,
+ /** @export */ emscripten_glBlitFramebuffer: _emscripten_glBlitFramebuffer,
+ /** @export */ emscripten_glBufferData: _emscripten_glBufferData,
+ /** @export */ emscripten_glBufferSubData: _emscripten_glBufferSubData,
+ /** @export */ emscripten_glCheckFramebufferStatus: _emscripten_glCheckFramebufferStatus,
+ /** @export */ emscripten_glClear: _emscripten_glClear,
+ /** @export */ emscripten_glClearBufferfi: _emscripten_glClearBufferfi,
+ /** @export */ emscripten_glClearBufferfv: _emscripten_glClearBufferfv,
+ /** @export */ emscripten_glClearBufferiv: _emscripten_glClearBufferiv,
+ /** @export */ emscripten_glClearBufferuiv: _emscripten_glClearBufferuiv,
+ /** @export */ emscripten_glClearColor: _emscripten_glClearColor,
+ /** @export */ emscripten_glClearDepthf: _emscripten_glClearDepthf,
+ /** @export */ emscripten_glClearStencil: _emscripten_glClearStencil,
+ /** @export */ emscripten_glClientWaitSync: _emscripten_glClientWaitSync,
+ /** @export */ emscripten_glClipControlEXT: _emscripten_glClipControlEXT,
+ /** @export */ emscripten_glColorMask: _emscripten_glColorMask,
+ /** @export */ emscripten_glCompileShader: _emscripten_glCompileShader,
+ /** @export */ emscripten_glCompressedTexImage2D: _emscripten_glCompressedTexImage2D,
+ /** @export */ emscripten_glCompressedTexImage3D: _emscripten_glCompressedTexImage3D,
+ /** @export */ emscripten_glCompressedTexSubImage2D: _emscripten_glCompressedTexSubImage2D,
+ /** @export */ emscripten_glCompressedTexSubImage3D: _emscripten_glCompressedTexSubImage3D,
+ /** @export */ emscripten_glCopyBufferSubData: _emscripten_glCopyBufferSubData,
+ /** @export */ emscripten_glCopyTexImage2D: _emscripten_glCopyTexImage2D,
+ /** @export */ emscripten_glCopyTexSubImage2D: _emscripten_glCopyTexSubImage2D,
+ /** @export */ emscripten_glCopyTexSubImage3D: _emscripten_glCopyTexSubImage3D,
+ /** @export */ emscripten_glCreateProgram: _emscripten_glCreateProgram,
+ /** @export */ emscripten_glCreateShader: _emscripten_glCreateShader,
+ /** @export */ emscripten_glCullFace: _emscripten_glCullFace,
+ /** @export */ emscripten_glDeleteBuffers: _emscripten_glDeleteBuffers,
+ /** @export */ emscripten_glDeleteFramebuffers: _emscripten_glDeleteFramebuffers,
+ /** @export */ emscripten_glDeleteProgram: _emscripten_glDeleteProgram,
+ /** @export */ emscripten_glDeleteQueries: _emscripten_glDeleteQueries,
+ /** @export */ emscripten_glDeleteQueriesEXT: _emscripten_glDeleteQueriesEXT,
+ /** @export */ emscripten_glDeleteRenderbuffers: _emscripten_glDeleteRenderbuffers,
+ /** @export */ emscripten_glDeleteSamplers: _emscripten_glDeleteSamplers,
+ /** @export */ emscripten_glDeleteShader: _emscripten_glDeleteShader,
+ /** @export */ emscripten_glDeleteSync: _emscripten_glDeleteSync,
+ /** @export */ emscripten_glDeleteTextures: _emscripten_glDeleteTextures,
+ /** @export */ emscripten_glDeleteTransformFeedbacks: _emscripten_glDeleteTransformFeedbacks,
+ /** @export */ emscripten_glDeleteVertexArrays: _emscripten_glDeleteVertexArrays,
+ /** @export */ emscripten_glDeleteVertexArraysOES: _emscripten_glDeleteVertexArraysOES,
+ /** @export */ emscripten_glDepthFunc: _emscripten_glDepthFunc,
+ /** @export */ emscripten_glDepthMask: _emscripten_glDepthMask,
+ /** @export */ emscripten_glDepthRangef: _emscripten_glDepthRangef,
+ /** @export */ emscripten_glDetachShader: _emscripten_glDetachShader,
+ /** @export */ emscripten_glDisable: _emscripten_glDisable,
+ /** @export */ emscripten_glDisableVertexAttribArray: _emscripten_glDisableVertexAttribArray,
+ /** @export */ emscripten_glDrawArrays: _emscripten_glDrawArrays,
+ /** @export */ emscripten_glDrawArraysInstanced: _emscripten_glDrawArraysInstanced,
+ /** @export */ emscripten_glDrawArraysInstancedANGLE: _emscripten_glDrawArraysInstancedANGLE,
+ /** @export */ emscripten_glDrawArraysInstancedARB: _emscripten_glDrawArraysInstancedARB,
+ /** @export */ emscripten_glDrawArraysInstancedEXT: _emscripten_glDrawArraysInstancedEXT,
+ /** @export */ emscripten_glDrawArraysInstancedNV: _emscripten_glDrawArraysInstancedNV,
+ /** @export */ emscripten_glDrawBuffers: _emscripten_glDrawBuffers,
+ /** @export */ emscripten_glDrawBuffersEXT: _emscripten_glDrawBuffersEXT,
+ /** @export */ emscripten_glDrawBuffersWEBGL: _emscripten_glDrawBuffersWEBGL,
+ /** @export */ emscripten_glDrawElements: _emscripten_glDrawElements,
+ /** @export */ emscripten_glDrawElementsInstanced: _emscripten_glDrawElementsInstanced,
+ /** @export */ emscripten_glDrawElementsInstancedANGLE: _emscripten_glDrawElementsInstancedANGLE,
+ /** @export */ emscripten_glDrawElementsInstancedARB: _emscripten_glDrawElementsInstancedARB,
+ /** @export */ emscripten_glDrawElementsInstancedEXT: _emscripten_glDrawElementsInstancedEXT,
+ /** @export */ emscripten_glDrawElementsInstancedNV: _emscripten_glDrawElementsInstancedNV,
+ /** @export */ emscripten_glDrawRangeElements: _emscripten_glDrawRangeElements,
+ /** @export */ emscripten_glEnable: _emscripten_glEnable,
+ /** @export */ emscripten_glEnableVertexAttribArray: _emscripten_glEnableVertexAttribArray,
+ /** @export */ emscripten_glEndQuery: _emscripten_glEndQuery,
+ /** @export */ emscripten_glEndQueryEXT: _emscripten_glEndQueryEXT,
+ /** @export */ emscripten_glEndTransformFeedback: _emscripten_glEndTransformFeedback,
+ /** @export */ emscripten_glFenceSync: _emscripten_glFenceSync,
+ /** @export */ emscripten_glFinish: _emscripten_glFinish,
+ /** @export */ emscripten_glFlush: _emscripten_glFlush,
+ /** @export */ emscripten_glFramebufferRenderbuffer: _emscripten_glFramebufferRenderbuffer,
+ /** @export */ emscripten_glFramebufferTexture2D: _emscripten_glFramebufferTexture2D,
+ /** @export */ emscripten_glFramebufferTextureLayer: _emscripten_glFramebufferTextureLayer,
+ /** @export */ emscripten_glFrontFace: _emscripten_glFrontFace,
+ /** @export */ emscripten_glGenBuffers: _emscripten_glGenBuffers,
+ /** @export */ emscripten_glGenFramebuffers: _emscripten_glGenFramebuffers,
+ /** @export */ emscripten_glGenQueries: _emscripten_glGenQueries,
+ /** @export */ emscripten_glGenQueriesEXT: _emscripten_glGenQueriesEXT,
+ /** @export */ emscripten_glGenRenderbuffers: _emscripten_glGenRenderbuffers,
+ /** @export */ emscripten_glGenSamplers: _emscripten_glGenSamplers,
+ /** @export */ emscripten_glGenTextures: _emscripten_glGenTextures,
+ /** @export */ emscripten_glGenTransformFeedbacks: _emscripten_glGenTransformFeedbacks,
+ /** @export */ emscripten_glGenVertexArrays: _emscripten_glGenVertexArrays,
+ /** @export */ emscripten_glGenVertexArraysOES: _emscripten_glGenVertexArraysOES,
+ /** @export */ emscripten_glGenerateMipmap: _emscripten_glGenerateMipmap,
+ /** @export */ emscripten_glGetActiveAttrib: _emscripten_glGetActiveAttrib,
+ /** @export */ emscripten_glGetActiveUniform: _emscripten_glGetActiveUniform,
+ /** @export */ emscripten_glGetActiveUniformBlockName: _emscripten_glGetActiveUniformBlockName,
+ /** @export */ emscripten_glGetActiveUniformBlockiv: _emscripten_glGetActiveUniformBlockiv,
+ /** @export */ emscripten_glGetActiveUniformsiv: _emscripten_glGetActiveUniformsiv,
+ /** @export */ emscripten_glGetAttachedShaders: _emscripten_glGetAttachedShaders,
+ /** @export */ emscripten_glGetAttribLocation: _emscripten_glGetAttribLocation,
+ /** @export */ emscripten_glGetBooleanv: _emscripten_glGetBooleanv,
+ /** @export */ emscripten_glGetBufferParameteri64v: _emscripten_glGetBufferParameteri64v,
+ /** @export */ emscripten_glGetBufferParameteriv: _emscripten_glGetBufferParameteriv,
+ /** @export */ emscripten_glGetError: _emscripten_glGetError,
+ /** @export */ emscripten_glGetFloatv: _emscripten_glGetFloatv,
+ /** @export */ emscripten_glGetFragDataLocation: _emscripten_glGetFragDataLocation,
+ /** @export */ emscripten_glGetFramebufferAttachmentParameteriv: _emscripten_glGetFramebufferAttachmentParameteriv,
+ /** @export */ emscripten_glGetInteger64i_v: _emscripten_glGetInteger64i_v,
+ /** @export */ emscripten_glGetInteger64v: _emscripten_glGetInteger64v,
+ /** @export */ emscripten_glGetIntegeri_v: _emscripten_glGetIntegeri_v,
+ /** @export */ emscripten_glGetIntegerv: _emscripten_glGetIntegerv,
+ /** @export */ emscripten_glGetInternalformativ: _emscripten_glGetInternalformativ,
+ /** @export */ emscripten_glGetProgramBinary: _emscripten_glGetProgramBinary,
+ /** @export */ emscripten_glGetProgramInfoLog: _emscripten_glGetProgramInfoLog,
+ /** @export */ emscripten_glGetProgramiv: _emscripten_glGetProgramiv,
+ /** @export */ emscripten_glGetQueryObjecti64vEXT: _emscripten_glGetQueryObjecti64vEXT,
+ /** @export */ emscripten_glGetQueryObjectivEXT: _emscripten_glGetQueryObjectivEXT,
+ /** @export */ emscripten_glGetQueryObjectui64vEXT: _emscripten_glGetQueryObjectui64vEXT,
+ /** @export */ emscripten_glGetQueryObjectuiv: _emscripten_glGetQueryObjectuiv,
+ /** @export */ emscripten_glGetQueryObjectuivEXT: _emscripten_glGetQueryObjectuivEXT,
+ /** @export */ emscripten_glGetQueryiv: _emscripten_glGetQueryiv,
+ /** @export */ emscripten_glGetQueryivEXT: _emscripten_glGetQueryivEXT,
+ /** @export */ emscripten_glGetRenderbufferParameteriv: _emscripten_glGetRenderbufferParameteriv,
+ /** @export */ emscripten_glGetSamplerParameterfv: _emscripten_glGetSamplerParameterfv,
+ /** @export */ emscripten_glGetSamplerParameteriv: _emscripten_glGetSamplerParameteriv,
+ /** @export */ emscripten_glGetShaderInfoLog: _emscripten_glGetShaderInfoLog,
+ /** @export */ emscripten_glGetShaderPrecisionFormat: _emscripten_glGetShaderPrecisionFormat,
+ /** @export */ emscripten_glGetShaderSource: _emscripten_glGetShaderSource,
+ /** @export */ emscripten_glGetShaderiv: _emscripten_glGetShaderiv,
+ /** @export */ emscripten_glGetString: _emscripten_glGetString,
+ /** @export */ emscripten_glGetStringi: _emscripten_glGetStringi,
+ /** @export */ emscripten_glGetSynciv: _emscripten_glGetSynciv,
+ /** @export */ emscripten_glGetTexParameterfv: _emscripten_glGetTexParameterfv,
+ /** @export */ emscripten_glGetTexParameteriv: _emscripten_glGetTexParameteriv,
+ /** @export */ emscripten_glGetTransformFeedbackVarying: _emscripten_glGetTransformFeedbackVarying,
+ /** @export */ emscripten_glGetUniformBlockIndex: _emscripten_glGetUniformBlockIndex,
+ /** @export */ emscripten_glGetUniformIndices: _emscripten_glGetUniformIndices,
+ /** @export */ emscripten_glGetUniformLocation: _emscripten_glGetUniformLocation,
+ /** @export */ emscripten_glGetUniformfv: _emscripten_glGetUniformfv,
+ /** @export */ emscripten_glGetUniformiv: _emscripten_glGetUniformiv,
+ /** @export */ emscripten_glGetUniformuiv: _emscripten_glGetUniformuiv,
+ /** @export */ emscripten_glGetVertexAttribIiv: _emscripten_glGetVertexAttribIiv,
+ /** @export */ emscripten_glGetVertexAttribIuiv: _emscripten_glGetVertexAttribIuiv,
+ /** @export */ emscripten_glGetVertexAttribPointerv: _emscripten_glGetVertexAttribPointerv,
+ /** @export */ emscripten_glGetVertexAttribfv: _emscripten_glGetVertexAttribfv,
+ /** @export */ emscripten_glGetVertexAttribiv: _emscripten_glGetVertexAttribiv,
+ /** @export */ emscripten_glHint: _emscripten_glHint,
+ /** @export */ emscripten_glInvalidateFramebuffer: _emscripten_glInvalidateFramebuffer,
+ /** @export */ emscripten_glInvalidateSubFramebuffer: _emscripten_glInvalidateSubFramebuffer,
+ /** @export */ emscripten_glIsBuffer: _emscripten_glIsBuffer,
+ /** @export */ emscripten_glIsEnabled: _emscripten_glIsEnabled,
+ /** @export */ emscripten_glIsFramebuffer: _emscripten_glIsFramebuffer,
+ /** @export */ emscripten_glIsProgram: _emscripten_glIsProgram,
+ /** @export */ emscripten_glIsQuery: _emscripten_glIsQuery,
+ /** @export */ emscripten_glIsQueryEXT: _emscripten_glIsQueryEXT,
+ /** @export */ emscripten_glIsRenderbuffer: _emscripten_glIsRenderbuffer,
+ /** @export */ emscripten_glIsSampler: _emscripten_glIsSampler,
+ /** @export */ emscripten_glIsShader: _emscripten_glIsShader,
+ /** @export */ emscripten_glIsSync: _emscripten_glIsSync,
+ /** @export */ emscripten_glIsTexture: _emscripten_glIsTexture,
+ /** @export */ emscripten_glIsTransformFeedback: _emscripten_glIsTransformFeedback,
+ /** @export */ emscripten_glIsVertexArray: _emscripten_glIsVertexArray,
+ /** @export */ emscripten_glIsVertexArrayOES: _emscripten_glIsVertexArrayOES,
+ /** @export */ emscripten_glLineWidth: _emscripten_glLineWidth,
+ /** @export */ emscripten_glLinkProgram: _emscripten_glLinkProgram,
+ /** @export */ emscripten_glPauseTransformFeedback: _emscripten_glPauseTransformFeedback,
+ /** @export */ emscripten_glPixelStorei: _emscripten_glPixelStorei,
+ /** @export */ emscripten_glPolygonModeWEBGL: _emscripten_glPolygonModeWEBGL,
+ /** @export */ emscripten_glPolygonOffset: _emscripten_glPolygonOffset,
+ /** @export */ emscripten_glPolygonOffsetClampEXT: _emscripten_glPolygonOffsetClampEXT,
+ /** @export */ emscripten_glProgramBinary: _emscripten_glProgramBinary,
+ /** @export */ emscripten_glProgramParameteri: _emscripten_glProgramParameteri,
+ /** @export */ emscripten_glQueryCounterEXT: _emscripten_glQueryCounterEXT,
+ /** @export */ emscripten_glReadBuffer: _emscripten_glReadBuffer,
+ /** @export */ emscripten_glReadPixels: _emscripten_glReadPixels,
+ /** @export */ emscripten_glReleaseShaderCompiler: _emscripten_glReleaseShaderCompiler,
+ /** @export */ emscripten_glRenderbufferStorage: _emscripten_glRenderbufferStorage,
+ /** @export */ emscripten_glRenderbufferStorageMultisample: _emscripten_glRenderbufferStorageMultisample,
+ /** @export */ emscripten_glResumeTransformFeedback: _emscripten_glResumeTransformFeedback,
+ /** @export */ emscripten_glSampleCoverage: _emscripten_glSampleCoverage,
+ /** @export */ emscripten_glSamplerParameterf: _emscripten_glSamplerParameterf,
+ /** @export */ emscripten_glSamplerParameterfv: _emscripten_glSamplerParameterfv,
+ /** @export */ emscripten_glSamplerParameteri: _emscripten_glSamplerParameteri,
+ /** @export */ emscripten_glSamplerParameteriv: _emscripten_glSamplerParameteriv,
+ /** @export */ emscripten_glScissor: _emscripten_glScissor,
+ /** @export */ emscripten_glShaderBinary: _emscripten_glShaderBinary,
+ /** @export */ emscripten_glShaderSource: _emscripten_glShaderSource,
+ /** @export */ emscripten_glStencilFunc: _emscripten_glStencilFunc,
+ /** @export */ emscripten_glStencilFuncSeparate: _emscripten_glStencilFuncSeparate,
+ /** @export */ emscripten_glStencilMask: _emscripten_glStencilMask,
+ /** @export */ emscripten_glStencilMaskSeparate: _emscripten_glStencilMaskSeparate,
+ /** @export */ emscripten_glStencilOp: _emscripten_glStencilOp,
+ /** @export */ emscripten_glStencilOpSeparate: _emscripten_glStencilOpSeparate,
+ /** @export */ emscripten_glTexImage2D: _emscripten_glTexImage2D,
+ /** @export */ emscripten_glTexImage3D: _emscripten_glTexImage3D,
+ /** @export */ emscripten_glTexParameterf: _emscripten_glTexParameterf,
+ /** @export */ emscripten_glTexParameterfv: _emscripten_glTexParameterfv,
+ /** @export */ emscripten_glTexParameteri: _emscripten_glTexParameteri,
+ /** @export */ emscripten_glTexParameteriv: _emscripten_glTexParameteriv,
+ /** @export */ emscripten_glTexStorage2D: _emscripten_glTexStorage2D,
+ /** @export */ emscripten_glTexStorage3D: _emscripten_glTexStorage3D,
+ /** @export */ emscripten_glTexSubImage2D: _emscripten_glTexSubImage2D,
+ /** @export */ emscripten_glTexSubImage3D: _emscripten_glTexSubImage3D,
+ /** @export */ emscripten_glTransformFeedbackVaryings: _emscripten_glTransformFeedbackVaryings,
+ /** @export */ emscripten_glUniform1f: _emscripten_glUniform1f,
+ /** @export */ emscripten_glUniform1fv: _emscripten_glUniform1fv,
+ /** @export */ emscripten_glUniform1i: _emscripten_glUniform1i,
+ /** @export */ emscripten_glUniform1iv: _emscripten_glUniform1iv,
+ /** @export */ emscripten_glUniform1ui: _emscripten_glUniform1ui,
+ /** @export */ emscripten_glUniform1uiv: _emscripten_glUniform1uiv,
+ /** @export */ emscripten_glUniform2f: _emscripten_glUniform2f,
+ /** @export */ emscripten_glUniform2fv: _emscripten_glUniform2fv,
+ /** @export */ emscripten_glUniform2i: _emscripten_glUniform2i,
+ /** @export */ emscripten_glUniform2iv: _emscripten_glUniform2iv,
+ /** @export */ emscripten_glUniform2ui: _emscripten_glUniform2ui,
+ /** @export */ emscripten_glUniform2uiv: _emscripten_glUniform2uiv,
+ /** @export */ emscripten_glUniform3f: _emscripten_glUniform3f,
+ /** @export */ emscripten_glUniform3fv: _emscripten_glUniform3fv,
+ /** @export */ emscripten_glUniform3i: _emscripten_glUniform3i,
+ /** @export */ emscripten_glUniform3iv: _emscripten_glUniform3iv,
+ /** @export */ emscripten_glUniform3ui: _emscripten_glUniform3ui,
+ /** @export */ emscripten_glUniform3uiv: _emscripten_glUniform3uiv,
+ /** @export */ emscripten_glUniform4f: _emscripten_glUniform4f,
+ /** @export */ emscripten_glUniform4fv: _emscripten_glUniform4fv,
+ /** @export */ emscripten_glUniform4i: _emscripten_glUniform4i,
+ /** @export */ emscripten_glUniform4iv: _emscripten_glUniform4iv,
+ /** @export */ emscripten_glUniform4ui: _emscripten_glUniform4ui,
+ /** @export */ emscripten_glUniform4uiv: _emscripten_glUniform4uiv,
+ /** @export */ emscripten_glUniformBlockBinding: _emscripten_glUniformBlockBinding,
+ /** @export */ emscripten_glUniformMatrix2fv: _emscripten_glUniformMatrix2fv,
+ /** @export */ emscripten_glUniformMatrix2x3fv: _emscripten_glUniformMatrix2x3fv,
+ /** @export */ emscripten_glUniformMatrix2x4fv: _emscripten_glUniformMatrix2x4fv,
+ /** @export */ emscripten_glUniformMatrix3fv: _emscripten_glUniformMatrix3fv,
+ /** @export */ emscripten_glUniformMatrix3x2fv: _emscripten_glUniformMatrix3x2fv,
+ /** @export */ emscripten_glUniformMatrix3x4fv: _emscripten_glUniformMatrix3x4fv,
+ /** @export */ emscripten_glUniformMatrix4fv: _emscripten_glUniformMatrix4fv,
+ /** @export */ emscripten_glUniformMatrix4x2fv: _emscripten_glUniformMatrix4x2fv,
+ /** @export */ emscripten_glUniformMatrix4x3fv: _emscripten_glUniformMatrix4x3fv,
+ /** @export */ emscripten_glUseProgram: _emscripten_glUseProgram,
+ /** @export */ emscripten_glValidateProgram: _emscripten_glValidateProgram,
+ /** @export */ emscripten_glVertexAttrib1f: _emscripten_glVertexAttrib1f,
+ /** @export */ emscripten_glVertexAttrib1fv: _emscripten_glVertexAttrib1fv,
+ /** @export */ emscripten_glVertexAttrib2f: _emscripten_glVertexAttrib2f,
+ /** @export */ emscripten_glVertexAttrib2fv: _emscripten_glVertexAttrib2fv,
+ /** @export */ emscripten_glVertexAttrib3f: _emscripten_glVertexAttrib3f,
+ /** @export */ emscripten_glVertexAttrib3fv: _emscripten_glVertexAttrib3fv,
+ /** @export */ emscripten_glVertexAttrib4f: _emscripten_glVertexAttrib4f,
+ /** @export */ emscripten_glVertexAttrib4fv: _emscripten_glVertexAttrib4fv,
+ /** @export */ emscripten_glVertexAttribDivisor: _emscripten_glVertexAttribDivisor,
+ /** @export */ emscripten_glVertexAttribDivisorANGLE: _emscripten_glVertexAttribDivisorANGLE,
+ /** @export */ emscripten_glVertexAttribDivisorARB: _emscripten_glVertexAttribDivisorARB,
+ /** @export */ emscripten_glVertexAttribDivisorEXT: _emscripten_glVertexAttribDivisorEXT,
+ /** @export */ emscripten_glVertexAttribDivisorNV: _emscripten_glVertexAttribDivisorNV,
+ /** @export */ emscripten_glVertexAttribI4i: _emscripten_glVertexAttribI4i,
+ /** @export */ emscripten_glVertexAttribI4iv: _emscripten_glVertexAttribI4iv,
+ /** @export */ emscripten_glVertexAttribI4ui: _emscripten_glVertexAttribI4ui,
+ /** @export */ emscripten_glVertexAttribI4uiv: _emscripten_glVertexAttribI4uiv,
+ /** @export */ emscripten_glVertexAttribIPointer: _emscripten_glVertexAttribIPointer,
+ /** @export */ emscripten_glVertexAttribPointer: _emscripten_glVertexAttribPointer,
+ /** @export */ emscripten_glViewport: _emscripten_glViewport,
+ /** @export */ emscripten_glWaitSync: _emscripten_glWaitSync,
+ /** @export */ emscripten_num_logical_cores: _emscripten_num_logical_cores,
+ /** @export */ emscripten_resize_heap: _emscripten_resize_heap,
+ /** @export */ emscripten_set_main_loop: _emscripten_set_main_loop,
+ /** @export */ emscripten_set_touchcancel_callback_on_thread: _emscripten_set_touchcancel_callback_on_thread,
+ /** @export */ emscripten_set_touchend_callback_on_thread: _emscripten_set_touchend_callback_on_thread,
+ /** @export */ emscripten_set_touchmove_callback_on_thread: _emscripten_set_touchmove_callback_on_thread,
+ /** @export */ emscripten_set_touchstart_callback_on_thread: _emscripten_set_touchstart_callback_on_thread,
+ /** @export */ environ_get: _environ_get,
+ /** @export */ environ_sizes_get: _environ_sizes_get,
+ /** @export */ exit: _exit,
+ /** @export */ fd_close: _fd_close,
+ /** @export */ fd_read: _fd_read,
+ /** @export */ fd_seek: _fd_seek,
+ /** @export */ fd_write: _fd_write,
+ /** @export */ glfwCreateStandardCursor: _glfwCreateStandardCursor,
+ /** @export */ glfwCreateWindow: _glfwCreateWindow,
+ /** @export */ glfwGetClipboardString: _glfwGetClipboardString,
+ /** @export */ glfwGetCurrentContext: _glfwGetCurrentContext,
+ /** @export */ glfwGetCursorPos: _glfwGetCursorPos,
+ /** @export */ glfwGetFramebufferSize: _glfwGetFramebufferSize,
+ /** @export */ glfwGetInputMode: _glfwGetInputMode,
+ /** @export */ glfwGetJoystickAxes: _glfwGetJoystickAxes,
+ /** @export */ glfwGetJoystickButtons: _glfwGetJoystickButtons,
+ /** @export */ glfwGetKey: _glfwGetKey,
+ /** @export */ glfwGetMonitorPos: _glfwGetMonitorPos,
+ /** @export */ glfwGetMonitorWorkarea: _glfwGetMonitorWorkarea,
+ /** @export */ glfwGetMonitors: _glfwGetMonitors,
+ /** @export */ glfwGetMouseButton: _glfwGetMouseButton,
+ /** @export */ glfwGetTime: _glfwGetTime,
+ /** @export */ glfwGetVideoMode: _glfwGetVideoMode,
+ /** @export */ glfwGetWindowAttrib: _glfwGetWindowAttrib,
+ /** @export */ glfwGetWindowPos: _glfwGetWindowPos,
+ /** @export */ glfwGetWindowSize: _glfwGetWindowSize,
+ /** @export */ glfwGetWindowUserPointer: _glfwGetWindowUserPointer,
+ /** @export */ glfwInit: _glfwInit,
+ /** @export */ glfwMakeContextCurrent: _glfwMakeContextCurrent,
+ /** @export */ glfwPollEvents: _glfwPollEvents,
+ /** @export */ glfwSetCharCallback: _glfwSetCharCallback,
+ /** @export */ glfwSetClipboardString: _glfwSetClipboardString,
+ /** @export */ glfwSetCursor: _glfwSetCursor,
+ /** @export */ glfwSetCursorEnterCallback: _glfwSetCursorEnterCallback,
+ /** @export */ glfwSetCursorPos: _glfwSetCursorPos,
+ /** @export */ glfwSetCursorPosCallback: _glfwSetCursorPosCallback,
+ /** @export */ glfwSetErrorCallback: _glfwSetErrorCallback,
+ /** @export */ glfwSetInputMode: _glfwSetInputMode,
+ /** @export */ glfwSetKeyCallback: _glfwSetKeyCallback,
+ /** @export */ glfwSetMonitorCallback: _glfwSetMonitorCallback,
+ /** @export */ glfwSetMouseButtonCallback: _glfwSetMouseButtonCallback,
+ /** @export */ glfwSetScrollCallback: _glfwSetScrollCallback,
+ /** @export */ glfwSetWindowCloseCallback: _glfwSetWindowCloseCallback,
+ /** @export */ glfwSetWindowFocusCallback: _glfwSetWindowFocusCallback,
+ /** @export */ glfwSetWindowIconifyCallback: _glfwSetWindowIconifyCallback,
+ /** @export */ glfwSetWindowPosCallback: _glfwSetWindowPosCallback,
+ /** @export */ glfwSetWindowShouldClose: _glfwSetWindowShouldClose,
+ /** @export */ glfwSetWindowSize: _glfwSetWindowSize,
+ /** @export */ glfwSetWindowSizeCallback: _glfwSetWindowSizeCallback,
+ /** @export */ glfwSetWindowUserPointer: _glfwSetWindowUserPointer,
+ /** @export */ glfwSwapBuffers: _glfwSwapBuffers,
+ /** @export */ glfwTerminate: _glfwTerminate,
+ /** @export */ glfwWindowHint: _glfwWindowHint,
+ /** @export */ glfwWindowShouldClose: _glfwWindowShouldClose,
+ /** @export */ invoke_ii,
+ /** @export */ invoke_iii,
+ /** @export */ invoke_iiii,
+ /** @export */ invoke_iiiii,
+ /** @export */ invoke_iiiiiii,
+ /** @export */ invoke_iiiiiiiiii,
+ /** @export */ invoke_vi,
+ /** @export */ invoke_vii,
+ /** @export */ invoke_viii,
+ /** @export */ invoke_viiii,
+ /** @export */ memory: wasmMemory,
+ /** @export */ proc_exit: _proc_exit
+ };
+}
+
+var wasmExports = createWasm();
+
+var ___wasm_call_ctors = () => (___wasm_call_ctors = wasmExports["__wasm_call_ctors"])();
+
+var _main = Module["_main"] = (a0, a1) => (_main = Module["_main"] = wasmExports["__main_argc_argv"])(a0, a1);
+
+var _free = a0 => (_free = wasmExports["free"])(a0);
+
+var _malloc = a0 => (_malloc = wasmExports["malloc"])(a0);
+
+var _axmol_hdoc_visibilitychange = Module["_axmol_hdoc_visibilitychange"] = a0 => (_axmol_hdoc_visibilitychange = Module["_axmol_hdoc_visibilitychange"] = wasmExports["axmol_hdoc_visibilitychange"])(a0);
+
+var _axmol_webglcontextlost = Module["_axmol_webglcontextlost"] = () => (_axmol_webglcontextlost = Module["_axmol_webglcontextlost"] = wasmExports["axmol_webglcontextlost"])();
+
+var _axmol_webglcontextrestored = Module["_axmol_webglcontextrestored"] = () => (_axmol_webglcontextrestored = Module["_axmol_webglcontextrestored"] = wasmExports["axmol_webglcontextrestored"])();
+
+var _axmol_dev_pause = Module["_axmol_dev_pause"] = () => (_axmol_dev_pause = Module["_axmol_dev_pause"] = wasmExports["axmol_dev_pause"])();
+
+var _axmol_dev_resume = Module["_axmol_dev_resume"] = () => (_axmol_dev_resume = Module["_axmol_dev_resume"] = wasmExports["axmol_dev_resume"])();
+
+var _axmol_dev_step = Module["_axmol_dev_step"] = () => (_axmol_dev_step = Module["_axmol_dev_step"] = wasmExports["axmol_dev_step"])();
+
+var _axmol_onwebclickcallback = Module["_axmol_onwebclickcallback"] = () => (_axmol_onwebclickcallback = Module["_axmol_onwebclickcallback"] = wasmExports["axmol_onwebclickcallback"])();
+
+var _pthread_self = () => (_pthread_self = wasmExports["pthread_self"])();
+
+var _htonl = a0 => (_htonl = wasmExports["htonl"])(a0);
+
+var _ntohs = a0 => (_ntohs = wasmExports["ntohs"])(a0);
+
+var __emscripten_tls_init = () => (__emscripten_tls_init = wasmExports["_emscripten_tls_init"])();
+
+var _emscripten_builtin_memalign = (a0, a1) => (_emscripten_builtin_memalign = wasmExports["emscripten_builtin_memalign"])(a0, a1);
+
+var __emscripten_run_callback_on_thread = (a0, a1, a2, a3, a4) => (__emscripten_run_callback_on_thread = wasmExports["_emscripten_run_callback_on_thread"])(a0, a1, a2, a3, a4);
+
+var __emscripten_thread_init = (a0, a1, a2, a3, a4, a5) => (__emscripten_thread_init = wasmExports["_emscripten_thread_init"])(a0, a1, a2, a3, a4, a5);
+
+var __emscripten_thread_crashed = () => (__emscripten_thread_crashed = wasmExports["_emscripten_thread_crashed"])();
+
+var _emscripten_main_thread_process_queued_calls = () => (_emscripten_main_thread_process_queued_calls = wasmExports["emscripten_main_thread_process_queued_calls"])();
+
+var _htons = a0 => (_htons = wasmExports["htons"])(a0);
+
+var _emscripten_main_runtime_thread_id = () => (_emscripten_main_runtime_thread_id = wasmExports["emscripten_main_runtime_thread_id"])();
+
+var __emscripten_run_on_main_thread_js = (a0, a1, a2, a3, a4) => (__emscripten_run_on_main_thread_js = wasmExports["_emscripten_run_on_main_thread_js"])(a0, a1, a2, a3, a4);
+
+var __emscripten_thread_free_data = a0 => (__emscripten_thread_free_data = wasmExports["_emscripten_thread_free_data"])(a0);
+
+var __emscripten_thread_exit = a0 => (__emscripten_thread_exit = wasmExports["_emscripten_thread_exit"])(a0);
+
+var __emscripten_check_mailbox = () => (__emscripten_check_mailbox = wasmExports["_emscripten_check_mailbox"])();
+
+var _setThrew = (a0, a1) => (_setThrew = wasmExports["setThrew"])(a0, a1);
+
+var __emscripten_tempret_set = a0 => (__emscripten_tempret_set = wasmExports["_emscripten_tempret_set"])(a0);
+
+var _emscripten_stack_set_limits = (a0, a1) => (_emscripten_stack_set_limits = wasmExports["emscripten_stack_set_limits"])(a0, a1);
+
+var __emscripten_stack_restore = a0 => (__emscripten_stack_restore = wasmExports["_emscripten_stack_restore"])(a0);
+
+var __emscripten_stack_alloc = a0 => (__emscripten_stack_alloc = wasmExports["_emscripten_stack_alloc"])(a0);
+
+var _emscripten_stack_get_current = () => (_emscripten_stack_get_current = wasmExports["emscripten_stack_get_current"])();
+
+var dynCall_jii = Module["dynCall_jii"] = (a0, a1, a2) => (dynCall_jii = Module["dynCall_jii"] = wasmExports["dynCall_jii"])(a0, a1, a2);
+
+var dynCall_jiji = Module["dynCall_jiji"] = (a0, a1, a2, a3, a4) => (dynCall_jiji = Module["dynCall_jiji"] = wasmExports["dynCall_jiji"])(a0, a1, a2, a3, a4);
+
+var dynCall_ji = Module["dynCall_ji"] = (a0, a1) => (dynCall_ji = Module["dynCall_ji"] = wasmExports["dynCall_ji"])(a0, a1);
+
+var dynCall_iij = Module["dynCall_iij"] = (a0, a1, a2, a3) => (dynCall_iij = Module["dynCall_iij"] = wasmExports["dynCall_iij"])(a0, a1, a2, a3);
+
+var dynCall_viijii = Module["dynCall_viijii"] = (a0, a1, a2, a3, a4, a5, a6) => (dynCall_viijii = Module["dynCall_viijii"] = wasmExports["dynCall_viijii"])(a0, a1, a2, a3, a4, a5, a6);
+
+var dynCall_iiiiij = Module["dynCall_iiiiij"] = (a0, a1, a2, a3, a4, a5, a6) => (dynCall_iiiiij = Module["dynCall_iiiiij"] = wasmExports["dynCall_iiiiij"])(a0, a1, a2, a3, a4, a5, a6);
+
+var dynCall_iiiiijj = Module["dynCall_iiiiijj"] = (a0, a1, a2, a3, a4, a5, a6, a7, a8) => (dynCall_iiiiijj = Module["dynCall_iiiiijj"] = wasmExports["dynCall_iiiiijj"])(a0, a1, a2, a3, a4, a5, a6, a7, a8);
+
+var dynCall_iiiiiijj = Module["dynCall_iiiiiijj"] = (a0, a1, a2, a3, a4, a5, a6, a7, a8, a9) => (dynCall_iiiiiijj = Module["dynCall_iiiiiijj"] = wasmExports["dynCall_iiiiiijj"])(a0, a1, a2, a3, a4, a5, a6, a7, a8, a9);
+
+function invoke_iiii(index, a1, a2, a3) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiii(index, a1, a2, a3, a4) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_ii(index, a1) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viii(index, a1, a2, a3) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_vii(index, a1, a2) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iii(index, a1, a2) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_vi(index, a1) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiii(index, a1, a2, a3, a4) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1, a2, a3, a4);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7, a8, a9);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6);
+ } catch (e) {
+ stackRestore(sp);
+ if (e !== e + 0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+// include: postamble.js
+// === Auto-generated postamble setup entry stuff ===
+Module["addRunDependency"] = addRunDependency;
+
+Module["removeRunDependency"] = removeRunDependency;
+
+Module["ccall"] = ccall;
+
+Module["cwrap"] = cwrap;
+
+Module["FS_createPreloadedFile"] = FS_createPreloadedFile;
+
+Module["FS_unlink"] = FS_unlink;
+
+Module["FS_createPath"] = FS_createPath;
+
+Module["FS_createDevice"] = FS_createDevice;
+
+Module["FS_createDataFile"] = FS_createDataFile;
+
+Module["FS_createLazyFile"] = FS_createLazyFile;
+
+var calledRun;
+
+dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!calledRun) run();
+ if (!calledRun) dependenciesFulfilled = runCaller;
+};
+
+// try this again later, after new deps are fulfilled
+function callMain(args = []) {
+ var entryFunction = _main;
+ args.unshift(thisProgram);
+ var argc = args.length;
+ var argv = stackAlloc((argc + 1) * 4);
+ var argv_ptr = argv;
+ args.forEach(arg => {
+ GROWABLE_HEAP_U32()[((argv_ptr) >> 2)] = stringToUTF8OnStack(arg);
+ argv_ptr += 4;
+ });
+ GROWABLE_HEAP_U32()[((argv_ptr) >> 2)] = 0;
+ try {
+ var ret = entryFunction(argc, argv);
+ // if we're not running an evented main loop, it's time to exit
+ exitJS(ret, /* implicit = */ true);
+ return ret;
+ } catch (e) {
+ return handleException(e);
+ }
+}
+
+function run(args = arguments_) {
+ if (runDependencies > 0) {
+ return;
+ }
+ if (ENVIRONMENT_IS_PTHREAD) {
+ initRuntime();
+ startWorker(Module);
+ return;
+ }
+ preRun();
+ // a preRun added a dependency, run will be called later
+ if (runDependencies > 0) {
+ return;
+ }
+ function doRun() {
+ // run may have just been called through dependencies being fulfilled just in this very frame,
+ // or while the async setStatus time below was happening
+ if (calledRun) return;
+ calledRun = true;
+ Module["calledRun"] = true;
+ if (ABORT) return;
+ initRuntime();
+ preMain();
+ Module["onRuntimeInitialized"]?.();
+ if (shouldRunNow) callMain(args);
+ postRun();
+ }
+ if (Module["setStatus"]) {
+ Module["setStatus"]("Running...");
+ setTimeout(() => {
+ setTimeout(() => Module["setStatus"](""), 1);
+ doRun();
+ }, 1);
+ } else {
+ doRun();
+ }
+}
+
+if (Module["preInit"]) {
+ if (typeof Module["preInit"] == "function") Module["preInit"] = [ Module["preInit"] ];
+ while (Module["preInit"].length > 0) {
+ Module["preInit"].pop()();
+ }
+}
+
+// shouldRunNow refers to calling main(), not run().
+var shouldRunNow = true;
+
+if (Module["noInitialRun"]) shouldRunNow = false;
+
+run();
diff --git a/index.wasm b/index.wasm
new file mode 100644
index 0000000..169c5f0
Binary files /dev/null and b/index.wasm differ